diff --git a/index.html b/index.html
new file mode 100644
index 0000000..1410bfc
--- /dev/null
+++ b/index.html
@@ -0,0 +1,17725 @@
+<!DOCTYPE HTML>
+<html>
+<head>
+  <meta charset="UTF-8">
+  <title>Main</title>
+  <style>body { padding: 0; margin: 0; }</style>
+</head>
+
+<body>
+
+<pre id="elm"></pre>
+
+<script>
+try {
+(function(scope){
+'use strict';
+
+function F(arity, fun, wrapper) {
+  wrapper.a = arity;
+  wrapper.f = fun;
+  return wrapper;
+}
+
+function F2(fun) {
+  return F(2, fun, function(a) { return function(b) { return fun(a,b); }; })
+}
+function F3(fun) {
+  return F(3, fun, function(a) {
+    return function(b) { return function(c) { return fun(a, b, c); }; };
+  });
+}
+function F4(fun) {
+  return F(4, fun, function(a) { return function(b) { return function(c) {
+    return function(d) { return fun(a, b, c, d); }; }; };
+  });
+}
+function F5(fun) {
+  return F(5, fun, function(a) { return function(b) { return function(c) {
+    return function(d) { return function(e) { return fun(a, b, c, d, e); }; }; }; };
+  });
+}
+function F6(fun) {
+  return F(6, fun, function(a) { return function(b) { return function(c) {
+    return function(d) { return function(e) { return function(f) {
+    return fun(a, b, c, d, e, f); }; }; }; }; };
+  });
+}
+function F7(fun) {
+  return F(7, fun, function(a) { return function(b) { return function(c) {
+    return function(d) { return function(e) { return function(f) {
+    return function(g) { return fun(a, b, c, d, e, f, g); }; }; }; }; }; };
+  });
+}
+function F8(fun) {
+  return F(8, fun, function(a) { return function(b) { return function(c) {
+    return function(d) { return function(e) { return function(f) {
+    return function(g) { return function(h) {
+    return fun(a, b, c, d, e, f, g, h); }; }; }; }; }; }; };
+  });
+}
+function F9(fun) {
+  return F(9, fun, function(a) { return function(b) { return function(c) {
+    return function(d) { return function(e) { return function(f) {
+    return function(g) { return function(h) { return function(i) {
+    return fun(a, b, c, d, e, f, g, h, i); }; }; }; }; }; }; }; };
+  });
+}
+
+function A2(fun, a, b) {
+  return fun.a === 2 ? fun.f(a, b) : fun(a)(b);
+}
+function A3(fun, a, b, c) {
+  return fun.a === 3 ? fun.f(a, b, c) : fun(a)(b)(c);
+}
+function A4(fun, a, b, c, d) {
+  return fun.a === 4 ? fun.f(a, b, c, d) : fun(a)(b)(c)(d);
+}
+function A5(fun, a, b, c, d, e) {
+  return fun.a === 5 ? fun.f(a, b, c, d, e) : fun(a)(b)(c)(d)(e);
+}
+function A6(fun, a, b, c, d, e, f) {
+  return fun.a === 6 ? fun.f(a, b, c, d, e, f) : fun(a)(b)(c)(d)(e)(f);
+}
+function A7(fun, a, b, c, d, e, f, g) {
+  return fun.a === 7 ? fun.f(a, b, c, d, e, f, g) : fun(a)(b)(c)(d)(e)(f)(g);
+}
+function A8(fun, a, b, c, d, e, f, g, h) {
+  return fun.a === 8 ? fun.f(a, b, c, d, e, f, g, h) : fun(a)(b)(c)(d)(e)(f)(g)(h);
+}
+function A9(fun, a, b, c, d, e, f, g, h, i) {
+  return fun.a === 9 ? fun.f(a, b, c, d, e, f, g, h, i) : fun(a)(b)(c)(d)(e)(f)(g)(h)(i);
+}
+
+console.warn('Compiled in DEV mode. Follow the advice at https://elm-lang.org/0.19.1/optimize for better performance and smaller assets.');
+
+
+// EQUALITY
+
+function _Utils_eq(x, y)
+{
+	for (
+		var pair, stack = [], isEqual = _Utils_eqHelp(x, y, 0, stack);
+		isEqual && (pair = stack.pop());
+		isEqual = _Utils_eqHelp(pair.a, pair.b, 0, stack)
+		)
+	{}
+
+	return isEqual;
+}
+
+function _Utils_eqHelp(x, y, depth, stack)
+{
+	if (x === y)
+	{
+		return true;
+	}
+
+	if (typeof x !== 'object' || x === null || y === null)
+	{
+		typeof x === 'function' && _Debug_crash(5);
+		return false;
+	}
+
+	if (depth > 100)
+	{
+		stack.push(_Utils_Tuple2(x,y));
+		return true;
+	}
+
+	/**/
+	if (x.$ === 'Set_elm_builtin')
+	{
+		x = $elm$core$Set$toList(x);
+		y = $elm$core$Set$toList(y);
+	}
+	if (x.$ === 'RBNode_elm_builtin' || x.$ === 'RBEmpty_elm_builtin')
+	{
+		x = $elm$core$Dict$toList(x);
+		y = $elm$core$Dict$toList(y);
+	}
+	//*/
+
+	/**_UNUSED/
+	if (x.$ < 0)
+	{
+		x = $elm$core$Dict$toList(x);
+		y = $elm$core$Dict$toList(y);
+	}
+	//*/
+
+	for (var key in x)
+	{
+		if (!_Utils_eqHelp(x[key], y[key], depth + 1, stack))
+		{
+			return false;
+		}
+	}
+	return true;
+}
+
+var _Utils_equal = F2(_Utils_eq);
+var _Utils_notEqual = F2(function(a, b) { return !_Utils_eq(a,b); });
+
+
+
+// COMPARISONS
+
+// Code in Generate/JavaScript.hs, Basics.js, and List.js depends on
+// the particular integer values assigned to LT, EQ, and GT.
+
+function _Utils_cmp(x, y, ord)
+{
+	if (typeof x !== 'object')
+	{
+		return x === y ? /*EQ*/ 0 : x < y ? /*LT*/ -1 : /*GT*/ 1;
+	}
+
+	/**/
+	if (x instanceof String)
+	{
+		var a = x.valueOf();
+		var b = y.valueOf();
+		return a === b ? 0 : a < b ? -1 : 1;
+	}
+	//*/
+
+	/**_UNUSED/
+	if (typeof x.$ === 'undefined')
+	//*/
+	/**/
+	if (x.$[0] === '#')
+	//*/
+	{
+		return (ord = _Utils_cmp(x.a, y.a))
+			? ord
+			: (ord = _Utils_cmp(x.b, y.b))
+				? ord
+				: _Utils_cmp(x.c, y.c);
+	}
+
+	// traverse conses until end of a list or a mismatch
+	for (; x.b && y.b && !(ord = _Utils_cmp(x.a, y.a)); x = x.b, y = y.b) {} // WHILE_CONSES
+	return ord || (x.b ? /*GT*/ 1 : y.b ? /*LT*/ -1 : /*EQ*/ 0);
+}
+
+var _Utils_lt = F2(function(a, b) { return _Utils_cmp(a, b) < 0; });
+var _Utils_le = F2(function(a, b) { return _Utils_cmp(a, b) < 1; });
+var _Utils_gt = F2(function(a, b) { return _Utils_cmp(a, b) > 0; });
+var _Utils_ge = F2(function(a, b) { return _Utils_cmp(a, b) >= 0; });
+
+var _Utils_compare = F2(function(x, y)
+{
+	var n = _Utils_cmp(x, y);
+	return n < 0 ? $elm$core$Basics$LT : n ? $elm$core$Basics$GT : $elm$core$Basics$EQ;
+});
+
+
+// COMMON VALUES
+
+var _Utils_Tuple0_UNUSED = 0;
+var _Utils_Tuple0 = { $: '#0' };
+
+function _Utils_Tuple2_UNUSED(a, b) { return { a: a, b: b }; }
+function _Utils_Tuple2(a, b) { return { $: '#2', a: a, b: b }; }
+
+function _Utils_Tuple3_UNUSED(a, b, c) { return { a: a, b: b, c: c }; }
+function _Utils_Tuple3(a, b, c) { return { $: '#3', a: a, b: b, c: c }; }
+
+function _Utils_chr_UNUSED(c) { return c; }
+function _Utils_chr(c) { return new String(c); }
+
+
+// RECORDS
+
+function _Utils_update(oldRecord, updatedFields)
+{
+	var newRecord = {};
+
+	for (var key in oldRecord)
+	{
+		newRecord[key] = oldRecord[key];
+	}
+
+	for (var key in updatedFields)
+	{
+		newRecord[key] = updatedFields[key];
+	}
+
+	return newRecord;
+}
+
+
+// APPEND
+
+var _Utils_append = F2(_Utils_ap);
+
+function _Utils_ap(xs, ys)
+{
+	// append Strings
+	if (typeof xs === 'string')
+	{
+		return xs + ys;
+	}
+
+	// append Lists
+	if (!xs.b)
+	{
+		return ys;
+	}
+	var root = _List_Cons(xs.a, ys);
+	xs = xs.b
+	for (var curr = root; xs.b; xs = xs.b) // WHILE_CONS
+	{
+		curr = curr.b = _List_Cons(xs.a, ys);
+	}
+	return root;
+}
+
+
+
+var _List_Nil_UNUSED = { $: 0 };
+var _List_Nil = { $: '[]' };
+
+function _List_Cons_UNUSED(hd, tl) { return { $: 1, a: hd, b: tl }; }
+function _List_Cons(hd, tl) { return { $: '::', a: hd, b: tl }; }
+
+
+var _List_cons = F2(_List_Cons);
+
+function _List_fromArray(arr)
+{
+	var out = _List_Nil;
+	for (var i = arr.length; i--; )
+	{
+		out = _List_Cons(arr[i], out);
+	}
+	return out;
+}
+
+function _List_toArray(xs)
+{
+	for (var out = []; xs.b; xs = xs.b) // WHILE_CONS
+	{
+		out.push(xs.a);
+	}
+	return out;
+}
+
+var _List_map2 = F3(function(f, xs, ys)
+{
+	for (var arr = []; xs.b && ys.b; xs = xs.b, ys = ys.b) // WHILE_CONSES
+	{
+		arr.push(A2(f, xs.a, ys.a));
+	}
+	return _List_fromArray(arr);
+});
+
+var _List_map3 = F4(function(f, xs, ys, zs)
+{
+	for (var arr = []; xs.b && ys.b && zs.b; xs = xs.b, ys = ys.b, zs = zs.b) // WHILE_CONSES
+	{
+		arr.push(A3(f, xs.a, ys.a, zs.a));
+	}
+	return _List_fromArray(arr);
+});
+
+var _List_map4 = F5(function(f, ws, xs, ys, zs)
+{
+	for (var arr = []; ws.b && xs.b && ys.b && zs.b; ws = ws.b, xs = xs.b, ys = ys.b, zs = zs.b) // WHILE_CONSES
+	{
+		arr.push(A4(f, ws.a, xs.a, ys.a, zs.a));
+	}
+	return _List_fromArray(arr);
+});
+
+var _List_map5 = F6(function(f, vs, ws, xs, ys, zs)
+{
+	for (var arr = []; vs.b && ws.b && xs.b && ys.b && zs.b; vs = vs.b, ws = ws.b, xs = xs.b, ys = ys.b, zs = zs.b) // WHILE_CONSES
+	{
+		arr.push(A5(f, vs.a, ws.a, xs.a, ys.a, zs.a));
+	}
+	return _List_fromArray(arr);
+});
+
+var _List_sortBy = F2(function(f, xs)
+{
+	return _List_fromArray(_List_toArray(xs).sort(function(a, b) {
+		return _Utils_cmp(f(a), f(b));
+	}));
+});
+
+var _List_sortWith = F2(function(f, xs)
+{
+	return _List_fromArray(_List_toArray(xs).sort(function(a, b) {
+		var ord = A2(f, a, b);
+		return ord === $elm$core$Basics$EQ ? 0 : ord === $elm$core$Basics$LT ? -1 : 1;
+	}));
+});
+
+
+
+var _JsArray_empty = [];
+
+function _JsArray_singleton(value)
+{
+    return [value];
+}
+
+function _JsArray_length(array)
+{
+    return array.length;
+}
+
+var _JsArray_initialize = F3(function(size, offset, func)
+{
+    var result = new Array(size);
+
+    for (var i = 0; i < size; i++)
+    {
+        result[i] = func(offset + i);
+    }
+
+    return result;
+});
+
+var _JsArray_initializeFromList = F2(function (max, ls)
+{
+    var result = new Array(max);
+
+    for (var i = 0; i < max && ls.b; i++)
+    {
+        result[i] = ls.a;
+        ls = ls.b;
+    }
+
+    result.length = i;
+    return _Utils_Tuple2(result, ls);
+});
+
+var _JsArray_unsafeGet = F2(function(index, array)
+{
+    return array[index];
+});
+
+var _JsArray_unsafeSet = F3(function(index, value, array)
+{
+    var length = array.length;
+    var result = new Array(length);
+
+    for (var i = 0; i < length; i++)
+    {
+        result[i] = array[i];
+    }
+
+    result[index] = value;
+    return result;
+});
+
+var _JsArray_push = F2(function(value, array)
+{
+    var length = array.length;
+    var result = new Array(length + 1);
+
+    for (var i = 0; i < length; i++)
+    {
+        result[i] = array[i];
+    }
+
+    result[length] = value;
+    return result;
+});
+
+var _JsArray_foldl = F3(function(func, acc, array)
+{
+    var length = array.length;
+
+    for (var i = 0; i < length; i++)
+    {
+        acc = A2(func, array[i], acc);
+    }
+
+    return acc;
+});
+
+var _JsArray_foldr = F3(function(func, acc, array)
+{
+    for (var i = array.length - 1; i >= 0; i--)
+    {
+        acc = A2(func, array[i], acc);
+    }
+
+    return acc;
+});
+
+var _JsArray_map = F2(function(func, array)
+{
+    var length = array.length;
+    var result = new Array(length);
+
+    for (var i = 0; i < length; i++)
+    {
+        result[i] = func(array[i]);
+    }
+
+    return result;
+});
+
+var _JsArray_indexedMap = F3(function(func, offset, array)
+{
+    var length = array.length;
+    var result = new Array(length);
+
+    for (var i = 0; i < length; i++)
+    {
+        result[i] = A2(func, offset + i, array[i]);
+    }
+
+    return result;
+});
+
+var _JsArray_slice = F3(function(from, to, array)
+{
+    return array.slice(from, to);
+});
+
+var _JsArray_appendN = F3(function(n, dest, source)
+{
+    var destLen = dest.length;
+    var itemsToCopy = n - destLen;
+
+    if (itemsToCopy > source.length)
+    {
+        itemsToCopy = source.length;
+    }
+
+    var size = destLen + itemsToCopy;
+    var result = new Array(size);
+
+    for (var i = 0; i < destLen; i++)
+    {
+        result[i] = dest[i];
+    }
+
+    for (var i = 0; i < itemsToCopy; i++)
+    {
+        result[i + destLen] = source[i];
+    }
+
+    return result;
+});
+
+
+
+// LOG
+
+var _Debug_log_UNUSED = F2(function(tag, value)
+{
+	return value;
+});
+
+var _Debug_log = F2(function(tag, value)
+{
+	console.log(tag + ': ' + _Debug_toString(value));
+	return value;
+});
+
+
+// TODOS
+
+function _Debug_todo(moduleName, region)
+{
+	return function(message) {
+		_Debug_crash(8, moduleName, region, message);
+	};
+}
+
+function _Debug_todoCase(moduleName, region, value)
+{
+	return function(message) {
+		_Debug_crash(9, moduleName, region, value, message);
+	};
+}
+
+
+// TO STRING
+
+function _Debug_toString_UNUSED(value)
+{
+	return '<internals>';
+}
+
+function _Debug_toString(value)
+{
+	return _Debug_toAnsiString(false, value);
+}
+
+function _Debug_toAnsiString(ansi, value)
+{
+	if (typeof value === 'function')
+	{
+		return _Debug_internalColor(ansi, '<function>');
+	}
+
+	if (typeof value === 'boolean')
+	{
+		return _Debug_ctorColor(ansi, value ? 'True' : 'False');
+	}
+
+	if (typeof value === 'number')
+	{
+		return _Debug_numberColor(ansi, value + '');
+	}
+
+	if (value instanceof String)
+	{
+		return _Debug_charColor(ansi, "'" + _Debug_addSlashes(value, true) + "'");
+	}
+
+	if (typeof value === 'string')
+	{
+		return _Debug_stringColor(ansi, '"' + _Debug_addSlashes(value, false) + '"');
+	}
+
+	if (typeof value === 'object' && '$' in value)
+	{
+		var tag = value.$;
+
+		if (typeof tag === 'number')
+		{
+			return _Debug_internalColor(ansi, '<internals>');
+		}
+
+		if (tag[0] === '#')
+		{
+			var output = [];
+			for (var k in value)
+			{
+				if (k === '$') continue;
+				output.push(_Debug_toAnsiString(ansi, value[k]));
+			}
+			return '(' + output.join(',') + ')';
+		}
+
+		if (tag === 'Set_elm_builtin')
+		{
+			return _Debug_ctorColor(ansi, 'Set')
+				+ _Debug_fadeColor(ansi, '.fromList') + ' '
+				+ _Debug_toAnsiString(ansi, $elm$core$Set$toList(value));
+		}
+
+		if (tag === 'RBNode_elm_builtin' || tag === 'RBEmpty_elm_builtin')
+		{
+			return _Debug_ctorColor(ansi, 'Dict')
+				+ _Debug_fadeColor(ansi, '.fromList') + ' '
+				+ _Debug_toAnsiString(ansi, $elm$core$Dict$toList(value));
+		}
+
+		if (tag === 'Array_elm_builtin')
+		{
+			return _Debug_ctorColor(ansi, 'Array')
+				+ _Debug_fadeColor(ansi, '.fromList') + ' '
+				+ _Debug_toAnsiString(ansi, $elm$core$Array$toList(value));
+		}
+
+		if (tag === '::' || tag === '[]')
+		{
+			var output = '[';
+
+			value.b && (output += _Debug_toAnsiString(ansi, value.a), value = value.b)
+
+			for (; value.b; value = value.b) // WHILE_CONS
+			{
+				output += ',' + _Debug_toAnsiString(ansi, value.a);
+			}
+			return output + ']';
+		}
+
+		var output = '';
+		for (var i in value)
+		{
+			if (i === '$') continue;
+			var str = _Debug_toAnsiString(ansi, value[i]);
+			var c0 = str[0];
+			var parenless = c0 === '{' || c0 === '(' || c0 === '[' || c0 === '<' || c0 === '"' || str.indexOf(' ') < 0;
+			output += ' ' + (parenless ? str : '(' + str + ')');
+		}
+		return _Debug_ctorColor(ansi, tag) + output;
+	}
+
+	if (typeof DataView === 'function' && value instanceof DataView)
+	{
+		return _Debug_stringColor(ansi, '<' + value.byteLength + ' bytes>');
+	}
+
+	if (typeof File !== 'undefined' && value instanceof File)
+	{
+		return _Debug_internalColor(ansi, '<' + value.name + '>');
+	}
+
+	if (typeof value === 'object')
+	{
+		var output = [];
+		for (var key in value)
+		{
+			var field = key[0] === '_' ? key.slice(1) : key;
+			output.push(_Debug_fadeColor(ansi, field) + ' = ' + _Debug_toAnsiString(ansi, value[key]));
+		}
+		if (output.length === 0)
+		{
+			return '{}';
+		}
+		return '{ ' + output.join(', ') + ' }';
+	}
+
+	return _Debug_internalColor(ansi, '<internals>');
+}
+
+function _Debug_addSlashes(str, isChar)
+{
+	var s = str
+		.replace(/\\/g, '\\\\')
+		.replace(/\n/g, '\\n')
+		.replace(/\t/g, '\\t')
+		.replace(/\r/g, '\\r')
+		.replace(/\v/g, '\\v')
+		.replace(/\0/g, '\\0');
+
+	if (isChar)
+	{
+		return s.replace(/\'/g, '\\\'');
+	}
+	else
+	{
+		return s.replace(/\"/g, '\\"');
+	}
+}
+
+function _Debug_ctorColor(ansi, string)
+{
+	return ansi ? '\x1b[96m' + string + '\x1b[0m' : string;
+}
+
+function _Debug_numberColor(ansi, string)
+{
+	return ansi ? '\x1b[95m' + string + '\x1b[0m' : string;
+}
+
+function _Debug_stringColor(ansi, string)
+{
+	return ansi ? '\x1b[93m' + string + '\x1b[0m' : string;
+}
+
+function _Debug_charColor(ansi, string)
+{
+	return ansi ? '\x1b[92m' + string + '\x1b[0m' : string;
+}
+
+function _Debug_fadeColor(ansi, string)
+{
+	return ansi ? '\x1b[37m' + string + '\x1b[0m' : string;
+}
+
+function _Debug_internalColor(ansi, string)
+{
+	return ansi ? '\x1b[36m' + string + '\x1b[0m' : string;
+}
+
+function _Debug_toHexDigit(n)
+{
+	return String.fromCharCode(n < 10 ? 48 + n : 55 + n);
+}
+
+
+// CRASH
+
+
+function _Debug_crash_UNUSED(identifier)
+{
+	throw new Error('https://github.com/elm/core/blob/1.0.0/hints/' + identifier + '.md');
+}
+
+
+function _Debug_crash(identifier, fact1, fact2, fact3, fact4)
+{
+	switch(identifier)
+	{
+		case 0:
+			throw new Error('What node should I take over? In JavaScript I need something like:\n\n    Elm.Main.init({\n        node: document.getElementById("elm-node")\n    })\n\nYou need to do this with any Browser.sandbox or Browser.element program.');
+
+		case 1:
+			throw new Error('Browser.application programs cannot handle URLs like this:\n\n    ' + document.location.href + '\n\nWhat is the root? The root of your file system? Try looking at this program with `elm reactor` or some other server.');
+
+		case 2:
+			var jsonErrorString = fact1;
+			throw new Error('Problem with the flags given to your Elm program on initialization.\n\n' + jsonErrorString);
+
+		case 3:
+			var portName = fact1;
+			throw new Error('There can only be one port named `' + portName + '`, but your program has multiple.');
+
+		case 4:
+			var portName = fact1;
+			var problem = fact2;
+			throw new Error('Trying to send an unexpected type of value through port `' + portName + '`:\n' + problem);
+
+		case 5:
+			throw new Error('Trying to use `(==)` on functions.\nThere is no way to know if functions are "the same" in the Elm sense.\nRead more about this at https://package.elm-lang.org/packages/elm/core/latest/Basics#== which describes why it is this way and what the better version will look like.');
+
+		case 6:
+			var moduleName = fact1;
+			throw new Error('Your page is loading multiple Elm scripts with a module named ' + moduleName + '. Maybe a duplicate script is getting loaded accidentally? If not, rename one of them so I know which is which!');
+
+		case 8:
+			var moduleName = fact1;
+			var region = fact2;
+			var message = fact3;
+			throw new Error('TODO in module `' + moduleName + '` ' + _Debug_regionToString(region) + '\n\n' + message);
+
+		case 9:
+			var moduleName = fact1;
+			var region = fact2;
+			var value = fact3;
+			var message = fact4;
+			throw new Error(
+				'TODO in module `' + moduleName + '` from the `case` expression '
+				+ _Debug_regionToString(region) + '\n\nIt received the following value:\n\n    '
+				+ _Debug_toString(value).replace('\n', '\n    ')
+				+ '\n\nBut the branch that handles it says:\n\n    ' + message.replace('\n', '\n    ')
+			);
+
+		case 10:
+			throw new Error('Bug in https://github.com/elm/virtual-dom/issues');
+
+		case 11:
+			throw new Error('Cannot perform mod 0. Division by zero error.');
+	}
+}
+
+function _Debug_regionToString(region)
+{
+	if (region.start.line === region.end.line)
+	{
+		return 'on line ' + region.start.line;
+	}
+	return 'on lines ' + region.start.line + ' through ' + region.end.line;
+}
+
+
+
+// MATH
+
+var _Basics_add = F2(function(a, b) { return a + b; });
+var _Basics_sub = F2(function(a, b) { return a - b; });
+var _Basics_mul = F2(function(a, b) { return a * b; });
+var _Basics_fdiv = F2(function(a, b) { return a / b; });
+var _Basics_idiv = F2(function(a, b) { return (a / b) | 0; });
+var _Basics_pow = F2(Math.pow);
+
+var _Basics_remainderBy = F2(function(b, a) { return a % b; });
+
+// https://www.microsoft.com/en-us/research/wp-content/uploads/2016/02/divmodnote-letter.pdf
+var _Basics_modBy = F2(function(modulus, x)
+{
+	var answer = x % modulus;
+	return modulus === 0
+		? _Debug_crash(11)
+		:
+	((answer > 0 && modulus < 0) || (answer < 0 && modulus > 0))
+		? answer + modulus
+		: answer;
+});
+
+
+// TRIGONOMETRY
+
+var _Basics_pi = Math.PI;
+var _Basics_e = Math.E;
+var _Basics_cos = Math.cos;
+var _Basics_sin = Math.sin;
+var _Basics_tan = Math.tan;
+var _Basics_acos = Math.acos;
+var _Basics_asin = Math.asin;
+var _Basics_atan = Math.atan;
+var _Basics_atan2 = F2(Math.atan2);
+
+
+// MORE MATH
+
+function _Basics_toFloat(x) { return x; }
+function _Basics_truncate(n) { return n | 0; }
+function _Basics_isInfinite(n) { return n === Infinity || n === -Infinity; }
+
+var _Basics_ceiling = Math.ceil;
+var _Basics_floor = Math.floor;
+var _Basics_round = Math.round;
+var _Basics_sqrt = Math.sqrt;
+var _Basics_log = Math.log;
+var _Basics_isNaN = isNaN;
+
+
+// BOOLEANS
+
+function _Basics_not(bool) { return !bool; }
+var _Basics_and = F2(function(a, b) { return a && b; });
+var _Basics_or  = F2(function(a, b) { return a || b; });
+var _Basics_xor = F2(function(a, b) { return a !== b; });
+
+
+
+var _String_cons = F2(function(chr, str)
+{
+	return chr + str;
+});
+
+function _String_uncons(string)
+{
+	var word = string.charCodeAt(0);
+	return !isNaN(word)
+		? $elm$core$Maybe$Just(
+			0xD800 <= word && word <= 0xDBFF
+				? _Utils_Tuple2(_Utils_chr(string[0] + string[1]), string.slice(2))
+				: _Utils_Tuple2(_Utils_chr(string[0]), string.slice(1))
+		)
+		: $elm$core$Maybe$Nothing;
+}
+
+var _String_append = F2(function(a, b)
+{
+	return a + b;
+});
+
+function _String_length(str)
+{
+	return str.length;
+}
+
+var _String_map = F2(function(func, string)
+{
+	var len = string.length;
+	var array = new Array(len);
+	var i = 0;
+	while (i < len)
+	{
+		var word = string.charCodeAt(i);
+		if (0xD800 <= word && word <= 0xDBFF)
+		{
+			array[i] = func(_Utils_chr(string[i] + string[i+1]));
+			i += 2;
+			continue;
+		}
+		array[i] = func(_Utils_chr(string[i]));
+		i++;
+	}
+	return array.join('');
+});
+
+var _String_filter = F2(function(isGood, str)
+{
+	var arr = [];
+	var len = str.length;
+	var i = 0;
+	while (i < len)
+	{
+		var char = str[i];
+		var word = str.charCodeAt(i);
+		i++;
+		if (0xD800 <= word && word <= 0xDBFF)
+		{
+			char += str[i];
+			i++;
+		}
+
+		if (isGood(_Utils_chr(char)))
+		{
+			arr.push(char);
+		}
+	}
+	return arr.join('');
+});
+
+function _String_reverse(str)
+{
+	var len = str.length;
+	var arr = new Array(len);
+	var i = 0;
+	while (i < len)
+	{
+		var word = str.charCodeAt(i);
+		if (0xD800 <= word && word <= 0xDBFF)
+		{
+			arr[len - i] = str[i + 1];
+			i++;
+			arr[len - i] = str[i - 1];
+			i++;
+		}
+		else
+		{
+			arr[len - i] = str[i];
+			i++;
+		}
+	}
+	return arr.join('');
+}
+
+var _String_foldl = F3(function(func, state, string)
+{
+	var len = string.length;
+	var i = 0;
+	while (i < len)
+	{
+		var char = string[i];
+		var word = string.charCodeAt(i);
+		i++;
+		if (0xD800 <= word && word <= 0xDBFF)
+		{
+			char += string[i];
+			i++;
+		}
+		state = A2(func, _Utils_chr(char), state);
+	}
+	return state;
+});
+
+var _String_foldr = F3(function(func, state, string)
+{
+	var i = string.length;
+	while (i--)
+	{
+		var char = string[i];
+		var word = string.charCodeAt(i);
+		if (0xDC00 <= word && word <= 0xDFFF)
+		{
+			i--;
+			char = string[i] + char;
+		}
+		state = A2(func, _Utils_chr(char), state);
+	}
+	return state;
+});
+
+var _String_split = F2(function(sep, str)
+{
+	return str.split(sep);
+});
+
+var _String_join = F2(function(sep, strs)
+{
+	return strs.join(sep);
+});
+
+var _String_slice = F3(function(start, end, str) {
+	return str.slice(start, end);
+});
+
+function _String_trim(str)
+{
+	return str.trim();
+}
+
+function _String_trimLeft(str)
+{
+	return str.replace(/^\s+/, '');
+}
+
+function _String_trimRight(str)
+{
+	return str.replace(/\s+$/, '');
+}
+
+function _String_words(str)
+{
+	return _List_fromArray(str.trim().split(/\s+/g));
+}
+
+function _String_lines(str)
+{
+	return _List_fromArray(str.split(/\r\n|\r|\n/g));
+}
+
+function _String_toUpper(str)
+{
+	return str.toUpperCase();
+}
+
+function _String_toLower(str)
+{
+	return str.toLowerCase();
+}
+
+var _String_any = F2(function(isGood, string)
+{
+	var i = string.length;
+	while (i--)
+	{
+		var char = string[i];
+		var word = string.charCodeAt(i);
+		if (0xDC00 <= word && word <= 0xDFFF)
+		{
+			i--;
+			char = string[i] + char;
+		}
+		if (isGood(_Utils_chr(char)))
+		{
+			return true;
+		}
+	}
+	return false;
+});
+
+var _String_all = F2(function(isGood, string)
+{
+	var i = string.length;
+	while (i--)
+	{
+		var char = string[i];
+		var word = string.charCodeAt(i);
+		if (0xDC00 <= word && word <= 0xDFFF)
+		{
+			i--;
+			char = string[i] + char;
+		}
+		if (!isGood(_Utils_chr(char)))
+		{
+			return false;
+		}
+	}
+	return true;
+});
+
+var _String_contains = F2(function(sub, str)
+{
+	return str.indexOf(sub) > -1;
+});
+
+var _String_startsWith = F2(function(sub, str)
+{
+	return str.indexOf(sub) === 0;
+});
+
+var _String_endsWith = F2(function(sub, str)
+{
+	return str.length >= sub.length &&
+		str.lastIndexOf(sub) === str.length - sub.length;
+});
+
+var _String_indexes = F2(function(sub, str)
+{
+	var subLen = sub.length;
+
+	if (subLen < 1)
+	{
+		return _List_Nil;
+	}
+
+	var i = 0;
+	var is = [];
+
+	while ((i = str.indexOf(sub, i)) > -1)
+	{
+		is.push(i);
+		i = i + subLen;
+	}
+
+	return _List_fromArray(is);
+});
+
+
+// TO STRING
+
+function _String_fromNumber(number)
+{
+	return number + '';
+}
+
+
+// INT CONVERSIONS
+
+function _String_toInt(str)
+{
+	var total = 0;
+	var code0 = str.charCodeAt(0);
+	var start = code0 == 0x2B /* + */ || code0 == 0x2D /* - */ ? 1 : 0;
+
+	for (var i = start; i < str.length; ++i)
+	{
+		var code = str.charCodeAt(i);
+		if (code < 0x30 || 0x39 < code)
+		{
+			return $elm$core$Maybe$Nothing;
+		}
+		total = 10 * total + code - 0x30;
+	}
+
+	return i == start
+		? $elm$core$Maybe$Nothing
+		: $elm$core$Maybe$Just(code0 == 0x2D ? -total : total);
+}
+
+
+// FLOAT CONVERSIONS
+
+function _String_toFloat(s)
+{
+	// check if it is a hex, octal, or binary number
+	if (s.length === 0 || /[\sxbo]/.test(s))
+	{
+		return $elm$core$Maybe$Nothing;
+	}
+	var n = +s;
+	// faster isNaN check
+	return n === n ? $elm$core$Maybe$Just(n) : $elm$core$Maybe$Nothing;
+}
+
+function _String_fromList(chars)
+{
+	return _List_toArray(chars).join('');
+}
+
+
+
+
+function _Char_toCode(char)
+{
+	var code = char.charCodeAt(0);
+	if (0xD800 <= code && code <= 0xDBFF)
+	{
+		return (code - 0xD800) * 0x400 + char.charCodeAt(1) - 0xDC00 + 0x10000
+	}
+	return code;
+}
+
+function _Char_fromCode(code)
+{
+	return _Utils_chr(
+		(code < 0 || 0x10FFFF < code)
+			? '\uFFFD'
+			:
+		(code <= 0xFFFF)
+			? String.fromCharCode(code)
+			:
+		(code -= 0x10000,
+			String.fromCharCode(Math.floor(code / 0x400) + 0xD800, code % 0x400 + 0xDC00)
+		)
+	);
+}
+
+function _Char_toUpper(char)
+{
+	return _Utils_chr(char.toUpperCase());
+}
+
+function _Char_toLower(char)
+{
+	return _Utils_chr(char.toLowerCase());
+}
+
+function _Char_toLocaleUpper(char)
+{
+	return _Utils_chr(char.toLocaleUpperCase());
+}
+
+function _Char_toLocaleLower(char)
+{
+	return _Utils_chr(char.toLocaleLowerCase());
+}
+
+
+
+/**/
+function _Json_errorToString(error)
+{
+	return $elm$json$Json$Decode$errorToString(error);
+}
+//*/
+
+
+// CORE DECODERS
+
+function _Json_succeed(msg)
+{
+	return {
+		$: 0,
+		a: msg
+	};
+}
+
+function _Json_fail(msg)
+{
+	return {
+		$: 1,
+		a: msg
+	};
+}
+
+function _Json_decodePrim(decoder)
+{
+	return { $: 2, b: decoder };
+}
+
+var _Json_decodeInt = _Json_decodePrim(function(value) {
+	return (typeof value !== 'number')
+		? _Json_expecting('an INT', value)
+		:
+	(-2147483647 < value && value < 2147483647 && (value | 0) === value)
+		? $elm$core$Result$Ok(value)
+		:
+	(isFinite(value) && !(value % 1))
+		? $elm$core$Result$Ok(value)
+		: _Json_expecting('an INT', value);
+});
+
+var _Json_decodeBool = _Json_decodePrim(function(value) {
+	return (typeof value === 'boolean')
+		? $elm$core$Result$Ok(value)
+		: _Json_expecting('a BOOL', value);
+});
+
+var _Json_decodeFloat = _Json_decodePrim(function(value) {
+	return (typeof value === 'number')
+		? $elm$core$Result$Ok(value)
+		: _Json_expecting('a FLOAT', value);
+});
+
+var _Json_decodeValue = _Json_decodePrim(function(value) {
+	return $elm$core$Result$Ok(_Json_wrap(value));
+});
+
+var _Json_decodeString = _Json_decodePrim(function(value) {
+	return (typeof value === 'string')
+		? $elm$core$Result$Ok(value)
+		: (value instanceof String)
+			? $elm$core$Result$Ok(value + '')
+			: _Json_expecting('a STRING', value);
+});
+
+function _Json_decodeList(decoder) { return { $: 3, b: decoder }; }
+function _Json_decodeArray(decoder) { return { $: 4, b: decoder }; }
+
+function _Json_decodeNull(value) { return { $: 5, c: value }; }
+
+var _Json_decodeField = F2(function(field, decoder)
+{
+	return {
+		$: 6,
+		d: field,
+		b: decoder
+	};
+});
+
+var _Json_decodeIndex = F2(function(index, decoder)
+{
+	return {
+		$: 7,
+		e: index,
+		b: decoder
+	};
+});
+
+function _Json_decodeKeyValuePairs(decoder)
+{
+	return {
+		$: 8,
+		b: decoder
+	};
+}
+
+function _Json_mapMany(f, decoders)
+{
+	return {
+		$: 9,
+		f: f,
+		g: decoders
+	};
+}
+
+var _Json_andThen = F2(function(callback, decoder)
+{
+	return {
+		$: 10,
+		b: decoder,
+		h: callback
+	};
+});
+
+function _Json_oneOf(decoders)
+{
+	return {
+		$: 11,
+		g: decoders
+	};
+}
+
+
+// DECODING OBJECTS
+
+var _Json_map1 = F2(function(f, d1)
+{
+	return _Json_mapMany(f, [d1]);
+});
+
+var _Json_map2 = F3(function(f, d1, d2)
+{
+	return _Json_mapMany(f, [d1, d2]);
+});
+
+var _Json_map3 = F4(function(f, d1, d2, d3)
+{
+	return _Json_mapMany(f, [d1, d2, d3]);
+});
+
+var _Json_map4 = F5(function(f, d1, d2, d3, d4)
+{
+	return _Json_mapMany(f, [d1, d2, d3, d4]);
+});
+
+var _Json_map5 = F6(function(f, d1, d2, d3, d4, d5)
+{
+	return _Json_mapMany(f, [d1, d2, d3, d4, d5]);
+});
+
+var _Json_map6 = F7(function(f, d1, d2, d3, d4, d5, d6)
+{
+	return _Json_mapMany(f, [d1, d2, d3, d4, d5, d6]);
+});
+
+var _Json_map7 = F8(function(f, d1, d2, d3, d4, d5, d6, d7)
+{
+	return _Json_mapMany(f, [d1, d2, d3, d4, d5, d6, d7]);
+});
+
+var _Json_map8 = F9(function(f, d1, d2, d3, d4, d5, d6, d7, d8)
+{
+	return _Json_mapMany(f, [d1, d2, d3, d4, d5, d6, d7, d8]);
+});
+
+
+// DECODE
+
+var _Json_runOnString = F2(function(decoder, string)
+{
+	try
+	{
+		var value = JSON.parse(string);
+		return _Json_runHelp(decoder, value);
+	}
+	catch (e)
+	{
+		return $elm$core$Result$Err(A2($elm$json$Json$Decode$Failure, 'This is not valid JSON! ' + e.message, _Json_wrap(string)));
+	}
+});
+
+var _Json_run = F2(function(decoder, value)
+{
+	return _Json_runHelp(decoder, _Json_unwrap(value));
+});
+
+function _Json_runHelp(decoder, value)
+{
+	switch (decoder.$)
+	{
+		case 2:
+			return decoder.b(value);
+
+		case 5:
+			return (value === null)
+				? $elm$core$Result$Ok(decoder.c)
+				: _Json_expecting('null', value);
+
+		case 3:
+			if (!_Json_isArray(value))
+			{
+				return _Json_expecting('a LIST', value);
+			}
+			return _Json_runArrayDecoder(decoder.b, value, _List_fromArray);
+
+		case 4:
+			if (!_Json_isArray(value))
+			{
+				return _Json_expecting('an ARRAY', value);
+			}
+			return _Json_runArrayDecoder(decoder.b, value, _Json_toElmArray);
+
+		case 6:
+			var field = decoder.d;
+			if (typeof value !== 'object' || value === null || !(field in value))
+			{
+				return _Json_expecting('an OBJECT with a field named `' + field + '`', value);
+			}
+			var result = _Json_runHelp(decoder.b, value[field]);
+			return ($elm$core$Result$isOk(result)) ? result : $elm$core$Result$Err(A2($elm$json$Json$Decode$Field, field, result.a));
+
+		case 7:
+			var index = decoder.e;
+			if (!_Json_isArray(value))
+			{
+				return _Json_expecting('an ARRAY', value);
+			}
+			if (index >= value.length)
+			{
+				return _Json_expecting('a LONGER array. Need index ' + index + ' but only see ' + value.length + ' entries', value);
+			}
+			var result = _Json_runHelp(decoder.b, value[index]);
+			return ($elm$core$Result$isOk(result)) ? result : $elm$core$Result$Err(A2($elm$json$Json$Decode$Index, index, result.a));
+
+		case 8:
+			if (typeof value !== 'object' || value === null || _Json_isArray(value))
+			{
+				return _Json_expecting('an OBJECT', value);
+			}
+
+			var keyValuePairs = _List_Nil;
+			// TODO test perf of Object.keys and switch when support is good enough
+			for (var key in value)
+			{
+				if (value.hasOwnProperty(key))
+				{
+					var result = _Json_runHelp(decoder.b, value[key]);
+					if (!$elm$core$Result$isOk(result))
+					{
+						return $elm$core$Result$Err(A2($elm$json$Json$Decode$Field, key, result.a));
+					}
+					keyValuePairs = _List_Cons(_Utils_Tuple2(key, result.a), keyValuePairs);
+				}
+			}
+			return $elm$core$Result$Ok($elm$core$List$reverse(keyValuePairs));
+
+		case 9:
+			var answer = decoder.f;
+			var decoders = decoder.g;
+			for (var i = 0; i < decoders.length; i++)
+			{
+				var result = _Json_runHelp(decoders[i], value);
+				if (!$elm$core$Result$isOk(result))
+				{
+					return result;
+				}
+				answer = answer(result.a);
+			}
+			return $elm$core$Result$Ok(answer);
+
+		case 10:
+			var result = _Json_runHelp(decoder.b, value);
+			return (!$elm$core$Result$isOk(result))
+				? result
+				: _Json_runHelp(decoder.h(result.a), value);
+
+		case 11:
+			var errors = _List_Nil;
+			for (var temp = decoder.g; temp.b; temp = temp.b) // WHILE_CONS
+			{
+				var result = _Json_runHelp(temp.a, value);
+				if ($elm$core$Result$isOk(result))
+				{
+					return result;
+				}
+				errors = _List_Cons(result.a, errors);
+			}
+			return $elm$core$Result$Err($elm$json$Json$Decode$OneOf($elm$core$List$reverse(errors)));
+
+		case 1:
+			return $elm$core$Result$Err(A2($elm$json$Json$Decode$Failure, decoder.a, _Json_wrap(value)));
+
+		case 0:
+			return $elm$core$Result$Ok(decoder.a);
+	}
+}
+
+function _Json_runArrayDecoder(decoder, value, toElmValue)
+{
+	var len = value.length;
+	var array = new Array(len);
+	for (var i = 0; i < len; i++)
+	{
+		var result = _Json_runHelp(decoder, value[i]);
+		if (!$elm$core$Result$isOk(result))
+		{
+			return $elm$core$Result$Err(A2($elm$json$Json$Decode$Index, i, result.a));
+		}
+		array[i] = result.a;
+	}
+	return $elm$core$Result$Ok(toElmValue(array));
+}
+
+function _Json_isArray(value)
+{
+	return Array.isArray(value) || (typeof FileList !== 'undefined' && value instanceof FileList);
+}
+
+function _Json_toElmArray(array)
+{
+	return A2($elm$core$Array$initialize, array.length, function(i) { return array[i]; });
+}
+
+function _Json_expecting(type, value)
+{
+	return $elm$core$Result$Err(A2($elm$json$Json$Decode$Failure, 'Expecting ' + type, _Json_wrap(value)));
+}
+
+
+// EQUALITY
+
+function _Json_equality(x, y)
+{
+	if (x === y)
+	{
+		return true;
+	}
+
+	if (x.$ !== y.$)
+	{
+		return false;
+	}
+
+	switch (x.$)
+	{
+		case 0:
+		case 1:
+			return x.a === y.a;
+
+		case 2:
+			return x.b === y.b;
+
+		case 5:
+			return x.c === y.c;
+
+		case 3:
+		case 4:
+		case 8:
+			return _Json_equality(x.b, y.b);
+
+		case 6:
+			return x.d === y.d && _Json_equality(x.b, y.b);
+
+		case 7:
+			return x.e === y.e && _Json_equality(x.b, y.b);
+
+		case 9:
+			return x.f === y.f && _Json_listEquality(x.g, y.g);
+
+		case 10:
+			return x.h === y.h && _Json_equality(x.b, y.b);
+
+		case 11:
+			return _Json_listEquality(x.g, y.g);
+	}
+}
+
+function _Json_listEquality(aDecoders, bDecoders)
+{
+	var len = aDecoders.length;
+	if (len !== bDecoders.length)
+	{
+		return false;
+	}
+	for (var i = 0; i < len; i++)
+	{
+		if (!_Json_equality(aDecoders[i], bDecoders[i]))
+		{
+			return false;
+		}
+	}
+	return true;
+}
+
+
+// ENCODE
+
+var _Json_encode = F2(function(indentLevel, value)
+{
+	return JSON.stringify(_Json_unwrap(value), null, indentLevel) + '';
+});
+
+function _Json_wrap(value) { return { $: 0, a: value }; }
+function _Json_unwrap(value) { return value.a; }
+
+function _Json_wrap_UNUSED(value) { return value; }
+function _Json_unwrap_UNUSED(value) { return value; }
+
+function _Json_emptyArray() { return []; }
+function _Json_emptyObject() { return {}; }
+
+var _Json_addField = F3(function(key, value, object)
+{
+	object[key] = _Json_unwrap(value);
+	return object;
+});
+
+function _Json_addEntry(func)
+{
+	return F2(function(entry, array)
+	{
+		array.push(_Json_unwrap(func(entry)));
+		return array;
+	});
+}
+
+var _Json_encodeNull = _Json_wrap(null);
+
+
+
+// TASKS
+
+function _Scheduler_succeed(value)
+{
+	return {
+		$: 0,
+		a: value
+	};
+}
+
+function _Scheduler_fail(error)
+{
+	return {
+		$: 1,
+		a: error
+	};
+}
+
+function _Scheduler_binding(callback)
+{
+	return {
+		$: 2,
+		b: callback,
+		c: null
+	};
+}
+
+var _Scheduler_andThen = F2(function(callback, task)
+{
+	return {
+		$: 3,
+		b: callback,
+		d: task
+	};
+});
+
+var _Scheduler_onError = F2(function(callback, task)
+{
+	return {
+		$: 4,
+		b: callback,
+		d: task
+	};
+});
+
+function _Scheduler_receive(callback)
+{
+	return {
+		$: 5,
+		b: callback
+	};
+}
+
+
+// PROCESSES
+
+var _Scheduler_guid = 0;
+
+function _Scheduler_rawSpawn(task)
+{
+	var proc = {
+		$: 0,
+		e: _Scheduler_guid++,
+		f: task,
+		g: null,
+		h: []
+	};
+
+	_Scheduler_enqueue(proc);
+
+	return proc;
+}
+
+function _Scheduler_spawn(task)
+{
+	return _Scheduler_binding(function(callback) {
+		callback(_Scheduler_succeed(_Scheduler_rawSpawn(task)));
+	});
+}
+
+function _Scheduler_rawSend(proc, msg)
+{
+	proc.h.push(msg);
+	_Scheduler_enqueue(proc);
+}
+
+var _Scheduler_send = F2(function(proc, msg)
+{
+	return _Scheduler_binding(function(callback) {
+		_Scheduler_rawSend(proc, msg);
+		callback(_Scheduler_succeed(_Utils_Tuple0));
+	});
+});
+
+function _Scheduler_kill(proc)
+{
+	return _Scheduler_binding(function(callback) {
+		var task = proc.f;
+		if (task.$ === 2 && task.c)
+		{
+			task.c();
+		}
+
+		proc.f = null;
+
+		callback(_Scheduler_succeed(_Utils_Tuple0));
+	});
+}
+
+
+/* STEP PROCESSES
+
+type alias Process =
+  { $ : tag
+  , id : unique_id
+  , root : Task
+  , stack : null | { $: SUCCEED | FAIL, a: callback, b: stack }
+  , mailbox : [msg]
+  }
+
+*/
+
+
+var _Scheduler_working = false;
+var _Scheduler_queue = [];
+
+
+function _Scheduler_enqueue(proc)
+{
+	_Scheduler_queue.push(proc);
+	if (_Scheduler_working)
+	{
+		return;
+	}
+	_Scheduler_working = true;
+	while (proc = _Scheduler_queue.shift())
+	{
+		_Scheduler_step(proc);
+	}
+	_Scheduler_working = false;
+}
+
+
+function _Scheduler_step(proc)
+{
+	while (proc.f)
+	{
+		var rootTag = proc.f.$;
+		if (rootTag === 0 || rootTag === 1)
+		{
+			while (proc.g && proc.g.$ !== rootTag)
+			{
+				proc.g = proc.g.i;
+			}
+			if (!proc.g)
+			{
+				return;
+			}
+			proc.f = proc.g.b(proc.f.a);
+			proc.g = proc.g.i;
+		}
+		else if (rootTag === 2)
+		{
+			proc.f.c = proc.f.b(function(newRoot) {
+				proc.f = newRoot;
+				_Scheduler_enqueue(proc);
+			});
+			return;
+		}
+		else if (rootTag === 5)
+		{
+			if (proc.h.length === 0)
+			{
+				return;
+			}
+			proc.f = proc.f.b(proc.h.shift());
+		}
+		else // if (rootTag === 3 || rootTag === 4)
+		{
+			proc.g = {
+				$: rootTag === 3 ? 0 : 1,
+				b: proc.f.b,
+				i: proc.g
+			};
+			proc.f = proc.f.d;
+		}
+	}
+}
+
+
+
+function _Process_sleep(time)
+{
+	return _Scheduler_binding(function(callback) {
+		var id = setTimeout(function() {
+			callback(_Scheduler_succeed(_Utils_Tuple0));
+		}, time);
+
+		return function() { clearTimeout(id); };
+	});
+}
+
+
+
+
+// PROGRAMS
+
+
+var _Platform_worker = F4(function(impl, flagDecoder, debugMetadata, args)
+{
+	return _Platform_initialize(
+		flagDecoder,
+		args,
+		impl.init,
+		impl.update,
+		impl.subscriptions,
+		function() { return function() {} }
+	);
+});
+
+
+
+// INITIALIZE A PROGRAM
+
+
+function _Platform_initialize(flagDecoder, args, init, update, subscriptions, stepperBuilder)
+{
+	var result = A2(_Json_run, flagDecoder, _Json_wrap(args ? args['flags'] : undefined));
+	$elm$core$Result$isOk(result) || _Debug_crash(2 /**/, _Json_errorToString(result.a) /**/);
+	var managers = {};
+	var initPair = init(result.a);
+	var model = initPair.a;
+	var stepper = stepperBuilder(sendToApp, model);
+	var ports = _Platform_setupEffects(managers, sendToApp);
+
+	function sendToApp(msg, viewMetadata)
+	{
+		var pair = A2(update, msg, model);
+		stepper(model = pair.a, viewMetadata);
+		_Platform_enqueueEffects(managers, pair.b, subscriptions(model));
+	}
+
+	_Platform_enqueueEffects(managers, initPair.b, subscriptions(model));
+
+	return ports ? { ports: ports } : {};
+}
+
+
+
+// TRACK PRELOADS
+//
+// This is used by code in elm/browser and elm/http
+// to register any HTTP requests that are triggered by init.
+//
+
+
+var _Platform_preload;
+
+
+function _Platform_registerPreload(url)
+{
+	_Platform_preload.add(url);
+}
+
+
+
+// EFFECT MANAGERS
+
+
+var _Platform_effectManagers = {};
+
+
+function _Platform_setupEffects(managers, sendToApp)
+{
+	var ports;
+
+	// setup all necessary effect managers
+	for (var key in _Platform_effectManagers)
+	{
+		var manager = _Platform_effectManagers[key];
+
+		if (manager.a)
+		{
+			ports = ports || {};
+			ports[key] = manager.a(key, sendToApp);
+		}
+
+		managers[key] = _Platform_instantiateManager(manager, sendToApp);
+	}
+
+	return ports;
+}
+
+
+function _Platform_createManager(init, onEffects, onSelfMsg, cmdMap, subMap)
+{
+	return {
+		b: init,
+		c: onEffects,
+		d: onSelfMsg,
+		e: cmdMap,
+		f: subMap
+	};
+}
+
+
+function _Platform_instantiateManager(info, sendToApp)
+{
+	var router = {
+		g: sendToApp,
+		h: undefined
+	};
+
+	var onEffects = info.c;
+	var onSelfMsg = info.d;
+	var cmdMap = info.e;
+	var subMap = info.f;
+
+	function loop(state)
+	{
+		return A2(_Scheduler_andThen, loop, _Scheduler_receive(function(msg)
+		{
+			var value = msg.a;
+
+			if (msg.$ === 0)
+			{
+				return A3(onSelfMsg, router, value, state);
+			}
+
+			return cmdMap && subMap
+				? A4(onEffects, router, value.i, value.j, state)
+				: A3(onEffects, router, cmdMap ? value.i : value.j, state);
+		}));
+	}
+
+	return router.h = _Scheduler_rawSpawn(A2(_Scheduler_andThen, loop, info.b));
+}
+
+
+
+// ROUTING
+
+
+var _Platform_sendToApp = F2(function(router, msg)
+{
+	return _Scheduler_binding(function(callback)
+	{
+		router.g(msg);
+		callback(_Scheduler_succeed(_Utils_Tuple0));
+	});
+});
+
+
+var _Platform_sendToSelf = F2(function(router, msg)
+{
+	return A2(_Scheduler_send, router.h, {
+		$: 0,
+		a: msg
+	});
+});
+
+
+
+// BAGS
+
+
+function _Platform_leaf(home)
+{
+	return function(value)
+	{
+		return {
+			$: 1,
+			k: home,
+			l: value
+		};
+	};
+}
+
+
+function _Platform_batch(list)
+{
+	return {
+		$: 2,
+		m: list
+	};
+}
+
+
+var _Platform_map = F2(function(tagger, bag)
+{
+	return {
+		$: 3,
+		n: tagger,
+		o: bag
+	}
+});
+
+
+
+// PIPE BAGS INTO EFFECT MANAGERS
+//
+// Effects must be queued!
+//
+// Say your init contains a synchronous command, like Time.now or Time.here
+//
+//   - This will produce a batch of effects (FX_1)
+//   - The synchronous task triggers the subsequent `update` call
+//   - This will produce a batch of effects (FX_2)
+//
+// If we just start dispatching FX_2, subscriptions from FX_2 can be processed
+// before subscriptions from FX_1. No good! Earlier versions of this code had
+// this problem, leading to these reports:
+//
+//   https://github.com/elm/core/issues/980
+//   https://github.com/elm/core/pull/981
+//   https://github.com/elm/compiler/issues/1776
+//
+// The queue is necessary to avoid ordering issues for synchronous commands.
+
+
+// Why use true/false here? Why not just check the length of the queue?
+// The goal is to detect "are we currently dispatching effects?" If we
+// are, we need to bail and let the ongoing while loop handle things.
+//
+// Now say the queue has 1 element. When we dequeue the final element,
+// the queue will be empty, but we are still actively dispatching effects.
+// So you could get queue jumping in a really tricky category of cases.
+//
+var _Platform_effectsQueue = [];
+var _Platform_effectsActive = false;
+
+
+function _Platform_enqueueEffects(managers, cmdBag, subBag)
+{
+	_Platform_effectsQueue.push({ p: managers, q: cmdBag, r: subBag });
+
+	if (_Platform_effectsActive) return;
+
+	_Platform_effectsActive = true;
+	for (var fx; fx = _Platform_effectsQueue.shift(); )
+	{
+		_Platform_dispatchEffects(fx.p, fx.q, fx.r);
+	}
+	_Platform_effectsActive = false;
+}
+
+
+function _Platform_dispatchEffects(managers, cmdBag, subBag)
+{
+	var effectsDict = {};
+	_Platform_gatherEffects(true, cmdBag, effectsDict, null);
+	_Platform_gatherEffects(false, subBag, effectsDict, null);
+
+	for (var home in managers)
+	{
+		_Scheduler_rawSend(managers[home], {
+			$: 'fx',
+			a: effectsDict[home] || { i: _List_Nil, j: _List_Nil }
+		});
+	}
+}
+
+
+function _Platform_gatherEffects(isCmd, bag, effectsDict, taggers)
+{
+	switch (bag.$)
+	{
+		case 1:
+			var home = bag.k;
+			var effect = _Platform_toEffect(isCmd, home, taggers, bag.l);
+			effectsDict[home] = _Platform_insert(isCmd, effect, effectsDict[home]);
+			return;
+
+		case 2:
+			for (var list = bag.m; list.b; list = list.b) // WHILE_CONS
+			{
+				_Platform_gatherEffects(isCmd, list.a, effectsDict, taggers);
+			}
+			return;
+
+		case 3:
+			_Platform_gatherEffects(isCmd, bag.o, effectsDict, {
+				s: bag.n,
+				t: taggers
+			});
+			return;
+	}
+}
+
+
+function _Platform_toEffect(isCmd, home, taggers, value)
+{
+	function applyTaggers(x)
+	{
+		for (var temp = taggers; temp; temp = temp.t)
+		{
+			x = temp.s(x);
+		}
+		return x;
+	}
+
+	var map = isCmd
+		? _Platform_effectManagers[home].e
+		: _Platform_effectManagers[home].f;
+
+	return A2(map, applyTaggers, value)
+}
+
+
+function _Platform_insert(isCmd, newEffect, effects)
+{
+	effects = effects || { i: _List_Nil, j: _List_Nil };
+
+	isCmd
+		? (effects.i = _List_Cons(newEffect, effects.i))
+		: (effects.j = _List_Cons(newEffect, effects.j));
+
+	return effects;
+}
+
+
+
+// PORTS
+
+
+function _Platform_checkPortName(name)
+{
+	if (_Platform_effectManagers[name])
+	{
+		_Debug_crash(3, name)
+	}
+}
+
+
+
+// OUTGOING PORTS
+
+
+function _Platform_outgoingPort(name, converter)
+{
+	_Platform_checkPortName(name);
+	_Platform_effectManagers[name] = {
+		e: _Platform_outgoingPortMap,
+		u: converter,
+		a: _Platform_setupOutgoingPort
+	};
+	return _Platform_leaf(name);
+}
+
+
+var _Platform_outgoingPortMap = F2(function(tagger, value) { return value; });
+
+
+function _Platform_setupOutgoingPort(name)
+{
+	var subs = [];
+	var converter = _Platform_effectManagers[name].u;
+
+	// CREATE MANAGER
+
+	var init = _Process_sleep(0);
+
+	_Platform_effectManagers[name].b = init;
+	_Platform_effectManagers[name].c = F3(function(router, cmdList, state)
+	{
+		for ( ; cmdList.b; cmdList = cmdList.b) // WHILE_CONS
+		{
+			// grab a separate reference to subs in case unsubscribe is called
+			var currentSubs = subs;
+			var value = _Json_unwrap(converter(cmdList.a));
+			for (var i = 0; i < currentSubs.length; i++)
+			{
+				currentSubs[i](value);
+			}
+		}
+		return init;
+	});
+
+	// PUBLIC API
+
+	function subscribe(callback)
+	{
+		subs.push(callback);
+	}
+
+	function unsubscribe(callback)
+	{
+		// copy subs into a new array in case unsubscribe is called within a
+		// subscribed callback
+		subs = subs.slice();
+		var index = subs.indexOf(callback);
+		if (index >= 0)
+		{
+			subs.splice(index, 1);
+		}
+	}
+
+	return {
+		subscribe: subscribe,
+		unsubscribe: unsubscribe
+	};
+}
+
+
+
+// INCOMING PORTS
+
+
+function _Platform_incomingPort(name, converter)
+{
+	_Platform_checkPortName(name);
+	_Platform_effectManagers[name] = {
+		f: _Platform_incomingPortMap,
+		u: converter,
+		a: _Platform_setupIncomingPort
+	};
+	return _Platform_leaf(name);
+}
+
+
+var _Platform_incomingPortMap = F2(function(tagger, finalTagger)
+{
+	return function(value)
+	{
+		return tagger(finalTagger(value));
+	};
+});
+
+
+function _Platform_setupIncomingPort(name, sendToApp)
+{
+	var subs = _List_Nil;
+	var converter = _Platform_effectManagers[name].u;
+
+	// CREATE MANAGER
+
+	var init = _Scheduler_succeed(null);
+
+	_Platform_effectManagers[name].b = init;
+	_Platform_effectManagers[name].c = F3(function(router, subList, state)
+	{
+		subs = subList;
+		return init;
+	});
+
+	// PUBLIC API
+
+	function send(incomingValue)
+	{
+		var result = A2(_Json_run, converter, _Json_wrap(incomingValue));
+
+		$elm$core$Result$isOk(result) || _Debug_crash(4, name, result.a);
+
+		var value = result.a;
+		for (var temp = subs; temp.b; temp = temp.b) // WHILE_CONS
+		{
+			sendToApp(temp.a(value));
+		}
+	}
+
+	return { send: send };
+}
+
+
+
+// EXPORT ELM MODULES
+//
+// Have DEBUG and PROD versions so that we can (1) give nicer errors in
+// debug mode and (2) not pay for the bits needed for that in prod mode.
+//
+
+
+function _Platform_export_UNUSED(exports)
+{
+	scope['Elm']
+		? _Platform_mergeExportsProd(scope['Elm'], exports)
+		: scope['Elm'] = exports;
+}
+
+
+function _Platform_mergeExportsProd(obj, exports)
+{
+	for (var name in exports)
+	{
+		(name in obj)
+			? (name == 'init')
+				? _Debug_crash(6)
+				: _Platform_mergeExportsProd(obj[name], exports[name])
+			: (obj[name] = exports[name]);
+	}
+}
+
+
+function _Platform_export(exports)
+{
+	scope['Elm']
+		? _Platform_mergeExportsDebug('Elm', scope['Elm'], exports)
+		: scope['Elm'] = exports;
+}
+
+
+function _Platform_mergeExportsDebug(moduleName, obj, exports)
+{
+	for (var name in exports)
+	{
+		(name in obj)
+			? (name == 'init')
+				? _Debug_crash(6, moduleName)
+				: _Platform_mergeExportsDebug(moduleName + '.' + name, obj[name], exports[name])
+			: (obj[name] = exports[name]);
+	}
+}
+
+
+
+
+// HELPERS
+
+
+var _VirtualDom_divertHrefToApp;
+
+var _VirtualDom_doc = typeof document !== 'undefined' ? document : {};
+
+
+function _VirtualDom_appendChild(parent, child)
+{
+	parent.appendChild(child);
+}
+
+var _VirtualDom_init = F4(function(virtualNode, flagDecoder, debugMetadata, args)
+{
+	// NOTE: this function needs _Platform_export available to work
+
+	/**_UNUSED/
+	var node = args['node'];
+	//*/
+	/**/
+	var node = args && args['node'] ? args['node'] : _Debug_crash(0);
+	//*/
+
+	node.parentNode.replaceChild(
+		_VirtualDom_render(virtualNode, function() {}),
+		node
+	);
+
+	return {};
+});
+
+
+
+// TEXT
+
+
+function _VirtualDom_text(string)
+{
+	return {
+		$: 0,
+		a: string
+	};
+}
+
+
+
+// NODE
+
+
+var _VirtualDom_nodeNS = F2(function(namespace, tag)
+{
+	return F2(function(factList, kidList)
+	{
+		for (var kids = [], descendantsCount = 0; kidList.b; kidList = kidList.b) // WHILE_CONS
+		{
+			var kid = kidList.a;
+			descendantsCount += (kid.b || 0);
+			kids.push(kid);
+		}
+		descendantsCount += kids.length;
+
+		return {
+			$: 1,
+			c: tag,
+			d: _VirtualDom_organizeFacts(factList),
+			e: kids,
+			f: namespace,
+			b: descendantsCount
+		};
+	});
+});
+
+
+var _VirtualDom_node = _VirtualDom_nodeNS(undefined);
+
+
+
+// KEYED NODE
+
+
+var _VirtualDom_keyedNodeNS = F2(function(namespace, tag)
+{
+	return F2(function(factList, kidList)
+	{
+		for (var kids = [], descendantsCount = 0; kidList.b; kidList = kidList.b) // WHILE_CONS
+		{
+			var kid = kidList.a;
+			descendantsCount += (kid.b.b || 0);
+			kids.push(kid);
+		}
+		descendantsCount += kids.length;
+
+		return {
+			$: 2,
+			c: tag,
+			d: _VirtualDom_organizeFacts(factList),
+			e: kids,
+			f: namespace,
+			b: descendantsCount
+		};
+	});
+});
+
+
+var _VirtualDom_keyedNode = _VirtualDom_keyedNodeNS(undefined);
+
+
+
+// CUSTOM
+
+
+function _VirtualDom_custom(factList, model, render, diff)
+{
+	return {
+		$: 3,
+		d: _VirtualDom_organizeFacts(factList),
+		g: model,
+		h: render,
+		i: diff
+	};
+}
+
+
+
+// MAP
+
+
+var _VirtualDom_map = F2(function(tagger, node)
+{
+	return {
+		$: 4,
+		j: tagger,
+		k: node,
+		b: 1 + (node.b || 0)
+	};
+});
+
+
+
+// LAZY
+
+
+function _VirtualDom_thunk(refs, thunk)
+{
+	return {
+		$: 5,
+		l: refs,
+		m: thunk,
+		k: undefined
+	};
+}
+
+var _VirtualDom_lazy = F2(function(func, a)
+{
+	return _VirtualDom_thunk([func, a], function() {
+		return func(a);
+	});
+});
+
+var _VirtualDom_lazy2 = F3(function(func, a, b)
+{
+	return _VirtualDom_thunk([func, a, b], function() {
+		return A2(func, a, b);
+	});
+});
+
+var _VirtualDom_lazy3 = F4(function(func, a, b, c)
+{
+	return _VirtualDom_thunk([func, a, b, c], function() {
+		return A3(func, a, b, c);
+	});
+});
+
+var _VirtualDom_lazy4 = F5(function(func, a, b, c, d)
+{
+	return _VirtualDom_thunk([func, a, b, c, d], function() {
+		return A4(func, a, b, c, d);
+	});
+});
+
+var _VirtualDom_lazy5 = F6(function(func, a, b, c, d, e)
+{
+	return _VirtualDom_thunk([func, a, b, c, d, e], function() {
+		return A5(func, a, b, c, d, e);
+	});
+});
+
+var _VirtualDom_lazy6 = F7(function(func, a, b, c, d, e, f)
+{
+	return _VirtualDom_thunk([func, a, b, c, d, e, f], function() {
+		return A6(func, a, b, c, d, e, f);
+	});
+});
+
+var _VirtualDom_lazy7 = F8(function(func, a, b, c, d, e, f, g)
+{
+	return _VirtualDom_thunk([func, a, b, c, d, e, f, g], function() {
+		return A7(func, a, b, c, d, e, f, g);
+	});
+});
+
+var _VirtualDom_lazy8 = F9(function(func, a, b, c, d, e, f, g, h)
+{
+	return _VirtualDom_thunk([func, a, b, c, d, e, f, g, h], function() {
+		return A8(func, a, b, c, d, e, f, g, h);
+	});
+});
+
+
+
+// FACTS
+
+
+var _VirtualDom_on = F2(function(key, handler)
+{
+	return {
+		$: 'a0',
+		n: key,
+		o: handler
+	};
+});
+var _VirtualDom_style = F2(function(key, value)
+{
+	return {
+		$: 'a1',
+		n: key,
+		o: value
+	};
+});
+var _VirtualDom_property = F2(function(key, value)
+{
+	return {
+		$: 'a2',
+		n: key,
+		o: value
+	};
+});
+var _VirtualDom_attribute = F2(function(key, value)
+{
+	return {
+		$: 'a3',
+		n: key,
+		o: value
+	};
+});
+var _VirtualDom_attributeNS = F3(function(namespace, key, value)
+{
+	return {
+		$: 'a4',
+		n: key,
+		o: { f: namespace, o: value }
+	};
+});
+
+
+
+// XSS ATTACK VECTOR CHECKS
+//
+// For some reason, tabs can appear in href protocols and it still works.
+// So '\tjava\tSCRIPT:alert("!!!")' and 'javascript:alert("!!!")' are the same
+// in practice. That is why _VirtualDom_RE_js and _VirtualDom_RE_js_html look
+// so freaky.
+//
+// Pulling the regular expressions out to the top level gives a slight speed
+// boost in small benchmarks (4-10%) but hoisting values to reduce allocation
+// can be unpredictable in large programs where JIT may have a harder time with
+// functions are not fully self-contained. The benefit is more that the js and
+// js_html ones are so weird that I prefer to see them near each other.
+
+
+var _VirtualDom_RE_script = /^script$/i;
+var _VirtualDom_RE_on_formAction = /^(on|formAction$)/i;
+var _VirtualDom_RE_js = /^\s*j\s*a\s*v\s*a\s*s\s*c\s*r\s*i\s*p\s*t\s*:/i;
+var _VirtualDom_RE_js_html = /^\s*(j\s*a\s*v\s*a\s*s\s*c\s*r\s*i\s*p\s*t\s*:|d\s*a\s*t\s*a\s*:\s*t\s*e\s*x\s*t\s*\/\s*h\s*t\s*m\s*l\s*(,|;))/i;
+
+
+function _VirtualDom_noScript(tag)
+{
+	return _VirtualDom_RE_script.test(tag) ? 'p' : tag;
+}
+
+function _VirtualDom_noOnOrFormAction(key)
+{
+	return _VirtualDom_RE_on_formAction.test(key) ? 'data-' + key : key;
+}
+
+function _VirtualDom_noInnerHtmlOrFormAction(key)
+{
+	return key == 'innerHTML' || key == 'formAction' ? 'data-' + key : key;
+}
+
+function _VirtualDom_noJavaScriptUri(value)
+{
+	return _VirtualDom_RE_js.test(value)
+		? /**_UNUSED/''//*//**/'javascript:alert("This is an XSS vector. Please use ports or web components instead.")'//*/
+		: value;
+}
+
+function _VirtualDom_noJavaScriptOrHtmlUri(value)
+{
+	return _VirtualDom_RE_js_html.test(value)
+		? /**_UNUSED/''//*//**/'javascript:alert("This is an XSS vector. Please use ports or web components instead.")'//*/
+		: value;
+}
+
+function _VirtualDom_noJavaScriptOrHtmlJson(value)
+{
+	return (typeof _Json_unwrap(value) === 'string' && _VirtualDom_RE_js_html.test(_Json_unwrap(value)))
+		? _Json_wrap(
+			/**_UNUSED/''//*//**/'javascript:alert("This is an XSS vector. Please use ports or web components instead.")'//*/
+		) : value;
+}
+
+
+
+// MAP FACTS
+
+
+var _VirtualDom_mapAttribute = F2(function(func, attr)
+{
+	return (attr.$ === 'a0')
+		? A2(_VirtualDom_on, attr.n, _VirtualDom_mapHandler(func, attr.o))
+		: attr;
+});
+
+function _VirtualDom_mapHandler(func, handler)
+{
+	var tag = $elm$virtual_dom$VirtualDom$toHandlerInt(handler);
+
+	// 0 = Normal
+	// 1 = MayStopPropagation
+	// 2 = MayPreventDefault
+	// 3 = Custom
+
+	return {
+		$: handler.$,
+		a:
+			!tag
+				? A2($elm$json$Json$Decode$map, func, handler.a)
+				:
+			A3($elm$json$Json$Decode$map2,
+				tag < 3
+					? _VirtualDom_mapEventTuple
+					: _VirtualDom_mapEventRecord,
+				$elm$json$Json$Decode$succeed(func),
+				handler.a
+			)
+	};
+}
+
+var _VirtualDom_mapEventTuple = F2(function(func, tuple)
+{
+	return _Utils_Tuple2(func(tuple.a), tuple.b);
+});
+
+var _VirtualDom_mapEventRecord = F2(function(func, record)
+{
+	return {
+		message: func(record.message),
+		stopPropagation: record.stopPropagation,
+		preventDefault: record.preventDefault
+	}
+});
+
+
+
+// ORGANIZE FACTS
+
+
+function _VirtualDom_organizeFacts(factList)
+{
+	for (var facts = {}; factList.b; factList = factList.b) // WHILE_CONS
+	{
+		var entry = factList.a;
+
+		var tag = entry.$;
+		var key = entry.n;
+		var value = entry.o;
+
+		if (tag === 'a2')
+		{
+			(key === 'className')
+				? _VirtualDom_addClass(facts, key, _Json_unwrap(value))
+				: facts[key] = _Json_unwrap(value);
+
+			continue;
+		}
+
+		var subFacts = facts[tag] || (facts[tag] = {});
+		(tag === 'a3' && key === 'class')
+			? _VirtualDom_addClass(subFacts, key, value)
+			: subFacts[key] = value;
+	}
+
+	return facts;
+}
+
+function _VirtualDom_addClass(object, key, newClass)
+{
+	var classes = object[key];
+	object[key] = classes ? classes + ' ' + newClass : newClass;
+}
+
+
+
+// RENDER
+
+
+function _VirtualDom_render(vNode, eventNode)
+{
+	var tag = vNode.$;
+
+	if (tag === 5)
+	{
+		return _VirtualDom_render(vNode.k || (vNode.k = vNode.m()), eventNode);
+	}
+
+	if (tag === 0)
+	{
+		return _VirtualDom_doc.createTextNode(vNode.a);
+	}
+
+	if (tag === 4)
+	{
+		var subNode = vNode.k;
+		var tagger = vNode.j;
+
+		while (subNode.$ === 4)
+		{
+			typeof tagger !== 'object'
+				? tagger = [tagger, subNode.j]
+				: tagger.push(subNode.j);
+
+			subNode = subNode.k;
+		}
+
+		var subEventRoot = { j: tagger, p: eventNode };
+		var domNode = _VirtualDom_render(subNode, subEventRoot);
+		domNode.elm_event_node_ref = subEventRoot;
+		return domNode;
+	}
+
+	if (tag === 3)
+	{
+		var domNode = vNode.h(vNode.g);
+		_VirtualDom_applyFacts(domNode, eventNode, vNode.d);
+		return domNode;
+	}
+
+	// at this point `tag` must be 1 or 2
+
+	var domNode = vNode.f
+		? _VirtualDom_doc.createElementNS(vNode.f, vNode.c)
+		: _VirtualDom_doc.createElement(vNode.c);
+
+	if (_VirtualDom_divertHrefToApp && vNode.c == 'a')
+	{
+		domNode.addEventListener('click', _VirtualDom_divertHrefToApp(domNode));
+	}
+
+	_VirtualDom_applyFacts(domNode, eventNode, vNode.d);
+
+	for (var kids = vNode.e, i = 0; i < kids.length; i++)
+	{
+		_VirtualDom_appendChild(domNode, _VirtualDom_render(tag === 1 ? kids[i] : kids[i].b, eventNode));
+	}
+
+	return domNode;
+}
+
+
+
+// APPLY FACTS
+
+
+function _VirtualDom_applyFacts(domNode, eventNode, facts)
+{
+	for (var key in facts)
+	{
+		var value = facts[key];
+
+		key === 'a1'
+			? _VirtualDom_applyStyles(domNode, value)
+			:
+		key === 'a0'
+			? _VirtualDom_applyEvents(domNode, eventNode, value)
+			:
+		key === 'a3'
+			? _VirtualDom_applyAttrs(domNode, value)
+			:
+		key === 'a4'
+			? _VirtualDom_applyAttrsNS(domNode, value)
+			:
+		((key !== 'value' && key !== 'checked') || domNode[key] !== value) && (domNode[key] = value);
+	}
+}
+
+
+
+// APPLY STYLES
+
+
+function _VirtualDom_applyStyles(domNode, styles)
+{
+	var domNodeStyle = domNode.style;
+
+	for (var key in styles)
+	{
+		domNodeStyle[key] = styles[key];
+	}
+}
+
+
+
+// APPLY ATTRS
+
+
+function _VirtualDom_applyAttrs(domNode, attrs)
+{
+	for (var key in attrs)
+	{
+		var value = attrs[key];
+		typeof value !== 'undefined'
+			? domNode.setAttribute(key, value)
+			: domNode.removeAttribute(key);
+	}
+}
+
+
+
+// APPLY NAMESPACED ATTRS
+
+
+function _VirtualDom_applyAttrsNS(domNode, nsAttrs)
+{
+	for (var key in nsAttrs)
+	{
+		var pair = nsAttrs[key];
+		var namespace = pair.f;
+		var value = pair.o;
+
+		typeof value !== 'undefined'
+			? domNode.setAttributeNS(namespace, key, value)
+			: domNode.removeAttributeNS(namespace, key);
+	}
+}
+
+
+
+// APPLY EVENTS
+
+
+function _VirtualDom_applyEvents(domNode, eventNode, events)
+{
+	var allCallbacks = domNode.elmFs || (domNode.elmFs = {});
+
+	for (var key in events)
+	{
+		var newHandler = events[key];
+		var oldCallback = allCallbacks[key];
+
+		if (!newHandler)
+		{
+			domNode.removeEventListener(key, oldCallback);
+			allCallbacks[key] = undefined;
+			continue;
+		}
+
+		if (oldCallback)
+		{
+			var oldHandler = oldCallback.q;
+			if (oldHandler.$ === newHandler.$)
+			{
+				oldCallback.q = newHandler;
+				continue;
+			}
+			domNode.removeEventListener(key, oldCallback);
+		}
+
+		oldCallback = _VirtualDom_makeCallback(eventNode, newHandler);
+		domNode.addEventListener(key, oldCallback,
+			_VirtualDom_passiveSupported
+			&& { passive: $elm$virtual_dom$VirtualDom$toHandlerInt(newHandler) < 2 }
+		);
+		allCallbacks[key] = oldCallback;
+	}
+}
+
+
+
+// PASSIVE EVENTS
+
+
+var _VirtualDom_passiveSupported;
+
+try
+{
+	window.addEventListener('t', null, Object.defineProperty({}, 'passive', {
+		get: function() { _VirtualDom_passiveSupported = true; }
+	}));
+}
+catch(e) {}
+
+
+
+// EVENT HANDLERS
+
+
+function _VirtualDom_makeCallback(eventNode, initialHandler)
+{
+	function callback(event)
+	{
+		var handler = callback.q;
+		var result = _Json_runHelp(handler.a, event);
+
+		if (!$elm$core$Result$isOk(result))
+		{
+			return;
+		}
+
+		var tag = $elm$virtual_dom$VirtualDom$toHandlerInt(handler);
+
+		// 0 = Normal
+		// 1 = MayStopPropagation
+		// 2 = MayPreventDefault
+		// 3 = Custom
+
+		var value = result.a;
+		var message = !tag ? value : tag < 3 ? value.a : value.message;
+		var stopPropagation = tag == 1 ? value.b : tag == 3 && value.stopPropagation;
+		var currentEventNode = (
+			stopPropagation && event.stopPropagation(),
+			(tag == 2 ? value.b : tag == 3 && value.preventDefault) && event.preventDefault(),
+			eventNode
+		);
+		var tagger;
+		var i;
+		while (tagger = currentEventNode.j)
+		{
+			if (typeof tagger == 'function')
+			{
+				message = tagger(message);
+			}
+			else
+			{
+				for (var i = tagger.length; i--; )
+				{
+					message = tagger[i](message);
+				}
+			}
+			currentEventNode = currentEventNode.p;
+		}
+		currentEventNode(message, stopPropagation); // stopPropagation implies isSync
+	}
+
+	callback.q = initialHandler;
+
+	return callback;
+}
+
+function _VirtualDom_equalEvents(x, y)
+{
+	return x.$ == y.$ && _Json_equality(x.a, y.a);
+}
+
+
+
+// DIFF
+
+
+// TODO: Should we do patches like in iOS?
+//
+// type Patch
+//   = At Int Patch
+//   | Batch (List Patch)
+//   | Change ...
+//
+// How could it not be better?
+//
+function _VirtualDom_diff(x, y)
+{
+	var patches = [];
+	_VirtualDom_diffHelp(x, y, patches, 0);
+	return patches;
+}
+
+
+function _VirtualDom_pushPatch(patches, type, index, data)
+{
+	var patch = {
+		$: type,
+		r: index,
+		s: data,
+		t: undefined,
+		u: undefined
+	};
+	patches.push(patch);
+	return patch;
+}
+
+
+function _VirtualDom_diffHelp(x, y, patches, index)
+{
+	if (x === y)
+	{
+		return;
+	}
+
+	var xType = x.$;
+	var yType = y.$;
+
+	// Bail if you run into different types of nodes. Implies that the
+	// structure has changed significantly and it's not worth a diff.
+	if (xType !== yType)
+	{
+		if (xType === 1 && yType === 2)
+		{
+			y = _VirtualDom_dekey(y);
+			yType = 1;
+		}
+		else
+		{
+			_VirtualDom_pushPatch(patches, 0, index, y);
+			return;
+		}
+	}
+
+	// Now we know that both nodes are the same $.
+	switch (yType)
+	{
+		case 5:
+			var xRefs = x.l;
+			var yRefs = y.l;
+			var i = xRefs.length;
+			var same = i === yRefs.length;
+			while (same && i--)
+			{
+				same = xRefs[i] === yRefs[i];
+			}
+			if (same)
+			{
+				y.k = x.k;
+				return;
+			}
+			y.k = y.m();
+			var subPatches = [];
+			_VirtualDom_diffHelp(x.k, y.k, subPatches, 0);
+			subPatches.length > 0 && _VirtualDom_pushPatch(patches, 1, index, subPatches);
+			return;
+
+		case 4:
+			// gather nested taggers
+			var xTaggers = x.j;
+			var yTaggers = y.j;
+			var nesting = false;
+
+			var xSubNode = x.k;
+			while (xSubNode.$ === 4)
+			{
+				nesting = true;
+
+				typeof xTaggers !== 'object'
+					? xTaggers = [xTaggers, xSubNode.j]
+					: xTaggers.push(xSubNode.j);
+
+				xSubNode = xSubNode.k;
+			}
+
+			var ySubNode = y.k;
+			while (ySubNode.$ === 4)
+			{
+				nesting = true;
+
+				typeof yTaggers !== 'object'
+					? yTaggers = [yTaggers, ySubNode.j]
+					: yTaggers.push(ySubNode.j);
+
+				ySubNode = ySubNode.k;
+			}
+
+			// Just bail if different numbers of taggers. This implies the
+			// structure of the virtual DOM has changed.
+			if (nesting && xTaggers.length !== yTaggers.length)
+			{
+				_VirtualDom_pushPatch(patches, 0, index, y);
+				return;
+			}
+
+			// check if taggers are "the same"
+			if (nesting ? !_VirtualDom_pairwiseRefEqual(xTaggers, yTaggers) : xTaggers !== yTaggers)
+			{
+				_VirtualDom_pushPatch(patches, 2, index, yTaggers);
+			}
+
+			// diff everything below the taggers
+			_VirtualDom_diffHelp(xSubNode, ySubNode, patches, index + 1);
+			return;
+
+		case 0:
+			if (x.a !== y.a)
+			{
+				_VirtualDom_pushPatch(patches, 3, index, y.a);
+			}
+			return;
+
+		case 1:
+			_VirtualDom_diffNodes(x, y, patches, index, _VirtualDom_diffKids);
+			return;
+
+		case 2:
+			_VirtualDom_diffNodes(x, y, patches, index, _VirtualDom_diffKeyedKids);
+			return;
+
+		case 3:
+			if (x.h !== y.h)
+			{
+				_VirtualDom_pushPatch(patches, 0, index, y);
+				return;
+			}
+
+			var factsDiff = _VirtualDom_diffFacts(x.d, y.d);
+			factsDiff && _VirtualDom_pushPatch(patches, 4, index, factsDiff);
+
+			var patch = y.i(x.g, y.g);
+			patch && _VirtualDom_pushPatch(patches, 5, index, patch);
+
+			return;
+	}
+}
+
+// assumes the incoming arrays are the same length
+function _VirtualDom_pairwiseRefEqual(as, bs)
+{
+	for (var i = 0; i < as.length; i++)
+	{
+		if (as[i] !== bs[i])
+		{
+			return false;
+		}
+	}
+
+	return true;
+}
+
+function _VirtualDom_diffNodes(x, y, patches, index, diffKids)
+{
+	// Bail if obvious indicators have changed. Implies more serious
+	// structural changes such that it's not worth it to diff.
+	if (x.c !== y.c || x.f !== y.f)
+	{
+		_VirtualDom_pushPatch(patches, 0, index, y);
+		return;
+	}
+
+	var factsDiff = _VirtualDom_diffFacts(x.d, y.d);
+	factsDiff && _VirtualDom_pushPatch(patches, 4, index, factsDiff);
+
+	diffKids(x, y, patches, index);
+}
+
+
+
+// DIFF FACTS
+
+
+// TODO Instead of creating a new diff object, it's possible to just test if
+// there *is* a diff. During the actual patch, do the diff again and make the
+// modifications directly. This way, there's no new allocations. Worth it?
+function _VirtualDom_diffFacts(x, y, category)
+{
+	var diff;
+
+	// look for changes and removals
+	for (var xKey in x)
+	{
+		if (xKey === 'a1' || xKey === 'a0' || xKey === 'a3' || xKey === 'a4')
+		{
+			var subDiff = _VirtualDom_diffFacts(x[xKey], y[xKey] || {}, xKey);
+			if (subDiff)
+			{
+				diff = diff || {};
+				diff[xKey] = subDiff;
+			}
+			continue;
+		}
+
+		// remove if not in the new facts
+		if (!(xKey in y))
+		{
+			diff = diff || {};
+			diff[xKey] =
+				!category
+					? (typeof x[xKey] === 'string' ? '' : null)
+					:
+				(category === 'a1')
+					? ''
+					:
+				(category === 'a0' || category === 'a3')
+					? undefined
+					:
+				{ f: x[xKey].f, o: undefined };
+
+			continue;
+		}
+
+		var xValue = x[xKey];
+		var yValue = y[xKey];
+
+		// reference equal, so don't worry about it
+		if (xValue === yValue && xKey !== 'value' && xKey !== 'checked'
+			|| category === 'a0' && _VirtualDom_equalEvents(xValue, yValue))
+		{
+			continue;
+		}
+
+		diff = diff || {};
+		diff[xKey] = yValue;
+	}
+
+	// add new stuff
+	for (var yKey in y)
+	{
+		if (!(yKey in x))
+		{
+			diff = diff || {};
+			diff[yKey] = y[yKey];
+		}
+	}
+
+	return diff;
+}
+
+
+
+// DIFF KIDS
+
+
+function _VirtualDom_diffKids(xParent, yParent, patches, index)
+{
+	var xKids = xParent.e;
+	var yKids = yParent.e;
+
+	var xLen = xKids.length;
+	var yLen = yKids.length;
+
+	// FIGURE OUT IF THERE ARE INSERTS OR REMOVALS
+
+	if (xLen > yLen)
+	{
+		_VirtualDom_pushPatch(patches, 6, index, {
+			v: yLen,
+			i: xLen - yLen
+		});
+	}
+	else if (xLen < yLen)
+	{
+		_VirtualDom_pushPatch(patches, 7, index, {
+			v: xLen,
+			e: yKids
+		});
+	}
+
+	// PAIRWISE DIFF EVERYTHING ELSE
+
+	for (var minLen = xLen < yLen ? xLen : yLen, i = 0; i < minLen; i++)
+	{
+		var xKid = xKids[i];
+		_VirtualDom_diffHelp(xKid, yKids[i], patches, ++index);
+		index += xKid.b || 0;
+	}
+}
+
+
+
+// KEYED DIFF
+
+
+function _VirtualDom_diffKeyedKids(xParent, yParent, patches, rootIndex)
+{
+	var localPatches = [];
+
+	var changes = {}; // Dict String Entry
+	var inserts = []; // Array { index : Int, entry : Entry }
+	// type Entry = { tag : String, vnode : VNode, index : Int, data : _ }
+
+	var xKids = xParent.e;
+	var yKids = yParent.e;
+	var xLen = xKids.length;
+	var yLen = yKids.length;
+	var xIndex = 0;
+	var yIndex = 0;
+
+	var index = rootIndex;
+
+	while (xIndex < xLen && yIndex < yLen)
+	{
+		var x = xKids[xIndex];
+		var y = yKids[yIndex];
+
+		var xKey = x.a;
+		var yKey = y.a;
+		var xNode = x.b;
+		var yNode = y.b;
+
+		var newMatch = undefined;
+		var oldMatch = undefined;
+
+		// check if keys match
+
+		if (xKey === yKey)
+		{
+			index++;
+			_VirtualDom_diffHelp(xNode, yNode, localPatches, index);
+			index += xNode.b || 0;
+
+			xIndex++;
+			yIndex++;
+			continue;
+		}
+
+		// look ahead 1 to detect insertions and removals.
+
+		var xNext = xKids[xIndex + 1];
+		var yNext = yKids[yIndex + 1];
+
+		if (xNext)
+		{
+			var xNextKey = xNext.a;
+			var xNextNode = xNext.b;
+			oldMatch = yKey === xNextKey;
+		}
+
+		if (yNext)
+		{
+			var yNextKey = yNext.a;
+			var yNextNode = yNext.b;
+			newMatch = xKey === yNextKey;
+		}
+
+
+		// swap x and y
+		if (newMatch && oldMatch)
+		{
+			index++;
+			_VirtualDom_diffHelp(xNode, yNextNode, localPatches, index);
+			_VirtualDom_insertNode(changes, localPatches, xKey, yNode, yIndex, inserts);
+			index += xNode.b || 0;
+
+			index++;
+			_VirtualDom_removeNode(changes, localPatches, xKey, xNextNode, index);
+			index += xNextNode.b || 0;
+
+			xIndex += 2;
+			yIndex += 2;
+			continue;
+		}
+
+		// insert y
+		if (newMatch)
+		{
+			index++;
+			_VirtualDom_insertNode(changes, localPatches, yKey, yNode, yIndex, inserts);
+			_VirtualDom_diffHelp(xNode, yNextNode, localPatches, index);
+			index += xNode.b || 0;
+
+			xIndex += 1;
+			yIndex += 2;
+			continue;
+		}
+
+		// remove x
+		if (oldMatch)
+		{
+			index++;
+			_VirtualDom_removeNode(changes, localPatches, xKey, xNode, index);
+			index += xNode.b || 0;
+
+			index++;
+			_VirtualDom_diffHelp(xNextNode, yNode, localPatches, index);
+			index += xNextNode.b || 0;
+
+			xIndex += 2;
+			yIndex += 1;
+			continue;
+		}
+
+		// remove x, insert y
+		if (xNext && xNextKey === yNextKey)
+		{
+			index++;
+			_VirtualDom_removeNode(changes, localPatches, xKey, xNode, index);
+			_VirtualDom_insertNode(changes, localPatches, yKey, yNode, yIndex, inserts);
+			index += xNode.b || 0;
+
+			index++;
+			_VirtualDom_diffHelp(xNextNode, yNextNode, localPatches, index);
+			index += xNextNode.b || 0;
+
+			xIndex += 2;
+			yIndex += 2;
+			continue;
+		}
+
+		break;
+	}
+
+	// eat up any remaining nodes with removeNode and insertNode
+
+	while (xIndex < xLen)
+	{
+		index++;
+		var x = xKids[xIndex];
+		var xNode = x.b;
+		_VirtualDom_removeNode(changes, localPatches, x.a, xNode, index);
+		index += xNode.b || 0;
+		xIndex++;
+	}
+
+	while (yIndex < yLen)
+	{
+		var endInserts = endInserts || [];
+		var y = yKids[yIndex];
+		_VirtualDom_insertNode(changes, localPatches, y.a, y.b, undefined, endInserts);
+		yIndex++;
+	}
+
+	if (localPatches.length > 0 || inserts.length > 0 || endInserts)
+	{
+		_VirtualDom_pushPatch(patches, 8, rootIndex, {
+			w: localPatches,
+			x: inserts,
+			y: endInserts
+		});
+	}
+}
+
+
+
+// CHANGES FROM KEYED DIFF
+
+
+var _VirtualDom_POSTFIX = '_elmW6BL';
+
+
+function _VirtualDom_insertNode(changes, localPatches, key, vnode, yIndex, inserts)
+{
+	var entry = changes[key];
+
+	// never seen this key before
+	if (!entry)
+	{
+		entry = {
+			c: 0,
+			z: vnode,
+			r: yIndex,
+			s: undefined
+		};
+
+		inserts.push({ r: yIndex, A: entry });
+		changes[key] = entry;
+
+		return;
+	}
+
+	// this key was removed earlier, a match!
+	if (entry.c === 1)
+	{
+		inserts.push({ r: yIndex, A: entry });
+
+		entry.c = 2;
+		var subPatches = [];
+		_VirtualDom_diffHelp(entry.z, vnode, subPatches, entry.r);
+		entry.r = yIndex;
+		entry.s.s = {
+			w: subPatches,
+			A: entry
+		};
+
+		return;
+	}
+
+	// this key has already been inserted or moved, a duplicate!
+	_VirtualDom_insertNode(changes, localPatches, key + _VirtualDom_POSTFIX, vnode, yIndex, inserts);
+}
+
+
+function _VirtualDom_removeNode(changes, localPatches, key, vnode, index)
+{
+	var entry = changes[key];
+
+	// never seen this key before
+	if (!entry)
+	{
+		var patch = _VirtualDom_pushPatch(localPatches, 9, index, undefined);
+
+		changes[key] = {
+			c: 1,
+			z: vnode,
+			r: index,
+			s: patch
+		};
+
+		return;
+	}
+
+	// this key was inserted earlier, a match!
+	if (entry.c === 0)
+	{
+		entry.c = 2;
+		var subPatches = [];
+		_VirtualDom_diffHelp(vnode, entry.z, subPatches, index);
+
+		_VirtualDom_pushPatch(localPatches, 9, index, {
+			w: subPatches,
+			A: entry
+		});
+
+		return;
+	}
+
+	// this key has already been removed or moved, a duplicate!
+	_VirtualDom_removeNode(changes, localPatches, key + _VirtualDom_POSTFIX, vnode, index);
+}
+
+
+
+// ADD DOM NODES
+//
+// Each DOM node has an "index" assigned in order of traversal. It is important
+// to minimize our crawl over the actual DOM, so these indexes (along with the
+// descendantsCount of virtual nodes) let us skip touching entire subtrees of
+// the DOM if we know there are no patches there.
+
+
+function _VirtualDom_addDomNodes(domNode, vNode, patches, eventNode)
+{
+	_VirtualDom_addDomNodesHelp(domNode, vNode, patches, 0, 0, vNode.b, eventNode);
+}
+
+
+// assumes `patches` is non-empty and indexes increase monotonically.
+function _VirtualDom_addDomNodesHelp(domNode, vNode, patches, i, low, high, eventNode)
+{
+	var patch = patches[i];
+	var index = patch.r;
+
+	while (index === low)
+	{
+		var patchType = patch.$;
+
+		if (patchType === 1)
+		{
+			_VirtualDom_addDomNodes(domNode, vNode.k, patch.s, eventNode);
+		}
+		else if (patchType === 8)
+		{
+			patch.t = domNode;
+			patch.u = eventNode;
+
+			var subPatches = patch.s.w;
+			if (subPatches.length > 0)
+			{
+				_VirtualDom_addDomNodesHelp(domNode, vNode, subPatches, 0, low, high, eventNode);
+			}
+		}
+		else if (patchType === 9)
+		{
+			patch.t = domNode;
+			patch.u = eventNode;
+
+			var data = patch.s;
+			if (data)
+			{
+				data.A.s = domNode;
+				var subPatches = data.w;
+				if (subPatches.length > 0)
+				{
+					_VirtualDom_addDomNodesHelp(domNode, vNode, subPatches, 0, low, high, eventNode);
+				}
+			}
+		}
+		else
+		{
+			patch.t = domNode;
+			patch.u = eventNode;
+		}
+
+		i++;
+
+		if (!(patch = patches[i]) || (index = patch.r) > high)
+		{
+			return i;
+		}
+	}
+
+	var tag = vNode.$;
+
+	if (tag === 4)
+	{
+		var subNode = vNode.k;
+
+		while (subNode.$ === 4)
+		{
+			subNode = subNode.k;
+		}
+
+		return _VirtualDom_addDomNodesHelp(domNode, subNode, patches, i, low + 1, high, domNode.elm_event_node_ref);
+	}
+
+	// tag must be 1 or 2 at this point
+
+	var vKids = vNode.e;
+	var childNodes = domNode.childNodes;
+	for (var j = 0; j < vKids.length; j++)
+	{
+		low++;
+		var vKid = tag === 1 ? vKids[j] : vKids[j].b;
+		var nextLow = low + (vKid.b || 0);
+		if (low <= index && index <= nextLow)
+		{
+			i = _VirtualDom_addDomNodesHelp(childNodes[j], vKid, patches, i, low, nextLow, eventNode);
+			if (!(patch = patches[i]) || (index = patch.r) > high)
+			{
+				return i;
+			}
+		}
+		low = nextLow;
+	}
+	return i;
+}
+
+
+
+// APPLY PATCHES
+
+
+function _VirtualDom_applyPatches(rootDomNode, oldVirtualNode, patches, eventNode)
+{
+	if (patches.length === 0)
+	{
+		return rootDomNode;
+	}
+
+	_VirtualDom_addDomNodes(rootDomNode, oldVirtualNode, patches, eventNode);
+	return _VirtualDom_applyPatchesHelp(rootDomNode, patches);
+}
+
+function _VirtualDom_applyPatchesHelp(rootDomNode, patches)
+{
+	for (var i = 0; i < patches.length; i++)
+	{
+		var patch = patches[i];
+		var localDomNode = patch.t
+		var newNode = _VirtualDom_applyPatch(localDomNode, patch);
+		if (localDomNode === rootDomNode)
+		{
+			rootDomNode = newNode;
+		}
+	}
+	return rootDomNode;
+}
+
+function _VirtualDom_applyPatch(domNode, patch)
+{
+	switch (patch.$)
+	{
+		case 0:
+			return _VirtualDom_applyPatchRedraw(domNode, patch.s, patch.u);
+
+		case 4:
+			_VirtualDom_applyFacts(domNode, patch.u, patch.s);
+			return domNode;
+
+		case 3:
+			domNode.replaceData(0, domNode.length, patch.s);
+			return domNode;
+
+		case 1:
+			return _VirtualDom_applyPatchesHelp(domNode, patch.s);
+
+		case 2:
+			if (domNode.elm_event_node_ref)
+			{
+				domNode.elm_event_node_ref.j = patch.s;
+			}
+			else
+			{
+				domNode.elm_event_node_ref = { j: patch.s, p: patch.u };
+			}
+			return domNode;
+
+		case 6:
+			var data = patch.s;
+			for (var i = 0; i < data.i; i++)
+			{
+				domNode.removeChild(domNode.childNodes[data.v]);
+			}
+			return domNode;
+
+		case 7:
+			var data = patch.s;
+			var kids = data.e;
+			var i = data.v;
+			var theEnd = domNode.childNodes[i];
+			for (; i < kids.length; i++)
+			{
+				domNode.insertBefore(_VirtualDom_render(kids[i], patch.u), theEnd);
+			}
+			return domNode;
+
+		case 9:
+			var data = patch.s;
+			if (!data)
+			{
+				domNode.parentNode.removeChild(domNode);
+				return domNode;
+			}
+			var entry = data.A;
+			if (typeof entry.r !== 'undefined')
+			{
+				domNode.parentNode.removeChild(domNode);
+			}
+			entry.s = _VirtualDom_applyPatchesHelp(domNode, data.w);
+			return domNode;
+
+		case 8:
+			return _VirtualDom_applyPatchReorder(domNode, patch);
+
+		case 5:
+			return patch.s(domNode);
+
+		default:
+			_Debug_crash(10); // 'Ran into an unknown patch!'
+	}
+}
+
+
+function _VirtualDom_applyPatchRedraw(domNode, vNode, eventNode)
+{
+	var parentNode = domNode.parentNode;
+	var newNode = _VirtualDom_render(vNode, eventNode);
+
+	if (!newNode.elm_event_node_ref)
+	{
+		newNode.elm_event_node_ref = domNode.elm_event_node_ref;
+	}
+
+	if (parentNode && newNode !== domNode)
+	{
+		parentNode.replaceChild(newNode, domNode);
+	}
+	return newNode;
+}
+
+
+function _VirtualDom_applyPatchReorder(domNode, patch)
+{
+	var data = patch.s;
+
+	// remove end inserts
+	var frag = _VirtualDom_applyPatchReorderEndInsertsHelp(data.y, patch);
+
+	// removals
+	domNode = _VirtualDom_applyPatchesHelp(domNode, data.w);
+
+	// inserts
+	var inserts = data.x;
+	for (var i = 0; i < inserts.length; i++)
+	{
+		var insert = inserts[i];
+		var entry = insert.A;
+		var node = entry.c === 2
+			? entry.s
+			: _VirtualDom_render(entry.z, patch.u);
+		domNode.insertBefore(node, domNode.childNodes[insert.r]);
+	}
+
+	// add end inserts
+	if (frag)
+	{
+		_VirtualDom_appendChild(domNode, frag);
+	}
+
+	return domNode;
+}
+
+
+function _VirtualDom_applyPatchReorderEndInsertsHelp(endInserts, patch)
+{
+	if (!endInserts)
+	{
+		return;
+	}
+
+	var frag = _VirtualDom_doc.createDocumentFragment();
+	for (var i = 0; i < endInserts.length; i++)
+	{
+		var insert = endInserts[i];
+		var entry = insert.A;
+		_VirtualDom_appendChild(frag, entry.c === 2
+			? entry.s
+			: _VirtualDom_render(entry.z, patch.u)
+		);
+	}
+	return frag;
+}
+
+
+function _VirtualDom_virtualize(node)
+{
+	// TEXT NODES
+
+	if (node.nodeType === 3)
+	{
+		return _VirtualDom_text(node.textContent);
+	}
+
+
+	// WEIRD NODES
+
+	if (node.nodeType !== 1)
+	{
+		return _VirtualDom_text('');
+	}
+
+
+	// ELEMENT NODES
+
+	var attrList = _List_Nil;
+	var attrs = node.attributes;
+	for (var i = attrs.length; i--; )
+	{
+		var attr = attrs[i];
+		var name = attr.name;
+		var value = attr.value;
+		attrList = _List_Cons( A2(_VirtualDom_attribute, name, value), attrList );
+	}
+
+	var tag = node.tagName.toLowerCase();
+	var kidList = _List_Nil;
+	var kids = node.childNodes;
+
+	for (var i = kids.length; i--; )
+	{
+		kidList = _List_Cons(_VirtualDom_virtualize(kids[i]), kidList);
+	}
+	return A3(_VirtualDom_node, tag, attrList, kidList);
+}
+
+function _VirtualDom_dekey(keyedNode)
+{
+	var keyedKids = keyedNode.e;
+	var len = keyedKids.length;
+	var kids = new Array(len);
+	for (var i = 0; i < len; i++)
+	{
+		kids[i] = keyedKids[i].b;
+	}
+
+	return {
+		$: 1,
+		c: keyedNode.c,
+		d: keyedNode.d,
+		e: kids,
+		f: keyedNode.f,
+		b: keyedNode.b
+	};
+}
+
+
+
+
+// ELEMENT
+
+
+var _Debugger_element;
+
+var _Browser_element = _Debugger_element || F4(function(impl, flagDecoder, debugMetadata, args)
+{
+	return _Platform_initialize(
+		flagDecoder,
+		args,
+		impl.init,
+		impl.update,
+		impl.subscriptions,
+		function(sendToApp, initialModel) {
+			var view = impl.view;
+			/**_UNUSED/
+			var domNode = args['node'];
+			//*/
+			/**/
+			var domNode = args && args['node'] ? args['node'] : _Debug_crash(0);
+			//*/
+			var currNode = _VirtualDom_virtualize(domNode);
+
+			return _Browser_makeAnimator(initialModel, function(model)
+			{
+				var nextNode = view(model);
+				var patches = _VirtualDom_diff(currNode, nextNode);
+				domNode = _VirtualDom_applyPatches(domNode, currNode, patches, sendToApp);
+				currNode = nextNode;
+			});
+		}
+	);
+});
+
+
+
+// DOCUMENT
+
+
+var _Debugger_document;
+
+var _Browser_document = _Debugger_document || F4(function(impl, flagDecoder, debugMetadata, args)
+{
+	return _Platform_initialize(
+		flagDecoder,
+		args,
+		impl.init,
+		impl.update,
+		impl.subscriptions,
+		function(sendToApp, initialModel) {
+			var divertHrefToApp = impl.setup && impl.setup(sendToApp)
+			var view = impl.view;
+			var title = _VirtualDom_doc.title;
+			var bodyNode = _VirtualDom_doc.body;
+			var currNode = _VirtualDom_virtualize(bodyNode);
+			return _Browser_makeAnimator(initialModel, function(model)
+			{
+				_VirtualDom_divertHrefToApp = divertHrefToApp;
+				var doc = view(model);
+				var nextNode = _VirtualDom_node('body')(_List_Nil)(doc.body);
+				var patches = _VirtualDom_diff(currNode, nextNode);
+				bodyNode = _VirtualDom_applyPatches(bodyNode, currNode, patches, sendToApp);
+				currNode = nextNode;
+				_VirtualDom_divertHrefToApp = 0;
+				(title !== doc.title) && (_VirtualDom_doc.title = title = doc.title);
+			});
+		}
+	);
+});
+
+
+
+// ANIMATION
+
+
+var _Browser_cancelAnimationFrame =
+	typeof cancelAnimationFrame !== 'undefined'
+		? cancelAnimationFrame
+		: function(id) { clearTimeout(id); };
+
+var _Browser_requestAnimationFrame =
+	typeof requestAnimationFrame !== 'undefined'
+		? requestAnimationFrame
+		: function(callback) { return setTimeout(callback, 1000 / 60); };
+
+
+function _Browser_makeAnimator(model, draw)
+{
+	draw(model);
+
+	var state = 0;
+
+	function updateIfNeeded()
+	{
+		state = state === 1
+			? 0
+			: ( _Browser_requestAnimationFrame(updateIfNeeded), draw(model), 1 );
+	}
+
+	return function(nextModel, isSync)
+	{
+		model = nextModel;
+
+		isSync
+			? ( draw(model),
+				state === 2 && (state = 1)
+				)
+			: ( state === 0 && _Browser_requestAnimationFrame(updateIfNeeded),
+				state = 2
+				);
+	};
+}
+
+
+
+// APPLICATION
+
+
+function _Browser_application(impl)
+{
+	var onUrlChange = impl.onUrlChange;
+	var onUrlRequest = impl.onUrlRequest;
+	var key = function() { key.a(onUrlChange(_Browser_getUrl())); };
+
+	return _Browser_document({
+		setup: function(sendToApp)
+		{
+			key.a = sendToApp;
+			_Browser_window.addEventListener('popstate', key);
+			_Browser_window.navigator.userAgent.indexOf('Trident') < 0 || _Browser_window.addEventListener('hashchange', key);
+
+			return F2(function(domNode, event)
+			{
+				if (!event.ctrlKey && !event.metaKey && !event.shiftKey && event.button < 1 && !domNode.target && !domNode.hasAttribute('download'))
+				{
+					event.preventDefault();
+					var href = domNode.href;
+					var curr = _Browser_getUrl();
+					var next = $elm$url$Url$fromString(href).a;
+					sendToApp(onUrlRequest(
+						(next
+							&& curr.protocol === next.protocol
+							&& curr.host === next.host
+							&& curr.port_.a === next.port_.a
+						)
+							? $elm$browser$Browser$Internal(next)
+							: $elm$browser$Browser$External(href)
+					));
+				}
+			});
+		},
+		init: function(flags)
+		{
+			return A3(impl.init, flags, _Browser_getUrl(), key);
+		},
+		view: impl.view,
+		update: impl.update,
+		subscriptions: impl.subscriptions
+	});
+}
+
+function _Browser_getUrl()
+{
+	return $elm$url$Url$fromString(_VirtualDom_doc.location.href).a || _Debug_crash(1);
+}
+
+var _Browser_go = F2(function(key, n)
+{
+	return A2($elm$core$Task$perform, $elm$core$Basics$never, _Scheduler_binding(function() {
+		n && history.go(n);
+		key();
+	}));
+});
+
+var _Browser_pushUrl = F2(function(key, url)
+{
+	return A2($elm$core$Task$perform, $elm$core$Basics$never, _Scheduler_binding(function() {
+		history.pushState({}, '', url);
+		key();
+	}));
+});
+
+var _Browser_replaceUrl = F2(function(key, url)
+{
+	return A2($elm$core$Task$perform, $elm$core$Basics$never, _Scheduler_binding(function() {
+		history.replaceState({}, '', url);
+		key();
+	}));
+});
+
+
+
+// GLOBAL EVENTS
+
+
+var _Browser_fakeNode = { addEventListener: function() {}, removeEventListener: function() {} };
+var _Browser_doc = typeof document !== 'undefined' ? document : _Browser_fakeNode;
+var _Browser_window = typeof window !== 'undefined' ? window : _Browser_fakeNode;
+
+var _Browser_on = F3(function(node, eventName, sendToSelf)
+{
+	return _Scheduler_spawn(_Scheduler_binding(function(callback)
+	{
+		function handler(event)	{ _Scheduler_rawSpawn(sendToSelf(event)); }
+		node.addEventListener(eventName, handler, _VirtualDom_passiveSupported && { passive: true });
+		return function() { node.removeEventListener(eventName, handler); };
+	}));
+});
+
+var _Browser_decodeEvent = F2(function(decoder, event)
+{
+	var result = _Json_runHelp(decoder, event);
+	return $elm$core$Result$isOk(result) ? $elm$core$Maybe$Just(result.a) : $elm$core$Maybe$Nothing;
+});
+
+
+
+// PAGE VISIBILITY
+
+
+function _Browser_visibilityInfo()
+{
+	return (typeof _VirtualDom_doc.hidden !== 'undefined')
+		? { hidden: 'hidden', change: 'visibilitychange' }
+		:
+	(typeof _VirtualDom_doc.mozHidden !== 'undefined')
+		? { hidden: 'mozHidden', change: 'mozvisibilitychange' }
+		:
+	(typeof _VirtualDom_doc.msHidden !== 'undefined')
+		? { hidden: 'msHidden', change: 'msvisibilitychange' }
+		:
+	(typeof _VirtualDom_doc.webkitHidden !== 'undefined')
+		? { hidden: 'webkitHidden', change: 'webkitvisibilitychange' }
+		: { hidden: 'hidden', change: 'visibilitychange' };
+}
+
+
+
+// ANIMATION FRAMES
+
+
+function _Browser_rAF()
+{
+	return _Scheduler_binding(function(callback)
+	{
+		var id = _Browser_requestAnimationFrame(function() {
+			callback(_Scheduler_succeed(Date.now()));
+		});
+
+		return function() {
+			_Browser_cancelAnimationFrame(id);
+		};
+	});
+}
+
+
+function _Browser_now()
+{
+	return _Scheduler_binding(function(callback)
+	{
+		callback(_Scheduler_succeed(Date.now()));
+	});
+}
+
+
+
+// DOM STUFF
+
+
+function _Browser_withNode(id, doStuff)
+{
+	return _Scheduler_binding(function(callback)
+	{
+		_Browser_requestAnimationFrame(function() {
+			var node = document.getElementById(id);
+			callback(node
+				? _Scheduler_succeed(doStuff(node))
+				: _Scheduler_fail($elm$browser$Browser$Dom$NotFound(id))
+			);
+		});
+	});
+}
+
+
+function _Browser_withWindow(doStuff)
+{
+	return _Scheduler_binding(function(callback)
+	{
+		_Browser_requestAnimationFrame(function() {
+			callback(_Scheduler_succeed(doStuff()));
+		});
+	});
+}
+
+
+// FOCUS and BLUR
+
+
+var _Browser_call = F2(function(functionName, id)
+{
+	return _Browser_withNode(id, function(node) {
+		node[functionName]();
+		return _Utils_Tuple0;
+	});
+});
+
+
+
+// WINDOW VIEWPORT
+
+
+function _Browser_getViewport()
+{
+	return {
+		scene: _Browser_getScene(),
+		viewport: {
+			x: _Browser_window.pageXOffset,
+			y: _Browser_window.pageYOffset,
+			width: _Browser_doc.documentElement.clientWidth,
+			height: _Browser_doc.documentElement.clientHeight
+		}
+	};
+}
+
+function _Browser_getScene()
+{
+	var body = _Browser_doc.body;
+	var elem = _Browser_doc.documentElement;
+	return {
+		width: Math.max(body.scrollWidth, body.offsetWidth, elem.scrollWidth, elem.offsetWidth, elem.clientWidth),
+		height: Math.max(body.scrollHeight, body.offsetHeight, elem.scrollHeight, elem.offsetHeight, elem.clientHeight)
+	};
+}
+
+var _Browser_setViewport = F2(function(x, y)
+{
+	return _Browser_withWindow(function()
+	{
+		_Browser_window.scroll(x, y);
+		return _Utils_Tuple0;
+	});
+});
+
+
+
+// ELEMENT VIEWPORT
+
+
+function _Browser_getViewportOf(id)
+{
+	return _Browser_withNode(id, function(node)
+	{
+		return {
+			scene: {
+				width: node.scrollWidth,
+				height: node.scrollHeight
+			},
+			viewport: {
+				x: node.scrollLeft,
+				y: node.scrollTop,
+				width: node.clientWidth,
+				height: node.clientHeight
+			}
+		};
+	});
+}
+
+
+var _Browser_setViewportOf = F3(function(id, x, y)
+{
+	return _Browser_withNode(id, function(node)
+	{
+		node.scrollLeft = x;
+		node.scrollTop = y;
+		return _Utils_Tuple0;
+	});
+});
+
+
+
+// ELEMENT
+
+
+function _Browser_getElement(id)
+{
+	return _Browser_withNode(id, function(node)
+	{
+		var rect = node.getBoundingClientRect();
+		var x = _Browser_window.pageXOffset;
+		var y = _Browser_window.pageYOffset;
+		return {
+			scene: _Browser_getScene(),
+			viewport: {
+				x: x,
+				y: y,
+				width: _Browser_doc.documentElement.clientWidth,
+				height: _Browser_doc.documentElement.clientHeight
+			},
+			element: {
+				x: x + rect.left,
+				y: y + rect.top,
+				width: rect.width,
+				height: rect.height
+			}
+		};
+	});
+}
+
+
+
+// LOAD and RELOAD
+
+
+function _Browser_reload(skipCache)
+{
+	return A2($elm$core$Task$perform, $elm$core$Basics$never, _Scheduler_binding(function(callback)
+	{
+		_VirtualDom_doc.location.reload(skipCache);
+	}));
+}
+
+function _Browser_load(url)
+{
+	return A2($elm$core$Task$perform, $elm$core$Basics$never, _Scheduler_binding(function(callback)
+	{
+		try
+		{
+			_Browser_window.location = url;
+		}
+		catch(err)
+		{
+			// Only Firefox can throw a NS_ERROR_MALFORMED_URI exception here.
+			// Other browsers reload the page, so let's be consistent about that.
+			_VirtualDom_doc.location.reload(false);
+		}
+	}));
+}
+
+
+function _Url_percentEncode(string)
+{
+	return encodeURIComponent(string);
+}
+
+function _Url_percentDecode(string)
+{
+	try
+	{
+		return $elm$core$Maybe$Just(decodeURIComponent(string));
+	}
+	catch (e)
+	{
+		return $elm$core$Maybe$Nothing;
+	}
+}
+
+
+var _Bitwise_and = F2(function(a, b)
+{
+	return a & b;
+});
+
+var _Bitwise_or = F2(function(a, b)
+{
+	return a | b;
+});
+
+var _Bitwise_xor = F2(function(a, b)
+{
+	return a ^ b;
+});
+
+function _Bitwise_complement(a)
+{
+	return ~a;
+};
+
+var _Bitwise_shiftLeftBy = F2(function(offset, a)
+{
+	return a << offset;
+});
+
+var _Bitwise_shiftRightBy = F2(function(offset, a)
+{
+	return a >> offset;
+});
+
+var _Bitwise_shiftRightZfBy = F2(function(offset, a)
+{
+	return a >>> offset;
+});
+var $author$project$Main$OnUrlChange = function (a) {
+	return {$: 'OnUrlChange', a: a};
+};
+var $author$project$Main$OnUrlRequest = function (a) {
+	return {$: 'OnUrlRequest', a: a};
+};
+var $elm$core$Basics$EQ = {$: 'EQ'};
+var $elm$core$Basics$GT = {$: 'GT'};
+var $elm$core$Basics$LT = {$: 'LT'};
+var $elm$core$List$cons = _List_cons;
+var $elm$core$Dict$foldr = F3(
+	function (func, acc, t) {
+		foldr:
+		while (true) {
+			if (t.$ === 'RBEmpty_elm_builtin') {
+				return acc;
+			} else {
+				var key = t.b;
+				var value = t.c;
+				var left = t.d;
+				var right = t.e;
+				var $temp$func = func,
+					$temp$acc = A3(
+					func,
+					key,
+					value,
+					A3($elm$core$Dict$foldr, func, acc, right)),
+					$temp$t = left;
+				func = $temp$func;
+				acc = $temp$acc;
+				t = $temp$t;
+				continue foldr;
+			}
+		}
+	});
+var $elm$core$Dict$toList = function (dict) {
+	return A3(
+		$elm$core$Dict$foldr,
+		F3(
+			function (key, value, list) {
+				return A2(
+					$elm$core$List$cons,
+					_Utils_Tuple2(key, value),
+					list);
+			}),
+		_List_Nil,
+		dict);
+};
+var $elm$core$Dict$keys = function (dict) {
+	return A3(
+		$elm$core$Dict$foldr,
+		F3(
+			function (key, value, keyList) {
+				return A2($elm$core$List$cons, key, keyList);
+			}),
+		_List_Nil,
+		dict);
+};
+var $elm$core$Set$toList = function (_v0) {
+	var dict = _v0.a;
+	return $elm$core$Dict$keys(dict);
+};
+var $elm$core$Elm$JsArray$foldr = _JsArray_foldr;
+var $elm$core$Array$foldr = F3(
+	function (func, baseCase, _v0) {
+		var tree = _v0.c;
+		var tail = _v0.d;
+		var helper = F2(
+			function (node, acc) {
+				if (node.$ === 'SubTree') {
+					var subTree = node.a;
+					return A3($elm$core$Elm$JsArray$foldr, helper, acc, subTree);
+				} else {
+					var values = node.a;
+					return A3($elm$core$Elm$JsArray$foldr, func, acc, values);
+				}
+			});
+		return A3(
+			$elm$core$Elm$JsArray$foldr,
+			helper,
+			A3($elm$core$Elm$JsArray$foldr, func, baseCase, tail),
+			tree);
+	});
+var $elm$core$Array$toList = function (array) {
+	return A3($elm$core$Array$foldr, $elm$core$List$cons, _List_Nil, array);
+};
+var $elm$core$Result$Err = function (a) {
+	return {$: 'Err', a: a};
+};
+var $elm$json$Json$Decode$Failure = F2(
+	function (a, b) {
+		return {$: 'Failure', a: a, b: b};
+	});
+var $elm$json$Json$Decode$Field = F2(
+	function (a, b) {
+		return {$: 'Field', a: a, b: b};
+	});
+var $elm$json$Json$Decode$Index = F2(
+	function (a, b) {
+		return {$: 'Index', a: a, b: b};
+	});
+var $elm$core$Result$Ok = function (a) {
+	return {$: 'Ok', a: a};
+};
+var $elm$json$Json$Decode$OneOf = function (a) {
+	return {$: 'OneOf', a: a};
+};
+var $elm$core$Basics$False = {$: 'False'};
+var $elm$core$Basics$add = _Basics_add;
+var $elm$core$Maybe$Just = function (a) {
+	return {$: 'Just', a: a};
+};
+var $elm$core$Maybe$Nothing = {$: 'Nothing'};
+var $elm$core$String$all = _String_all;
+var $elm$core$Basics$and = _Basics_and;
+var $elm$core$Basics$append = _Utils_append;
+var $elm$json$Json$Encode$encode = _Json_encode;
+var $elm$core$String$fromInt = _String_fromNumber;
+var $elm$core$String$join = F2(
+	function (sep, chunks) {
+		return A2(
+			_String_join,
+			sep,
+			_List_toArray(chunks));
+	});
+var $elm$core$String$split = F2(
+	function (sep, string) {
+		return _List_fromArray(
+			A2(_String_split, sep, string));
+	});
+var $elm$json$Json$Decode$indent = function (str) {
+	return A2(
+		$elm$core$String$join,
+		'\n    ',
+		A2($elm$core$String$split, '\n', str));
+};
+var $elm$core$List$foldl = F3(
+	function (func, acc, list) {
+		foldl:
+		while (true) {
+			if (!list.b) {
+				return acc;
+			} else {
+				var x = list.a;
+				var xs = list.b;
+				var $temp$func = func,
+					$temp$acc = A2(func, x, acc),
+					$temp$list = xs;
+				func = $temp$func;
+				acc = $temp$acc;
+				list = $temp$list;
+				continue foldl;
+			}
+		}
+	});
+var $elm$core$List$length = function (xs) {
+	return A3(
+		$elm$core$List$foldl,
+		F2(
+			function (_v0, i) {
+				return i + 1;
+			}),
+		0,
+		xs);
+};
+var $elm$core$List$map2 = _List_map2;
+var $elm$core$Basics$le = _Utils_le;
+var $elm$core$Basics$sub = _Basics_sub;
+var $elm$core$List$rangeHelp = F3(
+	function (lo, hi, list) {
+		rangeHelp:
+		while (true) {
+			if (_Utils_cmp(lo, hi) < 1) {
+				var $temp$lo = lo,
+					$temp$hi = hi - 1,
+					$temp$list = A2($elm$core$List$cons, hi, list);
+				lo = $temp$lo;
+				hi = $temp$hi;
+				list = $temp$list;
+				continue rangeHelp;
+			} else {
+				return list;
+			}
+		}
+	});
+var $elm$core$List$range = F2(
+	function (lo, hi) {
+		return A3($elm$core$List$rangeHelp, lo, hi, _List_Nil);
+	});
+var $elm$core$List$indexedMap = F2(
+	function (f, xs) {
+		return A3(
+			$elm$core$List$map2,
+			f,
+			A2(
+				$elm$core$List$range,
+				0,
+				$elm$core$List$length(xs) - 1),
+			xs);
+	});
+var $elm$core$Char$toCode = _Char_toCode;
+var $elm$core$Char$isLower = function (_char) {
+	var code = $elm$core$Char$toCode(_char);
+	return (97 <= code) && (code <= 122);
+};
+var $elm$core$Char$isUpper = function (_char) {
+	var code = $elm$core$Char$toCode(_char);
+	return (code <= 90) && (65 <= code);
+};
+var $elm$core$Basics$or = _Basics_or;
+var $elm$core$Char$isAlpha = function (_char) {
+	return $elm$core$Char$isLower(_char) || $elm$core$Char$isUpper(_char);
+};
+var $elm$core$Char$isDigit = function (_char) {
+	var code = $elm$core$Char$toCode(_char);
+	return (code <= 57) && (48 <= code);
+};
+var $elm$core$Char$isAlphaNum = function (_char) {
+	return $elm$core$Char$isLower(_char) || ($elm$core$Char$isUpper(_char) || $elm$core$Char$isDigit(_char));
+};
+var $elm$core$List$reverse = function (list) {
+	return A3($elm$core$List$foldl, $elm$core$List$cons, _List_Nil, list);
+};
+var $elm$core$String$uncons = _String_uncons;
+var $elm$json$Json$Decode$errorOneOf = F2(
+	function (i, error) {
+		return '\n\n(' + ($elm$core$String$fromInt(i + 1) + (') ' + $elm$json$Json$Decode$indent(
+			$elm$json$Json$Decode$errorToString(error))));
+	});
+var $elm$json$Json$Decode$errorToString = function (error) {
+	return A2($elm$json$Json$Decode$errorToStringHelp, error, _List_Nil);
+};
+var $elm$json$Json$Decode$errorToStringHelp = F2(
+	function (error, context) {
+		errorToStringHelp:
+		while (true) {
+			switch (error.$) {
+				case 'Field':
+					var f = error.a;
+					var err = error.b;
+					var isSimple = function () {
+						var _v1 = $elm$core$String$uncons(f);
+						if (_v1.$ === 'Nothing') {
+							return false;
+						} else {
+							var _v2 = _v1.a;
+							var _char = _v2.a;
+							var rest = _v2.b;
+							return $elm$core$Char$isAlpha(_char) && A2($elm$core$String$all, $elm$core$Char$isAlphaNum, rest);
+						}
+					}();
+					var fieldName = isSimple ? ('.' + f) : ('[\'' + (f + '\']'));
+					var $temp$error = err,
+						$temp$context = A2($elm$core$List$cons, fieldName, context);
+					error = $temp$error;
+					context = $temp$context;
+					continue errorToStringHelp;
+				case 'Index':
+					var i = error.a;
+					var err = error.b;
+					var indexName = '[' + ($elm$core$String$fromInt(i) + ']');
+					var $temp$error = err,
+						$temp$context = A2($elm$core$List$cons, indexName, context);
+					error = $temp$error;
+					context = $temp$context;
+					continue errorToStringHelp;
+				case 'OneOf':
+					var errors = error.a;
+					if (!errors.b) {
+						return 'Ran into a Json.Decode.oneOf with no possibilities' + function () {
+							if (!context.b) {
+								return '!';
+							} else {
+								return ' at json' + A2(
+									$elm$core$String$join,
+									'',
+									$elm$core$List$reverse(context));
+							}
+						}();
+					} else {
+						if (!errors.b.b) {
+							var err = errors.a;
+							var $temp$error = err,
+								$temp$context = context;
+							error = $temp$error;
+							context = $temp$context;
+							continue errorToStringHelp;
+						} else {
+							var starter = function () {
+								if (!context.b) {
+									return 'Json.Decode.oneOf';
+								} else {
+									return 'The Json.Decode.oneOf at json' + A2(
+										$elm$core$String$join,
+										'',
+										$elm$core$List$reverse(context));
+								}
+							}();
+							var introduction = starter + (' failed in the following ' + ($elm$core$String$fromInt(
+								$elm$core$List$length(errors)) + ' ways:'));
+							return A2(
+								$elm$core$String$join,
+								'\n\n',
+								A2(
+									$elm$core$List$cons,
+									introduction,
+									A2($elm$core$List$indexedMap, $elm$json$Json$Decode$errorOneOf, errors)));
+						}
+					}
+				default:
+					var msg = error.a;
+					var json = error.b;
+					var introduction = function () {
+						if (!context.b) {
+							return 'Problem with the given value:\n\n';
+						} else {
+							return 'Problem with the value at json' + (A2(
+								$elm$core$String$join,
+								'',
+								$elm$core$List$reverse(context)) + ':\n\n    ');
+						}
+					}();
+					return introduction + ($elm$json$Json$Decode$indent(
+						A2($elm$json$Json$Encode$encode, 4, json)) + ('\n\n' + msg));
+			}
+		}
+	});
+var $elm$core$Array$branchFactor = 32;
+var $elm$core$Array$Array_elm_builtin = F4(
+	function (a, b, c, d) {
+		return {$: 'Array_elm_builtin', a: a, b: b, c: c, d: d};
+	});
+var $elm$core$Elm$JsArray$empty = _JsArray_empty;
+var $elm$core$Basics$ceiling = _Basics_ceiling;
+var $elm$core$Basics$fdiv = _Basics_fdiv;
+var $elm$core$Basics$logBase = F2(
+	function (base, number) {
+		return _Basics_log(number) / _Basics_log(base);
+	});
+var $elm$core$Basics$toFloat = _Basics_toFloat;
+var $elm$core$Array$shiftStep = $elm$core$Basics$ceiling(
+	A2($elm$core$Basics$logBase, 2, $elm$core$Array$branchFactor));
+var $elm$core$Array$empty = A4($elm$core$Array$Array_elm_builtin, 0, $elm$core$Array$shiftStep, $elm$core$Elm$JsArray$empty, $elm$core$Elm$JsArray$empty);
+var $elm$core$Elm$JsArray$initialize = _JsArray_initialize;
+var $elm$core$Array$Leaf = function (a) {
+	return {$: 'Leaf', a: a};
+};
+var $elm$core$Basics$apL = F2(
+	function (f, x) {
+		return f(x);
+	});
+var $elm$core$Basics$apR = F2(
+	function (x, f) {
+		return f(x);
+	});
+var $elm$core$Basics$eq = _Utils_equal;
+var $elm$core$Basics$floor = _Basics_floor;
+var $elm$core$Elm$JsArray$length = _JsArray_length;
+var $elm$core$Basics$gt = _Utils_gt;
+var $elm$core$Basics$max = F2(
+	function (x, y) {
+		return (_Utils_cmp(x, y) > 0) ? x : y;
+	});
+var $elm$core$Basics$mul = _Basics_mul;
+var $elm$core$Array$SubTree = function (a) {
+	return {$: 'SubTree', a: a};
+};
+var $elm$core$Elm$JsArray$initializeFromList = _JsArray_initializeFromList;
+var $elm$core$Array$compressNodes = F2(
+	function (nodes, acc) {
+		compressNodes:
+		while (true) {
+			var _v0 = A2($elm$core$Elm$JsArray$initializeFromList, $elm$core$Array$branchFactor, nodes);
+			var node = _v0.a;
+			var remainingNodes = _v0.b;
+			var newAcc = A2(
+				$elm$core$List$cons,
+				$elm$core$Array$SubTree(node),
+				acc);
+			if (!remainingNodes.b) {
+				return $elm$core$List$reverse(newAcc);
+			} else {
+				var $temp$nodes = remainingNodes,
+					$temp$acc = newAcc;
+				nodes = $temp$nodes;
+				acc = $temp$acc;
+				continue compressNodes;
+			}
+		}
+	});
+var $elm$core$Tuple$first = function (_v0) {
+	var x = _v0.a;
+	return x;
+};
+var $elm$core$Array$treeFromBuilder = F2(
+	function (nodeList, nodeListSize) {
+		treeFromBuilder:
+		while (true) {
+			var newNodeSize = $elm$core$Basics$ceiling(nodeListSize / $elm$core$Array$branchFactor);
+			if (newNodeSize === 1) {
+				return A2($elm$core$Elm$JsArray$initializeFromList, $elm$core$Array$branchFactor, nodeList).a;
+			} else {
+				var $temp$nodeList = A2($elm$core$Array$compressNodes, nodeList, _List_Nil),
+					$temp$nodeListSize = newNodeSize;
+				nodeList = $temp$nodeList;
+				nodeListSize = $temp$nodeListSize;
+				continue treeFromBuilder;
+			}
+		}
+	});
+var $elm$core$Array$builderToArray = F2(
+	function (reverseNodeList, builder) {
+		if (!builder.nodeListSize) {
+			return A4(
+				$elm$core$Array$Array_elm_builtin,
+				$elm$core$Elm$JsArray$length(builder.tail),
+				$elm$core$Array$shiftStep,
+				$elm$core$Elm$JsArray$empty,
+				builder.tail);
+		} else {
+			var treeLen = builder.nodeListSize * $elm$core$Array$branchFactor;
+			var depth = $elm$core$Basics$floor(
+				A2($elm$core$Basics$logBase, $elm$core$Array$branchFactor, treeLen - 1));
+			var correctNodeList = reverseNodeList ? $elm$core$List$reverse(builder.nodeList) : builder.nodeList;
+			var tree = A2($elm$core$Array$treeFromBuilder, correctNodeList, builder.nodeListSize);
+			return A4(
+				$elm$core$Array$Array_elm_builtin,
+				$elm$core$Elm$JsArray$length(builder.tail) + treeLen,
+				A2($elm$core$Basics$max, 5, depth * $elm$core$Array$shiftStep),
+				tree,
+				builder.tail);
+		}
+	});
+var $elm$core$Basics$idiv = _Basics_idiv;
+var $elm$core$Basics$lt = _Utils_lt;
+var $elm$core$Array$initializeHelp = F5(
+	function (fn, fromIndex, len, nodeList, tail) {
+		initializeHelp:
+		while (true) {
+			if (fromIndex < 0) {
+				return A2(
+					$elm$core$Array$builderToArray,
+					false,
+					{nodeList: nodeList, nodeListSize: (len / $elm$core$Array$branchFactor) | 0, tail: tail});
+			} else {
+				var leaf = $elm$core$Array$Leaf(
+					A3($elm$core$Elm$JsArray$initialize, $elm$core$Array$branchFactor, fromIndex, fn));
+				var $temp$fn = fn,
+					$temp$fromIndex = fromIndex - $elm$core$Array$branchFactor,
+					$temp$len = len,
+					$temp$nodeList = A2($elm$core$List$cons, leaf, nodeList),
+					$temp$tail = tail;
+				fn = $temp$fn;
+				fromIndex = $temp$fromIndex;
+				len = $temp$len;
+				nodeList = $temp$nodeList;
+				tail = $temp$tail;
+				continue initializeHelp;
+			}
+		}
+	});
+var $elm$core$Basics$remainderBy = _Basics_remainderBy;
+var $elm$core$Array$initialize = F2(
+	function (len, fn) {
+		if (len <= 0) {
+			return $elm$core$Array$empty;
+		} else {
+			var tailLen = len % $elm$core$Array$branchFactor;
+			var tail = A3($elm$core$Elm$JsArray$initialize, tailLen, len - tailLen, fn);
+			var initialFromIndex = (len - tailLen) - $elm$core$Array$branchFactor;
+			return A5($elm$core$Array$initializeHelp, fn, initialFromIndex, len, _List_Nil, tail);
+		}
+	});
+var $elm$core$Basics$True = {$: 'True'};
+var $elm$core$Result$isOk = function (result) {
+	if (result.$ === 'Ok') {
+		return true;
+	} else {
+		return false;
+	}
+};
+var $elm$json$Json$Decode$map = _Json_map1;
+var $elm$json$Json$Decode$map2 = _Json_map2;
+var $elm$json$Json$Decode$succeed = _Json_succeed;
+var $elm$virtual_dom$VirtualDom$toHandlerInt = function (handler) {
+	switch (handler.$) {
+		case 'Normal':
+			return 0;
+		case 'MayStopPropagation':
+			return 1;
+		case 'MayPreventDefault':
+			return 2;
+		default:
+			return 3;
+	}
+};
+var $elm$browser$Browser$External = function (a) {
+	return {$: 'External', a: a};
+};
+var $elm$browser$Browser$Internal = function (a) {
+	return {$: 'Internal', a: a};
+};
+var $elm$core$Basics$identity = function (x) {
+	return x;
+};
+var $elm$browser$Browser$Dom$NotFound = function (a) {
+	return {$: 'NotFound', a: a};
+};
+var $elm$url$Url$Http = {$: 'Http'};
+var $elm$url$Url$Https = {$: 'Https'};
+var $elm$url$Url$Url = F6(
+	function (protocol, host, port_, path, query, fragment) {
+		return {fragment: fragment, host: host, path: path, port_: port_, protocol: protocol, query: query};
+	});
+var $elm$core$String$contains = _String_contains;
+var $elm$core$String$length = _String_length;
+var $elm$core$String$slice = _String_slice;
+var $elm$core$String$dropLeft = F2(
+	function (n, string) {
+		return (n < 1) ? string : A3(
+			$elm$core$String$slice,
+			n,
+			$elm$core$String$length(string),
+			string);
+	});
+var $elm$core$String$indexes = _String_indexes;
+var $elm$core$String$isEmpty = function (string) {
+	return string === '';
+};
+var $elm$core$String$left = F2(
+	function (n, string) {
+		return (n < 1) ? '' : A3($elm$core$String$slice, 0, n, string);
+	});
+var $elm$core$String$toInt = _String_toInt;
+var $elm$url$Url$chompBeforePath = F5(
+	function (protocol, path, params, frag, str) {
+		if ($elm$core$String$isEmpty(str) || A2($elm$core$String$contains, '@', str)) {
+			return $elm$core$Maybe$Nothing;
+		} else {
+			var _v0 = A2($elm$core$String$indexes, ':', str);
+			if (!_v0.b) {
+				return $elm$core$Maybe$Just(
+					A6($elm$url$Url$Url, protocol, str, $elm$core$Maybe$Nothing, path, params, frag));
+			} else {
+				if (!_v0.b.b) {
+					var i = _v0.a;
+					var _v1 = $elm$core$String$toInt(
+						A2($elm$core$String$dropLeft, i + 1, str));
+					if (_v1.$ === 'Nothing') {
+						return $elm$core$Maybe$Nothing;
+					} else {
+						var port_ = _v1;
+						return $elm$core$Maybe$Just(
+							A6(
+								$elm$url$Url$Url,
+								protocol,
+								A2($elm$core$String$left, i, str),
+								port_,
+								path,
+								params,
+								frag));
+					}
+				} else {
+					return $elm$core$Maybe$Nothing;
+				}
+			}
+		}
+	});
+var $elm$url$Url$chompBeforeQuery = F4(
+	function (protocol, params, frag, str) {
+		if ($elm$core$String$isEmpty(str)) {
+			return $elm$core$Maybe$Nothing;
+		} else {
+			var _v0 = A2($elm$core$String$indexes, '/', str);
+			if (!_v0.b) {
+				return A5($elm$url$Url$chompBeforePath, protocol, '/', params, frag, str);
+			} else {
+				var i = _v0.a;
+				return A5(
+					$elm$url$Url$chompBeforePath,
+					protocol,
+					A2($elm$core$String$dropLeft, i, str),
+					params,
+					frag,
+					A2($elm$core$String$left, i, str));
+			}
+		}
+	});
+var $elm$url$Url$chompBeforeFragment = F3(
+	function (protocol, frag, str) {
+		if ($elm$core$String$isEmpty(str)) {
+			return $elm$core$Maybe$Nothing;
+		} else {
+			var _v0 = A2($elm$core$String$indexes, '?', str);
+			if (!_v0.b) {
+				return A4($elm$url$Url$chompBeforeQuery, protocol, $elm$core$Maybe$Nothing, frag, str);
+			} else {
+				var i = _v0.a;
+				return A4(
+					$elm$url$Url$chompBeforeQuery,
+					protocol,
+					$elm$core$Maybe$Just(
+						A2($elm$core$String$dropLeft, i + 1, str)),
+					frag,
+					A2($elm$core$String$left, i, str));
+			}
+		}
+	});
+var $elm$url$Url$chompAfterProtocol = F2(
+	function (protocol, str) {
+		if ($elm$core$String$isEmpty(str)) {
+			return $elm$core$Maybe$Nothing;
+		} else {
+			var _v0 = A2($elm$core$String$indexes, '#', str);
+			if (!_v0.b) {
+				return A3($elm$url$Url$chompBeforeFragment, protocol, $elm$core$Maybe$Nothing, str);
+			} else {
+				var i = _v0.a;
+				return A3(
+					$elm$url$Url$chompBeforeFragment,
+					protocol,
+					$elm$core$Maybe$Just(
+						A2($elm$core$String$dropLeft, i + 1, str)),
+					A2($elm$core$String$left, i, str));
+			}
+		}
+	});
+var $elm$core$String$startsWith = _String_startsWith;
+var $elm$url$Url$fromString = function (str) {
+	return A2($elm$core$String$startsWith, 'http://', str) ? A2(
+		$elm$url$Url$chompAfterProtocol,
+		$elm$url$Url$Http,
+		A2($elm$core$String$dropLeft, 7, str)) : (A2($elm$core$String$startsWith, 'https://', str) ? A2(
+		$elm$url$Url$chompAfterProtocol,
+		$elm$url$Url$Https,
+		A2($elm$core$String$dropLeft, 8, str)) : $elm$core$Maybe$Nothing);
+};
+var $elm$core$Basics$never = function (_v0) {
+	never:
+	while (true) {
+		var nvr = _v0.a;
+		var $temp$_v0 = nvr;
+		_v0 = $temp$_v0;
+		continue never;
+	}
+};
+var $elm$core$Task$Perform = function (a) {
+	return {$: 'Perform', a: a};
+};
+var $elm$core$Task$succeed = _Scheduler_succeed;
+var $elm$core$Task$init = $elm$core$Task$succeed(_Utils_Tuple0);
+var $elm$core$List$foldrHelper = F4(
+	function (fn, acc, ctr, ls) {
+		if (!ls.b) {
+			return acc;
+		} else {
+			var a = ls.a;
+			var r1 = ls.b;
+			if (!r1.b) {
+				return A2(fn, a, acc);
+			} else {
+				var b = r1.a;
+				var r2 = r1.b;
+				if (!r2.b) {
+					return A2(
+						fn,
+						a,
+						A2(fn, b, acc));
+				} else {
+					var c = r2.a;
+					var r3 = r2.b;
+					if (!r3.b) {
+						return A2(
+							fn,
+							a,
+							A2(
+								fn,
+								b,
+								A2(fn, c, acc)));
+					} else {
+						var d = r3.a;
+						var r4 = r3.b;
+						var res = (ctr > 500) ? A3(
+							$elm$core$List$foldl,
+							fn,
+							acc,
+							$elm$core$List$reverse(r4)) : A4($elm$core$List$foldrHelper, fn, acc, ctr + 1, r4);
+						return A2(
+							fn,
+							a,
+							A2(
+								fn,
+								b,
+								A2(
+									fn,
+									c,
+									A2(fn, d, res))));
+					}
+				}
+			}
+		}
+	});
+var $elm$core$List$foldr = F3(
+	function (fn, acc, ls) {
+		return A4($elm$core$List$foldrHelper, fn, acc, 0, ls);
+	});
+var $elm$core$List$map = F2(
+	function (f, xs) {
+		return A3(
+			$elm$core$List$foldr,
+			F2(
+				function (x, acc) {
+					return A2(
+						$elm$core$List$cons,
+						f(x),
+						acc);
+				}),
+			_List_Nil,
+			xs);
+	});
+var $elm$core$Task$andThen = _Scheduler_andThen;
+var $elm$core$Task$map = F2(
+	function (func, taskA) {
+		return A2(
+			$elm$core$Task$andThen,
+			function (a) {
+				return $elm$core$Task$succeed(
+					func(a));
+			},
+			taskA);
+	});
+var $elm$core$Task$map2 = F3(
+	function (func, taskA, taskB) {
+		return A2(
+			$elm$core$Task$andThen,
+			function (a) {
+				return A2(
+					$elm$core$Task$andThen,
+					function (b) {
+						return $elm$core$Task$succeed(
+							A2(func, a, b));
+					},
+					taskB);
+			},
+			taskA);
+	});
+var $elm$core$Task$sequence = function (tasks) {
+	return A3(
+		$elm$core$List$foldr,
+		$elm$core$Task$map2($elm$core$List$cons),
+		$elm$core$Task$succeed(_List_Nil),
+		tasks);
+};
+var $elm$core$Platform$sendToApp = _Platform_sendToApp;
+var $elm$core$Task$spawnCmd = F2(
+	function (router, _v0) {
+		var task = _v0.a;
+		return _Scheduler_spawn(
+			A2(
+				$elm$core$Task$andThen,
+				$elm$core$Platform$sendToApp(router),
+				task));
+	});
+var $elm$core$Task$onEffects = F3(
+	function (router, commands, state) {
+		return A2(
+			$elm$core$Task$map,
+			function (_v0) {
+				return _Utils_Tuple0;
+			},
+			$elm$core$Task$sequence(
+				A2(
+					$elm$core$List$map,
+					$elm$core$Task$spawnCmd(router),
+					commands)));
+	});
+var $elm$core$Task$onSelfMsg = F3(
+	function (_v0, _v1, _v2) {
+		return $elm$core$Task$succeed(_Utils_Tuple0);
+	});
+var $elm$core$Task$cmdMap = F2(
+	function (tagger, _v0) {
+		var task = _v0.a;
+		return $elm$core$Task$Perform(
+			A2($elm$core$Task$map, tagger, task));
+	});
+_Platform_effectManagers['Task'] = _Platform_createManager($elm$core$Task$init, $elm$core$Task$onEffects, $elm$core$Task$onSelfMsg, $elm$core$Task$cmdMap);
+var $elm$core$Task$command = _Platform_leaf('Task');
+var $elm$core$Task$perform = F2(
+	function (toMessage, task) {
+		return $elm$core$Task$command(
+			$elm$core$Task$Perform(
+				A2($elm$core$Task$map, toMessage, task)));
+	});
+var $elm$browser$Browser$application = _Browser_application;
+var $elm$core$Platform$Cmd$batch = _Platform_batch;
+var $elm$core$Platform$Cmd$none = $elm$core$Platform$Cmd$batch(_List_Nil);
+var $author$project$Route$NotFound = {$: 'NotFound'};
+var $elm$url$Url$Parser$State = F5(
+	function (visited, unvisited, params, frag, value) {
+		return {frag: frag, params: params, unvisited: unvisited, value: value, visited: visited};
+	});
+var $elm$url$Url$Parser$getFirstMatch = function (states) {
+	getFirstMatch:
+	while (true) {
+		if (!states.b) {
+			return $elm$core$Maybe$Nothing;
+		} else {
+			var state = states.a;
+			var rest = states.b;
+			var _v1 = state.unvisited;
+			if (!_v1.b) {
+				return $elm$core$Maybe$Just(state.value);
+			} else {
+				if ((_v1.a === '') && (!_v1.b.b)) {
+					return $elm$core$Maybe$Just(state.value);
+				} else {
+					var $temp$states = rest;
+					states = $temp$states;
+					continue getFirstMatch;
+				}
+			}
+		}
+	}
+};
+var $elm$url$Url$Parser$removeFinalEmpty = function (segments) {
+	if (!segments.b) {
+		return _List_Nil;
+	} else {
+		if ((segments.a === '') && (!segments.b.b)) {
+			return _List_Nil;
+		} else {
+			var segment = segments.a;
+			var rest = segments.b;
+			return A2(
+				$elm$core$List$cons,
+				segment,
+				$elm$url$Url$Parser$removeFinalEmpty(rest));
+		}
+	}
+};
+var $elm$url$Url$Parser$preparePath = function (path) {
+	var _v0 = A2($elm$core$String$split, '/', path);
+	if (_v0.b && (_v0.a === '')) {
+		var segments = _v0.b;
+		return $elm$url$Url$Parser$removeFinalEmpty(segments);
+	} else {
+		var segments = _v0;
+		return $elm$url$Url$Parser$removeFinalEmpty(segments);
+	}
+};
+var $elm$url$Url$Parser$addToParametersHelp = F2(
+	function (value, maybeList) {
+		if (maybeList.$ === 'Nothing') {
+			return $elm$core$Maybe$Just(
+				_List_fromArray(
+					[value]));
+		} else {
+			var list = maybeList.a;
+			return $elm$core$Maybe$Just(
+				A2($elm$core$List$cons, value, list));
+		}
+	});
+var $elm$url$Url$percentDecode = _Url_percentDecode;
+var $elm$core$Basics$compare = _Utils_compare;
+var $elm$core$Dict$get = F2(
+	function (targetKey, dict) {
+		get:
+		while (true) {
+			if (dict.$ === 'RBEmpty_elm_builtin') {
+				return $elm$core$Maybe$Nothing;
+			} else {
+				var key = dict.b;
+				var value = dict.c;
+				var left = dict.d;
+				var right = dict.e;
+				var _v1 = A2($elm$core$Basics$compare, targetKey, key);
+				switch (_v1.$) {
+					case 'LT':
+						var $temp$targetKey = targetKey,
+							$temp$dict = left;
+						targetKey = $temp$targetKey;
+						dict = $temp$dict;
+						continue get;
+					case 'EQ':
+						return $elm$core$Maybe$Just(value);
+					default:
+						var $temp$targetKey = targetKey,
+							$temp$dict = right;
+						targetKey = $temp$targetKey;
+						dict = $temp$dict;
+						continue get;
+				}
+			}
+		}
+	});
+var $elm$core$Dict$Black = {$: 'Black'};
+var $elm$core$Dict$RBNode_elm_builtin = F5(
+	function (a, b, c, d, e) {
+		return {$: 'RBNode_elm_builtin', a: a, b: b, c: c, d: d, e: e};
+	});
+var $elm$core$Dict$RBEmpty_elm_builtin = {$: 'RBEmpty_elm_builtin'};
+var $elm$core$Dict$Red = {$: 'Red'};
+var $elm$core$Dict$balance = F5(
+	function (color, key, value, left, right) {
+		if ((right.$ === 'RBNode_elm_builtin') && (right.a.$ === 'Red')) {
+			var _v1 = right.a;
+			var rK = right.b;
+			var rV = right.c;
+			var rLeft = right.d;
+			var rRight = right.e;
+			if ((left.$ === 'RBNode_elm_builtin') && (left.a.$ === 'Red')) {
+				var _v3 = left.a;
+				var lK = left.b;
+				var lV = left.c;
+				var lLeft = left.d;
+				var lRight = left.e;
+				return A5(
+					$elm$core$Dict$RBNode_elm_builtin,
+					$elm$core$Dict$Red,
+					key,
+					value,
+					A5($elm$core$Dict$RBNode_elm_builtin, $elm$core$Dict$Black, lK, lV, lLeft, lRight),
+					A5($elm$core$Dict$RBNode_elm_builtin, $elm$core$Dict$Black, rK, rV, rLeft, rRight));
+			} else {
+				return A5(
+					$elm$core$Dict$RBNode_elm_builtin,
+					color,
+					rK,
+					rV,
+					A5($elm$core$Dict$RBNode_elm_builtin, $elm$core$Dict$Red, key, value, left, rLeft),
+					rRight);
+			}
+		} else {
+			if ((((left.$ === 'RBNode_elm_builtin') && (left.a.$ === 'Red')) && (left.d.$ === 'RBNode_elm_builtin')) && (left.d.a.$ === 'Red')) {
+				var _v5 = left.a;
+				var lK = left.b;
+				var lV = left.c;
+				var _v6 = left.d;
+				var _v7 = _v6.a;
+				var llK = _v6.b;
+				var llV = _v6.c;
+				var llLeft = _v6.d;
+				var llRight = _v6.e;
+				var lRight = left.e;
+				return A5(
+					$elm$core$Dict$RBNode_elm_builtin,
+					$elm$core$Dict$Red,
+					lK,
+					lV,
+					A5($elm$core$Dict$RBNode_elm_builtin, $elm$core$Dict$Black, llK, llV, llLeft, llRight),
+					A5($elm$core$Dict$RBNode_elm_builtin, $elm$core$Dict$Black, key, value, lRight, right));
+			} else {
+				return A5($elm$core$Dict$RBNode_elm_builtin, color, key, value, left, right);
+			}
+		}
+	});
+var $elm$core$Dict$insertHelp = F3(
+	function (key, value, dict) {
+		if (dict.$ === 'RBEmpty_elm_builtin') {
+			return A5($elm$core$Dict$RBNode_elm_builtin, $elm$core$Dict$Red, key, value, $elm$core$Dict$RBEmpty_elm_builtin, $elm$core$Dict$RBEmpty_elm_builtin);
+		} else {
+			var nColor = dict.a;
+			var nKey = dict.b;
+			var nValue = dict.c;
+			var nLeft = dict.d;
+			var nRight = dict.e;
+			var _v1 = A2($elm$core$Basics$compare, key, nKey);
+			switch (_v1.$) {
+				case 'LT':
+					return A5(
+						$elm$core$Dict$balance,
+						nColor,
+						nKey,
+						nValue,
+						A3($elm$core$Dict$insertHelp, key, value, nLeft),
+						nRight);
+				case 'EQ':
+					return A5($elm$core$Dict$RBNode_elm_builtin, nColor, nKey, value, nLeft, nRight);
+				default:
+					return A5(
+						$elm$core$Dict$balance,
+						nColor,
+						nKey,
+						nValue,
+						nLeft,
+						A3($elm$core$Dict$insertHelp, key, value, nRight));
+			}
+		}
+	});
+var $elm$core$Dict$insert = F3(
+	function (key, value, dict) {
+		var _v0 = A3($elm$core$Dict$insertHelp, key, value, dict);
+		if ((_v0.$ === 'RBNode_elm_builtin') && (_v0.a.$ === 'Red')) {
+			var _v1 = _v0.a;
+			var k = _v0.b;
+			var v = _v0.c;
+			var l = _v0.d;
+			var r = _v0.e;
+			return A5($elm$core$Dict$RBNode_elm_builtin, $elm$core$Dict$Black, k, v, l, r);
+		} else {
+			var x = _v0;
+			return x;
+		}
+	});
+var $elm$core$Dict$getMin = function (dict) {
+	getMin:
+	while (true) {
+		if ((dict.$ === 'RBNode_elm_builtin') && (dict.d.$ === 'RBNode_elm_builtin')) {
+			var left = dict.d;
+			var $temp$dict = left;
+			dict = $temp$dict;
+			continue getMin;
+		} else {
+			return dict;
+		}
+	}
+};
+var $elm$core$Dict$moveRedLeft = function (dict) {
+	if (((dict.$ === 'RBNode_elm_builtin') && (dict.d.$ === 'RBNode_elm_builtin')) && (dict.e.$ === 'RBNode_elm_builtin')) {
+		if ((dict.e.d.$ === 'RBNode_elm_builtin') && (dict.e.d.a.$ === 'Red')) {
+			var clr = dict.a;
+			var k = dict.b;
+			var v = dict.c;
+			var _v1 = dict.d;
+			var lClr = _v1.a;
+			var lK = _v1.b;
+			var lV = _v1.c;
+			var lLeft = _v1.d;
+			var lRight = _v1.e;
+			var _v2 = dict.e;
+			var rClr = _v2.a;
+			var rK = _v2.b;
+			var rV = _v2.c;
+			var rLeft = _v2.d;
+			var _v3 = rLeft.a;
+			var rlK = rLeft.b;
+			var rlV = rLeft.c;
+			var rlL = rLeft.d;
+			var rlR = rLeft.e;
+			var rRight = _v2.e;
+			return A5(
+				$elm$core$Dict$RBNode_elm_builtin,
+				$elm$core$Dict$Red,
+				rlK,
+				rlV,
+				A5(
+					$elm$core$Dict$RBNode_elm_builtin,
+					$elm$core$Dict$Black,
+					k,
+					v,
+					A5($elm$core$Dict$RBNode_elm_builtin, $elm$core$Dict$Red, lK, lV, lLeft, lRight),
+					rlL),
+				A5($elm$core$Dict$RBNode_elm_builtin, $elm$core$Dict$Black, rK, rV, rlR, rRight));
+		} else {
+			var clr = dict.a;
+			var k = dict.b;
+			var v = dict.c;
+			var _v4 = dict.d;
+			var lClr = _v4.a;
+			var lK = _v4.b;
+			var lV = _v4.c;
+			var lLeft = _v4.d;
+			var lRight = _v4.e;
+			var _v5 = dict.e;
+			var rClr = _v5.a;
+			var rK = _v5.b;
+			var rV = _v5.c;
+			var rLeft = _v5.d;
+			var rRight = _v5.e;
+			if (clr.$ === 'Black') {
+				return A5(
+					$elm$core$Dict$RBNode_elm_builtin,
+					$elm$core$Dict$Black,
+					k,
+					v,
+					A5($elm$core$Dict$RBNode_elm_builtin, $elm$core$Dict$Red, lK, lV, lLeft, lRight),
+					A5($elm$core$Dict$RBNode_elm_builtin, $elm$core$Dict$Red, rK, rV, rLeft, rRight));
+			} else {
+				return A5(
+					$elm$core$Dict$RBNode_elm_builtin,
+					$elm$core$Dict$Black,
+					k,
+					v,
+					A5($elm$core$Dict$RBNode_elm_builtin, $elm$core$Dict$Red, lK, lV, lLeft, lRight),
+					A5($elm$core$Dict$RBNode_elm_builtin, $elm$core$Dict$Red, rK, rV, rLeft, rRight));
+			}
+		}
+	} else {
+		return dict;
+	}
+};
+var $elm$core$Dict$moveRedRight = function (dict) {
+	if (((dict.$ === 'RBNode_elm_builtin') && (dict.d.$ === 'RBNode_elm_builtin')) && (dict.e.$ === 'RBNode_elm_builtin')) {
+		if ((dict.d.d.$ === 'RBNode_elm_builtin') && (dict.d.d.a.$ === 'Red')) {
+			var clr = dict.a;
+			var k = dict.b;
+			var v = dict.c;
+			var _v1 = dict.d;
+			var lClr = _v1.a;
+			var lK = _v1.b;
+			var lV = _v1.c;
+			var _v2 = _v1.d;
+			var _v3 = _v2.a;
+			var llK = _v2.b;
+			var llV = _v2.c;
+			var llLeft = _v2.d;
+			var llRight = _v2.e;
+			var lRight = _v1.e;
+			var _v4 = dict.e;
+			var rClr = _v4.a;
+			var rK = _v4.b;
+			var rV = _v4.c;
+			var rLeft = _v4.d;
+			var rRight = _v4.e;
+			return A5(
+				$elm$core$Dict$RBNode_elm_builtin,
+				$elm$core$Dict$Red,
+				lK,
+				lV,
+				A5($elm$core$Dict$RBNode_elm_builtin, $elm$core$Dict$Black, llK, llV, llLeft, llRight),
+				A5(
+					$elm$core$Dict$RBNode_elm_builtin,
+					$elm$core$Dict$Black,
+					k,
+					v,
+					lRight,
+					A5($elm$core$Dict$RBNode_elm_builtin, $elm$core$Dict$Red, rK, rV, rLeft, rRight)));
+		} else {
+			var clr = dict.a;
+			var k = dict.b;
+			var v = dict.c;
+			var _v5 = dict.d;
+			var lClr = _v5.a;
+			var lK = _v5.b;
+			var lV = _v5.c;
+			var lLeft = _v5.d;
+			var lRight = _v5.e;
+			var _v6 = dict.e;
+			var rClr = _v6.a;
+			var rK = _v6.b;
+			var rV = _v6.c;
+			var rLeft = _v6.d;
+			var rRight = _v6.e;
+			if (clr.$ === 'Black') {
+				return A5(
+					$elm$core$Dict$RBNode_elm_builtin,
+					$elm$core$Dict$Black,
+					k,
+					v,
+					A5($elm$core$Dict$RBNode_elm_builtin, $elm$core$Dict$Red, lK, lV, lLeft, lRight),
+					A5($elm$core$Dict$RBNode_elm_builtin, $elm$core$Dict$Red, rK, rV, rLeft, rRight));
+			} else {
+				return A5(
+					$elm$core$Dict$RBNode_elm_builtin,
+					$elm$core$Dict$Black,
+					k,
+					v,
+					A5($elm$core$Dict$RBNode_elm_builtin, $elm$core$Dict$Red, lK, lV, lLeft, lRight),
+					A5($elm$core$Dict$RBNode_elm_builtin, $elm$core$Dict$Red, rK, rV, rLeft, rRight));
+			}
+		}
+	} else {
+		return dict;
+	}
+};
+var $elm$core$Dict$removeHelpPrepEQGT = F7(
+	function (targetKey, dict, color, key, value, left, right) {
+		if ((left.$ === 'RBNode_elm_builtin') && (left.a.$ === 'Red')) {
+			var _v1 = left.a;
+			var lK = left.b;
+			var lV = left.c;
+			var lLeft = left.d;
+			var lRight = left.e;
+			return A5(
+				$elm$core$Dict$RBNode_elm_builtin,
+				color,
+				lK,
+				lV,
+				lLeft,
+				A5($elm$core$Dict$RBNode_elm_builtin, $elm$core$Dict$Red, key, value, lRight, right));
+		} else {
+			_v2$2:
+			while (true) {
+				if ((right.$ === 'RBNode_elm_builtin') && (right.a.$ === 'Black')) {
+					if (right.d.$ === 'RBNode_elm_builtin') {
+						if (right.d.a.$ === 'Black') {
+							var _v3 = right.a;
+							var _v4 = right.d;
+							var _v5 = _v4.a;
+							return $elm$core$Dict$moveRedRight(dict);
+						} else {
+							break _v2$2;
+						}
+					} else {
+						var _v6 = right.a;
+						var _v7 = right.d;
+						return $elm$core$Dict$moveRedRight(dict);
+					}
+				} else {
+					break _v2$2;
+				}
+			}
+			return dict;
+		}
+	});
+var $elm$core$Dict$removeMin = function (dict) {
+	if ((dict.$ === 'RBNode_elm_builtin') && (dict.d.$ === 'RBNode_elm_builtin')) {
+		var color = dict.a;
+		var key = dict.b;
+		var value = dict.c;
+		var left = dict.d;
+		var lColor = left.a;
+		var lLeft = left.d;
+		var right = dict.e;
+		if (lColor.$ === 'Black') {
+			if ((lLeft.$ === 'RBNode_elm_builtin') && (lLeft.a.$ === 'Red')) {
+				var _v3 = lLeft.a;
+				return A5(
+					$elm$core$Dict$RBNode_elm_builtin,
+					color,
+					key,
+					value,
+					$elm$core$Dict$removeMin(left),
+					right);
+			} else {
+				var _v4 = $elm$core$Dict$moveRedLeft(dict);
+				if (_v4.$ === 'RBNode_elm_builtin') {
+					var nColor = _v4.a;
+					var nKey = _v4.b;
+					var nValue = _v4.c;
+					var nLeft = _v4.d;
+					var nRight = _v4.e;
+					return A5(
+						$elm$core$Dict$balance,
+						nColor,
+						nKey,
+						nValue,
+						$elm$core$Dict$removeMin(nLeft),
+						nRight);
+				} else {
+					return $elm$core$Dict$RBEmpty_elm_builtin;
+				}
+			}
+		} else {
+			return A5(
+				$elm$core$Dict$RBNode_elm_builtin,
+				color,
+				key,
+				value,
+				$elm$core$Dict$removeMin(left),
+				right);
+		}
+	} else {
+		return $elm$core$Dict$RBEmpty_elm_builtin;
+	}
+};
+var $elm$core$Dict$removeHelp = F2(
+	function (targetKey, dict) {
+		if (dict.$ === 'RBEmpty_elm_builtin') {
+			return $elm$core$Dict$RBEmpty_elm_builtin;
+		} else {
+			var color = dict.a;
+			var key = dict.b;
+			var value = dict.c;
+			var left = dict.d;
+			var right = dict.e;
+			if (_Utils_cmp(targetKey, key) < 0) {
+				if ((left.$ === 'RBNode_elm_builtin') && (left.a.$ === 'Black')) {
+					var _v4 = left.a;
+					var lLeft = left.d;
+					if ((lLeft.$ === 'RBNode_elm_builtin') && (lLeft.a.$ === 'Red')) {
+						var _v6 = lLeft.a;
+						return A5(
+							$elm$core$Dict$RBNode_elm_builtin,
+							color,
+							key,
+							value,
+							A2($elm$core$Dict$removeHelp, targetKey, left),
+							right);
+					} else {
+						var _v7 = $elm$core$Dict$moveRedLeft(dict);
+						if (_v7.$ === 'RBNode_elm_builtin') {
+							var nColor = _v7.a;
+							var nKey = _v7.b;
+							var nValue = _v7.c;
+							var nLeft = _v7.d;
+							var nRight = _v7.e;
+							return A5(
+								$elm$core$Dict$balance,
+								nColor,
+								nKey,
+								nValue,
+								A2($elm$core$Dict$removeHelp, targetKey, nLeft),
+								nRight);
+						} else {
+							return $elm$core$Dict$RBEmpty_elm_builtin;
+						}
+					}
+				} else {
+					return A5(
+						$elm$core$Dict$RBNode_elm_builtin,
+						color,
+						key,
+						value,
+						A2($elm$core$Dict$removeHelp, targetKey, left),
+						right);
+				}
+			} else {
+				return A2(
+					$elm$core$Dict$removeHelpEQGT,
+					targetKey,
+					A7($elm$core$Dict$removeHelpPrepEQGT, targetKey, dict, color, key, value, left, right));
+			}
+		}
+	});
+var $elm$core$Dict$removeHelpEQGT = F2(
+	function (targetKey, dict) {
+		if (dict.$ === 'RBNode_elm_builtin') {
+			var color = dict.a;
+			var key = dict.b;
+			var value = dict.c;
+			var left = dict.d;
+			var right = dict.e;
+			if (_Utils_eq(targetKey, key)) {
+				var _v1 = $elm$core$Dict$getMin(right);
+				if (_v1.$ === 'RBNode_elm_builtin') {
+					var minKey = _v1.b;
+					var minValue = _v1.c;
+					return A5(
+						$elm$core$Dict$balance,
+						color,
+						minKey,
+						minValue,
+						left,
+						$elm$core$Dict$removeMin(right));
+				} else {
+					return $elm$core$Dict$RBEmpty_elm_builtin;
+				}
+			} else {
+				return A5(
+					$elm$core$Dict$balance,
+					color,
+					key,
+					value,
+					left,
+					A2($elm$core$Dict$removeHelp, targetKey, right));
+			}
+		} else {
+			return $elm$core$Dict$RBEmpty_elm_builtin;
+		}
+	});
+var $elm$core$Dict$remove = F2(
+	function (key, dict) {
+		var _v0 = A2($elm$core$Dict$removeHelp, key, dict);
+		if ((_v0.$ === 'RBNode_elm_builtin') && (_v0.a.$ === 'Red')) {
+			var _v1 = _v0.a;
+			var k = _v0.b;
+			var v = _v0.c;
+			var l = _v0.d;
+			var r = _v0.e;
+			return A5($elm$core$Dict$RBNode_elm_builtin, $elm$core$Dict$Black, k, v, l, r);
+		} else {
+			var x = _v0;
+			return x;
+		}
+	});
+var $elm$core$Dict$update = F3(
+	function (targetKey, alter, dictionary) {
+		var _v0 = alter(
+			A2($elm$core$Dict$get, targetKey, dictionary));
+		if (_v0.$ === 'Just') {
+			var value = _v0.a;
+			return A3($elm$core$Dict$insert, targetKey, value, dictionary);
+		} else {
+			return A2($elm$core$Dict$remove, targetKey, dictionary);
+		}
+	});
+var $elm$url$Url$Parser$addParam = F2(
+	function (segment, dict) {
+		var _v0 = A2($elm$core$String$split, '=', segment);
+		if ((_v0.b && _v0.b.b) && (!_v0.b.b.b)) {
+			var rawKey = _v0.a;
+			var _v1 = _v0.b;
+			var rawValue = _v1.a;
+			var _v2 = $elm$url$Url$percentDecode(rawKey);
+			if (_v2.$ === 'Nothing') {
+				return dict;
+			} else {
+				var key = _v2.a;
+				var _v3 = $elm$url$Url$percentDecode(rawValue);
+				if (_v3.$ === 'Nothing') {
+					return dict;
+				} else {
+					var value = _v3.a;
+					return A3(
+						$elm$core$Dict$update,
+						key,
+						$elm$url$Url$Parser$addToParametersHelp(value),
+						dict);
+				}
+			}
+		} else {
+			return dict;
+		}
+	});
+var $elm$core$Dict$empty = $elm$core$Dict$RBEmpty_elm_builtin;
+var $elm$url$Url$Parser$prepareQuery = function (maybeQuery) {
+	if (maybeQuery.$ === 'Nothing') {
+		return $elm$core$Dict$empty;
+	} else {
+		var qry = maybeQuery.a;
+		return A3(
+			$elm$core$List$foldr,
+			$elm$url$Url$Parser$addParam,
+			$elm$core$Dict$empty,
+			A2($elm$core$String$split, '&', qry));
+	}
+};
+var $elm$url$Url$Parser$parse = F2(
+	function (_v0, url) {
+		var parser = _v0.a;
+		return $elm$url$Url$Parser$getFirstMatch(
+			parser(
+				A5(
+					$elm$url$Url$Parser$State,
+					_List_Nil,
+					$elm$url$Url$Parser$preparePath(url.path),
+					$elm$url$Url$Parser$prepareQuery(url.query),
+					url.fragment,
+					$elm$core$Basics$identity)));
+	});
+var $author$project$Route$Home = {$: 'Home'};
+var $author$project$Route$ViewObject = function (a) {
+	return {$: 'ViewObject', a: a};
+};
+var $elm$url$Url$Parser$Parser = function (a) {
+	return {$: 'Parser', a: a};
+};
+var $elm$url$Url$Parser$mapState = F2(
+	function (func, _v0) {
+		var visited = _v0.visited;
+		var unvisited = _v0.unvisited;
+		var params = _v0.params;
+		var frag = _v0.frag;
+		var value = _v0.value;
+		return A5(
+			$elm$url$Url$Parser$State,
+			visited,
+			unvisited,
+			params,
+			frag,
+			func(value));
+	});
+var $elm$url$Url$Parser$map = F2(
+	function (subValue, _v0) {
+		var parseArg = _v0.a;
+		return $elm$url$Url$Parser$Parser(
+			function (_v1) {
+				var visited = _v1.visited;
+				var unvisited = _v1.unvisited;
+				var params = _v1.params;
+				var frag = _v1.frag;
+				var value = _v1.value;
+				return A2(
+					$elm$core$List$map,
+					$elm$url$Url$Parser$mapState(value),
+					parseArg(
+						A5($elm$url$Url$Parser$State, visited, unvisited, params, frag, subValue)));
+			});
+	});
+var $elm$core$List$append = F2(
+	function (xs, ys) {
+		if (!ys.b) {
+			return xs;
+		} else {
+			return A3($elm$core$List$foldr, $elm$core$List$cons, ys, xs);
+		}
+	});
+var $elm$core$List$concat = function (lists) {
+	return A3($elm$core$List$foldr, $elm$core$List$append, _List_Nil, lists);
+};
+var $elm$core$List$concatMap = F2(
+	function (f, list) {
+		return $elm$core$List$concat(
+			A2($elm$core$List$map, f, list));
+	});
+var $elm$url$Url$Parser$oneOf = function (parsers) {
+	return $elm$url$Url$Parser$Parser(
+		function (state) {
+			return A2(
+				$elm$core$List$concatMap,
+				function (_v0) {
+					var parser = _v0.a;
+					return parser(state);
+				},
+				parsers);
+		});
+};
+var $elm$url$Url$Parser$s = function (str) {
+	return $elm$url$Url$Parser$Parser(
+		function (_v0) {
+			var visited = _v0.visited;
+			var unvisited = _v0.unvisited;
+			var params = _v0.params;
+			var frag = _v0.frag;
+			var value = _v0.value;
+			if (!unvisited.b) {
+				return _List_Nil;
+			} else {
+				var next = unvisited.a;
+				var rest = unvisited.b;
+				return _Utils_eq(next, str) ? _List_fromArray(
+					[
+						A5(
+						$elm$url$Url$Parser$State,
+						A2($elm$core$List$cons, next, visited),
+						rest,
+						params,
+						frag,
+						value)
+					]) : _List_Nil;
+			}
+		});
+};
+var $elm$url$Url$Parser$slash = F2(
+	function (_v0, _v1) {
+		var parseBefore = _v0.a;
+		var parseAfter = _v1.a;
+		return $elm$url$Url$Parser$Parser(
+			function (state) {
+				return A2(
+					$elm$core$List$concatMap,
+					parseAfter,
+					parseBefore(state));
+			});
+	});
+var $elm$url$Url$Parser$custom = F2(
+	function (tipe, stringToSomething) {
+		return $elm$url$Url$Parser$Parser(
+			function (_v0) {
+				var visited = _v0.visited;
+				var unvisited = _v0.unvisited;
+				var params = _v0.params;
+				var frag = _v0.frag;
+				var value = _v0.value;
+				if (!unvisited.b) {
+					return _List_Nil;
+				} else {
+					var next = unvisited.a;
+					var rest = unvisited.b;
+					var _v2 = stringToSomething(next);
+					if (_v2.$ === 'Just') {
+						var nextValue = _v2.a;
+						return _List_fromArray(
+							[
+								A5(
+								$elm$url$Url$Parser$State,
+								A2($elm$core$List$cons, next, visited),
+								rest,
+								params,
+								frag,
+								value(nextValue))
+							]);
+					} else {
+						return _List_Nil;
+					}
+				}
+			});
+	});
+var $elm$url$Url$Parser$string = A2($elm$url$Url$Parser$custom, 'STRING', $elm$core$Maybe$Just);
+var $elm$url$Url$Parser$top = $elm$url$Url$Parser$Parser(
+	function (state) {
+		return _List_fromArray(
+			[state]);
+	});
+var $author$project$Route$routeParser = $elm$url$Url$Parser$oneOf(
+	_List_fromArray(
+		[
+			A2($elm$url$Url$Parser$map, $author$project$Route$Home, $elm$url$Url$Parser$top),
+			A2(
+			$elm$url$Url$Parser$map,
+			$author$project$Route$Home,
+			$elm$url$Url$Parser$s('home')),
+			A2(
+			$elm$url$Url$Parser$map,
+			$author$project$Route$Home,
+			$elm$url$Url$Parser$s('index')),
+			A2(
+			$elm$url$Url$Parser$map,
+			$author$project$Route$Home,
+			A2(
+				$elm$url$Url$Parser$slash,
+				$elm$url$Url$Parser$s('dev'),
+				$elm$url$Url$Parser$s('Main.elm'))),
+			A2(
+			$elm$url$Url$Parser$map,
+			$author$project$Route$ViewObject,
+			A2(
+				$elm$url$Url$Parser$slash,
+				$elm$url$Url$Parser$s('object'),
+				$elm$url$Url$Parser$string)),
+			A2(
+			$elm$url$Url$Parser$map,
+			$author$project$Route$ViewObject(''),
+			A2(
+				$elm$url$Url$Parser$slash,
+				$elm$url$Url$Parser$s('object'),
+				$elm$url$Url$Parser$top))
+		]));
+var $elm$core$Maybe$withDefault = F2(
+	function (_default, maybe) {
+		if (maybe.$ === 'Just') {
+			var value = maybe.a;
+			return value;
+		} else {
+			return _default;
+		}
+	});
+var $author$project$Route$toRoute = function (url) {
+	return A2(
+		$elm$core$Maybe$withDefault,
+		$author$project$Route$NotFound,
+		A2($elm$url$Url$Parser$parse, $author$project$Route$routeParser, url));
+};
+var $author$project$Main$init = F3(
+	function (_v0, url, key) {
+		return _Utils_Tuple2(
+			{
+				input: '',
+				key: key,
+				page: $author$project$Route$toRoute(url),
+				valid: $elm$core$Maybe$Nothing
+			},
+			$elm$core$Platform$Cmd$none);
+	});
+var $elm$core$Platform$Sub$batch = _Platform_batch;
+var $elm$core$Platform$Sub$none = $elm$core$Platform$Sub$batch(_List_Nil);
+var $author$project$Main$subscriptions = function (_v0) {
+	return $elm$core$Platform$Sub$none;
+};
+var $author$project$Main$OnScreenMoved = function (a) {
+	return {$: 'OnScreenMoved', a: a};
+};
+var $elm$core$Basics$always = F2(
+	function (a, _v0) {
+		return a;
+	});
+var $author$project$Internal$Tools$Hashdict$Hashdict = function (a) {
+	return {$: 'Hashdict', a: a};
+};
+var $author$project$Internal$Tools$Json$Coder = function (a) {
+	return {$: 'Coder', a: a};
+};
+var $author$project$Internal$Tools$Json$DocsRiskyMap = function (a) {
+	return {$: 'DocsRiskyMap', a: a};
+};
+var $elm$json$Json$Decode$andThen = _Json_andThen;
+var $elm$core$Basics$composeR = F3(
+	function (f, g, x) {
+		return g(
+			f(x));
+	});
+var $elm$json$Json$Decode$fail = _Json_fail;
+var $elm$core$Tuple$mapSecond = F2(
+	function (func, _v0) {
+		var x = _v0.a;
+		var y = _v0.b;
+		return _Utils_Tuple2(
+			x,
+			func(y));
+	});
+var $author$project$Internal$Tools$Json$andThen = F2(
+	function (_v0, _v1) {
+		var name = _v0.name;
+		var description = _v0.description;
+		var failure = _v0.failure;
+		var back = _v0.back;
+		var forth = _v0.forth;
+		var old = _v1.a;
+		return $author$project$Internal$Tools$Json$Coder(
+			{
+				decoder: A2(
+					$elm$json$Json$Decode$andThen,
+					function (result) {
+						var out = result.a;
+						var logs = result.b;
+						var _v3 = forth(out);
+						if (_v3.$ === 'Success') {
+							var x = _v3.a;
+							return $elm$json$Json$Decode$succeed(
+								A2(
+									$elm$core$Tuple$mapSecond,
+									$elm$core$List$append(logs),
+									x));
+						} else {
+							var _v4 = _v3.a;
+							var f = _v4.a;
+							return $elm$json$Json$Decode$fail(f);
+						}
+					},
+					old.decoder),
+				docs: $author$project$Internal$Tools$Json$DocsRiskyMap(
+					{content: old.docs, description: description, failure: failure, name: name}),
+				encoder: A2($elm$core$Basics$composeR, back, old.encoder)
+			});
+	});
+var $author$project$Internal$Config$Text$docs = {
+	context: {
+		description: _List_fromArray(
+			['The Context is the set of variables that the user (mostly) cannot control.', 'The Context contains tokens, values and other bits that the Vault receives from the Matrix API.']),
+		name: 'Context'
+	},
+	envelope: {
+		description: _List_fromArray(
+			['The Envelope module wraps existing data types with lots of values and settings that can be adjusted manually.']),
+		name: 'Envelope'
+	},
+	event: {
+		description: _List_fromArray(
+			['The Event type represents a single value that contains all the information for a single event in the room.']),
+		name: 'Event'
+	},
+	hashdict: {
+		description: _List_fromArray(
+			['This allows you to store values based on an externally defined identifier.', 'For example, the hashdict can store events and use their event id as their key.']),
+		name: 'Hashdict'
+	},
+	mashdict: {
+		description: _List_fromArray(
+			['The mashdict exclusively stores values for which the hashing algorithm returns a value, and it ignores the outcome for all other scenarios.']),
+		name: 'Mashdict'
+	},
+	settings: {
+		description: _List_fromArray(
+			['The settings type is a data type to configure settings in the enveloped data type.']),
+		name: 'Settings'
+	},
+	stateManager: {
+		description: _List_fromArray(
+			['The StateManager tracks the room state based on events, their event types and the optional state keys they provide.', 'Instead of making the user loop through the room\'s timeline of events, the StateManager offers the user a dictionary-like experience to navigate through the Matrix room state.']),
+		name: 'StateManager'
+	},
+	unsigned: {
+		description: _List_fromArray(
+			['Unsigned data is optional data that might come along with the event.', 'This information is often supportive but not necessary to the context.']),
+		name: 'Unsigned Data'
+	}
+};
+var $author$project$Internal$Tools$Json$Fail = function (a) {
+	return {$: 'Fail', a: a};
+};
+var $author$project$Internal$Tools$Json$fail = F2(
+	function (reason, logs) {
+		return $author$project$Internal$Tools$Json$Fail(
+			_Utils_Tuple2(reason, logs));
+	});
+var $author$project$Internal$Config$Text$failures = {
+	hashdict: _List_fromArray(
+		['Not all values map to thir respected hash with the given hash function.']),
+	mashdict: _List_fromArray(
+		['Not all values map to thir respected hash with the given hash function.'])
+};
+var $author$project$Internal$Tools$Json$DocsDict = function (a) {
+	return {$: 'DocsDict', a: a};
+};
+var $elm$core$Dict$foldl = F3(
+	function (func, acc, dict) {
+		foldl:
+		while (true) {
+			if (dict.$ === 'RBEmpty_elm_builtin') {
+				return acc;
+			} else {
+				var key = dict.b;
+				var value = dict.c;
+				var left = dict.d;
+				var right = dict.e;
+				var $temp$func = func,
+					$temp$acc = A3(
+					func,
+					key,
+					value,
+					A3($elm$core$Dict$foldl, func, acc, left)),
+					$temp$dict = right;
+				func = $temp$func;
+				acc = $temp$acc;
+				dict = $temp$dict;
+				continue foldl;
+			}
+		}
+	});
+var $elm$json$Json$Encode$dict = F3(
+	function (toKey, toValue, dictionary) {
+		return _Json_wrap(
+			A3(
+				$elm$core$Dict$foldl,
+				F3(
+					function (key, value, obj) {
+						return A3(
+							_Json_addField,
+							toKey(key),
+							toValue(value),
+							obj);
+					}),
+				_Json_emptyObject(_Utils_Tuple0),
+				dictionary));
+	});
+var $miniBill$elm_fast_dict$Internal$Dict = F2(
+	function (a, b) {
+		return {$: 'Dict', a: a, b: b};
+	});
+var $miniBill$elm_fast_dict$Internal$Leaf = {$: 'Leaf'};
+var $miniBill$elm_fast_dict$FastDict$empty = A2($miniBill$elm_fast_dict$Internal$Dict, 0, $miniBill$elm_fast_dict$Internal$Leaf);
+var $miniBill$elm_fast_dict$Internal$Black = {$: 'Black'};
+var $miniBill$elm_fast_dict$Internal$InnerNode = F5(
+	function (a, b, c, d, e) {
+		return {$: 'InnerNode', a: a, b: b, c: c, d: d, e: e};
+	});
+var $miniBill$elm_fast_dict$Internal$Red = {$: 'Red'};
+var $miniBill$elm_fast_dict$FastDict$balance = F5(
+	function (color, key, value, left, right) {
+		if ((right.$ === 'InnerNode') && (right.a.$ === 'Red')) {
+			var _v1 = right.a;
+			var rK = right.b;
+			var rV = right.c;
+			var rLeft = right.d;
+			var rRight = right.e;
+			if ((left.$ === 'InnerNode') && (left.a.$ === 'Red')) {
+				var _v3 = left.a;
+				var lK = left.b;
+				var lV = left.c;
+				var lLeft = left.d;
+				var lRight = left.e;
+				return A5(
+					$miniBill$elm_fast_dict$Internal$InnerNode,
+					$miniBill$elm_fast_dict$Internal$Red,
+					key,
+					value,
+					A5($miniBill$elm_fast_dict$Internal$InnerNode, $miniBill$elm_fast_dict$Internal$Black, lK, lV, lLeft, lRight),
+					A5($miniBill$elm_fast_dict$Internal$InnerNode, $miniBill$elm_fast_dict$Internal$Black, rK, rV, rLeft, rRight));
+			} else {
+				return A5(
+					$miniBill$elm_fast_dict$Internal$InnerNode,
+					color,
+					rK,
+					rV,
+					A5($miniBill$elm_fast_dict$Internal$InnerNode, $miniBill$elm_fast_dict$Internal$Red, key, value, left, rLeft),
+					rRight);
+			}
+		} else {
+			if ((((left.$ === 'InnerNode') && (left.a.$ === 'Red')) && (left.d.$ === 'InnerNode')) && (left.d.a.$ === 'Red')) {
+				var _v5 = left.a;
+				var lK = left.b;
+				var lV = left.c;
+				var _v6 = left.d;
+				var _v7 = _v6.a;
+				var llK = _v6.b;
+				var llV = _v6.c;
+				var llLeft = _v6.d;
+				var llRight = _v6.e;
+				var lRight = left.e;
+				return A5(
+					$miniBill$elm_fast_dict$Internal$InnerNode,
+					$miniBill$elm_fast_dict$Internal$Red,
+					lK,
+					lV,
+					A5($miniBill$elm_fast_dict$Internal$InnerNode, $miniBill$elm_fast_dict$Internal$Black, llK, llV, llLeft, llRight),
+					A5($miniBill$elm_fast_dict$Internal$InnerNode, $miniBill$elm_fast_dict$Internal$Black, key, value, lRight, right));
+			} else {
+				return A5($miniBill$elm_fast_dict$Internal$InnerNode, color, key, value, left, right);
+			}
+		}
+	});
+var $miniBill$elm_fast_dict$FastDict$insertHelp = F3(
+	function (key, value, dict) {
+		if (dict.$ === 'Leaf') {
+			return _Utils_Tuple2(
+				A5($miniBill$elm_fast_dict$Internal$InnerNode, $miniBill$elm_fast_dict$Internal$Red, key, value, $miniBill$elm_fast_dict$Internal$Leaf, $miniBill$elm_fast_dict$Internal$Leaf),
+				true);
+		} else {
+			var nColor = dict.a;
+			var nKey = dict.b;
+			var nValue = dict.c;
+			var nLeft = dict.d;
+			var nRight = dict.e;
+			var _v1 = A2($elm$core$Basics$compare, key, nKey);
+			switch (_v1.$) {
+				case 'LT':
+					var _v2 = A3($miniBill$elm_fast_dict$FastDict$insertHelp, key, value, nLeft);
+					var newLeft = _v2.a;
+					var isNew = _v2.b;
+					return _Utils_Tuple2(
+						A5($miniBill$elm_fast_dict$FastDict$balance, nColor, nKey, nValue, newLeft, nRight),
+						isNew);
+				case 'EQ':
+					return _Utils_Tuple2(
+						A5($miniBill$elm_fast_dict$Internal$InnerNode, nColor, nKey, value, nLeft, nRight),
+						false);
+				default:
+					var _v3 = A3($miniBill$elm_fast_dict$FastDict$insertHelp, key, value, nRight);
+					var newRight = _v3.a;
+					var isNew = _v3.b;
+					return _Utils_Tuple2(
+						A5($miniBill$elm_fast_dict$FastDict$balance, nColor, nKey, nValue, nLeft, newRight),
+						isNew);
+			}
+		}
+	});
+var $miniBill$elm_fast_dict$FastDict$insertInner = F3(
+	function (key, value, dict) {
+		var _v0 = A3($miniBill$elm_fast_dict$FastDict$insertHelp, key, value, dict);
+		if ((_v0.a.$ === 'InnerNode') && (_v0.a.a.$ === 'Red')) {
+			var _v1 = _v0.a;
+			var _v2 = _v1.a;
+			var k = _v1.b;
+			var v = _v1.c;
+			var l = _v1.d;
+			var r = _v1.e;
+			var isNew = _v0.b;
+			return _Utils_Tuple2(
+				A5($miniBill$elm_fast_dict$Internal$InnerNode, $miniBill$elm_fast_dict$Internal$Black, k, v, l, r),
+				isNew);
+		} else {
+			var x = _v0;
+			return x;
+		}
+	});
+var $miniBill$elm_fast_dict$FastDict$insert = F3(
+	function (key, value, _v0) {
+		var sz = _v0.a;
+		var dict = _v0.b;
+		var _v1 = A3($miniBill$elm_fast_dict$FastDict$insertInner, key, value, dict);
+		var result = _v1.a;
+		var isNew = _v1.b;
+		return isNew ? A2($miniBill$elm_fast_dict$Internal$Dict, sz + 1, result) : A2($miniBill$elm_fast_dict$Internal$Dict, sz, result);
+	});
+var $miniBill$elm_fast_dict$FastDict$fromList = function (assocs) {
+	return A3(
+		$elm$core$List$foldl,
+		F2(
+			function (_v0, dict) {
+				var key = _v0.a;
+				var value = _v0.b;
+				return A3($miniBill$elm_fast_dict$FastDict$insert, key, value, dict);
+			}),
+		$miniBill$elm_fast_dict$FastDict$empty,
+		assocs);
+};
+var $elm$json$Json$Decode$keyValuePairs = _Json_decodeKeyValuePairs;
+var $elm$core$Tuple$second = function (_v0) {
+	var y = _v0.b;
+	return y;
+};
+var $miniBill$elm_fast_dict$FastDict$foldlInner = F3(
+	function (func, acc, dict) {
+		foldlInner:
+		while (true) {
+			if (dict.$ === 'Leaf') {
+				return acc;
+			} else {
+				var key = dict.b;
+				var value = dict.c;
+				var left = dict.d;
+				var right = dict.e;
+				var $temp$func = func,
+					$temp$acc = A3(
+					func,
+					key,
+					value,
+					A3($miniBill$elm_fast_dict$FastDict$foldlInner, func, acc, left)),
+					$temp$dict = right;
+				func = $temp$func;
+				acc = $temp$acc;
+				dict = $temp$dict;
+				continue foldlInner;
+			}
+		}
+	});
+var $miniBill$elm_fast_dict$FastDict$foldl = F3(
+	function (func, acc, _v0) {
+		var dict = _v0.b;
+		return A3($miniBill$elm_fast_dict$FastDict$foldlInner, func, acc, dict);
+	});
+var $miniBill$elm_fast_dict$FastDict$toCoreDict = function (dict) {
+	return A3($miniBill$elm_fast_dict$FastDict$foldl, $elm$core$Dict$insert, $elm$core$Dict$empty, dict);
+};
+var $author$project$Internal$Tools$Json$fastDict = function (_v0) {
+	var old = _v0.a;
+	return $author$project$Internal$Tools$Json$Coder(
+		{
+			decoder: A2(
+				$elm$json$Json$Decode$map,
+				function (items) {
+					return _Utils_Tuple2(
+						$miniBill$elm_fast_dict$FastDict$fromList(
+							A2(
+								$elm$core$List$map,
+								$elm$core$Tuple$mapSecond($elm$core$Tuple$first),
+								items)),
+						A2(
+							$elm$core$List$concatMap,
+							$elm$core$Tuple$second,
+							A2($elm$core$List$map, $elm$core$Tuple$second, items)));
+				},
+				$elm$json$Json$Decode$keyValuePairs(old.decoder)),
+			docs: $author$project$Internal$Tools$Json$DocsDict(old.docs),
+			encoder: A2(
+				$elm$core$Basics$composeR,
+				$miniBill$elm_fast_dict$FastDict$toCoreDict,
+				A2($elm$json$Json$Encode$dict, $elm$core$Basics$identity, old.encoder))
+		});
+};
+var $elm$core$List$filter = F2(
+	function (isGood, list) {
+		return A3(
+			$elm$core$List$foldr,
+			F2(
+				function (x, xs) {
+					return isGood(x) ? A2($elm$core$List$cons, x, xs) : xs;
+				}),
+			_List_Nil,
+			list);
+	});
+var $author$project$Internal$Config$Text$invalidHashInHashdict = 'Invalid hash function: not all elements hash to their JSON-stored hashes';
+var $author$project$Internal$Config$Log$Log = F2(
+	function (channel, content) {
+		return {channel: channel, content: content};
+	});
+var $author$project$Internal$Config$Log$caughtError = 'caught-error';
+var $author$project$Internal$Config$Log$debug = 'debug';
+var $author$project$Internal$Config$Log$error = 'error';
+var $author$project$Internal$Config$Log$info = 'info';
+var $author$project$Internal$Config$Log$securityWarn = 'security-warn';
+var $author$project$Internal$Config$Log$warn = 'warn';
+var $author$project$Internal$Config$Log$log = {
+	caughtError: $author$project$Internal$Config$Log$Log($author$project$Internal$Config$Log$caughtError),
+	debug: $author$project$Internal$Config$Log$Log($author$project$Internal$Config$Log$debug),
+	error: $author$project$Internal$Config$Log$Log($author$project$Internal$Config$Log$error),
+	info: $author$project$Internal$Config$Log$Log($author$project$Internal$Config$Log$info),
+	securityWarn: $author$project$Internal$Config$Log$Log($author$project$Internal$Config$Log$securityWarn),
+	warn: $author$project$Internal$Config$Log$Log($author$project$Internal$Config$Log$warn)
+};
+var $elm$core$Basics$neq = _Utils_notEqual;
+var $author$project$Internal$Tools$Json$Success = function (a) {
+	return {$: 'Success', a: a};
+};
+var $author$project$Internal$Tools$Json$succeed = F2(
+	function (x, logs) {
+		return $author$project$Internal$Tools$Json$Success(
+			_Utils_Tuple2(x, logs));
+	});
+var $miniBill$elm_fast_dict$FastDict$foldrInner = F3(
+	function (func, acc, t) {
+		foldrInner:
+		while (true) {
+			if (t.$ === 'Leaf') {
+				return acc;
+			} else {
+				var key = t.b;
+				var value = t.c;
+				var left = t.d;
+				var right = t.e;
+				var $temp$func = func,
+					$temp$acc = A3(
+					func,
+					key,
+					value,
+					A3($miniBill$elm_fast_dict$FastDict$foldrInner, func, acc, right)),
+					$temp$t = left;
+				func = $temp$func;
+				acc = $temp$acc;
+				t = $temp$t;
+				continue foldrInner;
+			}
+		}
+	});
+var $miniBill$elm_fast_dict$FastDict$foldr = F3(
+	function (func, acc, _v0) {
+		var dict = _v0.b;
+		return A3($miniBill$elm_fast_dict$FastDict$foldrInner, func, acc, dict);
+	});
+var $miniBill$elm_fast_dict$FastDict$toList = function (dict) {
+	return A3(
+		$miniBill$elm_fast_dict$FastDict$foldr,
+		F3(
+			function (key, value, list) {
+				return A2(
+					$elm$core$List$cons,
+					_Utils_Tuple2(key, value),
+					list);
+			}),
+		_List_Nil,
+		dict);
+};
+var $author$project$Internal$Tools$Hashdict$coder = F2(
+	function (f, c1) {
+		return A2(
+			$author$project$Internal$Tools$Json$andThen,
+			{
+				back: function (_v0) {
+					var h = _v0.a;
+					return h.values;
+				},
+				description: $author$project$Internal$Config$Text$docs.hashdict.description,
+				failure: $author$project$Internal$Config$Text$failures.hashdict,
+				forth: function (items) {
+					var _v1 = A2(
+						$elm$core$List$filter,
+						function (_v2) {
+							var k = _v2.a;
+							var v = _v2.b;
+							return !_Utils_eq(
+								f(v),
+								k);
+						},
+						$miniBill$elm_fast_dict$FastDict$toList(items));
+					if (!_v1.b) {
+						return A3(
+							$elm$core$Basics$apR,
+							$author$project$Internal$Tools$Hashdict$Hashdict(
+								{hash: f, values: items}),
+							$author$project$Internal$Tools$Json$succeed,
+							_List_Nil);
+					} else {
+						var wrongHashes = _v1;
+						return A2(
+							$author$project$Internal$Tools$Json$fail,
+							$author$project$Internal$Config$Text$invalidHashInHashdict,
+							A2(
+								$elm$core$List$map,
+								$author$project$Internal$Config$Log$log.error,
+								A2(
+									$elm$core$List$map,
+									$elm$core$Basics$append('Invalid hash'),
+									A2($elm$core$List$map, $elm$core$Tuple$first, wrongHashes))));
+					}
+				},
+				name: $author$project$Internal$Config$Text$docs.hashdict.name
+			},
+			$author$project$Internal$Tools$Json$fastDict(c1));
+	});
+var $author$project$Internal$Tools$Mashdict$Mashdict = function (a) {
+	return {$: 'Mashdict', a: a};
+};
+var $author$project$Internal$Config$Text$invalidHashInMashdict = 'Invalid hash function: not all elements hash to their JSON-stored hashes';
+var $author$project$Internal$Tools$Mashdict$coder = F2(
+	function (f, c1) {
+		return A2(
+			$author$project$Internal$Tools$Json$andThen,
+			{
+				back: function (_v0) {
+					var h = _v0.a;
+					return h.values;
+				},
+				description: $author$project$Internal$Config$Text$docs.mashdict.description,
+				failure: $author$project$Internal$Config$Text$failures.mashdict,
+				forth: function (items) {
+					var _v1 = A2(
+						$elm$core$List$filter,
+						function (_v2) {
+							var k = _v2.a;
+							var v = _v2.b;
+							return !_Utils_eq(
+								f(v),
+								$elm$core$Maybe$Just(k));
+						},
+						$miniBill$elm_fast_dict$FastDict$toList(items));
+					if (!_v1.b) {
+						return A3(
+							$elm$core$Basics$apR,
+							$author$project$Internal$Tools$Mashdict$Mashdict(
+								{hash: f, values: items}),
+							$author$project$Internal$Tools$Json$succeed,
+							_List_Nil);
+					} else {
+						var wrongHashes = _v1;
+						return A2(
+							$author$project$Internal$Tools$Json$fail,
+							$author$project$Internal$Config$Text$invalidHashInMashdict,
+							A2(
+								$elm$core$List$map,
+								$author$project$Internal$Config$Log$log.error,
+								A2(
+									$elm$core$List$map,
+									$elm$core$Basics$append('Invalid hash'),
+									A2($elm$core$List$map, $elm$core$Tuple$first, wrongHashes))));
+					}
+				},
+				name: $author$project$Internal$Config$Text$docs.mashdict.name
+			},
+			$author$project$Internal$Tools$Json$fastDict(c1));
+	});
+var $author$project$Internal$Tools$Json$DocsInt = {$: 'DocsInt'};
+var $author$project$Internal$Tools$Json$empty = function (x) {
+	return _Utils_Tuple2(x, _List_Nil);
+};
+var $elm$json$Json$Decode$int = _Json_decodeInt;
+var $elm$json$Json$Encode$int = _Json_wrap;
+var $author$project$Internal$Tools$Json$int = $author$project$Internal$Tools$Json$Coder(
+	{
+		decoder: A2($elm$json$Json$Decode$map, $author$project$Internal$Tools$Json$empty, $elm$json$Json$Decode$int),
+		docs: $author$project$Internal$Tools$Json$DocsInt,
+		encoder: $elm$json$Json$Encode$int
+	});
+var $author$project$Internal$Tools$Json$DocsMap = function (a) {
+	return {$: 'DocsMap', a: a};
+};
+var $elm$core$Tuple$mapFirst = F2(
+	function (func, _v0) {
+		var x = _v0.a;
+		var y = _v0.b;
+		return _Utils_Tuple2(
+			func(x),
+			y);
+	});
+var $author$project$Internal$Tools$Json$map = F2(
+	function (_v0, _v1) {
+		var name = _v0.name;
+		var description = _v0.description;
+		var back = _v0.back;
+		var forth = _v0.forth;
+		var old = _v1.a;
+		return $author$project$Internal$Tools$Json$Coder(
+			{
+				decoder: A2(
+					$elm$json$Json$Decode$map,
+					$elm$core$Tuple$mapFirst(forth),
+					old.decoder),
+				docs: $author$project$Internal$Tools$Json$DocsMap(
+					{content: old.docs, description: description, name: name}),
+				encoder: A2($elm$core$Basics$composeR, back, old.encoder)
+			});
+	});
+var $elm$time$Time$Posix = function (a) {
+	return {$: 'Posix', a: a};
+};
+var $elm$time$Time$millisToPosix = $elm$time$Time$Posix;
+var $elm$time$Time$posixToMillis = function (_v0) {
+	var millis = _v0.a;
+	return millis;
+};
+var $author$project$Internal$Tools$Timestamp$coder = A2(
+	$author$project$Internal$Tools$Json$map,
+	{
+		back: $elm$time$Time$posixToMillis,
+		description: _List_fromArray(
+			['Converts the timestamp from milliseconds to a POSIX timestamp.']),
+		forth: $elm$time$Time$millisToPosix,
+		name: 'Milliseconds to POSIX'
+	},
+	$author$project$Internal$Tools$Json$int);
+var $author$project$Internal$Values$Context$Context = F7(
+	function (accessToken, baseUrl, password, refreshToken, username, transaction, versions) {
+		return {accessToken: accessToken, baseUrl: baseUrl, password: password, refreshToken: refreshToken, transaction: transaction, username: username, versions: versions};
+	});
+var $author$project$Internal$Tools$Json$Field = function (a) {
+	return {$: 'Field', a: a};
+};
+var $author$project$Internal$Tools$Json$OptionalField = {$: 'OptionalField'};
+var $author$project$Internal$Tools$Json$OptionalFieldWithDefault = function (a) {
+	return {$: 'OptionalFieldWithDefault', a: a};
+};
+var $author$project$Internal$Tools$Json$RequiredField = {$: 'RequiredField'};
+var $elm$json$Json$Decode$field = _Json_decodeField;
+var $elm$core$Maybe$map = F2(
+	function (f, maybe) {
+		if (maybe.$ === 'Just') {
+			var value = maybe.a;
+			return $elm$core$Maybe$Just(
+				f(value));
+		} else {
+			return $elm$core$Maybe$Nothing;
+		}
+	});
+var $elm$json$Json$Decode$oneOf = _Json_oneOf;
+var $elm$json$Json$Decode$maybe = function (decoder) {
+	return $elm$json$Json$Decode$oneOf(
+		_List_fromArray(
+			[
+				A2($elm$json$Json$Decode$map, $elm$core$Maybe$Just, decoder),
+				$elm$json$Json$Decode$succeed($elm$core$Maybe$Nothing)
+			]));
+};
+var $elm$json$Json$Decode$null = _Json_decodeNull;
+var $elm$json$Json$Decode$value = _Json_decodeValue;
+var $author$project$Internal$Tools$DecodeExtra$opField = F2(
+	function (fieldName, decoder) {
+		return A2(
+			$elm$json$Json$Decode$andThen,
+			function (v) {
+				if (v.$ === 'Just') {
+					return A2(
+						$elm$json$Json$Decode$field,
+						fieldName,
+						$elm$json$Json$Decode$oneOf(
+							_List_fromArray(
+								[
+									$elm$json$Json$Decode$null($elm$core$Maybe$Nothing),
+									A2($elm$json$Json$Decode$map, $elm$core$Maybe$Just, decoder)
+								])));
+				} else {
+					return $elm$json$Json$Decode$succeed($elm$core$Maybe$Nothing);
+				}
+			},
+			$elm$json$Json$Decode$maybe(
+				A2($elm$json$Json$Decode$field, fieldName, $elm$json$Json$Decode$value)));
+	});
+var $author$project$Internal$Tools$DecodeExtra$opFieldWithDefault = F3(
+	function (fieldName, _default, decoder) {
+		return A2(
+			$elm$json$Json$Decode$map,
+			$elm$core$Maybe$withDefault(_default),
+			A2($author$project$Internal$Tools$DecodeExtra$opField, fieldName, decoder));
+	});
+var $author$project$Internal$Tools$Json$field = {
+	optional: {
+		value: function (_v0) {
+			var fieldName = _v0.fieldName;
+			var toField = _v0.toField;
+			var description = _v0.description;
+			var coder = _v0.coder;
+			var encoder = coder.a.encoder;
+			var decoder = coder.a.decoder;
+			var docs = coder.a.docs;
+			return $author$project$Internal$Tools$Json$Field(
+				{
+					decoder: A2(
+						$elm$json$Json$Decode$map,
+						function (out) {
+							if (out.$ === 'Just') {
+								var _v3 = out.a;
+								var v = _v3.a;
+								var l = _v3.b;
+								return _Utils_Tuple2(
+									$elm$core$Maybe$Just(v),
+									l);
+							} else {
+								return _Utils_Tuple2($elm$core$Maybe$Nothing, _List_Nil);
+							}
+						},
+						A2($author$project$Internal$Tools$DecodeExtra$opField, fieldName, decoder)),
+					description: description,
+					docs: docs,
+					encoder: $elm$core$Maybe$map(encoder),
+					fieldName: fieldName,
+					requiredness: $author$project$Internal$Tools$Json$OptionalField,
+					toField: toField
+				});
+		},
+		withDefault: function (_v4) {
+			var fieldName = _v4.fieldName;
+			var toField = _v4.toField;
+			var description = _v4.description;
+			var coder = _v4.coder;
+			var _default = _v4._default;
+			var defaultToString = _v4.defaultToString;
+			var encoder = coder.a.encoder;
+			var decoder = coder.a.decoder;
+			var docs = coder.a.docs;
+			return $author$project$Internal$Tools$Json$Field(
+				{
+					decoder: A3($author$project$Internal$Tools$DecodeExtra$opFieldWithDefault, fieldName, _default, decoder),
+					description: description,
+					docs: docs,
+					encoder: function (o) {
+						return _Utils_eq(o, _default.a) ? $elm$core$Maybe$Nothing : $elm$core$Maybe$Just(
+							encoder(o));
+					},
+					fieldName: fieldName,
+					requiredness: $author$project$Internal$Tools$Json$OptionalFieldWithDefault(
+						defaultToString(_default.a)),
+					toField: toField
+				});
+		}
+	},
+	required: function (_v6) {
+		var fieldName = _v6.fieldName;
+		var toField = _v6.toField;
+		var description = _v6.description;
+		var coder = _v6.coder;
+		var encoder = coder.a.encoder;
+		var decoder = coder.a.decoder;
+		var docs = coder.a.docs;
+		return $author$project$Internal$Tools$Json$Field(
+			{
+				decoder: A2($elm$json$Json$Decode$field, fieldName, decoder),
+				description: description,
+				docs: docs,
+				encoder: A2($elm$core$Basics$composeR, encoder, $elm$core$Maybe$Just),
+				fieldName: fieldName,
+				requiredness: $author$project$Internal$Tools$Json$RequiredField,
+				toField: toField
+			});
+	}
+};
+var $author$project$Internal$Config$Text$fields = {
+	context: {accessToken: _List_Nil, baseUrl: _List_Nil, password: _List_Nil, refreshToken: _List_Nil, transaction: _List_Nil, username: _List_Nil, versions: _List_Nil},
+	envelope: {content: _List_Nil, context: _List_Nil, settings: _List_Nil},
+	event: {content: _List_Nil, eventId: _List_Nil, eventType: _List_Nil, originServerTs: _List_Nil, roomId: _List_Nil, sender: _List_Nil, stateKey: _List_Nil, unsigned: _List_Nil},
+	settings: {currentVersion: _List_Nil, deviceName: _List_Nil, syncTime: _List_Nil},
+	unsigned: {age: _List_Nil, prevContent: _List_Nil, redactedBecause: _List_Nil, transactionId: _List_Nil}
+};
+var $author$project$Internal$Tools$Json$DocsList = function (a) {
+	return {$: 'DocsList', a: a};
+};
+var $elm$json$Json$Decode$list = _Json_decodeList;
+var $elm$json$Json$Encode$list = F2(
+	function (func, entries) {
+		return _Json_wrap(
+			A3(
+				$elm$core$List$foldl,
+				_Json_addEntry(func),
+				_Json_emptyArray(_Utils_Tuple0),
+				entries));
+	});
+var $author$project$Internal$Tools$Json$list = function (_v0) {
+	var old = _v0.a;
+	return $author$project$Internal$Tools$Json$Coder(
+		{
+			decoder: A2(
+				$elm$json$Json$Decode$map,
+				function (items) {
+					return _Utils_Tuple2(
+						A2($elm$core$List$map, $elm$core$Tuple$first, items),
+						A2($elm$core$List$concatMap, $elm$core$Tuple$second, items));
+				},
+				$elm$json$Json$Decode$list(old.decoder)),
+			docs: $author$project$Internal$Tools$Json$DocsList(old.docs),
+			encoder: $elm$json$Json$Encode$list(old.encoder)
+		});
+};
+var $author$project$Internal$Tools$Json$DocsObject = function (a) {
+	return {$: 'DocsObject', a: a};
+};
+var $elm$json$Json$Decode$map7 = _Json_map7;
+var $elm$core$List$maybeCons = F3(
+	function (f, mx, xs) {
+		var _v0 = f(mx);
+		if (_v0.$ === 'Just') {
+			var x = _v0.a;
+			return A2($elm$core$List$cons, x, xs);
+		} else {
+			return xs;
+		}
+	});
+var $elm$core$List$filterMap = F2(
+	function (f, xs) {
+		return A3(
+			$elm$core$List$foldr,
+			$elm$core$List$maybeCons(f),
+			_List_Nil,
+			xs);
+	});
+var $elm$json$Json$Encode$object = function (pairs) {
+	return _Json_wrap(
+		A3(
+			$elm$core$List$foldl,
+			F2(
+				function (_v0, obj) {
+					var k = _v0.a;
+					var v = _v0.b;
+					return A3(_Json_addField, k, v, obj);
+				}),
+			_Json_emptyObject(_Utils_Tuple0),
+			pairs));
+};
+var $author$project$Internal$Tools$EncodeExtra$maybeObject = A2(
+	$elm$core$Basics$composeR,
+	$elm$core$List$filterMap(
+		function (_v0) {
+			var name = _v0.a;
+			var value = _v0.b;
+			if (value.$ === 'Just') {
+				var v = value.a;
+				return $elm$core$Maybe$Just(
+					_Utils_Tuple2(name, v));
+			} else {
+				return $elm$core$Maybe$Nothing;
+			}
+		}),
+	$elm$json$Json$Encode$object);
+var $author$project$Internal$Tools$Json$objectEncoder = F2(
+	function (items, object) {
+		return $author$project$Internal$Tools$EncodeExtra$maybeObject(
+			A2(
+				$elm$core$List$map,
+				$elm$core$Tuple$mapSecond(
+					function (f) {
+						return f(object);
+					}),
+				items));
+	});
+var $author$project$Internal$Tools$Json$toDecoderField = function (_v0) {
+	var data = _v0.a;
+	return data.decoder;
+};
+var $author$project$Internal$Tools$Json$toDocsField = function (x) {
+	var fieldName = x.a.fieldName;
+	var description = x.a.description;
+	var docs = x.a.docs;
+	var requiredness = x.a.requiredness;
+	return {content: docs, description: description, field: fieldName, required: requiredness};
+};
+var $author$project$Internal$Tools$Json$toEncodeField = function (_v0) {
+	var data = _v0.a;
+	return _Utils_Tuple2(
+		data.fieldName,
+		A2($elm$core$Basics$composeR, data.toField, data.encoder));
+};
+var $author$project$Internal$Tools$Json$object7 = F8(
+	function (_v0, fa, fb, fc, fd, fe, ff, fg) {
+		var name = _v0.name;
+		var description = _v0.description;
+		var init = _v0.init;
+		return $author$project$Internal$Tools$Json$Coder(
+			{
+				decoder: A8(
+					$elm$json$Json$Decode$map7,
+					F7(
+						function (_v1, _v2, _v3, _v4, _v5, _v6, _v7) {
+							var a = _v1.a;
+							var la = _v1.b;
+							var b = _v2.a;
+							var lb = _v2.b;
+							var c = _v3.a;
+							var lc = _v3.b;
+							var d = _v4.a;
+							var ld = _v4.b;
+							var e = _v5.a;
+							var le = _v5.b;
+							var f = _v6.a;
+							var lf = _v6.b;
+							var g = _v7.a;
+							var lg = _v7.b;
+							return _Utils_Tuple2(
+								A7(init, a, b, c, d, e, f, g),
+								$elm$core$List$concat(
+									_List_fromArray(
+										[la, lb, lc, ld, le, lf, lg])));
+						}),
+					$author$project$Internal$Tools$Json$toDecoderField(fa),
+					$author$project$Internal$Tools$Json$toDecoderField(fb),
+					$author$project$Internal$Tools$Json$toDecoderField(fc),
+					$author$project$Internal$Tools$Json$toDecoderField(fd),
+					$author$project$Internal$Tools$Json$toDecoderField(fe),
+					$author$project$Internal$Tools$Json$toDecoderField(ff),
+					$author$project$Internal$Tools$Json$toDecoderField(fg)),
+				docs: $author$project$Internal$Tools$Json$DocsObject(
+					{
+						description: description,
+						keys: _List_fromArray(
+							[
+								$author$project$Internal$Tools$Json$toDocsField(fa),
+								$author$project$Internal$Tools$Json$toDocsField(fb),
+								$author$project$Internal$Tools$Json$toDocsField(fc),
+								$author$project$Internal$Tools$Json$toDocsField(fd),
+								$author$project$Internal$Tools$Json$toDocsField(fe),
+								$author$project$Internal$Tools$Json$toDocsField(ff),
+								$author$project$Internal$Tools$Json$toDocsField(fg)
+							]),
+						name: name
+					}),
+				encoder: $author$project$Internal$Tools$Json$objectEncoder(
+					_List_fromArray(
+						[
+							$author$project$Internal$Tools$Json$toEncodeField(fa),
+							$author$project$Internal$Tools$Json$toEncodeField(fb),
+							$author$project$Internal$Tools$Json$toEncodeField(fc),
+							$author$project$Internal$Tools$Json$toEncodeField(fd),
+							$author$project$Internal$Tools$Json$toEncodeField(fe),
+							$author$project$Internal$Tools$Json$toEncodeField(ff),
+							$author$project$Internal$Tools$Json$toEncodeField(fg)
+						]))
+			});
+	});
+var $author$project$Internal$Tools$Json$DocsString = {$: 'DocsString'};
+var $elm$json$Json$Decode$string = _Json_decodeString;
+var $elm$json$Json$Encode$string = _Json_wrap;
+var $author$project$Internal$Tools$Json$string = $author$project$Internal$Tools$Json$Coder(
+	{
+		decoder: A2($elm$json$Json$Decode$map, $author$project$Internal$Tools$Json$empty, $elm$json$Json$Decode$string),
+		docs: $author$project$Internal$Tools$Json$DocsString,
+		encoder: $elm$json$Json$Encode$string
+	});
+var $author$project$Internal$Values$Context$coder = A8(
+	$author$project$Internal$Tools$Json$object7,
+	{description: $author$project$Internal$Config$Text$docs.context.description, init: $author$project$Internal$Values$Context$Context, name: $author$project$Internal$Config$Text$docs.context.name},
+	$author$project$Internal$Tools$Json$field.optional.value(
+		{
+			coder: $author$project$Internal$Tools$Json$string,
+			description: $author$project$Internal$Config$Text$fields.context.accessToken,
+			fieldName: 'accessToken',
+			toField: function ($) {
+				return $.accessToken;
+			}
+		}),
+	$author$project$Internal$Tools$Json$field.optional.value(
+		{
+			coder: $author$project$Internal$Tools$Json$string,
+			description: $author$project$Internal$Config$Text$fields.context.baseUrl,
+			fieldName: 'baseUrl',
+			toField: function ($) {
+				return $.baseUrl;
+			}
+		}),
+	$author$project$Internal$Tools$Json$field.optional.value(
+		{
+			coder: $author$project$Internal$Tools$Json$string,
+			description: $author$project$Internal$Config$Text$fields.context.password,
+			fieldName: 'password',
+			toField: function ($) {
+				return $.password;
+			}
+		}),
+	$author$project$Internal$Tools$Json$field.optional.value(
+		{
+			coder: $author$project$Internal$Tools$Json$string,
+			description: $author$project$Internal$Config$Text$fields.context.refreshToken,
+			fieldName: 'refreshToken',
+			toField: function ($) {
+				return $.refreshToken;
+			}
+		}),
+	$author$project$Internal$Tools$Json$field.optional.value(
+		{
+			coder: $author$project$Internal$Tools$Json$string,
+			description: $author$project$Internal$Config$Text$fields.context.username,
+			fieldName: 'username',
+			toField: function ($) {
+				return $.username;
+			}
+		}),
+	$author$project$Internal$Tools$Json$field.optional.value(
+		{
+			coder: $author$project$Internal$Tools$Json$string,
+			description: $author$project$Internal$Config$Text$fields.context.transaction,
+			fieldName: 'transaction',
+			toField: function ($) {
+				return $.transaction;
+			}
+		}),
+	$author$project$Internal$Tools$Json$field.optional.value(
+		{
+			coder: $author$project$Internal$Tools$Json$list($author$project$Internal$Tools$Json$string),
+			description: $author$project$Internal$Config$Text$fields.context.versions,
+			fieldName: 'versions',
+			toField: function ($) {
+				return $.versions;
+			}
+		}));
+var $author$project$Internal$Values$Envelope$Envelope = F3(
+	function (content, context, settings) {
+		return {content: content, context: context, settings: settings};
+	});
+var $author$project$Internal$Values$Settings$Settings = F3(
+	function (currentVersion, deviceName, syncTime) {
+		return {currentVersion: currentVersion, deviceName: deviceName, syncTime: syncTime};
+	});
+var $author$project$Internal$Config$Default$currentVersion = 'beta 2.1.0';
+var $author$project$Internal$Config$Default$deviceName = 'Elm SDK (' + ($author$project$Internal$Config$Default$currentVersion + ')');
+var $elm$json$Json$Decode$map3 = _Json_map3;
+var $author$project$Internal$Tools$Json$object3 = F4(
+	function (_v0, fa, fb, fc) {
+		var name = _v0.name;
+		var description = _v0.description;
+		var init = _v0.init;
+		return $author$project$Internal$Tools$Json$Coder(
+			{
+				decoder: A4(
+					$elm$json$Json$Decode$map3,
+					F3(
+						function (_v1, _v2, _v3) {
+							var a = _v1.a;
+							var la = _v1.b;
+							var b = _v2.a;
+							var lb = _v2.b;
+							var c = _v3.a;
+							var lc = _v3.b;
+							return _Utils_Tuple2(
+								A3(init, a, b, c),
+								$elm$core$List$concat(
+									_List_fromArray(
+										[la, lb, lc])));
+						}),
+					$author$project$Internal$Tools$Json$toDecoderField(fa),
+					$author$project$Internal$Tools$Json$toDecoderField(fb),
+					$author$project$Internal$Tools$Json$toDecoderField(fc)),
+				docs: $author$project$Internal$Tools$Json$DocsObject(
+					{
+						description: description,
+						keys: _List_fromArray(
+							[
+								$author$project$Internal$Tools$Json$toDocsField(fa),
+								$author$project$Internal$Tools$Json$toDocsField(fb),
+								$author$project$Internal$Tools$Json$toDocsField(fc)
+							]),
+						name: name
+					}),
+				encoder: $author$project$Internal$Tools$Json$objectEncoder(
+					_List_fromArray(
+						[
+							$author$project$Internal$Tools$Json$toEncodeField(fa),
+							$author$project$Internal$Tools$Json$toEncodeField(fb),
+							$author$project$Internal$Tools$Json$toEncodeField(fc)
+						]))
+			});
+	});
+var $elm$core$Tuple$pair = F2(
+	function (a, b) {
+		return _Utils_Tuple2(a, b);
+	});
+var $author$project$Internal$Config$Default$syncTime = 30 * 1000;
+var $author$project$Internal$Values$Settings$coder = A4(
+	$author$project$Internal$Tools$Json$object3,
+	{description: $author$project$Internal$Config$Text$docs.settings.description, init: $author$project$Internal$Values$Settings$Settings, name: $author$project$Internal$Config$Text$docs.settings.name},
+	$author$project$Internal$Tools$Json$field.optional.withDefault(
+		{
+			coder: $author$project$Internal$Tools$Json$string,
+			_default: A2($elm$core$Tuple$pair, $author$project$Internal$Config$Default$currentVersion, _List_Nil),
+			defaultToString: $elm$core$Basics$identity,
+			description: $author$project$Internal$Config$Text$fields.settings.currentVersion,
+			fieldName: 'currentVersion',
+			toField: function ($) {
+				return $.currentVersion;
+			}
+		}),
+	$author$project$Internal$Tools$Json$field.optional.withDefault(
+		{
+			coder: $author$project$Internal$Tools$Json$string,
+			_default: A2($elm$core$Tuple$pair, $author$project$Internal$Config$Default$deviceName, _List_Nil),
+			defaultToString: $elm$core$Basics$identity,
+			description: $author$project$Internal$Config$Text$fields.settings.deviceName,
+			fieldName: 'deviceName',
+			toField: function ($) {
+				return $.deviceName;
+			}
+		}),
+	$author$project$Internal$Tools$Json$field.optional.withDefault(
+		{
+			coder: $author$project$Internal$Tools$Json$int,
+			_default: A2($elm$core$Tuple$pair, $author$project$Internal$Config$Default$syncTime, _List_Nil),
+			defaultToString: $elm$core$String$fromInt,
+			description: $author$project$Internal$Config$Text$fields.settings.syncTime,
+			fieldName: 'syncTime',
+			toField: function ($) {
+				return $.syncTime;
+			}
+		}));
+var $author$project$Internal$Values$Settings$init = {currentVersion: $author$project$Internal$Config$Default$currentVersion, deviceName: $author$project$Internal$Config$Default$deviceName, syncTime: $author$project$Internal$Config$Default$syncTime};
+var $author$project$Internal$Values$Envelope$coder = function (c1) {
+	return A4(
+		$author$project$Internal$Tools$Json$object3,
+		{description: $author$project$Internal$Config$Text$docs.envelope.description, init: $author$project$Internal$Values$Envelope$Envelope, name: $author$project$Internal$Config$Text$docs.envelope.name},
+		$author$project$Internal$Tools$Json$field.required(
+			{
+				coder: c1,
+				description: $author$project$Internal$Config$Text$fields.envelope.content,
+				fieldName: 'content',
+				toField: function ($) {
+					return $.content;
+				}
+			}),
+		$author$project$Internal$Tools$Json$field.required(
+			{
+				coder: $author$project$Internal$Values$Context$coder,
+				description: $author$project$Internal$Config$Text$fields.envelope.context,
+				fieldName: 'context',
+				toField: function ($) {
+					return $.context;
+				}
+			}),
+		$author$project$Internal$Tools$Json$field.optional.withDefault(
+			{
+				coder: $author$project$Internal$Values$Settings$coder,
+				_default: A2($elm$core$Tuple$pair, $author$project$Internal$Values$Settings$init, _List_Nil),
+				defaultToString: $elm$core$Basics$always('<Default settings>'),
+				description: $author$project$Internal$Config$Text$fields.envelope.settings,
+				fieldName: 'settings',
+				toField: function ($) {
+					return $.settings;
+				}
+			}));
+};
+var $author$project$Internal$Values$Event$Event = F8(
+	function (content, eventId, originServerTs, roomId, sender, stateKey, eventType, unsigned) {
+		return {content: content, eventId: eventId, eventType: eventType, originServerTs: originServerTs, roomId: roomId, sender: sender, stateKey: stateKey, unsigned: unsigned};
+	});
+var $author$project$Internal$Values$Event$UnsignedData = function (a) {
+	return {$: 'UnsignedData', a: a};
+};
+var $author$project$Internal$Tools$Json$DocsLazy = function (a) {
+	return {$: 'DocsLazy', a: a};
+};
+var $elm$json$Json$Decode$lazy = function (thunk) {
+	return A2(
+		$elm$json$Json$Decode$andThen,
+		thunk,
+		$elm$json$Json$Decode$succeed(_Utils_Tuple0));
+};
+var $author$project$Internal$Tools$Json$toDocs = function (_v0) {
+	var data = _v0.a;
+	return data.docs;
+};
+var $author$project$Internal$Tools$Json$lazy = function (f) {
+	return $author$project$Internal$Tools$Json$Coder(
+		{
+			decoder: $elm$json$Json$Decode$lazy(
+				function (_v0) {
+					var _v1 = f(_Utils_Tuple0);
+					var old = _v1.a;
+					return old.decoder;
+				}),
+			docs: $author$project$Internal$Tools$Json$DocsLazy(
+				A2($elm$core$Basics$composeR, f, $author$project$Internal$Tools$Json$toDocs)),
+			encoder: function (v) {
+				var _v2 = f(_Utils_Tuple0);
+				var old = _v2.a;
+				return old.encoder(v);
+			}
+		});
+};
+var $elm$json$Json$Decode$map4 = _Json_map4;
+var $author$project$Internal$Tools$Json$object4 = F5(
+	function (_v0, fa, fb, fc, fd) {
+		var name = _v0.name;
+		var description = _v0.description;
+		var init = _v0.init;
+		return $author$project$Internal$Tools$Json$Coder(
+			{
+				decoder: A5(
+					$elm$json$Json$Decode$map4,
+					F4(
+						function (_v1, _v2, _v3, _v4) {
+							var a = _v1.a;
+							var la = _v1.b;
+							var b = _v2.a;
+							var lb = _v2.b;
+							var c = _v3.a;
+							var lc = _v3.b;
+							var d = _v4.a;
+							var ld = _v4.b;
+							return _Utils_Tuple2(
+								A4(init, a, b, c, d),
+								$elm$core$List$concat(
+									_List_fromArray(
+										[la, lb, lc, ld])));
+						}),
+					$author$project$Internal$Tools$Json$toDecoderField(fa),
+					$author$project$Internal$Tools$Json$toDecoderField(fb),
+					$author$project$Internal$Tools$Json$toDecoderField(fc),
+					$author$project$Internal$Tools$Json$toDecoderField(fd)),
+				docs: $author$project$Internal$Tools$Json$DocsObject(
+					{
+						description: description,
+						keys: _List_fromArray(
+							[
+								$author$project$Internal$Tools$Json$toDocsField(fa),
+								$author$project$Internal$Tools$Json$toDocsField(fb),
+								$author$project$Internal$Tools$Json$toDocsField(fc),
+								$author$project$Internal$Tools$Json$toDocsField(fd)
+							]),
+						name: name
+					}),
+				encoder: $author$project$Internal$Tools$Json$objectEncoder(
+					_List_fromArray(
+						[
+							$author$project$Internal$Tools$Json$toEncodeField(fa),
+							$author$project$Internal$Tools$Json$toEncodeField(fb),
+							$author$project$Internal$Tools$Json$toEncodeField(fc),
+							$author$project$Internal$Tools$Json$toEncodeField(fd)
+						]))
+			});
+	});
+var $elm$json$Json$Decode$map8 = _Json_map8;
+var $author$project$Internal$Tools$Json$object8 = F9(
+	function (_v0, fa, fb, fc, fd, fe, ff, fg, fh) {
+		var name = _v0.name;
+		var description = _v0.description;
+		var init = _v0.init;
+		return $author$project$Internal$Tools$Json$Coder(
+			{
+				decoder: A9(
+					$elm$json$Json$Decode$map8,
+					F8(
+						function (_v1, _v2, _v3, _v4, _v5, _v6, _v7, _v8) {
+							var a = _v1.a;
+							var la = _v1.b;
+							var b = _v2.a;
+							var lb = _v2.b;
+							var c = _v3.a;
+							var lc = _v3.b;
+							var d = _v4.a;
+							var ld = _v4.b;
+							var e = _v5.a;
+							var le = _v5.b;
+							var f = _v6.a;
+							var lf = _v6.b;
+							var g = _v7.a;
+							var lg = _v7.b;
+							var h = _v8.a;
+							var lh = _v8.b;
+							return _Utils_Tuple2(
+								A8(init, a, b, c, d, e, f, g, h),
+								$elm$core$List$concat(
+									_List_fromArray(
+										[la, lb, lc, ld, le, lf, lg, lh])));
+						}),
+					$author$project$Internal$Tools$Json$toDecoderField(fa),
+					$author$project$Internal$Tools$Json$toDecoderField(fb),
+					$author$project$Internal$Tools$Json$toDecoderField(fc),
+					$author$project$Internal$Tools$Json$toDecoderField(fd),
+					$author$project$Internal$Tools$Json$toDecoderField(fe),
+					$author$project$Internal$Tools$Json$toDecoderField(ff),
+					$author$project$Internal$Tools$Json$toDecoderField(fg),
+					$author$project$Internal$Tools$Json$toDecoderField(fh)),
+				docs: $author$project$Internal$Tools$Json$DocsObject(
+					{
+						description: description,
+						keys: _List_fromArray(
+							[
+								$author$project$Internal$Tools$Json$toDocsField(fa),
+								$author$project$Internal$Tools$Json$toDocsField(fb),
+								$author$project$Internal$Tools$Json$toDocsField(fc),
+								$author$project$Internal$Tools$Json$toDocsField(fd),
+								$author$project$Internal$Tools$Json$toDocsField(fe),
+								$author$project$Internal$Tools$Json$toDocsField(ff),
+								$author$project$Internal$Tools$Json$toDocsField(fg),
+								$author$project$Internal$Tools$Json$toDocsField(fh)
+							]),
+						name: name
+					}),
+				encoder: $author$project$Internal$Tools$Json$objectEncoder(
+					_List_fromArray(
+						[
+							$author$project$Internal$Tools$Json$toEncodeField(fa),
+							$author$project$Internal$Tools$Json$toEncodeField(fb),
+							$author$project$Internal$Tools$Json$toEncodeField(fc),
+							$author$project$Internal$Tools$Json$toEncodeField(fd),
+							$author$project$Internal$Tools$Json$toEncodeField(fe),
+							$author$project$Internal$Tools$Json$toEncodeField(ff),
+							$author$project$Internal$Tools$Json$toEncodeField(fg),
+							$author$project$Internal$Tools$Json$toEncodeField(fh)
+						]))
+			});
+	});
+var $author$project$Internal$Tools$Json$DocsValue = {$: 'DocsValue'};
+var $author$project$Internal$Tools$Json$value = $author$project$Internal$Tools$Json$Coder(
+	{
+		decoder: A2(
+			$elm$json$Json$Decode$map,
+			function (v) {
+				return _Utils_Tuple2(v, _List_Nil);
+			},
+			$elm$json$Json$Decode$value),
+		docs: $author$project$Internal$Tools$Json$DocsValue,
+		encoder: $elm$core$Basics$identity
+	});
+function $author$project$Internal$Values$Event$cyclic$coder() {
+	return A9(
+		$author$project$Internal$Tools$Json$object8,
+		{description: $author$project$Internal$Config$Text$docs.event.description, init: $author$project$Internal$Values$Event$Event, name: $author$project$Internal$Config$Text$docs.event.name},
+		$author$project$Internal$Tools$Json$field.required(
+			{
+				coder: $author$project$Internal$Tools$Json$value,
+				description: $author$project$Internal$Config$Text$fields.event.content,
+				fieldName: 'content',
+				toField: function ($) {
+					return $.content;
+				}
+			}),
+		$author$project$Internal$Tools$Json$field.required(
+			{
+				coder: $author$project$Internal$Tools$Json$string,
+				description: $author$project$Internal$Config$Text$fields.event.eventId,
+				fieldName: 'eventId',
+				toField: function ($) {
+					return $.eventId;
+				}
+			}),
+		$author$project$Internal$Tools$Json$field.required(
+			{
+				coder: $author$project$Internal$Tools$Timestamp$coder,
+				description: $author$project$Internal$Config$Text$fields.event.originServerTs,
+				fieldName: 'originServerTs',
+				toField: function ($) {
+					return $.originServerTs;
+				}
+			}),
+		$author$project$Internal$Tools$Json$field.required(
+			{
+				coder: $author$project$Internal$Tools$Json$string,
+				description: $author$project$Internal$Config$Text$fields.event.roomId,
+				fieldName: 'roomId',
+				toField: function ($) {
+					return $.roomId;
+				}
+			}),
+		$author$project$Internal$Tools$Json$field.required(
+			{
+				coder: $author$project$Internal$Tools$Json$string,
+				description: $author$project$Internal$Config$Text$fields.event.sender,
+				fieldName: 'sender',
+				toField: function ($) {
+					return $.sender;
+				}
+			}),
+		$author$project$Internal$Tools$Json$field.optional.value(
+			{
+				coder: $author$project$Internal$Tools$Json$string,
+				description: $author$project$Internal$Config$Text$fields.event.stateKey,
+				fieldName: 'stateKey',
+				toField: function ($) {
+					return $.stateKey;
+				}
+			}),
+		$author$project$Internal$Tools$Json$field.required(
+			{
+				coder: $author$project$Internal$Tools$Json$string,
+				description: $author$project$Internal$Config$Text$fields.event.eventType,
+				fieldName: 'type',
+				toField: function ($) {
+					return $.eventType;
+				}
+			}),
+		$author$project$Internal$Tools$Json$field.optional.value(
+			{
+				coder: $author$project$Internal$Values$Event$cyclic$unsignedCoder(),
+				description: $author$project$Internal$Config$Text$fields.event.unsigned,
+				fieldName: 'unsigned',
+				toField: function ($) {
+					return $.unsigned;
+				}
+			}));
+}
+function $author$project$Internal$Values$Event$cyclic$unsignedCoder() {
+	return A5(
+		$author$project$Internal$Tools$Json$object4,
+		{
+			description: $author$project$Internal$Config$Text$docs.unsigned.description,
+			init: F4(
+				function (a, b, c, d) {
+					return $author$project$Internal$Values$Event$UnsignedData(
+						{age: a, prevContent: b, redactedBecause: c, transactionId: d});
+				}),
+			name: $author$project$Internal$Config$Text$docs.unsigned.name
+		},
+		$author$project$Internal$Tools$Json$field.optional.value(
+			{
+				coder: $author$project$Internal$Tools$Json$int,
+				description: $author$project$Internal$Config$Text$fields.unsigned.age,
+				fieldName: 'age',
+				toField: function (_v0) {
+					var data = _v0.a;
+					return data.age;
+				}
+			}),
+		$author$project$Internal$Tools$Json$field.optional.value(
+			{
+				coder: $author$project$Internal$Tools$Json$value,
+				description: $author$project$Internal$Config$Text$fields.unsigned.prevContent,
+				fieldName: 'prevContent',
+				toField: function (_v1) {
+					var data = _v1.a;
+					return data.prevContent;
+				}
+			}),
+		$author$project$Internal$Tools$Json$field.optional.value(
+			{
+				coder: $author$project$Internal$Tools$Json$lazy(
+					function (_v2) {
+						return $author$project$Internal$Values$Event$cyclic$coder();
+					}),
+				description: $author$project$Internal$Config$Text$fields.unsigned.redactedBecause,
+				fieldName: 'redactedBecause',
+				toField: function (_v3) {
+					var data = _v3.a;
+					return data.redactedBecause;
+				}
+			}),
+		$author$project$Internal$Tools$Json$field.optional.value(
+			{
+				coder: $author$project$Internal$Tools$Json$string,
+				description: $author$project$Internal$Config$Text$fields.unsigned.transactionId,
+				fieldName: 'transactionId',
+				toField: function (_v4) {
+					var data = _v4.a;
+					return data.transactionId;
+				}
+			}));
+}
+try {
+	var $author$project$Internal$Values$Event$coder = $author$project$Internal$Values$Event$cyclic$coder();
+	$author$project$Internal$Values$Event$cyclic$coder = function () {
+		return $author$project$Internal$Values$Event$coder;
+	};
+	var $author$project$Internal$Values$Event$unsignedCoder = $author$project$Internal$Values$Event$cyclic$unsignedCoder();
+	$author$project$Internal$Values$Event$cyclic$unsignedCoder = function () {
+		return $author$project$Internal$Values$Event$unsignedCoder;
+	};
+} catch ($) {
+	throw 'Some top-level definitions from `Internal.Values.Event` are causing infinite recursion:\n\n  ┌─────┐\n  │    coder\n  │     ↓\n  │    unsignedCoder\n  └─────┘\n\nThese errors are very tricky, so read https://elm-lang.org/0.19.1/bad-recursion to learn how to fix it!';}
+var $author$project$Internal$Values$StateManager$StateManager = function (a) {
+	return {$: 'StateManager', a: a};
+};
+var $author$project$Internal$Values$StateManager$coder = A2(
+	$author$project$Internal$Tools$Json$map,
+	{
+		back: function (_v0) {
+			var manager = _v0.a;
+			return manager;
+		},
+		description: $author$project$Internal$Config$Text$docs.stateManager.description,
+		forth: $author$project$Internal$Values$StateManager$StateManager,
+		name: $author$project$Internal$Config$Text$docs.stateManager.name
+	},
+	$author$project$Internal$Tools$Json$fastDict(
+		A2(
+			$author$project$Internal$Tools$Mashdict$coder,
+			function ($) {
+				return $.stateKey;
+			},
+			$author$project$Internal$Values$Event$coder)));
+var $elm$core$Dict$fromList = function (assocs) {
+	return A3(
+		$elm$core$List$foldl,
+		F2(
+			function (_v0, dict) {
+				var key = _v0.a;
+				var value = _v0.b;
+				return A3($elm$core$Dict$insert, key, value, dict);
+			}),
+		$elm$core$Dict$empty,
+		assocs);
+};
+var $author$project$Internal$Tools$Json$decode = function (_v0) {
+	var data = _v0.a;
+	return data.decoder;
+};
+var $elm$json$Json$Decode$decodeString = _Json_runOnString;
+var $elm$core$Result$map = F2(
+	function (func, ra) {
+		if (ra.$ === 'Ok') {
+			var a = ra.a;
+			return $elm$core$Result$Ok(
+				func(a));
+		} else {
+			var e = ra.a;
+			return $elm$core$Result$Err(e);
+		}
+	});
+var $elm$core$Result$mapError = F2(
+	function (f, result) {
+		if (result.$ === 'Ok') {
+			var v = result.a;
+			return $elm$core$Result$Ok(v);
+		} else {
+			var e = result.a;
+			return $elm$core$Result$Err(
+				f(e));
+		}
+	});
+var $elm$core$Debug$toString = _Debug_toString;
+var $author$project$Main$decoder = F2(
+	function (coder, value) {
+		return A2(
+			$elm$core$Result$map,
+			$elm$core$Basics$append('Success! JSON decoded to Elm value: '),
+			A2(
+				$elm$core$Result$map,
+				$elm$core$Debug$toString,
+				A2(
+					$elm$core$Result$mapError,
+					$elm$json$Json$Decode$errorToString,
+					A2(
+						$elm$json$Json$Decode$decodeString,
+						$author$project$Internal$Tools$Json$decode(coder),
+						value))));
+	});
+var $author$project$Main$shapeCoder = function (coder) {
+	return _Utils_Tuple2(
+		$author$project$Internal$Tools$Json$toDocs(coder),
+		$author$project$Main$decoder(coder));
+};
+var $author$project$Main$coders = $elm$core$Dict$fromList(
+	_List_fromArray(
+		[
+			_Utils_Tuple2(
+			'Context',
+			$author$project$Main$shapeCoder($author$project$Internal$Values$Context$coder)),
+			_Utils_Tuple2(
+			'Envelope',
+			$author$project$Main$shapeCoder(
+				$author$project$Internal$Values$Envelope$coder($author$project$Internal$Tools$Json$value))),
+			_Utils_Tuple2(
+			'Event',
+			$author$project$Main$shapeCoder($author$project$Internal$Values$Event$coder)),
+			_Utils_Tuple2(
+			'Hashdict',
+			$author$project$Main$shapeCoder(
+				A2(
+					$author$project$Internal$Tools$Hashdict$coder,
+					function ($) {
+						return $.eventId;
+					},
+					$author$project$Internal$Values$Event$coder))),
+			_Utils_Tuple2(
+			'Mashdict',
+			$author$project$Main$shapeCoder(
+				A2(
+					$author$project$Internal$Tools$Mashdict$coder,
+					function ($) {
+						return $.stateKey;
+					},
+					$author$project$Internal$Values$Event$coder))),
+			_Utils_Tuple2(
+			'Settings',
+			$author$project$Main$shapeCoder($author$project$Internal$Values$Settings$coder)),
+			_Utils_Tuple2(
+			'StateManager',
+			$author$project$Main$shapeCoder($author$project$Internal$Values$StateManager$coder)),
+			_Utils_Tuple2(
+			'Timestamp',
+			$author$project$Main$shapeCoder($author$project$Internal$Tools$Timestamp$coder))
+		]));
+var $elm$browser$Browser$Dom$getElement = _Browser_getElement;
+var $elm$browser$Browser$Navigation$load = _Browser_load;
+var $elm$core$Task$onError = _Scheduler_onError;
+var $elm$browser$Browser$Navigation$pushUrl = _Browser_pushUrl;
+var $elm$browser$Browser$Dom$setViewport = _Browser_setViewport;
+var $elm$url$Url$addPort = F2(
+	function (maybePort, starter) {
+		if (maybePort.$ === 'Nothing') {
+			return starter;
+		} else {
+			var port_ = maybePort.a;
+			return starter + (':' + $elm$core$String$fromInt(port_));
+		}
+	});
+var $elm$url$Url$addPrefixed = F3(
+	function (prefix, maybeSegment, starter) {
+		if (maybeSegment.$ === 'Nothing') {
+			return starter;
+		} else {
+			var segment = maybeSegment.a;
+			return _Utils_ap(
+				starter,
+				_Utils_ap(prefix, segment));
+		}
+	});
+var $elm$url$Url$toString = function (url) {
+	var http = function () {
+		var _v0 = url.protocol;
+		if (_v0.$ === 'Http') {
+			return 'http://';
+		} else {
+			return 'https://';
+		}
+	}();
+	return A3(
+		$elm$url$Url$addPrefixed,
+		'#',
+		url.fragment,
+		A3(
+			$elm$url$Url$addPrefixed,
+			'?',
+			url.query,
+			_Utils_ap(
+				A2(
+					$elm$url$Url$addPort,
+					url.port_,
+					_Utils_ap(http, url.host)),
+				url.path)));
+};
+var $author$project$Main$update = F2(
+	function (msg, model) {
+		switch (msg.$) {
+			case 'OnDecodeString':
+				var _v1 = model.page;
+				if (_v1.$ === 'ViewObject') {
+					var o = _v1.a;
+					return _Utils_Tuple2(
+						_Utils_update(
+							model,
+							{
+								valid: A2(
+									$elm$core$Maybe$map,
+									$elm$core$Basics$apR(model.input),
+									A2(
+										$elm$core$Maybe$map,
+										$elm$core$Tuple$second,
+										A2($elm$core$Dict$get, o, $author$project$Main$coders)))
+							}),
+						$elm$core$Platform$Cmd$none);
+				} else {
+					return _Utils_Tuple2(model, $elm$core$Platform$Cmd$none);
+				}
+			case 'OnObjectClick':
+				var name = msg.a;
+				return _Utils_Tuple2(
+					model,
+					A2(
+						$elm$core$Task$perform,
+						$author$project$Main$OnScreenMoved,
+						A2(
+							$elm$core$Task$onError,
+							function (_v2) {
+								return $elm$core$Task$succeed(false);
+							},
+							A2(
+								$elm$core$Task$map,
+								$elm$core$Basics$always(true),
+								A2(
+									$elm$core$Task$andThen,
+									function (data) {
+										return A2($elm$browser$Browser$Dom$setViewport, data.element.x, data.element.y);
+									},
+									$elm$browser$Browser$Dom$getElement(name))))));
+			case 'OnScreenMoved':
+				return _Utils_Tuple2(model, $elm$core$Platform$Cmd$none);
+			case 'OnUrlChange':
+				var url = msg.a;
+				return A3($author$project$Main$init, _Utils_Tuple0, url, model.key);
+			case 'OnUrlRequest':
+				if (msg.a.$ === 'Internal') {
+					var url = msg.a.a;
+					return _Utils_Tuple2(
+						model,
+						A2(
+							$elm$browser$Browser$Navigation$pushUrl,
+							model.key,
+							$elm$url$Url$toString(url)));
+				} else {
+					var url = msg.a.a;
+					return _Utils_Tuple2(
+						model,
+						$elm$browser$Browser$Navigation$load(url));
+				}
+			default:
+				var text = msg.a;
+				return _Utils_Tuple2(
+					_Utils_update(
+						model,
+						{input: text}),
+					$elm$core$Platform$Cmd$none);
+		}
+	});
+var $author$project$Main$OnDecodeString = {$: 'OnDecodeString'};
+var $author$project$Main$OnWriteJSON = function (a) {
+	return {$: 'OnWriteJSON', a: a};
+};
+var $mdgriffith$elm_ui$Element$Phone = {$: 'Phone'};
+var $mdgriffith$elm_ui$Internal$Model$AlignY = function (a) {
+	return {$: 'AlignY', a: a};
+};
+var $mdgriffith$elm_ui$Internal$Model$Top = {$: 'Top'};
+var $mdgriffith$elm_ui$Element$alignTop = $mdgriffith$elm_ui$Internal$Model$AlignY($mdgriffith$elm_ui$Internal$Model$Top);
+var $mdgriffith$elm_ui$Internal$Model$Colored = F3(
+	function (a, b, c) {
+		return {$: 'Colored', a: a, b: b, c: c};
+	});
+var $mdgriffith$elm_ui$Internal$Model$StyleClass = F2(
+	function (a, b) {
+		return {$: 'StyleClass', a: a, b: b};
+	});
+var $mdgriffith$elm_ui$Internal$Flag$Flag = function (a) {
+	return {$: 'Flag', a: a};
+};
+var $mdgriffith$elm_ui$Internal$Flag$Second = function (a) {
+	return {$: 'Second', a: a};
+};
+var $elm$core$Bitwise$shiftLeftBy = _Bitwise_shiftLeftBy;
+var $mdgriffith$elm_ui$Internal$Flag$flag = function (i) {
+	return (i > 31) ? $mdgriffith$elm_ui$Internal$Flag$Second(1 << (i - 32)) : $mdgriffith$elm_ui$Internal$Flag$Flag(1 << i);
+};
+var $mdgriffith$elm_ui$Internal$Flag$bgColor = $mdgriffith$elm_ui$Internal$Flag$flag(8);
+var $elm$core$Basics$round = _Basics_round;
+var $mdgriffith$elm_ui$Internal$Model$floatClass = function (x) {
+	return $elm$core$String$fromInt(
+		$elm$core$Basics$round(x * 255));
+};
+var $mdgriffith$elm_ui$Internal$Model$formatColorClass = function (_v0) {
+	var red = _v0.a;
+	var green = _v0.b;
+	var blue = _v0.c;
+	var alpha = _v0.d;
+	return $mdgriffith$elm_ui$Internal$Model$floatClass(red) + ('-' + ($mdgriffith$elm_ui$Internal$Model$floatClass(green) + ('-' + ($mdgriffith$elm_ui$Internal$Model$floatClass(blue) + ('-' + $mdgriffith$elm_ui$Internal$Model$floatClass(alpha))))));
+};
+var $mdgriffith$elm_ui$Element$Background$color = function (clr) {
+	return A2(
+		$mdgriffith$elm_ui$Internal$Model$StyleClass,
+		$mdgriffith$elm_ui$Internal$Flag$bgColor,
+		A3(
+			$mdgriffith$elm_ui$Internal$Model$Colored,
+			'bg-' + $mdgriffith$elm_ui$Internal$Model$formatColorClass(clr),
+			'background-color',
+			clr));
+};
+var $mdgriffith$elm_ui$Internal$Model$Rgba = F4(
+	function (a, b, c, d) {
+		return {$: 'Rgba', a: a, b: b, c: c, d: d};
+	});
+var $mdgriffith$elm_ui$Element$fromRgb = function (clr) {
+	return A4($mdgriffith$elm_ui$Internal$Model$Rgba, clr.red, clr.green, clr.blue, clr.alpha);
+};
+var $avh4$elm_color$Color$toRgba = function (_v0) {
+	var r = _v0.a;
+	var g = _v0.b;
+	var b = _v0.c;
+	var a = _v0.d;
+	return {alpha: a, blue: b, green: g, red: r};
+};
+var $author$project$Colors$background = A2(
+	$elm$core$Basics$composeR,
+	$avh4$elm_color$Color$toRgba,
+	A2($elm$core$Basics$composeR, $mdgriffith$elm_ui$Element$fromRgb, $mdgriffith$elm_ui$Element$Background$color));
+var $mdgriffith$elm_ui$Internal$Model$Attr = function (a) {
+	return {$: 'Attr', a: a};
+};
+var $mdgriffith$elm_ui$Internal$Model$Button = {$: 'Button'};
+var $mdgriffith$elm_ui$Internal$Model$Describe = function (a) {
+	return {$: 'Describe', a: a};
+};
+var $mdgriffith$elm_ui$Internal$Model$Unkeyed = function (a) {
+	return {$: 'Unkeyed', a: a};
+};
+var $mdgriffith$elm_ui$Internal$Model$AsEl = {$: 'AsEl'};
+var $mdgriffith$elm_ui$Internal$Model$asEl = $mdgriffith$elm_ui$Internal$Model$AsEl;
+var $mdgriffith$elm_ui$Internal$Style$classes = {above: 'a', active: 'atv', alignBottom: 'ab', alignCenterX: 'cx', alignCenterY: 'cy', alignContainerBottom: 'acb', alignContainerCenterX: 'accx', alignContainerCenterY: 'accy', alignContainerRight: 'acr', alignLeft: 'al', alignRight: 'ar', alignTop: 'at', alignedHorizontally: 'ah', alignedVertically: 'av', any: 's', behind: 'bh', below: 'b', bold: 'w7', borderDashed: 'bd', borderDotted: 'bdt', borderNone: 'bn', borderSolid: 'bs', capturePointerEvents: 'cpe', clip: 'cp', clipX: 'cpx', clipY: 'cpy', column: 'c', container: 'ctr', contentBottom: 'cb', contentCenterX: 'ccx', contentCenterY: 'ccy', contentLeft: 'cl', contentRight: 'cr', contentTop: 'ct', cursorPointer: 'cptr', cursorText: 'ctxt', focus: 'fcs', focusedWithin: 'focus-within', fullSize: 'fs', grid: 'g', hasBehind: 'hbh', heightContent: 'hc', heightExact: 'he', heightFill: 'hf', heightFillPortion: 'hfp', hover: 'hv', imageContainer: 'ic', inFront: 'fr', inputLabel: 'lbl', inputMultiline: 'iml', inputMultilineFiller: 'imlf', inputMultilineParent: 'imlp', inputMultilineWrapper: 'implw', inputText: 'it', italic: 'i', link: 'lnk', nearby: 'nb', noTextSelection: 'notxt', onLeft: 'ol', onRight: 'or', opaque: 'oq', overflowHidden: 'oh', page: 'pg', paragraph: 'p', passPointerEvents: 'ppe', root: 'ui', row: 'r', scrollbars: 'sb', scrollbarsX: 'sbx', scrollbarsY: 'sby', seButton: 'sbt', single: 'e', sizeByCapital: 'cap', spaceEvenly: 'sev', strike: 'sk', text: 't', textCenter: 'tc', textExtraBold: 'w8', textExtraLight: 'w2', textHeavy: 'w9', textJustify: 'tj', textJustifyAll: 'tja', textLeft: 'tl', textLight: 'w3', textMedium: 'w5', textNormalWeight: 'w4', textRight: 'tr', textSemiBold: 'w6', textThin: 'w1', textUnitalicized: 'tun', transition: 'ts', transparent: 'clr', underline: 'u', widthContent: 'wc', widthExact: 'we', widthFill: 'wf', widthFillPortion: 'wfp', wrapped: 'wrp'};
+var $elm$json$Json$Encode$bool = _Json_wrap;
+var $elm$html$Html$Attributes$boolProperty = F2(
+	function (key, bool) {
+		return A2(
+			_VirtualDom_property,
+			key,
+			$elm$json$Json$Encode$bool(bool));
+	});
+var $elm$html$Html$Attributes$disabled = $elm$html$Html$Attributes$boolProperty('disabled');
+var $mdgriffith$elm_ui$Internal$Model$Generic = {$: 'Generic'};
+var $mdgriffith$elm_ui$Internal$Model$div = $mdgriffith$elm_ui$Internal$Model$Generic;
+var $mdgriffith$elm_ui$Internal$Model$NoNearbyChildren = {$: 'NoNearbyChildren'};
+var $mdgriffith$elm_ui$Internal$Model$columnClass = $mdgriffith$elm_ui$Internal$Style$classes.any + (' ' + $mdgriffith$elm_ui$Internal$Style$classes.column);
+var $mdgriffith$elm_ui$Internal$Model$gridClass = $mdgriffith$elm_ui$Internal$Style$classes.any + (' ' + $mdgriffith$elm_ui$Internal$Style$classes.grid);
+var $mdgriffith$elm_ui$Internal$Model$pageClass = $mdgriffith$elm_ui$Internal$Style$classes.any + (' ' + $mdgriffith$elm_ui$Internal$Style$classes.page);
+var $mdgriffith$elm_ui$Internal$Model$paragraphClass = $mdgriffith$elm_ui$Internal$Style$classes.any + (' ' + $mdgriffith$elm_ui$Internal$Style$classes.paragraph);
+var $mdgriffith$elm_ui$Internal$Model$rowClass = $mdgriffith$elm_ui$Internal$Style$classes.any + (' ' + $mdgriffith$elm_ui$Internal$Style$classes.row);
+var $mdgriffith$elm_ui$Internal$Model$singleClass = $mdgriffith$elm_ui$Internal$Style$classes.any + (' ' + $mdgriffith$elm_ui$Internal$Style$classes.single);
+var $mdgriffith$elm_ui$Internal$Model$contextClasses = function (context) {
+	switch (context.$) {
+		case 'AsRow':
+			return $mdgriffith$elm_ui$Internal$Model$rowClass;
+		case 'AsColumn':
+			return $mdgriffith$elm_ui$Internal$Model$columnClass;
+		case 'AsEl':
+			return $mdgriffith$elm_ui$Internal$Model$singleClass;
+		case 'AsGrid':
+			return $mdgriffith$elm_ui$Internal$Model$gridClass;
+		case 'AsParagraph':
+			return $mdgriffith$elm_ui$Internal$Model$paragraphClass;
+		default:
+			return $mdgriffith$elm_ui$Internal$Model$pageClass;
+	}
+};
+var $mdgriffith$elm_ui$Internal$Model$Keyed = function (a) {
+	return {$: 'Keyed', a: a};
+};
+var $mdgriffith$elm_ui$Internal$Model$NoStyleSheet = {$: 'NoStyleSheet'};
+var $mdgriffith$elm_ui$Internal$Model$Styled = function (a) {
+	return {$: 'Styled', a: a};
+};
+var $mdgriffith$elm_ui$Internal$Model$Unstyled = function (a) {
+	return {$: 'Unstyled', a: a};
+};
+var $mdgriffith$elm_ui$Internal$Model$addChildren = F2(
+	function (existing, nearbyChildren) {
+		switch (nearbyChildren.$) {
+			case 'NoNearbyChildren':
+				return existing;
+			case 'ChildrenBehind':
+				var behind = nearbyChildren.a;
+				return _Utils_ap(behind, existing);
+			case 'ChildrenInFront':
+				var inFront = nearbyChildren.a;
+				return _Utils_ap(existing, inFront);
+			default:
+				var behind = nearbyChildren.a;
+				var inFront = nearbyChildren.b;
+				return _Utils_ap(
+					behind,
+					_Utils_ap(existing, inFront));
+		}
+	});
+var $mdgriffith$elm_ui$Internal$Model$addKeyedChildren = F3(
+	function (key, existing, nearbyChildren) {
+		switch (nearbyChildren.$) {
+			case 'NoNearbyChildren':
+				return existing;
+			case 'ChildrenBehind':
+				var behind = nearbyChildren.a;
+				return _Utils_ap(
+					A2(
+						$elm$core$List$map,
+						function (x) {
+							return _Utils_Tuple2(key, x);
+						},
+						behind),
+					existing);
+			case 'ChildrenInFront':
+				var inFront = nearbyChildren.a;
+				return _Utils_ap(
+					existing,
+					A2(
+						$elm$core$List$map,
+						function (x) {
+							return _Utils_Tuple2(key, x);
+						},
+						inFront));
+			default:
+				var behind = nearbyChildren.a;
+				var inFront = nearbyChildren.b;
+				return _Utils_ap(
+					A2(
+						$elm$core$List$map,
+						function (x) {
+							return _Utils_Tuple2(key, x);
+						},
+						behind),
+					_Utils_ap(
+						existing,
+						A2(
+							$elm$core$List$map,
+							function (x) {
+								return _Utils_Tuple2(key, x);
+							},
+							inFront)));
+		}
+	});
+var $mdgriffith$elm_ui$Internal$Model$AsParagraph = {$: 'AsParagraph'};
+var $mdgriffith$elm_ui$Internal$Model$asParagraph = $mdgriffith$elm_ui$Internal$Model$AsParagraph;
+var $mdgriffith$elm_ui$Internal$Flag$alignBottom = $mdgriffith$elm_ui$Internal$Flag$flag(41);
+var $mdgriffith$elm_ui$Internal$Flag$alignRight = $mdgriffith$elm_ui$Internal$Flag$flag(40);
+var $mdgriffith$elm_ui$Internal$Flag$centerX = $mdgriffith$elm_ui$Internal$Flag$flag(42);
+var $mdgriffith$elm_ui$Internal$Flag$centerY = $mdgriffith$elm_ui$Internal$Flag$flag(43);
+var $elm$html$Html$Attributes$stringProperty = F2(
+	function (key, string) {
+		return A2(
+			_VirtualDom_property,
+			key,
+			$elm$json$Json$Encode$string(string));
+	});
+var $elm$html$Html$Attributes$class = $elm$html$Html$Attributes$stringProperty('className');
+var $elm$html$Html$div = _VirtualDom_node('div');
+var $elm$core$Set$Set_elm_builtin = function (a) {
+	return {$: 'Set_elm_builtin', a: a};
+};
+var $elm$core$Set$empty = $elm$core$Set$Set_elm_builtin($elm$core$Dict$empty);
+var $mdgriffith$elm_ui$Internal$Model$lengthClassName = function (x) {
+	switch (x.$) {
+		case 'Px':
+			var px = x.a;
+			return $elm$core$String$fromInt(px) + 'px';
+		case 'Content':
+			return 'auto';
+		case 'Fill':
+			var i = x.a;
+			return $elm$core$String$fromInt(i) + 'fr';
+		case 'Min':
+			var min = x.a;
+			var len = x.b;
+			return 'min' + ($elm$core$String$fromInt(min) + $mdgriffith$elm_ui$Internal$Model$lengthClassName(len));
+		default:
+			var max = x.a;
+			var len = x.b;
+			return 'max' + ($elm$core$String$fromInt(max) + $mdgriffith$elm_ui$Internal$Model$lengthClassName(len));
+	}
+};
+var $mdgriffith$elm_ui$Internal$Model$transformClass = function (transform) {
+	switch (transform.$) {
+		case 'Untransformed':
+			return $elm$core$Maybe$Nothing;
+		case 'Moved':
+			var _v1 = transform.a;
+			var x = _v1.a;
+			var y = _v1.b;
+			var z = _v1.c;
+			return $elm$core$Maybe$Just(
+				'mv-' + ($mdgriffith$elm_ui$Internal$Model$floatClass(x) + ('-' + ($mdgriffith$elm_ui$Internal$Model$floatClass(y) + ('-' + $mdgriffith$elm_ui$Internal$Model$floatClass(z))))));
+		default:
+			var _v2 = transform.a;
+			var tx = _v2.a;
+			var ty = _v2.b;
+			var tz = _v2.c;
+			var _v3 = transform.b;
+			var sx = _v3.a;
+			var sy = _v3.b;
+			var sz = _v3.c;
+			var _v4 = transform.c;
+			var ox = _v4.a;
+			var oy = _v4.b;
+			var oz = _v4.c;
+			var angle = transform.d;
+			return $elm$core$Maybe$Just(
+				'tfrm-' + ($mdgriffith$elm_ui$Internal$Model$floatClass(tx) + ('-' + ($mdgriffith$elm_ui$Internal$Model$floatClass(ty) + ('-' + ($mdgriffith$elm_ui$Internal$Model$floatClass(tz) + ('-' + ($mdgriffith$elm_ui$Internal$Model$floatClass(sx) + ('-' + ($mdgriffith$elm_ui$Internal$Model$floatClass(sy) + ('-' + ($mdgriffith$elm_ui$Internal$Model$floatClass(sz) + ('-' + ($mdgriffith$elm_ui$Internal$Model$floatClass(ox) + ('-' + ($mdgriffith$elm_ui$Internal$Model$floatClass(oy) + ('-' + ($mdgriffith$elm_ui$Internal$Model$floatClass(oz) + ('-' + $mdgriffith$elm_ui$Internal$Model$floatClass(angle))))))))))))))))))));
+	}
+};
+var $mdgriffith$elm_ui$Internal$Model$getStyleName = function (style) {
+	switch (style.$) {
+		case 'Shadows':
+			var name = style.a;
+			return name;
+		case 'Transparency':
+			var name = style.a;
+			var o = style.b;
+			return name;
+		case 'Style':
+			var _class = style.a;
+			return _class;
+		case 'FontFamily':
+			var name = style.a;
+			return name;
+		case 'FontSize':
+			var i = style.a;
+			return 'font-size-' + $elm$core$String$fromInt(i);
+		case 'Single':
+			var _class = style.a;
+			return _class;
+		case 'Colored':
+			var _class = style.a;
+			return _class;
+		case 'SpacingStyle':
+			var cls = style.a;
+			var x = style.b;
+			var y = style.c;
+			return cls;
+		case 'PaddingStyle':
+			var cls = style.a;
+			var top = style.b;
+			var right = style.c;
+			var bottom = style.d;
+			var left = style.e;
+			return cls;
+		case 'BorderWidth':
+			var cls = style.a;
+			var top = style.b;
+			var right = style.c;
+			var bottom = style.d;
+			var left = style.e;
+			return cls;
+		case 'GridTemplateStyle':
+			var template = style.a;
+			return 'grid-rows-' + (A2(
+				$elm$core$String$join,
+				'-',
+				A2($elm$core$List$map, $mdgriffith$elm_ui$Internal$Model$lengthClassName, template.rows)) + ('-cols-' + (A2(
+				$elm$core$String$join,
+				'-',
+				A2($elm$core$List$map, $mdgriffith$elm_ui$Internal$Model$lengthClassName, template.columns)) + ('-space-x-' + ($mdgriffith$elm_ui$Internal$Model$lengthClassName(template.spacing.a) + ('-space-y-' + $mdgriffith$elm_ui$Internal$Model$lengthClassName(template.spacing.b)))))));
+		case 'GridPosition':
+			var pos = style.a;
+			return 'gp grid-pos-' + ($elm$core$String$fromInt(pos.row) + ('-' + ($elm$core$String$fromInt(pos.col) + ('-' + ($elm$core$String$fromInt(pos.width) + ('-' + $elm$core$String$fromInt(pos.height)))))));
+		case 'PseudoSelector':
+			var selector = style.a;
+			var subStyle = style.b;
+			var name = function () {
+				switch (selector.$) {
+					case 'Focus':
+						return 'fs';
+					case 'Hover':
+						return 'hv';
+					default:
+						return 'act';
+				}
+			}();
+			return A2(
+				$elm$core$String$join,
+				' ',
+				A2(
+					$elm$core$List$map,
+					function (sty) {
+						var _v1 = $mdgriffith$elm_ui$Internal$Model$getStyleName(sty);
+						if (_v1 === '') {
+							return '';
+						} else {
+							var styleName = _v1;
+							return styleName + ('-' + name);
+						}
+					},
+					subStyle));
+		default:
+			var x = style.a;
+			return A2(
+				$elm$core$Maybe$withDefault,
+				'',
+				$mdgriffith$elm_ui$Internal$Model$transformClass(x));
+	}
+};
+var $elm$core$Set$insert = F2(
+	function (key, _v0) {
+		var dict = _v0.a;
+		return $elm$core$Set$Set_elm_builtin(
+			A3($elm$core$Dict$insert, key, _Utils_Tuple0, dict));
+	});
+var $elm$core$Dict$member = F2(
+	function (key, dict) {
+		var _v0 = A2($elm$core$Dict$get, key, dict);
+		if (_v0.$ === 'Just') {
+			return true;
+		} else {
+			return false;
+		}
+	});
+var $elm$core$Set$member = F2(
+	function (key, _v0) {
+		var dict = _v0.a;
+		return A2($elm$core$Dict$member, key, dict);
+	});
+var $mdgriffith$elm_ui$Internal$Model$reduceStyles = F2(
+	function (style, nevermind) {
+		var cache = nevermind.a;
+		var existing = nevermind.b;
+		var styleName = $mdgriffith$elm_ui$Internal$Model$getStyleName(style);
+		return A2($elm$core$Set$member, styleName, cache) ? nevermind : _Utils_Tuple2(
+			A2($elm$core$Set$insert, styleName, cache),
+			A2($elm$core$List$cons, style, existing));
+	});
+var $mdgriffith$elm_ui$Internal$Model$Property = F2(
+	function (a, b) {
+		return {$: 'Property', a: a, b: b};
+	});
+var $mdgriffith$elm_ui$Internal$Model$Style = F2(
+	function (a, b) {
+		return {$: 'Style', a: a, b: b};
+	});
+var $mdgriffith$elm_ui$Internal$Style$dot = function (c) {
+	return '.' + c;
+};
+var $elm$core$String$fromFloat = _String_fromNumber;
+var $mdgriffith$elm_ui$Internal$Model$formatColor = function (_v0) {
+	var red = _v0.a;
+	var green = _v0.b;
+	var blue = _v0.c;
+	var alpha = _v0.d;
+	return 'rgba(' + ($elm$core$String$fromInt(
+		$elm$core$Basics$round(red * 255)) + ((',' + $elm$core$String$fromInt(
+		$elm$core$Basics$round(green * 255))) + ((',' + $elm$core$String$fromInt(
+		$elm$core$Basics$round(blue * 255))) + (',' + ($elm$core$String$fromFloat(alpha) + ')')))));
+};
+var $mdgriffith$elm_ui$Internal$Model$formatBoxShadow = function (shadow) {
+	return A2(
+		$elm$core$String$join,
+		' ',
+		A2(
+			$elm$core$List$filterMap,
+			$elm$core$Basics$identity,
+			_List_fromArray(
+				[
+					shadow.inset ? $elm$core$Maybe$Just('inset') : $elm$core$Maybe$Nothing,
+					$elm$core$Maybe$Just(
+					$elm$core$String$fromFloat(shadow.offset.a) + 'px'),
+					$elm$core$Maybe$Just(
+					$elm$core$String$fromFloat(shadow.offset.b) + 'px'),
+					$elm$core$Maybe$Just(
+					$elm$core$String$fromFloat(shadow.blur) + 'px'),
+					$elm$core$Maybe$Just(
+					$elm$core$String$fromFloat(shadow.size) + 'px'),
+					$elm$core$Maybe$Just(
+					$mdgriffith$elm_ui$Internal$Model$formatColor(shadow.color))
+				])));
+};
+var $mdgriffith$elm_ui$Internal$Model$renderFocusStyle = function (focus) {
+	return _List_fromArray(
+		[
+			A2(
+			$mdgriffith$elm_ui$Internal$Model$Style,
+			$mdgriffith$elm_ui$Internal$Style$dot($mdgriffith$elm_ui$Internal$Style$classes.focusedWithin) + ':focus-within',
+			A2(
+				$elm$core$List$filterMap,
+				$elm$core$Basics$identity,
+				_List_fromArray(
+					[
+						A2(
+						$elm$core$Maybe$map,
+						function (color) {
+							return A2(
+								$mdgriffith$elm_ui$Internal$Model$Property,
+								'border-color',
+								$mdgriffith$elm_ui$Internal$Model$formatColor(color));
+						},
+						focus.borderColor),
+						A2(
+						$elm$core$Maybe$map,
+						function (color) {
+							return A2(
+								$mdgriffith$elm_ui$Internal$Model$Property,
+								'background-color',
+								$mdgriffith$elm_ui$Internal$Model$formatColor(color));
+						},
+						focus.backgroundColor),
+						A2(
+						$elm$core$Maybe$map,
+						function (shadow) {
+							return A2(
+								$mdgriffith$elm_ui$Internal$Model$Property,
+								'box-shadow',
+								$mdgriffith$elm_ui$Internal$Model$formatBoxShadow(
+									{
+										blur: shadow.blur,
+										color: shadow.color,
+										inset: false,
+										offset: A2(
+											$elm$core$Tuple$mapSecond,
+											$elm$core$Basics$toFloat,
+											A2($elm$core$Tuple$mapFirst, $elm$core$Basics$toFloat, shadow.offset)),
+										size: shadow.size
+									}));
+						},
+						focus.shadow),
+						$elm$core$Maybe$Just(
+						A2($mdgriffith$elm_ui$Internal$Model$Property, 'outline', 'none'))
+					]))),
+			A2(
+			$mdgriffith$elm_ui$Internal$Model$Style,
+			($mdgriffith$elm_ui$Internal$Style$dot($mdgriffith$elm_ui$Internal$Style$classes.any) + ':focus .focusable, ') + (($mdgriffith$elm_ui$Internal$Style$dot($mdgriffith$elm_ui$Internal$Style$classes.any) + '.focusable:focus, ') + ('.ui-slide-bar:focus + ' + ($mdgriffith$elm_ui$Internal$Style$dot($mdgriffith$elm_ui$Internal$Style$classes.any) + ' .focusable-thumb'))),
+			A2(
+				$elm$core$List$filterMap,
+				$elm$core$Basics$identity,
+				_List_fromArray(
+					[
+						A2(
+						$elm$core$Maybe$map,
+						function (color) {
+							return A2(
+								$mdgriffith$elm_ui$Internal$Model$Property,
+								'border-color',
+								$mdgriffith$elm_ui$Internal$Model$formatColor(color));
+						},
+						focus.borderColor),
+						A2(
+						$elm$core$Maybe$map,
+						function (color) {
+							return A2(
+								$mdgriffith$elm_ui$Internal$Model$Property,
+								'background-color',
+								$mdgriffith$elm_ui$Internal$Model$formatColor(color));
+						},
+						focus.backgroundColor),
+						A2(
+						$elm$core$Maybe$map,
+						function (shadow) {
+							return A2(
+								$mdgriffith$elm_ui$Internal$Model$Property,
+								'box-shadow',
+								$mdgriffith$elm_ui$Internal$Model$formatBoxShadow(
+									{
+										blur: shadow.blur,
+										color: shadow.color,
+										inset: false,
+										offset: A2(
+											$elm$core$Tuple$mapSecond,
+											$elm$core$Basics$toFloat,
+											A2($elm$core$Tuple$mapFirst, $elm$core$Basics$toFloat, shadow.offset)),
+										size: shadow.size
+									}));
+						},
+						focus.shadow),
+						$elm$core$Maybe$Just(
+						A2($mdgriffith$elm_ui$Internal$Model$Property, 'outline', 'none'))
+					])))
+		]);
+};
+var $elm$virtual_dom$VirtualDom$node = function (tag) {
+	return _VirtualDom_node(
+		_VirtualDom_noScript(tag));
+};
+var $elm$virtual_dom$VirtualDom$property = F2(
+	function (key, value) {
+		return A2(
+			_VirtualDom_property,
+			_VirtualDom_noInnerHtmlOrFormAction(key),
+			_VirtualDom_noJavaScriptOrHtmlJson(value));
+	});
+var $mdgriffith$elm_ui$Internal$Style$AllChildren = F2(
+	function (a, b) {
+		return {$: 'AllChildren', a: a, b: b};
+	});
+var $mdgriffith$elm_ui$Internal$Style$Batch = function (a) {
+	return {$: 'Batch', a: a};
+};
+var $mdgriffith$elm_ui$Internal$Style$Child = F2(
+	function (a, b) {
+		return {$: 'Child', a: a, b: b};
+	});
+var $mdgriffith$elm_ui$Internal$Style$Class = F2(
+	function (a, b) {
+		return {$: 'Class', a: a, b: b};
+	});
+var $mdgriffith$elm_ui$Internal$Style$Descriptor = F2(
+	function (a, b) {
+		return {$: 'Descriptor', a: a, b: b};
+	});
+var $mdgriffith$elm_ui$Internal$Style$Left = {$: 'Left'};
+var $mdgriffith$elm_ui$Internal$Style$Prop = F2(
+	function (a, b) {
+		return {$: 'Prop', a: a, b: b};
+	});
+var $mdgriffith$elm_ui$Internal$Style$Right = {$: 'Right'};
+var $mdgriffith$elm_ui$Internal$Style$Self = function (a) {
+	return {$: 'Self', a: a};
+};
+var $mdgriffith$elm_ui$Internal$Style$Supports = F2(
+	function (a, b) {
+		return {$: 'Supports', a: a, b: b};
+	});
+var $mdgriffith$elm_ui$Internal$Style$Content = function (a) {
+	return {$: 'Content', a: a};
+};
+var $mdgriffith$elm_ui$Internal$Style$Bottom = {$: 'Bottom'};
+var $mdgriffith$elm_ui$Internal$Style$CenterX = {$: 'CenterX'};
+var $mdgriffith$elm_ui$Internal$Style$CenterY = {$: 'CenterY'};
+var $mdgriffith$elm_ui$Internal$Style$Top = {$: 'Top'};
+var $mdgriffith$elm_ui$Internal$Style$alignments = _List_fromArray(
+	[$mdgriffith$elm_ui$Internal$Style$Top, $mdgriffith$elm_ui$Internal$Style$Bottom, $mdgriffith$elm_ui$Internal$Style$Right, $mdgriffith$elm_ui$Internal$Style$Left, $mdgriffith$elm_ui$Internal$Style$CenterX, $mdgriffith$elm_ui$Internal$Style$CenterY]);
+var $mdgriffith$elm_ui$Internal$Style$contentName = function (desc) {
+	switch (desc.a.$) {
+		case 'Top':
+			var _v1 = desc.a;
+			return $mdgriffith$elm_ui$Internal$Style$dot($mdgriffith$elm_ui$Internal$Style$classes.contentTop);
+		case 'Bottom':
+			var _v2 = desc.a;
+			return $mdgriffith$elm_ui$Internal$Style$dot($mdgriffith$elm_ui$Internal$Style$classes.contentBottom);
+		case 'Right':
+			var _v3 = desc.a;
+			return $mdgriffith$elm_ui$Internal$Style$dot($mdgriffith$elm_ui$Internal$Style$classes.contentRight);
+		case 'Left':
+			var _v4 = desc.a;
+			return $mdgriffith$elm_ui$Internal$Style$dot($mdgriffith$elm_ui$Internal$Style$classes.contentLeft);
+		case 'CenterX':
+			var _v5 = desc.a;
+			return $mdgriffith$elm_ui$Internal$Style$dot($mdgriffith$elm_ui$Internal$Style$classes.contentCenterX);
+		default:
+			var _v6 = desc.a;
+			return $mdgriffith$elm_ui$Internal$Style$dot($mdgriffith$elm_ui$Internal$Style$classes.contentCenterY);
+	}
+};
+var $mdgriffith$elm_ui$Internal$Style$selfName = function (desc) {
+	switch (desc.a.$) {
+		case 'Top':
+			var _v1 = desc.a;
+			return $mdgriffith$elm_ui$Internal$Style$dot($mdgriffith$elm_ui$Internal$Style$classes.alignTop);
+		case 'Bottom':
+			var _v2 = desc.a;
+			return $mdgriffith$elm_ui$Internal$Style$dot($mdgriffith$elm_ui$Internal$Style$classes.alignBottom);
+		case 'Right':
+			var _v3 = desc.a;
+			return $mdgriffith$elm_ui$Internal$Style$dot($mdgriffith$elm_ui$Internal$Style$classes.alignRight);
+		case 'Left':
+			var _v4 = desc.a;
+			return $mdgriffith$elm_ui$Internal$Style$dot($mdgriffith$elm_ui$Internal$Style$classes.alignLeft);
+		case 'CenterX':
+			var _v5 = desc.a;
+			return $mdgriffith$elm_ui$Internal$Style$dot($mdgriffith$elm_ui$Internal$Style$classes.alignCenterX);
+		default:
+			var _v6 = desc.a;
+			return $mdgriffith$elm_ui$Internal$Style$dot($mdgriffith$elm_ui$Internal$Style$classes.alignCenterY);
+	}
+};
+var $mdgriffith$elm_ui$Internal$Style$describeAlignment = function (values) {
+	var createDescription = function (alignment) {
+		var _v0 = values(alignment);
+		var content = _v0.a;
+		var indiv = _v0.b;
+		return _List_fromArray(
+			[
+				A2(
+				$mdgriffith$elm_ui$Internal$Style$Descriptor,
+				$mdgriffith$elm_ui$Internal$Style$contentName(
+					$mdgriffith$elm_ui$Internal$Style$Content(alignment)),
+				content),
+				A2(
+				$mdgriffith$elm_ui$Internal$Style$Child,
+				$mdgriffith$elm_ui$Internal$Style$dot($mdgriffith$elm_ui$Internal$Style$classes.any),
+				_List_fromArray(
+					[
+						A2(
+						$mdgriffith$elm_ui$Internal$Style$Descriptor,
+						$mdgriffith$elm_ui$Internal$Style$selfName(
+							$mdgriffith$elm_ui$Internal$Style$Self(alignment)),
+						indiv)
+					]))
+			]);
+	};
+	return $mdgriffith$elm_ui$Internal$Style$Batch(
+		A2($elm$core$List$concatMap, createDescription, $mdgriffith$elm_ui$Internal$Style$alignments));
+};
+var $mdgriffith$elm_ui$Internal$Style$elDescription = _List_fromArray(
+	[
+		A2($mdgriffith$elm_ui$Internal$Style$Prop, 'display', 'flex'),
+		A2($mdgriffith$elm_ui$Internal$Style$Prop, 'flex-direction', 'column'),
+		A2($mdgriffith$elm_ui$Internal$Style$Prop, 'white-space', 'pre'),
+		A2(
+		$mdgriffith$elm_ui$Internal$Style$Descriptor,
+		$mdgriffith$elm_ui$Internal$Style$dot($mdgriffith$elm_ui$Internal$Style$classes.hasBehind),
+		_List_fromArray(
+			[
+				A2($mdgriffith$elm_ui$Internal$Style$Prop, 'z-index', '0'),
+				A2(
+				$mdgriffith$elm_ui$Internal$Style$Child,
+				$mdgriffith$elm_ui$Internal$Style$dot($mdgriffith$elm_ui$Internal$Style$classes.behind),
+				_List_fromArray(
+					[
+						A2($mdgriffith$elm_ui$Internal$Style$Prop, 'z-index', '-1')
+					]))
+			])),
+		A2(
+		$mdgriffith$elm_ui$Internal$Style$Descriptor,
+		$mdgriffith$elm_ui$Internal$Style$dot($mdgriffith$elm_ui$Internal$Style$classes.seButton),
+		_List_fromArray(
+			[
+				A2(
+				$mdgriffith$elm_ui$Internal$Style$Child,
+				$mdgriffith$elm_ui$Internal$Style$dot($mdgriffith$elm_ui$Internal$Style$classes.text),
+				_List_fromArray(
+					[
+						A2(
+						$mdgriffith$elm_ui$Internal$Style$Descriptor,
+						$mdgriffith$elm_ui$Internal$Style$dot($mdgriffith$elm_ui$Internal$Style$classes.heightFill),
+						_List_fromArray(
+							[
+								A2($mdgriffith$elm_ui$Internal$Style$Prop, 'flex-grow', '0')
+							])),
+						A2(
+						$mdgriffith$elm_ui$Internal$Style$Descriptor,
+						$mdgriffith$elm_ui$Internal$Style$dot($mdgriffith$elm_ui$Internal$Style$classes.widthFill),
+						_List_fromArray(
+							[
+								A2($mdgriffith$elm_ui$Internal$Style$Prop, 'align-self', 'auto !important')
+							]))
+					]))
+			])),
+		A2(
+		$mdgriffith$elm_ui$Internal$Style$Child,
+		$mdgriffith$elm_ui$Internal$Style$dot($mdgriffith$elm_ui$Internal$Style$classes.heightContent),
+		_List_fromArray(
+			[
+				A2($mdgriffith$elm_ui$Internal$Style$Prop, 'height', 'auto')
+			])),
+		A2(
+		$mdgriffith$elm_ui$Internal$Style$Child,
+		$mdgriffith$elm_ui$Internal$Style$dot($mdgriffith$elm_ui$Internal$Style$classes.heightFill),
+		_List_fromArray(
+			[
+				A2($mdgriffith$elm_ui$Internal$Style$Prop, 'flex-grow', '100000')
+			])),
+		A2(
+		$mdgriffith$elm_ui$Internal$Style$Child,
+		$mdgriffith$elm_ui$Internal$Style$dot($mdgriffith$elm_ui$Internal$Style$classes.widthFill),
+		_List_fromArray(
+			[
+				A2($mdgriffith$elm_ui$Internal$Style$Prop, 'width', '100%')
+			])),
+		A2(
+		$mdgriffith$elm_ui$Internal$Style$Child,
+		$mdgriffith$elm_ui$Internal$Style$dot($mdgriffith$elm_ui$Internal$Style$classes.widthFillPortion),
+		_List_fromArray(
+			[
+				A2($mdgriffith$elm_ui$Internal$Style$Prop, 'width', '100%')
+			])),
+		A2(
+		$mdgriffith$elm_ui$Internal$Style$Child,
+		$mdgriffith$elm_ui$Internal$Style$dot($mdgriffith$elm_ui$Internal$Style$classes.widthContent),
+		_List_fromArray(
+			[
+				A2($mdgriffith$elm_ui$Internal$Style$Prop, 'align-self', 'flex-start')
+			])),
+		$mdgriffith$elm_ui$Internal$Style$describeAlignment(
+		function (alignment) {
+			switch (alignment.$) {
+				case 'Top':
+					return _Utils_Tuple2(
+						_List_fromArray(
+							[
+								A2($mdgriffith$elm_ui$Internal$Style$Prop, 'justify-content', 'flex-start')
+							]),
+						_List_fromArray(
+							[
+								A2($mdgriffith$elm_ui$Internal$Style$Prop, 'margin-bottom', 'auto !important'),
+								A2($mdgriffith$elm_ui$Internal$Style$Prop, 'margin-top', '0 !important')
+							]));
+				case 'Bottom':
+					return _Utils_Tuple2(
+						_List_fromArray(
+							[
+								A2($mdgriffith$elm_ui$Internal$Style$Prop, 'justify-content', 'flex-end')
+							]),
+						_List_fromArray(
+							[
+								A2($mdgriffith$elm_ui$Internal$Style$Prop, 'margin-top', 'auto !important'),
+								A2($mdgriffith$elm_ui$Internal$Style$Prop, 'margin-bottom', '0 !important')
+							]));
+				case 'Right':
+					return _Utils_Tuple2(
+						_List_fromArray(
+							[
+								A2($mdgriffith$elm_ui$Internal$Style$Prop, 'align-items', 'flex-end')
+							]),
+						_List_fromArray(
+							[
+								A2($mdgriffith$elm_ui$Internal$Style$Prop, 'align-self', 'flex-end')
+							]));
+				case 'Left':
+					return _Utils_Tuple2(
+						_List_fromArray(
+							[
+								A2($mdgriffith$elm_ui$Internal$Style$Prop, 'align-items', 'flex-start')
+							]),
+						_List_fromArray(
+							[
+								A2($mdgriffith$elm_ui$Internal$Style$Prop, 'align-self', 'flex-start')
+							]));
+				case 'CenterX':
+					return _Utils_Tuple2(
+						_List_fromArray(
+							[
+								A2($mdgriffith$elm_ui$Internal$Style$Prop, 'align-items', 'center')
+							]),
+						_List_fromArray(
+							[
+								A2($mdgriffith$elm_ui$Internal$Style$Prop, 'align-self', 'center')
+							]));
+				default:
+					return _Utils_Tuple2(
+						_List_fromArray(
+							[
+								A2(
+								$mdgriffith$elm_ui$Internal$Style$Child,
+								$mdgriffith$elm_ui$Internal$Style$dot($mdgriffith$elm_ui$Internal$Style$classes.any),
+								_List_fromArray(
+									[
+										A2($mdgriffith$elm_ui$Internal$Style$Prop, 'margin-top', 'auto'),
+										A2($mdgriffith$elm_ui$Internal$Style$Prop, 'margin-bottom', 'auto')
+									]))
+							]),
+						_List_fromArray(
+							[
+								A2($mdgriffith$elm_ui$Internal$Style$Prop, 'margin-top', 'auto !important'),
+								A2($mdgriffith$elm_ui$Internal$Style$Prop, 'margin-bottom', 'auto !important')
+							]));
+			}
+		})
+	]);
+var $mdgriffith$elm_ui$Internal$Style$gridAlignments = function (values) {
+	var createDescription = function (alignment) {
+		return _List_fromArray(
+			[
+				A2(
+				$mdgriffith$elm_ui$Internal$Style$Child,
+				$mdgriffith$elm_ui$Internal$Style$dot($mdgriffith$elm_ui$Internal$Style$classes.any),
+				_List_fromArray(
+					[
+						A2(
+						$mdgriffith$elm_ui$Internal$Style$Descriptor,
+						$mdgriffith$elm_ui$Internal$Style$selfName(
+							$mdgriffith$elm_ui$Internal$Style$Self(alignment)),
+						values(alignment))
+					]))
+			]);
+	};
+	return $mdgriffith$elm_ui$Internal$Style$Batch(
+		A2($elm$core$List$concatMap, createDescription, $mdgriffith$elm_ui$Internal$Style$alignments));
+};
+var $mdgriffith$elm_ui$Internal$Style$Above = {$: 'Above'};
+var $mdgriffith$elm_ui$Internal$Style$Behind = {$: 'Behind'};
+var $mdgriffith$elm_ui$Internal$Style$Below = {$: 'Below'};
+var $mdgriffith$elm_ui$Internal$Style$OnLeft = {$: 'OnLeft'};
+var $mdgriffith$elm_ui$Internal$Style$OnRight = {$: 'OnRight'};
+var $mdgriffith$elm_ui$Internal$Style$Within = {$: 'Within'};
+var $mdgriffith$elm_ui$Internal$Style$locations = function () {
+	var loc = $mdgriffith$elm_ui$Internal$Style$Above;
+	var _v0 = function () {
+		switch (loc.$) {
+			case 'Above':
+				return _Utils_Tuple0;
+			case 'Below':
+				return _Utils_Tuple0;
+			case 'OnRight':
+				return _Utils_Tuple0;
+			case 'OnLeft':
+				return _Utils_Tuple0;
+			case 'Within':
+				return _Utils_Tuple0;
+			default:
+				return _Utils_Tuple0;
+		}
+	}();
+	return _List_fromArray(
+		[$mdgriffith$elm_ui$Internal$Style$Above, $mdgriffith$elm_ui$Internal$Style$Below, $mdgriffith$elm_ui$Internal$Style$OnRight, $mdgriffith$elm_ui$Internal$Style$OnLeft, $mdgriffith$elm_ui$Internal$Style$Within, $mdgriffith$elm_ui$Internal$Style$Behind]);
+}();
+var $mdgriffith$elm_ui$Internal$Style$baseSheet = _List_fromArray(
+	[
+		A2(
+		$mdgriffith$elm_ui$Internal$Style$Class,
+		'html,body',
+		_List_fromArray(
+			[
+				A2($mdgriffith$elm_ui$Internal$Style$Prop, 'height', '100%'),
+				A2($mdgriffith$elm_ui$Internal$Style$Prop, 'padding', '0'),
+				A2($mdgriffith$elm_ui$Internal$Style$Prop, 'margin', '0')
+			])),
+		A2(
+		$mdgriffith$elm_ui$Internal$Style$Class,
+		_Utils_ap(
+			$mdgriffith$elm_ui$Internal$Style$dot($mdgriffith$elm_ui$Internal$Style$classes.any),
+			_Utils_ap(
+				$mdgriffith$elm_ui$Internal$Style$dot($mdgriffith$elm_ui$Internal$Style$classes.single),
+				$mdgriffith$elm_ui$Internal$Style$dot($mdgriffith$elm_ui$Internal$Style$classes.imageContainer))),
+		_List_fromArray(
+			[
+				A2($mdgriffith$elm_ui$Internal$Style$Prop, 'display', 'block'),
+				A2(
+				$mdgriffith$elm_ui$Internal$Style$Descriptor,
+				$mdgriffith$elm_ui$Internal$Style$dot($mdgriffith$elm_ui$Internal$Style$classes.heightFill),
+				_List_fromArray(
+					[
+						A2(
+						$mdgriffith$elm_ui$Internal$Style$Child,
+						'img',
+						_List_fromArray(
+							[
+								A2($mdgriffith$elm_ui$Internal$Style$Prop, 'max-height', '100%'),
+								A2($mdgriffith$elm_ui$Internal$Style$Prop, 'object-fit', 'cover')
+							]))
+					])),
+				A2(
+				$mdgriffith$elm_ui$Internal$Style$Descriptor,
+				$mdgriffith$elm_ui$Internal$Style$dot($mdgriffith$elm_ui$Internal$Style$classes.widthFill),
+				_List_fromArray(
+					[
+						A2(
+						$mdgriffith$elm_ui$Internal$Style$Child,
+						'img',
+						_List_fromArray(
+							[
+								A2($mdgriffith$elm_ui$Internal$Style$Prop, 'max-width', '100%'),
+								A2($mdgriffith$elm_ui$Internal$Style$Prop, 'object-fit', 'cover')
+							]))
+					]))
+			])),
+		A2(
+		$mdgriffith$elm_ui$Internal$Style$Class,
+		$mdgriffith$elm_ui$Internal$Style$dot($mdgriffith$elm_ui$Internal$Style$classes.any) + ':focus',
+		_List_fromArray(
+			[
+				A2($mdgriffith$elm_ui$Internal$Style$Prop, 'outline', 'none')
+			])),
+		A2(
+		$mdgriffith$elm_ui$Internal$Style$Class,
+		$mdgriffith$elm_ui$Internal$Style$dot($mdgriffith$elm_ui$Internal$Style$classes.root),
+		_List_fromArray(
+			[
+				A2($mdgriffith$elm_ui$Internal$Style$Prop, 'width', '100%'),
+				A2($mdgriffith$elm_ui$Internal$Style$Prop, 'height', 'auto'),
+				A2($mdgriffith$elm_ui$Internal$Style$Prop, 'min-height', '100%'),
+				A2($mdgriffith$elm_ui$Internal$Style$Prop, 'z-index', '0'),
+				A2(
+				$mdgriffith$elm_ui$Internal$Style$Descriptor,
+				_Utils_ap(
+					$mdgriffith$elm_ui$Internal$Style$dot($mdgriffith$elm_ui$Internal$Style$classes.any),
+					$mdgriffith$elm_ui$Internal$Style$dot($mdgriffith$elm_ui$Internal$Style$classes.heightFill)),
+				_List_fromArray(
+					[
+						A2($mdgriffith$elm_ui$Internal$Style$Prop, 'height', '100%'),
+						A2(
+						$mdgriffith$elm_ui$Internal$Style$Child,
+						$mdgriffith$elm_ui$Internal$Style$dot($mdgriffith$elm_ui$Internal$Style$classes.heightFill),
+						_List_fromArray(
+							[
+								A2($mdgriffith$elm_ui$Internal$Style$Prop, 'height', '100%')
+							]))
+					])),
+				A2(
+				$mdgriffith$elm_ui$Internal$Style$Child,
+				$mdgriffith$elm_ui$Internal$Style$dot($mdgriffith$elm_ui$Internal$Style$classes.inFront),
+				_List_fromArray(
+					[
+						A2(
+						$mdgriffith$elm_ui$Internal$Style$Descriptor,
+						$mdgriffith$elm_ui$Internal$Style$dot($mdgriffith$elm_ui$Internal$Style$classes.nearby),
+						_List_fromArray(
+							[
+								A2($mdgriffith$elm_ui$Internal$Style$Prop, 'position', 'fixed'),
+								A2($mdgriffith$elm_ui$Internal$Style$Prop, 'z-index', '20')
+							]))
+					]))
+			])),
+		A2(
+		$mdgriffith$elm_ui$Internal$Style$Class,
+		$mdgriffith$elm_ui$Internal$Style$dot($mdgriffith$elm_ui$Internal$Style$classes.nearby),
+		_List_fromArray(
+			[
+				A2($mdgriffith$elm_ui$Internal$Style$Prop, 'position', 'relative'),
+				A2($mdgriffith$elm_ui$Internal$Style$Prop, 'border', 'none'),
+				A2($mdgriffith$elm_ui$Internal$Style$Prop, 'display', 'flex'),
+				A2($mdgriffith$elm_ui$Internal$Style$Prop, 'flex-direction', 'row'),
+				A2($mdgriffith$elm_ui$Internal$Style$Prop, 'flex-basis', 'auto'),
+				A2(
+				$mdgriffith$elm_ui$Internal$Style$Descriptor,
+				$mdgriffith$elm_ui$Internal$Style$dot($mdgriffith$elm_ui$Internal$Style$classes.single),
+				$mdgriffith$elm_ui$Internal$Style$elDescription),
+				$mdgriffith$elm_ui$Internal$Style$Batch(
+				function (fn) {
+					return A2($elm$core$List$map, fn, $mdgriffith$elm_ui$Internal$Style$locations);
+				}(
+					function (loc) {
+						switch (loc.$) {
+							case 'Above':
+								return A2(
+									$mdgriffith$elm_ui$Internal$Style$Descriptor,
+									$mdgriffith$elm_ui$Internal$Style$dot($mdgriffith$elm_ui$Internal$Style$classes.above),
+									_List_fromArray(
+										[
+											A2($mdgriffith$elm_ui$Internal$Style$Prop, 'position', 'absolute'),
+											A2($mdgriffith$elm_ui$Internal$Style$Prop, 'bottom', '100%'),
+											A2($mdgriffith$elm_ui$Internal$Style$Prop, 'left', '0'),
+											A2($mdgriffith$elm_ui$Internal$Style$Prop, 'width', '100%'),
+											A2($mdgriffith$elm_ui$Internal$Style$Prop, 'z-index', '20'),
+											A2($mdgriffith$elm_ui$Internal$Style$Prop, 'margin', '0 !important'),
+											A2(
+											$mdgriffith$elm_ui$Internal$Style$Child,
+											$mdgriffith$elm_ui$Internal$Style$dot($mdgriffith$elm_ui$Internal$Style$classes.heightFill),
+											_List_fromArray(
+												[
+													A2($mdgriffith$elm_ui$Internal$Style$Prop, 'height', 'auto')
+												])),
+											A2(
+											$mdgriffith$elm_ui$Internal$Style$Child,
+											$mdgriffith$elm_ui$Internal$Style$dot($mdgriffith$elm_ui$Internal$Style$classes.widthFill),
+											_List_fromArray(
+												[
+													A2($mdgriffith$elm_ui$Internal$Style$Prop, 'width', '100%')
+												])),
+											A2($mdgriffith$elm_ui$Internal$Style$Prop, 'pointer-events', 'none'),
+											A2(
+											$mdgriffith$elm_ui$Internal$Style$Child,
+											'*',
+											_List_fromArray(
+												[
+													A2($mdgriffith$elm_ui$Internal$Style$Prop, 'pointer-events', 'auto')
+												]))
+										]));
+							case 'Below':
+								return A2(
+									$mdgriffith$elm_ui$Internal$Style$Descriptor,
+									$mdgriffith$elm_ui$Internal$Style$dot($mdgriffith$elm_ui$Internal$Style$classes.below),
+									_List_fromArray(
+										[
+											A2($mdgriffith$elm_ui$Internal$Style$Prop, 'position', 'absolute'),
+											A2($mdgriffith$elm_ui$Internal$Style$Prop, 'bottom', '0'),
+											A2($mdgriffith$elm_ui$Internal$Style$Prop, 'left', '0'),
+											A2($mdgriffith$elm_ui$Internal$Style$Prop, 'height', '0'),
+											A2($mdgriffith$elm_ui$Internal$Style$Prop, 'width', '100%'),
+											A2($mdgriffith$elm_ui$Internal$Style$Prop, 'z-index', '20'),
+											A2($mdgriffith$elm_ui$Internal$Style$Prop, 'margin', '0 !important'),
+											A2($mdgriffith$elm_ui$Internal$Style$Prop, 'pointer-events', 'none'),
+											A2(
+											$mdgriffith$elm_ui$Internal$Style$Child,
+											'*',
+											_List_fromArray(
+												[
+													A2($mdgriffith$elm_ui$Internal$Style$Prop, 'pointer-events', 'auto')
+												])),
+											A2(
+											$mdgriffith$elm_ui$Internal$Style$Child,
+											$mdgriffith$elm_ui$Internal$Style$dot($mdgriffith$elm_ui$Internal$Style$classes.heightFill),
+											_List_fromArray(
+												[
+													A2($mdgriffith$elm_ui$Internal$Style$Prop, 'height', 'auto')
+												]))
+										]));
+							case 'OnRight':
+								return A2(
+									$mdgriffith$elm_ui$Internal$Style$Descriptor,
+									$mdgriffith$elm_ui$Internal$Style$dot($mdgriffith$elm_ui$Internal$Style$classes.onRight),
+									_List_fromArray(
+										[
+											A2($mdgriffith$elm_ui$Internal$Style$Prop, 'position', 'absolute'),
+											A2($mdgriffith$elm_ui$Internal$Style$Prop, 'left', '100%'),
+											A2($mdgriffith$elm_ui$Internal$Style$Prop, 'top', '0'),
+											A2($mdgriffith$elm_ui$Internal$Style$Prop, 'height', '100%'),
+											A2($mdgriffith$elm_ui$Internal$Style$Prop, 'margin', '0 !important'),
+											A2($mdgriffith$elm_ui$Internal$Style$Prop, 'z-index', '20'),
+											A2($mdgriffith$elm_ui$Internal$Style$Prop, 'pointer-events', 'none'),
+											A2(
+											$mdgriffith$elm_ui$Internal$Style$Child,
+											'*',
+											_List_fromArray(
+												[
+													A2($mdgriffith$elm_ui$Internal$Style$Prop, 'pointer-events', 'auto')
+												]))
+										]));
+							case 'OnLeft':
+								return A2(
+									$mdgriffith$elm_ui$Internal$Style$Descriptor,
+									$mdgriffith$elm_ui$Internal$Style$dot($mdgriffith$elm_ui$Internal$Style$classes.onLeft),
+									_List_fromArray(
+										[
+											A2($mdgriffith$elm_ui$Internal$Style$Prop, 'position', 'absolute'),
+											A2($mdgriffith$elm_ui$Internal$Style$Prop, 'right', '100%'),
+											A2($mdgriffith$elm_ui$Internal$Style$Prop, 'top', '0'),
+											A2($mdgriffith$elm_ui$Internal$Style$Prop, 'height', '100%'),
+											A2($mdgriffith$elm_ui$Internal$Style$Prop, 'margin', '0 !important'),
+											A2($mdgriffith$elm_ui$Internal$Style$Prop, 'z-index', '20'),
+											A2($mdgriffith$elm_ui$Internal$Style$Prop, 'pointer-events', 'none'),
+											A2(
+											$mdgriffith$elm_ui$Internal$Style$Child,
+											'*',
+											_List_fromArray(
+												[
+													A2($mdgriffith$elm_ui$Internal$Style$Prop, 'pointer-events', 'auto')
+												]))
+										]));
+							case 'Within':
+								return A2(
+									$mdgriffith$elm_ui$Internal$Style$Descriptor,
+									$mdgriffith$elm_ui$Internal$Style$dot($mdgriffith$elm_ui$Internal$Style$classes.inFront),
+									_List_fromArray(
+										[
+											A2($mdgriffith$elm_ui$Internal$Style$Prop, 'position', 'absolute'),
+											A2($mdgriffith$elm_ui$Internal$Style$Prop, 'width', '100%'),
+											A2($mdgriffith$elm_ui$Internal$Style$Prop, 'height', '100%'),
+											A2($mdgriffith$elm_ui$Internal$Style$Prop, 'left', '0'),
+											A2($mdgriffith$elm_ui$Internal$Style$Prop, 'top', '0'),
+											A2($mdgriffith$elm_ui$Internal$Style$Prop, 'margin', '0 !important'),
+											A2($mdgriffith$elm_ui$Internal$Style$Prop, 'pointer-events', 'none'),
+											A2(
+											$mdgriffith$elm_ui$Internal$Style$Child,
+											'*',
+											_List_fromArray(
+												[
+													A2($mdgriffith$elm_ui$Internal$Style$Prop, 'pointer-events', 'auto')
+												]))
+										]));
+							default:
+								return A2(
+									$mdgriffith$elm_ui$Internal$Style$Descriptor,
+									$mdgriffith$elm_ui$Internal$Style$dot($mdgriffith$elm_ui$Internal$Style$classes.behind),
+									_List_fromArray(
+										[
+											A2($mdgriffith$elm_ui$Internal$Style$Prop, 'position', 'absolute'),
+											A2($mdgriffith$elm_ui$Internal$Style$Prop, 'width', '100%'),
+											A2($mdgriffith$elm_ui$Internal$Style$Prop, 'height', '100%'),
+											A2($mdgriffith$elm_ui$Internal$Style$Prop, 'left', '0'),
+											A2($mdgriffith$elm_ui$Internal$Style$Prop, 'top', '0'),
+											A2($mdgriffith$elm_ui$Internal$Style$Prop, 'margin', '0 !important'),
+											A2($mdgriffith$elm_ui$Internal$Style$Prop, 'z-index', '0'),
+											A2($mdgriffith$elm_ui$Internal$Style$Prop, 'pointer-events', 'none'),
+											A2(
+											$mdgriffith$elm_ui$Internal$Style$Child,
+											'*',
+											_List_fromArray(
+												[
+													A2($mdgriffith$elm_ui$Internal$Style$Prop, 'pointer-events', 'auto')
+												]))
+										]));
+						}
+					}))
+			])),
+		A2(
+		$mdgriffith$elm_ui$Internal$Style$Class,
+		$mdgriffith$elm_ui$Internal$Style$dot($mdgriffith$elm_ui$Internal$Style$classes.any),
+		_List_fromArray(
+			[
+				A2($mdgriffith$elm_ui$Internal$Style$Prop, 'position', 'relative'),
+				A2($mdgriffith$elm_ui$Internal$Style$Prop, 'border', 'none'),
+				A2($mdgriffith$elm_ui$Internal$Style$Prop, 'flex-shrink', '0'),
+				A2($mdgriffith$elm_ui$Internal$Style$Prop, 'display', 'flex'),
+				A2($mdgriffith$elm_ui$Internal$Style$Prop, 'flex-direction', 'row'),
+				A2($mdgriffith$elm_ui$Internal$Style$Prop, 'flex-basis', 'auto'),
+				A2($mdgriffith$elm_ui$Internal$Style$Prop, 'resize', 'none'),
+				A2($mdgriffith$elm_ui$Internal$Style$Prop, 'font-feature-settings', 'inherit'),
+				A2($mdgriffith$elm_ui$Internal$Style$Prop, 'box-sizing', 'border-box'),
+				A2($mdgriffith$elm_ui$Internal$Style$Prop, 'margin', '0'),
+				A2($mdgriffith$elm_ui$Internal$Style$Prop, 'padding', '0'),
+				A2($mdgriffith$elm_ui$Internal$Style$Prop, 'border-width', '0'),
+				A2($mdgriffith$elm_ui$Internal$Style$Prop, 'border-style', 'solid'),
+				A2($mdgriffith$elm_ui$Internal$Style$Prop, 'font-size', 'inherit'),
+				A2($mdgriffith$elm_ui$Internal$Style$Prop, 'color', 'inherit'),
+				A2($mdgriffith$elm_ui$Internal$Style$Prop, 'font-family', 'inherit'),
+				A2($mdgriffith$elm_ui$Internal$Style$Prop, 'line-height', '1'),
+				A2($mdgriffith$elm_ui$Internal$Style$Prop, 'font-weight', 'inherit'),
+				A2($mdgriffith$elm_ui$Internal$Style$Prop, 'text-decoration', 'none'),
+				A2($mdgriffith$elm_ui$Internal$Style$Prop, 'font-style', 'inherit'),
+				A2(
+				$mdgriffith$elm_ui$Internal$Style$Descriptor,
+				$mdgriffith$elm_ui$Internal$Style$dot($mdgriffith$elm_ui$Internal$Style$classes.wrapped),
+				_List_fromArray(
+					[
+						A2($mdgriffith$elm_ui$Internal$Style$Prop, 'flex-wrap', 'wrap')
+					])),
+				A2(
+				$mdgriffith$elm_ui$Internal$Style$Descriptor,
+				$mdgriffith$elm_ui$Internal$Style$dot($mdgriffith$elm_ui$Internal$Style$classes.noTextSelection),
+				_List_fromArray(
+					[
+						A2($mdgriffith$elm_ui$Internal$Style$Prop, '-moz-user-select', 'none'),
+						A2($mdgriffith$elm_ui$Internal$Style$Prop, '-webkit-user-select', 'none'),
+						A2($mdgriffith$elm_ui$Internal$Style$Prop, '-ms-user-select', 'none'),
+						A2($mdgriffith$elm_ui$Internal$Style$Prop, 'user-select', 'none')
+					])),
+				A2(
+				$mdgriffith$elm_ui$Internal$Style$Descriptor,
+				$mdgriffith$elm_ui$Internal$Style$dot($mdgriffith$elm_ui$Internal$Style$classes.cursorPointer),
+				_List_fromArray(
+					[
+						A2($mdgriffith$elm_ui$Internal$Style$Prop, 'cursor', 'pointer')
+					])),
+				A2(
+				$mdgriffith$elm_ui$Internal$Style$Descriptor,
+				$mdgriffith$elm_ui$Internal$Style$dot($mdgriffith$elm_ui$Internal$Style$classes.cursorText),
+				_List_fromArray(
+					[
+						A2($mdgriffith$elm_ui$Internal$Style$Prop, 'cursor', 'text')
+					])),
+				A2(
+				$mdgriffith$elm_ui$Internal$Style$Descriptor,
+				$mdgriffith$elm_ui$Internal$Style$dot($mdgriffith$elm_ui$Internal$Style$classes.passPointerEvents),
+				_List_fromArray(
+					[
+						A2($mdgriffith$elm_ui$Internal$Style$Prop, 'pointer-events', 'none !important')
+					])),
+				A2(
+				$mdgriffith$elm_ui$Internal$Style$Descriptor,
+				$mdgriffith$elm_ui$Internal$Style$dot($mdgriffith$elm_ui$Internal$Style$classes.capturePointerEvents),
+				_List_fromArray(
+					[
+						A2($mdgriffith$elm_ui$Internal$Style$Prop, 'pointer-events', 'auto !important')
+					])),
+				A2(
+				$mdgriffith$elm_ui$Internal$Style$Descriptor,
+				$mdgriffith$elm_ui$Internal$Style$dot($mdgriffith$elm_ui$Internal$Style$classes.transparent),
+				_List_fromArray(
+					[
+						A2($mdgriffith$elm_ui$Internal$Style$Prop, 'opacity', '0')
+					])),
+				A2(
+				$mdgriffith$elm_ui$Internal$Style$Descriptor,
+				$mdgriffith$elm_ui$Internal$Style$dot($mdgriffith$elm_ui$Internal$Style$classes.opaque),
+				_List_fromArray(
+					[
+						A2($mdgriffith$elm_ui$Internal$Style$Prop, 'opacity', '1')
+					])),
+				A2(
+				$mdgriffith$elm_ui$Internal$Style$Descriptor,
+				$mdgriffith$elm_ui$Internal$Style$dot(
+					_Utils_ap($mdgriffith$elm_ui$Internal$Style$classes.hover, $mdgriffith$elm_ui$Internal$Style$classes.transparent)) + ':hover',
+				_List_fromArray(
+					[
+						A2($mdgriffith$elm_ui$Internal$Style$Prop, 'opacity', '0')
+					])),
+				A2(
+				$mdgriffith$elm_ui$Internal$Style$Descriptor,
+				$mdgriffith$elm_ui$Internal$Style$dot(
+					_Utils_ap($mdgriffith$elm_ui$Internal$Style$classes.hover, $mdgriffith$elm_ui$Internal$Style$classes.opaque)) + ':hover',
+				_List_fromArray(
+					[
+						A2($mdgriffith$elm_ui$Internal$Style$Prop, 'opacity', '1')
+					])),
+				A2(
+				$mdgriffith$elm_ui$Internal$Style$Descriptor,
+				$mdgriffith$elm_ui$Internal$Style$dot(
+					_Utils_ap($mdgriffith$elm_ui$Internal$Style$classes.focus, $mdgriffith$elm_ui$Internal$Style$classes.transparent)) + ':focus',
+				_List_fromArray(
+					[
+						A2($mdgriffith$elm_ui$Internal$Style$Prop, 'opacity', '0')
+					])),
+				A2(
+				$mdgriffith$elm_ui$Internal$Style$Descriptor,
+				$mdgriffith$elm_ui$Internal$Style$dot(
+					_Utils_ap($mdgriffith$elm_ui$Internal$Style$classes.focus, $mdgriffith$elm_ui$Internal$Style$classes.opaque)) + ':focus',
+				_List_fromArray(
+					[
+						A2($mdgriffith$elm_ui$Internal$Style$Prop, 'opacity', '1')
+					])),
+				A2(
+				$mdgriffith$elm_ui$Internal$Style$Descriptor,
+				$mdgriffith$elm_ui$Internal$Style$dot(
+					_Utils_ap($mdgriffith$elm_ui$Internal$Style$classes.active, $mdgriffith$elm_ui$Internal$Style$classes.transparent)) + ':active',
+				_List_fromArray(
+					[
+						A2($mdgriffith$elm_ui$Internal$Style$Prop, 'opacity', '0')
+					])),
+				A2(
+				$mdgriffith$elm_ui$Internal$Style$Descriptor,
+				$mdgriffith$elm_ui$Internal$Style$dot(
+					_Utils_ap($mdgriffith$elm_ui$Internal$Style$classes.active, $mdgriffith$elm_ui$Internal$Style$classes.opaque)) + ':active',
+				_List_fromArray(
+					[
+						A2($mdgriffith$elm_ui$Internal$Style$Prop, 'opacity', '1')
+					])),
+				A2(
+				$mdgriffith$elm_ui$Internal$Style$Descriptor,
+				$mdgriffith$elm_ui$Internal$Style$dot($mdgriffith$elm_ui$Internal$Style$classes.transition),
+				_List_fromArray(
+					[
+						A2(
+						$mdgriffith$elm_ui$Internal$Style$Prop,
+						'transition',
+						A2(
+							$elm$core$String$join,
+							', ',
+							A2(
+								$elm$core$List$map,
+								function (x) {
+									return x + ' 160ms';
+								},
+								_List_fromArray(
+									['transform', 'opacity', 'filter', 'background-color', 'color', 'font-size']))))
+					])),
+				A2(
+				$mdgriffith$elm_ui$Internal$Style$Descriptor,
+				$mdgriffith$elm_ui$Internal$Style$dot($mdgriffith$elm_ui$Internal$Style$classes.scrollbars),
+				_List_fromArray(
+					[
+						A2($mdgriffith$elm_ui$Internal$Style$Prop, 'overflow', 'auto'),
+						A2($mdgriffith$elm_ui$Internal$Style$Prop, 'flex-shrink', '1')
+					])),
+				A2(
+				$mdgriffith$elm_ui$Internal$Style$Descriptor,
+				$mdgriffith$elm_ui$Internal$Style$dot($mdgriffith$elm_ui$Internal$Style$classes.scrollbarsX),
+				_List_fromArray(
+					[
+						A2($mdgriffith$elm_ui$Internal$Style$Prop, 'overflow-x', 'auto'),
+						A2(
+						$mdgriffith$elm_ui$Internal$Style$Descriptor,
+						$mdgriffith$elm_ui$Internal$Style$dot($mdgriffith$elm_ui$Internal$Style$classes.row),
+						_List_fromArray(
+							[
+								A2($mdgriffith$elm_ui$Internal$Style$Prop, 'flex-shrink', '1')
+							]))
+					])),
+				A2(
+				$mdgriffith$elm_ui$Internal$Style$Descriptor,
+				$mdgriffith$elm_ui$Internal$Style$dot($mdgriffith$elm_ui$Internal$Style$classes.scrollbarsY),
+				_List_fromArray(
+					[
+						A2($mdgriffith$elm_ui$Internal$Style$Prop, 'overflow-y', 'auto'),
+						A2(
+						$mdgriffith$elm_ui$Internal$Style$Descriptor,
+						$mdgriffith$elm_ui$Internal$Style$dot($mdgriffith$elm_ui$Internal$Style$classes.column),
+						_List_fromArray(
+							[
+								A2($mdgriffith$elm_ui$Internal$Style$Prop, 'flex-shrink', '1')
+							])),
+						A2(
+						$mdgriffith$elm_ui$Internal$Style$Descriptor,
+						$mdgriffith$elm_ui$Internal$Style$dot($mdgriffith$elm_ui$Internal$Style$classes.single),
+						_List_fromArray(
+							[
+								A2($mdgriffith$elm_ui$Internal$Style$Prop, 'flex-shrink', '1')
+							]))
+					])),
+				A2(
+				$mdgriffith$elm_ui$Internal$Style$Descriptor,
+				$mdgriffith$elm_ui$Internal$Style$dot($mdgriffith$elm_ui$Internal$Style$classes.clip),
+				_List_fromArray(
+					[
+						A2($mdgriffith$elm_ui$Internal$Style$Prop, 'overflow', 'hidden')
+					])),
+				A2(
+				$mdgriffith$elm_ui$Internal$Style$Descriptor,
+				$mdgriffith$elm_ui$Internal$Style$dot($mdgriffith$elm_ui$Internal$Style$classes.clipX),
+				_List_fromArray(
+					[
+						A2($mdgriffith$elm_ui$Internal$Style$Prop, 'overflow-x', 'hidden')
+					])),
+				A2(
+				$mdgriffith$elm_ui$Internal$Style$Descriptor,
+				$mdgriffith$elm_ui$Internal$Style$dot($mdgriffith$elm_ui$Internal$Style$classes.clipY),
+				_List_fromArray(
+					[
+						A2($mdgriffith$elm_ui$Internal$Style$Prop, 'overflow-y', 'hidden')
+					])),
+				A2(
+				$mdgriffith$elm_ui$Internal$Style$Descriptor,
+				$mdgriffith$elm_ui$Internal$Style$dot($mdgriffith$elm_ui$Internal$Style$classes.widthContent),
+				_List_fromArray(
+					[
+						A2($mdgriffith$elm_ui$Internal$Style$Prop, 'width', 'auto')
+					])),
+				A2(
+				$mdgriffith$elm_ui$Internal$Style$Descriptor,
+				$mdgriffith$elm_ui$Internal$Style$dot($mdgriffith$elm_ui$Internal$Style$classes.borderNone),
+				_List_fromArray(
+					[
+						A2($mdgriffith$elm_ui$Internal$Style$Prop, 'border-width', '0')
+					])),
+				A2(
+				$mdgriffith$elm_ui$Internal$Style$Descriptor,
+				$mdgriffith$elm_ui$Internal$Style$dot($mdgriffith$elm_ui$Internal$Style$classes.borderDashed),
+				_List_fromArray(
+					[
+						A2($mdgriffith$elm_ui$Internal$Style$Prop, 'border-style', 'dashed')
+					])),
+				A2(
+				$mdgriffith$elm_ui$Internal$Style$Descriptor,
+				$mdgriffith$elm_ui$Internal$Style$dot($mdgriffith$elm_ui$Internal$Style$classes.borderDotted),
+				_List_fromArray(
+					[
+						A2($mdgriffith$elm_ui$Internal$Style$Prop, 'border-style', 'dotted')
+					])),
+				A2(
+				$mdgriffith$elm_ui$Internal$Style$Descriptor,
+				$mdgriffith$elm_ui$Internal$Style$dot($mdgriffith$elm_ui$Internal$Style$classes.borderSolid),
+				_List_fromArray(
+					[
+						A2($mdgriffith$elm_ui$Internal$Style$Prop, 'border-style', 'solid')
+					])),
+				A2(
+				$mdgriffith$elm_ui$Internal$Style$Descriptor,
+				$mdgriffith$elm_ui$Internal$Style$dot($mdgriffith$elm_ui$Internal$Style$classes.text),
+				_List_fromArray(
+					[
+						A2($mdgriffith$elm_ui$Internal$Style$Prop, 'white-space', 'pre'),
+						A2($mdgriffith$elm_ui$Internal$Style$Prop, 'display', 'inline-block')
+					])),
+				A2(
+				$mdgriffith$elm_ui$Internal$Style$Descriptor,
+				$mdgriffith$elm_ui$Internal$Style$dot($mdgriffith$elm_ui$Internal$Style$classes.inputText),
+				_List_fromArray(
+					[
+						A2($mdgriffith$elm_ui$Internal$Style$Prop, 'line-height', '1.05'),
+						A2($mdgriffith$elm_ui$Internal$Style$Prop, 'background', 'transparent'),
+						A2($mdgriffith$elm_ui$Internal$Style$Prop, 'text-align', 'inherit')
+					])),
+				A2(
+				$mdgriffith$elm_ui$Internal$Style$Descriptor,
+				$mdgriffith$elm_ui$Internal$Style$dot($mdgriffith$elm_ui$Internal$Style$classes.single),
+				$mdgriffith$elm_ui$Internal$Style$elDescription),
+				A2(
+				$mdgriffith$elm_ui$Internal$Style$Descriptor,
+				$mdgriffith$elm_ui$Internal$Style$dot($mdgriffith$elm_ui$Internal$Style$classes.row),
+				_List_fromArray(
+					[
+						A2($mdgriffith$elm_ui$Internal$Style$Prop, 'display', 'flex'),
+						A2($mdgriffith$elm_ui$Internal$Style$Prop, 'flex-direction', 'row'),
+						A2(
+						$mdgriffith$elm_ui$Internal$Style$Child,
+						$mdgriffith$elm_ui$Internal$Style$dot($mdgriffith$elm_ui$Internal$Style$classes.any),
+						_List_fromArray(
+							[
+								A2($mdgriffith$elm_ui$Internal$Style$Prop, 'flex-basis', '0%'),
+								A2(
+								$mdgriffith$elm_ui$Internal$Style$Descriptor,
+								$mdgriffith$elm_ui$Internal$Style$dot($mdgriffith$elm_ui$Internal$Style$classes.widthExact),
+								_List_fromArray(
+									[
+										A2($mdgriffith$elm_ui$Internal$Style$Prop, 'flex-basis', 'auto')
+									])),
+								A2(
+								$mdgriffith$elm_ui$Internal$Style$Descriptor,
+								$mdgriffith$elm_ui$Internal$Style$dot($mdgriffith$elm_ui$Internal$Style$classes.link),
+								_List_fromArray(
+									[
+										A2($mdgriffith$elm_ui$Internal$Style$Prop, 'flex-basis', 'auto')
+									]))
+							])),
+						A2(
+						$mdgriffith$elm_ui$Internal$Style$Child,
+						$mdgriffith$elm_ui$Internal$Style$dot($mdgriffith$elm_ui$Internal$Style$classes.heightFill),
+						_List_fromArray(
+							[
+								A2($mdgriffith$elm_ui$Internal$Style$Prop, 'align-self', 'stretch !important')
+							])),
+						A2(
+						$mdgriffith$elm_ui$Internal$Style$Child,
+						$mdgriffith$elm_ui$Internal$Style$dot($mdgriffith$elm_ui$Internal$Style$classes.heightFillPortion),
+						_List_fromArray(
+							[
+								A2($mdgriffith$elm_ui$Internal$Style$Prop, 'align-self', 'stretch !important')
+							])),
+						A2(
+						$mdgriffith$elm_ui$Internal$Style$Child,
+						$mdgriffith$elm_ui$Internal$Style$dot($mdgriffith$elm_ui$Internal$Style$classes.widthFill),
+						_List_fromArray(
+							[
+								A2($mdgriffith$elm_ui$Internal$Style$Prop, 'flex-grow', '100000')
+							])),
+						A2(
+						$mdgriffith$elm_ui$Internal$Style$Child,
+						$mdgriffith$elm_ui$Internal$Style$dot($mdgriffith$elm_ui$Internal$Style$classes.container),
+						_List_fromArray(
+							[
+								A2($mdgriffith$elm_ui$Internal$Style$Prop, 'flex-grow', '0'),
+								A2($mdgriffith$elm_ui$Internal$Style$Prop, 'flex-basis', 'auto'),
+								A2($mdgriffith$elm_ui$Internal$Style$Prop, 'align-self', 'stretch')
+							])),
+						A2(
+						$mdgriffith$elm_ui$Internal$Style$Child,
+						'u:first-of-type.' + $mdgriffith$elm_ui$Internal$Style$classes.alignContainerRight,
+						_List_fromArray(
+							[
+								A2($mdgriffith$elm_ui$Internal$Style$Prop, 'flex-grow', '1')
+							])),
+						A2(
+						$mdgriffith$elm_ui$Internal$Style$Child,
+						's:first-of-type.' + $mdgriffith$elm_ui$Internal$Style$classes.alignContainerCenterX,
+						_List_fromArray(
+							[
+								A2($mdgriffith$elm_ui$Internal$Style$Prop, 'flex-grow', '1'),
+								A2(
+								$mdgriffith$elm_ui$Internal$Style$Child,
+								$mdgriffith$elm_ui$Internal$Style$dot($mdgriffith$elm_ui$Internal$Style$classes.alignCenterX),
+								_List_fromArray(
+									[
+										A2($mdgriffith$elm_ui$Internal$Style$Prop, 'margin-left', 'auto !important')
+									]))
+							])),
+						A2(
+						$mdgriffith$elm_ui$Internal$Style$Child,
+						's:last-of-type.' + $mdgriffith$elm_ui$Internal$Style$classes.alignContainerCenterX,
+						_List_fromArray(
+							[
+								A2($mdgriffith$elm_ui$Internal$Style$Prop, 'flex-grow', '1'),
+								A2(
+								$mdgriffith$elm_ui$Internal$Style$Child,
+								$mdgriffith$elm_ui$Internal$Style$dot($mdgriffith$elm_ui$Internal$Style$classes.alignCenterX),
+								_List_fromArray(
+									[
+										A2($mdgriffith$elm_ui$Internal$Style$Prop, 'margin-right', 'auto !important')
+									]))
+							])),
+						A2(
+						$mdgriffith$elm_ui$Internal$Style$Child,
+						's:only-of-type.' + $mdgriffith$elm_ui$Internal$Style$classes.alignContainerCenterX,
+						_List_fromArray(
+							[
+								A2($mdgriffith$elm_ui$Internal$Style$Prop, 'flex-grow', '1'),
+								A2(
+								$mdgriffith$elm_ui$Internal$Style$Child,
+								$mdgriffith$elm_ui$Internal$Style$dot($mdgriffith$elm_ui$Internal$Style$classes.alignCenterY),
+								_List_fromArray(
+									[
+										A2($mdgriffith$elm_ui$Internal$Style$Prop, 'margin-top', 'auto !important'),
+										A2($mdgriffith$elm_ui$Internal$Style$Prop, 'margin-bottom', 'auto !important')
+									]))
+							])),
+						A2(
+						$mdgriffith$elm_ui$Internal$Style$Child,
+						's:last-of-type.' + ($mdgriffith$elm_ui$Internal$Style$classes.alignContainerCenterX + ' ~ u'),
+						_List_fromArray(
+							[
+								A2($mdgriffith$elm_ui$Internal$Style$Prop, 'flex-grow', '0')
+							])),
+						A2(
+						$mdgriffith$elm_ui$Internal$Style$Child,
+						'u:first-of-type.' + ($mdgriffith$elm_ui$Internal$Style$classes.alignContainerRight + (' ~ s.' + $mdgriffith$elm_ui$Internal$Style$classes.alignContainerCenterX)),
+						_List_fromArray(
+							[
+								A2($mdgriffith$elm_ui$Internal$Style$Prop, 'flex-grow', '0')
+							])),
+						$mdgriffith$elm_ui$Internal$Style$describeAlignment(
+						function (alignment) {
+							switch (alignment.$) {
+								case 'Top':
+									return _Utils_Tuple2(
+										_List_fromArray(
+											[
+												A2($mdgriffith$elm_ui$Internal$Style$Prop, 'align-items', 'flex-start')
+											]),
+										_List_fromArray(
+											[
+												A2($mdgriffith$elm_ui$Internal$Style$Prop, 'align-self', 'flex-start')
+											]));
+								case 'Bottom':
+									return _Utils_Tuple2(
+										_List_fromArray(
+											[
+												A2($mdgriffith$elm_ui$Internal$Style$Prop, 'align-items', 'flex-end')
+											]),
+										_List_fromArray(
+											[
+												A2($mdgriffith$elm_ui$Internal$Style$Prop, 'align-self', 'flex-end')
+											]));
+								case 'Right':
+									return _Utils_Tuple2(
+										_List_fromArray(
+											[
+												A2($mdgriffith$elm_ui$Internal$Style$Prop, 'justify-content', 'flex-end')
+											]),
+										_List_Nil);
+								case 'Left':
+									return _Utils_Tuple2(
+										_List_fromArray(
+											[
+												A2($mdgriffith$elm_ui$Internal$Style$Prop, 'justify-content', 'flex-start')
+											]),
+										_List_Nil);
+								case 'CenterX':
+									return _Utils_Tuple2(
+										_List_fromArray(
+											[
+												A2($mdgriffith$elm_ui$Internal$Style$Prop, 'justify-content', 'center')
+											]),
+										_List_Nil);
+								default:
+									return _Utils_Tuple2(
+										_List_fromArray(
+											[
+												A2($mdgriffith$elm_ui$Internal$Style$Prop, 'align-items', 'center')
+											]),
+										_List_fromArray(
+											[
+												A2($mdgriffith$elm_ui$Internal$Style$Prop, 'align-self', 'center')
+											]));
+							}
+						}),
+						A2(
+						$mdgriffith$elm_ui$Internal$Style$Descriptor,
+						$mdgriffith$elm_ui$Internal$Style$dot($mdgriffith$elm_ui$Internal$Style$classes.spaceEvenly),
+						_List_fromArray(
+							[
+								A2($mdgriffith$elm_ui$Internal$Style$Prop, 'justify-content', 'space-between')
+							])),
+						A2(
+						$mdgriffith$elm_ui$Internal$Style$Descriptor,
+						$mdgriffith$elm_ui$Internal$Style$dot($mdgriffith$elm_ui$Internal$Style$classes.inputLabel),
+						_List_fromArray(
+							[
+								A2($mdgriffith$elm_ui$Internal$Style$Prop, 'align-items', 'baseline')
+							]))
+					])),
+				A2(
+				$mdgriffith$elm_ui$Internal$Style$Descriptor,
+				$mdgriffith$elm_ui$Internal$Style$dot($mdgriffith$elm_ui$Internal$Style$classes.column),
+				_List_fromArray(
+					[
+						A2($mdgriffith$elm_ui$Internal$Style$Prop, 'display', 'flex'),
+						A2($mdgriffith$elm_ui$Internal$Style$Prop, 'flex-direction', 'column'),
+						A2(
+						$mdgriffith$elm_ui$Internal$Style$Child,
+						$mdgriffith$elm_ui$Internal$Style$dot($mdgriffith$elm_ui$Internal$Style$classes.any),
+						_List_fromArray(
+							[
+								A2($mdgriffith$elm_ui$Internal$Style$Prop, 'flex-basis', '0px'),
+								A2($mdgriffith$elm_ui$Internal$Style$Prop, 'min-height', 'min-content'),
+								A2(
+								$mdgriffith$elm_ui$Internal$Style$Descriptor,
+								$mdgriffith$elm_ui$Internal$Style$dot($mdgriffith$elm_ui$Internal$Style$classes.heightExact),
+								_List_fromArray(
+									[
+										A2($mdgriffith$elm_ui$Internal$Style$Prop, 'flex-basis', 'auto')
+									]))
+							])),
+						A2(
+						$mdgriffith$elm_ui$Internal$Style$Child,
+						$mdgriffith$elm_ui$Internal$Style$dot($mdgriffith$elm_ui$Internal$Style$classes.heightFill),
+						_List_fromArray(
+							[
+								A2($mdgriffith$elm_ui$Internal$Style$Prop, 'flex-grow', '100000')
+							])),
+						A2(
+						$mdgriffith$elm_ui$Internal$Style$Child,
+						$mdgriffith$elm_ui$Internal$Style$dot($mdgriffith$elm_ui$Internal$Style$classes.widthFill),
+						_List_fromArray(
+							[
+								A2($mdgriffith$elm_ui$Internal$Style$Prop, 'width', '100%')
+							])),
+						A2(
+						$mdgriffith$elm_ui$Internal$Style$Child,
+						$mdgriffith$elm_ui$Internal$Style$dot($mdgriffith$elm_ui$Internal$Style$classes.widthFillPortion),
+						_List_fromArray(
+							[
+								A2($mdgriffith$elm_ui$Internal$Style$Prop, 'width', '100%')
+							])),
+						A2(
+						$mdgriffith$elm_ui$Internal$Style$Child,
+						$mdgriffith$elm_ui$Internal$Style$dot($mdgriffith$elm_ui$Internal$Style$classes.widthContent),
+						_List_fromArray(
+							[
+								A2($mdgriffith$elm_ui$Internal$Style$Prop, 'align-self', 'flex-start')
+							])),
+						A2(
+						$mdgriffith$elm_ui$Internal$Style$Child,
+						'u:first-of-type.' + $mdgriffith$elm_ui$Internal$Style$classes.alignContainerBottom,
+						_List_fromArray(
+							[
+								A2($mdgriffith$elm_ui$Internal$Style$Prop, 'flex-grow', '1')
+							])),
+						A2(
+						$mdgriffith$elm_ui$Internal$Style$Child,
+						's:first-of-type.' + $mdgriffith$elm_ui$Internal$Style$classes.alignContainerCenterY,
+						_List_fromArray(
+							[
+								A2($mdgriffith$elm_ui$Internal$Style$Prop, 'flex-grow', '1'),
+								A2(
+								$mdgriffith$elm_ui$Internal$Style$Child,
+								$mdgriffith$elm_ui$Internal$Style$dot($mdgriffith$elm_ui$Internal$Style$classes.alignCenterY),
+								_List_fromArray(
+									[
+										A2($mdgriffith$elm_ui$Internal$Style$Prop, 'margin-top', 'auto !important'),
+										A2($mdgriffith$elm_ui$Internal$Style$Prop, 'margin-bottom', '0 !important')
+									]))
+							])),
+						A2(
+						$mdgriffith$elm_ui$Internal$Style$Child,
+						's:last-of-type.' + $mdgriffith$elm_ui$Internal$Style$classes.alignContainerCenterY,
+						_List_fromArray(
+							[
+								A2($mdgriffith$elm_ui$Internal$Style$Prop, 'flex-grow', '1'),
+								A2(
+								$mdgriffith$elm_ui$Internal$Style$Child,
+								$mdgriffith$elm_ui$Internal$Style$dot($mdgriffith$elm_ui$Internal$Style$classes.alignCenterY),
+								_List_fromArray(
+									[
+										A2($mdgriffith$elm_ui$Internal$Style$Prop, 'margin-bottom', 'auto !important'),
+										A2($mdgriffith$elm_ui$Internal$Style$Prop, 'margin-top', '0 !important')
+									]))
+							])),
+						A2(
+						$mdgriffith$elm_ui$Internal$Style$Child,
+						's:only-of-type.' + $mdgriffith$elm_ui$Internal$Style$classes.alignContainerCenterY,
+						_List_fromArray(
+							[
+								A2($mdgriffith$elm_ui$Internal$Style$Prop, 'flex-grow', '1'),
+								A2(
+								$mdgriffith$elm_ui$Internal$Style$Child,
+								$mdgriffith$elm_ui$Internal$Style$dot($mdgriffith$elm_ui$Internal$Style$classes.alignCenterY),
+								_List_fromArray(
+									[
+										A2($mdgriffith$elm_ui$Internal$Style$Prop, 'margin-top', 'auto !important'),
+										A2($mdgriffith$elm_ui$Internal$Style$Prop, 'margin-bottom', 'auto !important')
+									]))
+							])),
+						A2(
+						$mdgriffith$elm_ui$Internal$Style$Child,
+						's:last-of-type.' + ($mdgriffith$elm_ui$Internal$Style$classes.alignContainerCenterY + ' ~ u'),
+						_List_fromArray(
+							[
+								A2($mdgriffith$elm_ui$Internal$Style$Prop, 'flex-grow', '0')
+							])),
+						A2(
+						$mdgriffith$elm_ui$Internal$Style$Child,
+						'u:first-of-type.' + ($mdgriffith$elm_ui$Internal$Style$classes.alignContainerBottom + (' ~ s.' + $mdgriffith$elm_ui$Internal$Style$classes.alignContainerCenterY)),
+						_List_fromArray(
+							[
+								A2($mdgriffith$elm_ui$Internal$Style$Prop, 'flex-grow', '0')
+							])),
+						$mdgriffith$elm_ui$Internal$Style$describeAlignment(
+						function (alignment) {
+							switch (alignment.$) {
+								case 'Top':
+									return _Utils_Tuple2(
+										_List_fromArray(
+											[
+												A2($mdgriffith$elm_ui$Internal$Style$Prop, 'justify-content', 'flex-start')
+											]),
+										_List_fromArray(
+											[
+												A2($mdgriffith$elm_ui$Internal$Style$Prop, 'margin-bottom', 'auto')
+											]));
+								case 'Bottom':
+									return _Utils_Tuple2(
+										_List_fromArray(
+											[
+												A2($mdgriffith$elm_ui$Internal$Style$Prop, 'justify-content', 'flex-end')
+											]),
+										_List_fromArray(
+											[
+												A2($mdgriffith$elm_ui$Internal$Style$Prop, 'margin-top', 'auto')
+											]));
+								case 'Right':
+									return _Utils_Tuple2(
+										_List_fromArray(
+											[
+												A2($mdgriffith$elm_ui$Internal$Style$Prop, 'align-items', 'flex-end')
+											]),
+										_List_fromArray(
+											[
+												A2($mdgriffith$elm_ui$Internal$Style$Prop, 'align-self', 'flex-end')
+											]));
+								case 'Left':
+									return _Utils_Tuple2(
+										_List_fromArray(
+											[
+												A2($mdgriffith$elm_ui$Internal$Style$Prop, 'align-items', 'flex-start')
+											]),
+										_List_fromArray(
+											[
+												A2($mdgriffith$elm_ui$Internal$Style$Prop, 'align-self', 'flex-start')
+											]));
+								case 'CenterX':
+									return _Utils_Tuple2(
+										_List_fromArray(
+											[
+												A2($mdgriffith$elm_ui$Internal$Style$Prop, 'align-items', 'center')
+											]),
+										_List_fromArray(
+											[
+												A2($mdgriffith$elm_ui$Internal$Style$Prop, 'align-self', 'center')
+											]));
+								default:
+									return _Utils_Tuple2(
+										_List_fromArray(
+											[
+												A2($mdgriffith$elm_ui$Internal$Style$Prop, 'justify-content', 'center')
+											]),
+										_List_Nil);
+							}
+						}),
+						A2(
+						$mdgriffith$elm_ui$Internal$Style$Child,
+						$mdgriffith$elm_ui$Internal$Style$dot($mdgriffith$elm_ui$Internal$Style$classes.container),
+						_List_fromArray(
+							[
+								A2($mdgriffith$elm_ui$Internal$Style$Prop, 'flex-grow', '0'),
+								A2($mdgriffith$elm_ui$Internal$Style$Prop, 'flex-basis', 'auto'),
+								A2($mdgriffith$elm_ui$Internal$Style$Prop, 'width', '100%'),
+								A2($mdgriffith$elm_ui$Internal$Style$Prop, 'align-self', 'stretch !important')
+							])),
+						A2(
+						$mdgriffith$elm_ui$Internal$Style$Descriptor,
+						$mdgriffith$elm_ui$Internal$Style$dot($mdgriffith$elm_ui$Internal$Style$classes.spaceEvenly),
+						_List_fromArray(
+							[
+								A2($mdgriffith$elm_ui$Internal$Style$Prop, 'justify-content', 'space-between')
+							]))
+					])),
+				A2(
+				$mdgriffith$elm_ui$Internal$Style$Descriptor,
+				$mdgriffith$elm_ui$Internal$Style$dot($mdgriffith$elm_ui$Internal$Style$classes.grid),
+				_List_fromArray(
+					[
+						A2($mdgriffith$elm_ui$Internal$Style$Prop, 'display', '-ms-grid'),
+						A2(
+						$mdgriffith$elm_ui$Internal$Style$Child,
+						'.gp',
+						_List_fromArray(
+							[
+								A2(
+								$mdgriffith$elm_ui$Internal$Style$Child,
+								$mdgriffith$elm_ui$Internal$Style$dot($mdgriffith$elm_ui$Internal$Style$classes.any),
+								_List_fromArray(
+									[
+										A2($mdgriffith$elm_ui$Internal$Style$Prop, 'width', '100%')
+									]))
+							])),
+						A2(
+						$mdgriffith$elm_ui$Internal$Style$Supports,
+						_Utils_Tuple2('display', 'grid'),
+						_List_fromArray(
+							[
+								_Utils_Tuple2('display', 'grid')
+							])),
+						$mdgriffith$elm_ui$Internal$Style$gridAlignments(
+						function (alignment) {
+							switch (alignment.$) {
+								case 'Top':
+									return _List_fromArray(
+										[
+											A2($mdgriffith$elm_ui$Internal$Style$Prop, 'justify-content', 'flex-start')
+										]);
+								case 'Bottom':
+									return _List_fromArray(
+										[
+											A2($mdgriffith$elm_ui$Internal$Style$Prop, 'justify-content', 'flex-end')
+										]);
+								case 'Right':
+									return _List_fromArray(
+										[
+											A2($mdgriffith$elm_ui$Internal$Style$Prop, 'align-items', 'flex-end')
+										]);
+								case 'Left':
+									return _List_fromArray(
+										[
+											A2($mdgriffith$elm_ui$Internal$Style$Prop, 'align-items', 'flex-start')
+										]);
+								case 'CenterX':
+									return _List_fromArray(
+										[
+											A2($mdgriffith$elm_ui$Internal$Style$Prop, 'align-items', 'center')
+										]);
+								default:
+									return _List_fromArray(
+										[
+											A2($mdgriffith$elm_ui$Internal$Style$Prop, 'justify-content', 'center')
+										]);
+							}
+						})
+					])),
+				A2(
+				$mdgriffith$elm_ui$Internal$Style$Descriptor,
+				$mdgriffith$elm_ui$Internal$Style$dot($mdgriffith$elm_ui$Internal$Style$classes.page),
+				_List_fromArray(
+					[
+						A2($mdgriffith$elm_ui$Internal$Style$Prop, 'display', 'block'),
+						A2(
+						$mdgriffith$elm_ui$Internal$Style$Child,
+						$mdgriffith$elm_ui$Internal$Style$dot($mdgriffith$elm_ui$Internal$Style$classes.any + ':first-child'),
+						_List_fromArray(
+							[
+								A2($mdgriffith$elm_ui$Internal$Style$Prop, 'margin', '0 !important')
+							])),
+						A2(
+						$mdgriffith$elm_ui$Internal$Style$Child,
+						$mdgriffith$elm_ui$Internal$Style$dot(
+							$mdgriffith$elm_ui$Internal$Style$classes.any + ($mdgriffith$elm_ui$Internal$Style$selfName(
+								$mdgriffith$elm_ui$Internal$Style$Self($mdgriffith$elm_ui$Internal$Style$Left)) + (':first-child + .' + $mdgriffith$elm_ui$Internal$Style$classes.any))),
+						_List_fromArray(
+							[
+								A2($mdgriffith$elm_ui$Internal$Style$Prop, 'margin', '0 !important')
+							])),
+						A2(
+						$mdgriffith$elm_ui$Internal$Style$Child,
+						$mdgriffith$elm_ui$Internal$Style$dot(
+							$mdgriffith$elm_ui$Internal$Style$classes.any + ($mdgriffith$elm_ui$Internal$Style$selfName(
+								$mdgriffith$elm_ui$Internal$Style$Self($mdgriffith$elm_ui$Internal$Style$Right)) + (':first-child + .' + $mdgriffith$elm_ui$Internal$Style$classes.any))),
+						_List_fromArray(
+							[
+								A2($mdgriffith$elm_ui$Internal$Style$Prop, 'margin', '0 !important')
+							])),
+						$mdgriffith$elm_ui$Internal$Style$describeAlignment(
+						function (alignment) {
+							switch (alignment.$) {
+								case 'Top':
+									return _Utils_Tuple2(_List_Nil, _List_Nil);
+								case 'Bottom':
+									return _Utils_Tuple2(_List_Nil, _List_Nil);
+								case 'Right':
+									return _Utils_Tuple2(
+										_List_Nil,
+										_List_fromArray(
+											[
+												A2($mdgriffith$elm_ui$Internal$Style$Prop, 'float', 'right'),
+												A2(
+												$mdgriffith$elm_ui$Internal$Style$Descriptor,
+												'::after',
+												_List_fromArray(
+													[
+														A2($mdgriffith$elm_ui$Internal$Style$Prop, 'content', '\"\"'),
+														A2($mdgriffith$elm_ui$Internal$Style$Prop, 'display', 'table'),
+														A2($mdgriffith$elm_ui$Internal$Style$Prop, 'clear', 'both')
+													]))
+											]));
+								case 'Left':
+									return _Utils_Tuple2(
+										_List_Nil,
+										_List_fromArray(
+											[
+												A2($mdgriffith$elm_ui$Internal$Style$Prop, 'float', 'left'),
+												A2(
+												$mdgriffith$elm_ui$Internal$Style$Descriptor,
+												'::after',
+												_List_fromArray(
+													[
+														A2($mdgriffith$elm_ui$Internal$Style$Prop, 'content', '\"\"'),
+														A2($mdgriffith$elm_ui$Internal$Style$Prop, 'display', 'table'),
+														A2($mdgriffith$elm_ui$Internal$Style$Prop, 'clear', 'both')
+													]))
+											]));
+								case 'CenterX':
+									return _Utils_Tuple2(_List_Nil, _List_Nil);
+								default:
+									return _Utils_Tuple2(_List_Nil, _List_Nil);
+							}
+						})
+					])),
+				A2(
+				$mdgriffith$elm_ui$Internal$Style$Descriptor,
+				$mdgriffith$elm_ui$Internal$Style$dot($mdgriffith$elm_ui$Internal$Style$classes.inputMultiline),
+				_List_fromArray(
+					[
+						A2($mdgriffith$elm_ui$Internal$Style$Prop, 'white-space', 'pre-wrap !important'),
+						A2($mdgriffith$elm_ui$Internal$Style$Prop, 'height', '100%'),
+						A2($mdgriffith$elm_ui$Internal$Style$Prop, 'width', '100%'),
+						A2($mdgriffith$elm_ui$Internal$Style$Prop, 'background-color', 'transparent')
+					])),
+				A2(
+				$mdgriffith$elm_ui$Internal$Style$Descriptor,
+				$mdgriffith$elm_ui$Internal$Style$dot($mdgriffith$elm_ui$Internal$Style$classes.inputMultilineWrapper),
+				_List_fromArray(
+					[
+						A2(
+						$mdgriffith$elm_ui$Internal$Style$Descriptor,
+						$mdgriffith$elm_ui$Internal$Style$dot($mdgriffith$elm_ui$Internal$Style$classes.single),
+						_List_fromArray(
+							[
+								A2($mdgriffith$elm_ui$Internal$Style$Prop, 'flex-basis', 'auto')
+							]))
+					])),
+				A2(
+				$mdgriffith$elm_ui$Internal$Style$Descriptor,
+				$mdgriffith$elm_ui$Internal$Style$dot($mdgriffith$elm_ui$Internal$Style$classes.inputMultilineParent),
+				_List_fromArray(
+					[
+						A2($mdgriffith$elm_ui$Internal$Style$Prop, 'white-space', 'pre-wrap !important'),
+						A2($mdgriffith$elm_ui$Internal$Style$Prop, 'cursor', 'text'),
+						A2(
+						$mdgriffith$elm_ui$Internal$Style$Child,
+						$mdgriffith$elm_ui$Internal$Style$dot($mdgriffith$elm_ui$Internal$Style$classes.inputMultilineFiller),
+						_List_fromArray(
+							[
+								A2($mdgriffith$elm_ui$Internal$Style$Prop, 'white-space', 'pre-wrap !important'),
+								A2($mdgriffith$elm_ui$Internal$Style$Prop, 'color', 'transparent')
+							]))
+					])),
+				A2(
+				$mdgriffith$elm_ui$Internal$Style$Descriptor,
+				$mdgriffith$elm_ui$Internal$Style$dot($mdgriffith$elm_ui$Internal$Style$classes.paragraph),
+				_List_fromArray(
+					[
+						A2($mdgriffith$elm_ui$Internal$Style$Prop, 'display', 'block'),
+						A2($mdgriffith$elm_ui$Internal$Style$Prop, 'white-space', 'normal'),
+						A2($mdgriffith$elm_ui$Internal$Style$Prop, 'overflow-wrap', 'break-word'),
+						A2(
+						$mdgriffith$elm_ui$Internal$Style$Descriptor,
+						$mdgriffith$elm_ui$Internal$Style$dot($mdgriffith$elm_ui$Internal$Style$classes.hasBehind),
+						_List_fromArray(
+							[
+								A2($mdgriffith$elm_ui$Internal$Style$Prop, 'z-index', '0'),
+								A2(
+								$mdgriffith$elm_ui$Internal$Style$Child,
+								$mdgriffith$elm_ui$Internal$Style$dot($mdgriffith$elm_ui$Internal$Style$classes.behind),
+								_List_fromArray(
+									[
+										A2($mdgriffith$elm_ui$Internal$Style$Prop, 'z-index', '-1')
+									]))
+							])),
+						A2(
+						$mdgriffith$elm_ui$Internal$Style$AllChildren,
+						$mdgriffith$elm_ui$Internal$Style$dot($mdgriffith$elm_ui$Internal$Style$classes.text),
+						_List_fromArray(
+							[
+								A2($mdgriffith$elm_ui$Internal$Style$Prop, 'display', 'inline'),
+								A2($mdgriffith$elm_ui$Internal$Style$Prop, 'white-space', 'normal')
+							])),
+						A2(
+						$mdgriffith$elm_ui$Internal$Style$AllChildren,
+						$mdgriffith$elm_ui$Internal$Style$dot($mdgriffith$elm_ui$Internal$Style$classes.paragraph),
+						_List_fromArray(
+							[
+								A2($mdgriffith$elm_ui$Internal$Style$Prop, 'display', 'inline'),
+								A2(
+								$mdgriffith$elm_ui$Internal$Style$Descriptor,
+								'::after',
+								_List_fromArray(
+									[
+										A2($mdgriffith$elm_ui$Internal$Style$Prop, 'content', 'none')
+									])),
+								A2(
+								$mdgriffith$elm_ui$Internal$Style$Descriptor,
+								'::before',
+								_List_fromArray(
+									[
+										A2($mdgriffith$elm_ui$Internal$Style$Prop, 'content', 'none')
+									]))
+							])),
+						A2(
+						$mdgriffith$elm_ui$Internal$Style$AllChildren,
+						$mdgriffith$elm_ui$Internal$Style$dot($mdgriffith$elm_ui$Internal$Style$classes.single),
+						_List_fromArray(
+							[
+								A2($mdgriffith$elm_ui$Internal$Style$Prop, 'display', 'inline'),
+								A2($mdgriffith$elm_ui$Internal$Style$Prop, 'white-space', 'normal'),
+								A2(
+								$mdgriffith$elm_ui$Internal$Style$Descriptor,
+								$mdgriffith$elm_ui$Internal$Style$dot($mdgriffith$elm_ui$Internal$Style$classes.widthExact),
+								_List_fromArray(
+									[
+										A2($mdgriffith$elm_ui$Internal$Style$Prop, 'display', 'inline-block')
+									])),
+								A2(
+								$mdgriffith$elm_ui$Internal$Style$Descriptor,
+								$mdgriffith$elm_ui$Internal$Style$dot($mdgriffith$elm_ui$Internal$Style$classes.inFront),
+								_List_fromArray(
+									[
+										A2($mdgriffith$elm_ui$Internal$Style$Prop, 'display', 'flex')
+									])),
+								A2(
+								$mdgriffith$elm_ui$Internal$Style$Descriptor,
+								$mdgriffith$elm_ui$Internal$Style$dot($mdgriffith$elm_ui$Internal$Style$classes.behind),
+								_List_fromArray(
+									[
+										A2($mdgriffith$elm_ui$Internal$Style$Prop, 'display', 'flex')
+									])),
+								A2(
+								$mdgriffith$elm_ui$Internal$Style$Descriptor,
+								$mdgriffith$elm_ui$Internal$Style$dot($mdgriffith$elm_ui$Internal$Style$classes.above),
+								_List_fromArray(
+									[
+										A2($mdgriffith$elm_ui$Internal$Style$Prop, 'display', 'flex')
+									])),
+								A2(
+								$mdgriffith$elm_ui$Internal$Style$Descriptor,
+								$mdgriffith$elm_ui$Internal$Style$dot($mdgriffith$elm_ui$Internal$Style$classes.below),
+								_List_fromArray(
+									[
+										A2($mdgriffith$elm_ui$Internal$Style$Prop, 'display', 'flex')
+									])),
+								A2(
+								$mdgriffith$elm_ui$Internal$Style$Descriptor,
+								$mdgriffith$elm_ui$Internal$Style$dot($mdgriffith$elm_ui$Internal$Style$classes.onRight),
+								_List_fromArray(
+									[
+										A2($mdgriffith$elm_ui$Internal$Style$Prop, 'display', 'flex')
+									])),
+								A2(
+								$mdgriffith$elm_ui$Internal$Style$Descriptor,
+								$mdgriffith$elm_ui$Internal$Style$dot($mdgriffith$elm_ui$Internal$Style$classes.onLeft),
+								_List_fromArray(
+									[
+										A2($mdgriffith$elm_ui$Internal$Style$Prop, 'display', 'flex')
+									])),
+								A2(
+								$mdgriffith$elm_ui$Internal$Style$Child,
+								$mdgriffith$elm_ui$Internal$Style$dot($mdgriffith$elm_ui$Internal$Style$classes.text),
+								_List_fromArray(
+									[
+										A2($mdgriffith$elm_ui$Internal$Style$Prop, 'display', 'inline'),
+										A2($mdgriffith$elm_ui$Internal$Style$Prop, 'white-space', 'normal')
+									]))
+							])),
+						A2(
+						$mdgriffith$elm_ui$Internal$Style$Child,
+						$mdgriffith$elm_ui$Internal$Style$dot($mdgriffith$elm_ui$Internal$Style$classes.row),
+						_List_fromArray(
+							[
+								A2($mdgriffith$elm_ui$Internal$Style$Prop, 'display', 'inline')
+							])),
+						A2(
+						$mdgriffith$elm_ui$Internal$Style$Child,
+						$mdgriffith$elm_ui$Internal$Style$dot($mdgriffith$elm_ui$Internal$Style$classes.column),
+						_List_fromArray(
+							[
+								A2($mdgriffith$elm_ui$Internal$Style$Prop, 'display', 'inline-flex')
+							])),
+						A2(
+						$mdgriffith$elm_ui$Internal$Style$Child,
+						$mdgriffith$elm_ui$Internal$Style$dot($mdgriffith$elm_ui$Internal$Style$classes.grid),
+						_List_fromArray(
+							[
+								A2($mdgriffith$elm_ui$Internal$Style$Prop, 'display', 'inline-grid')
+							])),
+						$mdgriffith$elm_ui$Internal$Style$describeAlignment(
+						function (alignment) {
+							switch (alignment.$) {
+								case 'Top':
+									return _Utils_Tuple2(_List_Nil, _List_Nil);
+								case 'Bottom':
+									return _Utils_Tuple2(_List_Nil, _List_Nil);
+								case 'Right':
+									return _Utils_Tuple2(
+										_List_Nil,
+										_List_fromArray(
+											[
+												A2($mdgriffith$elm_ui$Internal$Style$Prop, 'float', 'right')
+											]));
+								case 'Left':
+									return _Utils_Tuple2(
+										_List_Nil,
+										_List_fromArray(
+											[
+												A2($mdgriffith$elm_ui$Internal$Style$Prop, 'float', 'left')
+											]));
+								case 'CenterX':
+									return _Utils_Tuple2(_List_Nil, _List_Nil);
+								default:
+									return _Utils_Tuple2(_List_Nil, _List_Nil);
+							}
+						})
+					])),
+				A2(
+				$mdgriffith$elm_ui$Internal$Style$Descriptor,
+				'.hidden',
+				_List_fromArray(
+					[
+						A2($mdgriffith$elm_ui$Internal$Style$Prop, 'display', 'none')
+					])),
+				A2(
+				$mdgriffith$elm_ui$Internal$Style$Descriptor,
+				$mdgriffith$elm_ui$Internal$Style$dot($mdgriffith$elm_ui$Internal$Style$classes.textThin),
+				_List_fromArray(
+					[
+						A2($mdgriffith$elm_ui$Internal$Style$Prop, 'font-weight', '100')
+					])),
+				A2(
+				$mdgriffith$elm_ui$Internal$Style$Descriptor,
+				$mdgriffith$elm_ui$Internal$Style$dot($mdgriffith$elm_ui$Internal$Style$classes.textExtraLight),
+				_List_fromArray(
+					[
+						A2($mdgriffith$elm_ui$Internal$Style$Prop, 'font-weight', '200')
+					])),
+				A2(
+				$mdgriffith$elm_ui$Internal$Style$Descriptor,
+				$mdgriffith$elm_ui$Internal$Style$dot($mdgriffith$elm_ui$Internal$Style$classes.textLight),
+				_List_fromArray(
+					[
+						A2($mdgriffith$elm_ui$Internal$Style$Prop, 'font-weight', '300')
+					])),
+				A2(
+				$mdgriffith$elm_ui$Internal$Style$Descriptor,
+				$mdgriffith$elm_ui$Internal$Style$dot($mdgriffith$elm_ui$Internal$Style$classes.textNormalWeight),
+				_List_fromArray(
+					[
+						A2($mdgriffith$elm_ui$Internal$Style$Prop, 'font-weight', '400')
+					])),
+				A2(
+				$mdgriffith$elm_ui$Internal$Style$Descriptor,
+				$mdgriffith$elm_ui$Internal$Style$dot($mdgriffith$elm_ui$Internal$Style$classes.textMedium),
+				_List_fromArray(
+					[
+						A2($mdgriffith$elm_ui$Internal$Style$Prop, 'font-weight', '500')
+					])),
+				A2(
+				$mdgriffith$elm_ui$Internal$Style$Descriptor,
+				$mdgriffith$elm_ui$Internal$Style$dot($mdgriffith$elm_ui$Internal$Style$classes.textSemiBold),
+				_List_fromArray(
+					[
+						A2($mdgriffith$elm_ui$Internal$Style$Prop, 'font-weight', '600')
+					])),
+				A2(
+				$mdgriffith$elm_ui$Internal$Style$Descriptor,
+				$mdgriffith$elm_ui$Internal$Style$dot($mdgriffith$elm_ui$Internal$Style$classes.bold),
+				_List_fromArray(
+					[
+						A2($mdgriffith$elm_ui$Internal$Style$Prop, 'font-weight', '700')
+					])),
+				A2(
+				$mdgriffith$elm_ui$Internal$Style$Descriptor,
+				$mdgriffith$elm_ui$Internal$Style$dot($mdgriffith$elm_ui$Internal$Style$classes.textExtraBold),
+				_List_fromArray(
+					[
+						A2($mdgriffith$elm_ui$Internal$Style$Prop, 'font-weight', '800')
+					])),
+				A2(
+				$mdgriffith$elm_ui$Internal$Style$Descriptor,
+				$mdgriffith$elm_ui$Internal$Style$dot($mdgriffith$elm_ui$Internal$Style$classes.textHeavy),
+				_List_fromArray(
+					[
+						A2($mdgriffith$elm_ui$Internal$Style$Prop, 'font-weight', '900')
+					])),
+				A2(
+				$mdgriffith$elm_ui$Internal$Style$Descriptor,
+				$mdgriffith$elm_ui$Internal$Style$dot($mdgriffith$elm_ui$Internal$Style$classes.italic),
+				_List_fromArray(
+					[
+						A2($mdgriffith$elm_ui$Internal$Style$Prop, 'font-style', 'italic')
+					])),
+				A2(
+				$mdgriffith$elm_ui$Internal$Style$Descriptor,
+				$mdgriffith$elm_ui$Internal$Style$dot($mdgriffith$elm_ui$Internal$Style$classes.strike),
+				_List_fromArray(
+					[
+						A2($mdgriffith$elm_ui$Internal$Style$Prop, 'text-decoration', 'line-through')
+					])),
+				A2(
+				$mdgriffith$elm_ui$Internal$Style$Descriptor,
+				$mdgriffith$elm_ui$Internal$Style$dot($mdgriffith$elm_ui$Internal$Style$classes.underline),
+				_List_fromArray(
+					[
+						A2($mdgriffith$elm_ui$Internal$Style$Prop, 'text-decoration', 'underline'),
+						A2($mdgriffith$elm_ui$Internal$Style$Prop, 'text-decoration-skip-ink', 'auto'),
+						A2($mdgriffith$elm_ui$Internal$Style$Prop, 'text-decoration-skip', 'ink')
+					])),
+				A2(
+				$mdgriffith$elm_ui$Internal$Style$Descriptor,
+				_Utils_ap(
+					$mdgriffith$elm_ui$Internal$Style$dot($mdgriffith$elm_ui$Internal$Style$classes.underline),
+					$mdgriffith$elm_ui$Internal$Style$dot($mdgriffith$elm_ui$Internal$Style$classes.strike)),
+				_List_fromArray(
+					[
+						A2($mdgriffith$elm_ui$Internal$Style$Prop, 'text-decoration', 'line-through underline'),
+						A2($mdgriffith$elm_ui$Internal$Style$Prop, 'text-decoration-skip-ink', 'auto'),
+						A2($mdgriffith$elm_ui$Internal$Style$Prop, 'text-decoration-skip', 'ink')
+					])),
+				A2(
+				$mdgriffith$elm_ui$Internal$Style$Descriptor,
+				$mdgriffith$elm_ui$Internal$Style$dot($mdgriffith$elm_ui$Internal$Style$classes.textUnitalicized),
+				_List_fromArray(
+					[
+						A2($mdgriffith$elm_ui$Internal$Style$Prop, 'font-style', 'normal')
+					])),
+				A2(
+				$mdgriffith$elm_ui$Internal$Style$Descriptor,
+				$mdgriffith$elm_ui$Internal$Style$dot($mdgriffith$elm_ui$Internal$Style$classes.textJustify),
+				_List_fromArray(
+					[
+						A2($mdgriffith$elm_ui$Internal$Style$Prop, 'text-align', 'justify')
+					])),
+				A2(
+				$mdgriffith$elm_ui$Internal$Style$Descriptor,
+				$mdgriffith$elm_ui$Internal$Style$dot($mdgriffith$elm_ui$Internal$Style$classes.textJustifyAll),
+				_List_fromArray(
+					[
+						A2($mdgriffith$elm_ui$Internal$Style$Prop, 'text-align', 'justify-all')
+					])),
+				A2(
+				$mdgriffith$elm_ui$Internal$Style$Descriptor,
+				$mdgriffith$elm_ui$Internal$Style$dot($mdgriffith$elm_ui$Internal$Style$classes.textCenter),
+				_List_fromArray(
+					[
+						A2($mdgriffith$elm_ui$Internal$Style$Prop, 'text-align', 'center')
+					])),
+				A2(
+				$mdgriffith$elm_ui$Internal$Style$Descriptor,
+				$mdgriffith$elm_ui$Internal$Style$dot($mdgriffith$elm_ui$Internal$Style$classes.textRight),
+				_List_fromArray(
+					[
+						A2($mdgriffith$elm_ui$Internal$Style$Prop, 'text-align', 'right')
+					])),
+				A2(
+				$mdgriffith$elm_ui$Internal$Style$Descriptor,
+				$mdgriffith$elm_ui$Internal$Style$dot($mdgriffith$elm_ui$Internal$Style$classes.textLeft),
+				_List_fromArray(
+					[
+						A2($mdgriffith$elm_ui$Internal$Style$Prop, 'text-align', 'left')
+					])),
+				A2(
+				$mdgriffith$elm_ui$Internal$Style$Descriptor,
+				'.modal',
+				_List_fromArray(
+					[
+						A2($mdgriffith$elm_ui$Internal$Style$Prop, 'position', 'fixed'),
+						A2($mdgriffith$elm_ui$Internal$Style$Prop, 'left', '0'),
+						A2($mdgriffith$elm_ui$Internal$Style$Prop, 'top', '0'),
+						A2($mdgriffith$elm_ui$Internal$Style$Prop, 'width', '100%'),
+						A2($mdgriffith$elm_ui$Internal$Style$Prop, 'height', '100%'),
+						A2($mdgriffith$elm_ui$Internal$Style$Prop, 'pointer-events', 'none')
+					]))
+			]))
+	]);
+var $mdgriffith$elm_ui$Internal$Style$fontVariant = function (_var) {
+	return _List_fromArray(
+		[
+			A2(
+			$mdgriffith$elm_ui$Internal$Style$Class,
+			'.v-' + _var,
+			_List_fromArray(
+				[
+					A2($mdgriffith$elm_ui$Internal$Style$Prop, 'font-feature-settings', '\"' + (_var + '\"'))
+				])),
+			A2(
+			$mdgriffith$elm_ui$Internal$Style$Class,
+			'.v-' + (_var + '-off'),
+			_List_fromArray(
+				[
+					A2($mdgriffith$elm_ui$Internal$Style$Prop, 'font-feature-settings', '\"' + (_var + '\" 0'))
+				]))
+		]);
+};
+var $mdgriffith$elm_ui$Internal$Style$commonValues = $elm$core$List$concat(
+	_List_fromArray(
+		[
+			A2(
+			$elm$core$List$map,
+			function (x) {
+				return A2(
+					$mdgriffith$elm_ui$Internal$Style$Class,
+					'.border-' + $elm$core$String$fromInt(x),
+					_List_fromArray(
+						[
+							A2(
+							$mdgriffith$elm_ui$Internal$Style$Prop,
+							'border-width',
+							$elm$core$String$fromInt(x) + 'px')
+						]));
+			},
+			A2($elm$core$List$range, 0, 6)),
+			A2(
+			$elm$core$List$map,
+			function (i) {
+				return A2(
+					$mdgriffith$elm_ui$Internal$Style$Class,
+					'.font-size-' + $elm$core$String$fromInt(i),
+					_List_fromArray(
+						[
+							A2(
+							$mdgriffith$elm_ui$Internal$Style$Prop,
+							'font-size',
+							$elm$core$String$fromInt(i) + 'px')
+						]));
+			},
+			A2($elm$core$List$range, 8, 32)),
+			A2(
+			$elm$core$List$map,
+			function (i) {
+				return A2(
+					$mdgriffith$elm_ui$Internal$Style$Class,
+					'.p-' + $elm$core$String$fromInt(i),
+					_List_fromArray(
+						[
+							A2(
+							$mdgriffith$elm_ui$Internal$Style$Prop,
+							'padding',
+							$elm$core$String$fromInt(i) + 'px')
+						]));
+			},
+			A2($elm$core$List$range, 0, 24)),
+			_List_fromArray(
+			[
+				A2(
+				$mdgriffith$elm_ui$Internal$Style$Class,
+				'.v-smcp',
+				_List_fromArray(
+					[
+						A2($mdgriffith$elm_ui$Internal$Style$Prop, 'font-variant', 'small-caps')
+					])),
+				A2(
+				$mdgriffith$elm_ui$Internal$Style$Class,
+				'.v-smcp-off',
+				_List_fromArray(
+					[
+						A2($mdgriffith$elm_ui$Internal$Style$Prop, 'font-variant', 'normal')
+					]))
+			]),
+			$mdgriffith$elm_ui$Internal$Style$fontVariant('zero'),
+			$mdgriffith$elm_ui$Internal$Style$fontVariant('onum'),
+			$mdgriffith$elm_ui$Internal$Style$fontVariant('liga'),
+			$mdgriffith$elm_ui$Internal$Style$fontVariant('dlig'),
+			$mdgriffith$elm_ui$Internal$Style$fontVariant('ordn'),
+			$mdgriffith$elm_ui$Internal$Style$fontVariant('tnum'),
+			$mdgriffith$elm_ui$Internal$Style$fontVariant('afrc'),
+			$mdgriffith$elm_ui$Internal$Style$fontVariant('frac')
+		]));
+var $mdgriffith$elm_ui$Internal$Style$explainer = '\n.explain {\n    border: 6px solid rgb(174, 121, 15) !important;\n}\n.explain > .' + ($mdgriffith$elm_ui$Internal$Style$classes.any + (' {\n    border: 4px dashed rgb(0, 151, 167) !important;\n}\n\n.ctr {\n    border: none !important;\n}\n.explain > .ctr > .' + ($mdgriffith$elm_ui$Internal$Style$classes.any + ' {\n    border: 4px dashed rgb(0, 151, 167) !important;\n}\n\n')));
+var $mdgriffith$elm_ui$Internal$Style$inputTextReset = '\ninput[type="search"],\ninput[type="search"]::-webkit-search-decoration,\ninput[type="search"]::-webkit-search-cancel-button,\ninput[type="search"]::-webkit-search-results-button,\ninput[type="search"]::-webkit-search-results-decoration {\n  -webkit-appearance:none;\n}\n';
+var $mdgriffith$elm_ui$Internal$Style$sliderReset = '\ninput[type=range] {\n  -webkit-appearance: none; \n  background: transparent;\n  position:absolute;\n  left:0;\n  top:0;\n  z-index:10;\n  width: 100%;\n  outline: dashed 1px;\n  height: 100%;\n  opacity: 0;\n}\n';
+var $mdgriffith$elm_ui$Internal$Style$thumbReset = '\ninput[type=range]::-webkit-slider-thumb {\n    -webkit-appearance: none;\n    opacity: 0.5;\n    width: 80px;\n    height: 80px;\n    background-color: black;\n    border:none;\n    border-radius: 5px;\n}\ninput[type=range]::-moz-range-thumb {\n    opacity: 0.5;\n    width: 80px;\n    height: 80px;\n    background-color: black;\n    border:none;\n    border-radius: 5px;\n}\ninput[type=range]::-ms-thumb {\n    opacity: 0.5;\n    width: 80px;\n    height: 80px;\n    background-color: black;\n    border:none;\n    border-radius: 5px;\n}\ninput[type=range][orient=vertical]{\n    writing-mode: bt-lr; /* IE */\n    -webkit-appearance: slider-vertical;  /* WebKit */\n}\n';
+var $mdgriffith$elm_ui$Internal$Style$trackReset = '\ninput[type=range]::-moz-range-track {\n    background: transparent;\n    cursor: pointer;\n}\ninput[type=range]::-ms-track {\n    background: transparent;\n    cursor: pointer;\n}\ninput[type=range]::-webkit-slider-runnable-track {\n    background: transparent;\n    cursor: pointer;\n}\n';
+var $mdgriffith$elm_ui$Internal$Style$overrides = '@media screen and (-ms-high-contrast: active), (-ms-high-contrast: none) {' + ($mdgriffith$elm_ui$Internal$Style$dot($mdgriffith$elm_ui$Internal$Style$classes.any) + ($mdgriffith$elm_ui$Internal$Style$dot($mdgriffith$elm_ui$Internal$Style$classes.row) + (' > ' + ($mdgriffith$elm_ui$Internal$Style$dot($mdgriffith$elm_ui$Internal$Style$classes.any) + (' { flex-basis: auto !important; } ' + ($mdgriffith$elm_ui$Internal$Style$dot($mdgriffith$elm_ui$Internal$Style$classes.any) + ($mdgriffith$elm_ui$Internal$Style$dot($mdgriffith$elm_ui$Internal$Style$classes.row) + (' > ' + ($mdgriffith$elm_ui$Internal$Style$dot($mdgriffith$elm_ui$Internal$Style$classes.any) + ($mdgriffith$elm_ui$Internal$Style$dot($mdgriffith$elm_ui$Internal$Style$classes.container) + (' { flex-basis: auto !important; }}' + ($mdgriffith$elm_ui$Internal$Style$inputTextReset + ($mdgriffith$elm_ui$Internal$Style$sliderReset + ($mdgriffith$elm_ui$Internal$Style$trackReset + ($mdgriffith$elm_ui$Internal$Style$thumbReset + $mdgriffith$elm_ui$Internal$Style$explainer)))))))))))))));
+var $elm$core$String$concat = function (strings) {
+	return A2($elm$core$String$join, '', strings);
+};
+var $mdgriffith$elm_ui$Internal$Style$Intermediate = function (a) {
+	return {$: 'Intermediate', a: a};
+};
+var $mdgriffith$elm_ui$Internal$Style$emptyIntermediate = F2(
+	function (selector, closing) {
+		return $mdgriffith$elm_ui$Internal$Style$Intermediate(
+			{closing: closing, others: _List_Nil, props: _List_Nil, selector: selector});
+	});
+var $mdgriffith$elm_ui$Internal$Style$renderRules = F2(
+	function (_v0, rulesToRender) {
+		var parent = _v0.a;
+		var generateIntermediates = F2(
+			function (rule, rendered) {
+				switch (rule.$) {
+					case 'Prop':
+						var name = rule.a;
+						var val = rule.b;
+						return _Utils_update(
+							rendered,
+							{
+								props: A2(
+									$elm$core$List$cons,
+									_Utils_Tuple2(name, val),
+									rendered.props)
+							});
+					case 'Supports':
+						var _v2 = rule.a;
+						var prop = _v2.a;
+						var value = _v2.b;
+						var props = rule.b;
+						return _Utils_update(
+							rendered,
+							{
+								others: A2(
+									$elm$core$List$cons,
+									$mdgriffith$elm_ui$Internal$Style$Intermediate(
+										{closing: '\n}', others: _List_Nil, props: props, selector: '@supports (' + (prop + (':' + (value + (') {' + parent.selector))))}),
+									rendered.others)
+							});
+					case 'Adjacent':
+						var selector = rule.a;
+						var adjRules = rule.b;
+						return _Utils_update(
+							rendered,
+							{
+								others: A2(
+									$elm$core$List$cons,
+									A2(
+										$mdgriffith$elm_ui$Internal$Style$renderRules,
+										A2($mdgriffith$elm_ui$Internal$Style$emptyIntermediate, parent.selector + (' + ' + selector), ''),
+										adjRules),
+									rendered.others)
+							});
+					case 'Child':
+						var child = rule.a;
+						var childRules = rule.b;
+						return _Utils_update(
+							rendered,
+							{
+								others: A2(
+									$elm$core$List$cons,
+									A2(
+										$mdgriffith$elm_ui$Internal$Style$renderRules,
+										A2($mdgriffith$elm_ui$Internal$Style$emptyIntermediate, parent.selector + (' > ' + child), ''),
+										childRules),
+									rendered.others)
+							});
+					case 'AllChildren':
+						var child = rule.a;
+						var childRules = rule.b;
+						return _Utils_update(
+							rendered,
+							{
+								others: A2(
+									$elm$core$List$cons,
+									A2(
+										$mdgriffith$elm_ui$Internal$Style$renderRules,
+										A2($mdgriffith$elm_ui$Internal$Style$emptyIntermediate, parent.selector + (' ' + child), ''),
+										childRules),
+									rendered.others)
+							});
+					case 'Descriptor':
+						var descriptor = rule.a;
+						var descriptorRules = rule.b;
+						return _Utils_update(
+							rendered,
+							{
+								others: A2(
+									$elm$core$List$cons,
+									A2(
+										$mdgriffith$elm_ui$Internal$Style$renderRules,
+										A2(
+											$mdgriffith$elm_ui$Internal$Style$emptyIntermediate,
+											_Utils_ap(parent.selector, descriptor),
+											''),
+										descriptorRules),
+									rendered.others)
+							});
+					default:
+						var batched = rule.a;
+						return _Utils_update(
+							rendered,
+							{
+								others: A2(
+									$elm$core$List$cons,
+									A2(
+										$mdgriffith$elm_ui$Internal$Style$renderRules,
+										A2($mdgriffith$elm_ui$Internal$Style$emptyIntermediate, parent.selector, ''),
+										batched),
+									rendered.others)
+							});
+				}
+			});
+		return $mdgriffith$elm_ui$Internal$Style$Intermediate(
+			A3($elm$core$List$foldr, generateIntermediates, parent, rulesToRender));
+	});
+var $mdgriffith$elm_ui$Internal$Style$renderCompact = function (styleClasses) {
+	var renderValues = function (values) {
+		return $elm$core$String$concat(
+			A2(
+				$elm$core$List$map,
+				function (_v3) {
+					var x = _v3.a;
+					var y = _v3.b;
+					return x + (':' + (y + ';'));
+				},
+				values));
+	};
+	var renderClass = function (rule) {
+		var _v2 = rule.props;
+		if (!_v2.b) {
+			return '';
+		} else {
+			return rule.selector + ('{' + (renderValues(rule.props) + (rule.closing + '}')));
+		}
+	};
+	var renderIntermediate = function (_v0) {
+		var rule = _v0.a;
+		return _Utils_ap(
+			renderClass(rule),
+			$elm$core$String$concat(
+				A2($elm$core$List$map, renderIntermediate, rule.others)));
+	};
+	return $elm$core$String$concat(
+		A2(
+			$elm$core$List$map,
+			renderIntermediate,
+			A3(
+				$elm$core$List$foldr,
+				F2(
+					function (_v1, existing) {
+						var name = _v1.a;
+						var styleRules = _v1.b;
+						return A2(
+							$elm$core$List$cons,
+							A2(
+								$mdgriffith$elm_ui$Internal$Style$renderRules,
+								A2($mdgriffith$elm_ui$Internal$Style$emptyIntermediate, name, ''),
+								styleRules),
+							existing);
+					}),
+				_List_Nil,
+				styleClasses)));
+};
+var $mdgriffith$elm_ui$Internal$Style$rules = _Utils_ap(
+	$mdgriffith$elm_ui$Internal$Style$overrides,
+	$mdgriffith$elm_ui$Internal$Style$renderCompact(
+		_Utils_ap($mdgriffith$elm_ui$Internal$Style$baseSheet, $mdgriffith$elm_ui$Internal$Style$commonValues)));
+var $elm$virtual_dom$VirtualDom$text = _VirtualDom_text;
+var $mdgriffith$elm_ui$Internal$Model$staticRoot = function (opts) {
+	var _v0 = opts.mode;
+	switch (_v0.$) {
+		case 'Layout':
+			return A3(
+				$elm$virtual_dom$VirtualDom$node,
+				'div',
+				_List_Nil,
+				_List_fromArray(
+					[
+						A3(
+						$elm$virtual_dom$VirtualDom$node,
+						'style',
+						_List_Nil,
+						_List_fromArray(
+							[
+								$elm$virtual_dom$VirtualDom$text($mdgriffith$elm_ui$Internal$Style$rules)
+							]))
+					]));
+		case 'NoStaticStyleSheet':
+			return $elm$virtual_dom$VirtualDom$text('');
+		default:
+			return A3(
+				$elm$virtual_dom$VirtualDom$node,
+				'elm-ui-static-rules',
+				_List_fromArray(
+					[
+						A2(
+						$elm$virtual_dom$VirtualDom$property,
+						'rules',
+						$elm$json$Json$Encode$string($mdgriffith$elm_ui$Internal$Style$rules))
+					]),
+				_List_Nil);
+	}
+};
+var $elm$core$List$any = F2(
+	function (isOkay, list) {
+		any:
+		while (true) {
+			if (!list.b) {
+				return false;
+			} else {
+				var x = list.a;
+				var xs = list.b;
+				if (isOkay(x)) {
+					return true;
+				} else {
+					var $temp$isOkay = isOkay,
+						$temp$list = xs;
+					isOkay = $temp$isOkay;
+					list = $temp$list;
+					continue any;
+				}
+			}
+		}
+	});
+var $mdgriffith$elm_ui$Internal$Model$fontName = function (font) {
+	switch (font.$) {
+		case 'Serif':
+			return 'serif';
+		case 'SansSerif':
+			return 'sans-serif';
+		case 'Monospace':
+			return 'monospace';
+		case 'Typeface':
+			var name = font.a;
+			return '\"' + (name + '\"');
+		case 'ImportFont':
+			var name = font.a;
+			var url = font.b;
+			return '\"' + (name + '\"');
+		default:
+			var name = font.a.name;
+			return '\"' + (name + '\"');
+	}
+};
+var $mdgriffith$elm_ui$Internal$Model$isSmallCaps = function (_var) {
+	switch (_var.$) {
+		case 'VariantActive':
+			var name = _var.a;
+			return name === 'smcp';
+		case 'VariantOff':
+			var name = _var.a;
+			return false;
+		default:
+			var name = _var.a;
+			var index = _var.b;
+			return (name === 'smcp') && (index === 1);
+	}
+};
+var $mdgriffith$elm_ui$Internal$Model$hasSmallCaps = function (typeface) {
+	if (typeface.$ === 'FontWith') {
+		var font = typeface.a;
+		return A2($elm$core$List$any, $mdgriffith$elm_ui$Internal$Model$isSmallCaps, font.variants);
+	} else {
+		return false;
+	}
+};
+var $elm$core$Basics$min = F2(
+	function (x, y) {
+		return (_Utils_cmp(x, y) < 0) ? x : y;
+	});
+var $elm$core$Basics$negate = function (n) {
+	return -n;
+};
+var $mdgriffith$elm_ui$Internal$Model$renderProps = F3(
+	function (force, _v0, existing) {
+		var key = _v0.a;
+		var val = _v0.b;
+		return force ? (existing + ('\n  ' + (key + (': ' + (val + ' !important;'))))) : (existing + ('\n  ' + (key + (': ' + (val + ';')))));
+	});
+var $mdgriffith$elm_ui$Internal$Model$renderStyle = F4(
+	function (options, maybePseudo, selector, props) {
+		if (maybePseudo.$ === 'Nothing') {
+			return _List_fromArray(
+				[
+					selector + ('{' + (A3(
+					$elm$core$List$foldl,
+					$mdgriffith$elm_ui$Internal$Model$renderProps(false),
+					'',
+					props) + '\n}'))
+				]);
+		} else {
+			var pseudo = maybePseudo.a;
+			switch (pseudo.$) {
+				case 'Hover':
+					var _v2 = options.hover;
+					switch (_v2.$) {
+						case 'NoHover':
+							return _List_Nil;
+						case 'ForceHover':
+							return _List_fromArray(
+								[
+									selector + ('-hv {' + (A3(
+									$elm$core$List$foldl,
+									$mdgriffith$elm_ui$Internal$Model$renderProps(true),
+									'',
+									props) + '\n}'))
+								]);
+						default:
+							return _List_fromArray(
+								[
+									selector + ('-hv:hover {' + (A3(
+									$elm$core$List$foldl,
+									$mdgriffith$elm_ui$Internal$Model$renderProps(false),
+									'',
+									props) + '\n}'))
+								]);
+					}
+				case 'Focus':
+					var renderedProps = A3(
+						$elm$core$List$foldl,
+						$mdgriffith$elm_ui$Internal$Model$renderProps(false),
+						'',
+						props);
+					return _List_fromArray(
+						[
+							selector + ('-fs:focus {' + (renderedProps + '\n}')),
+							('.' + ($mdgriffith$elm_ui$Internal$Style$classes.any + (':focus ' + (selector + '-fs  {')))) + (renderedProps + '\n}'),
+							(selector + '-fs:focus-within {') + (renderedProps + '\n}'),
+							('.ui-slide-bar:focus + ' + ($mdgriffith$elm_ui$Internal$Style$dot($mdgriffith$elm_ui$Internal$Style$classes.any) + (' .focusable-thumb' + (selector + '-fs {')))) + (renderedProps + '\n}')
+						]);
+				default:
+					return _List_fromArray(
+						[
+							selector + ('-act:active {' + (A3(
+							$elm$core$List$foldl,
+							$mdgriffith$elm_ui$Internal$Model$renderProps(false),
+							'',
+							props) + '\n}'))
+						]);
+			}
+		}
+	});
+var $mdgriffith$elm_ui$Internal$Model$renderVariant = function (_var) {
+	switch (_var.$) {
+		case 'VariantActive':
+			var name = _var.a;
+			return '\"' + (name + '\"');
+		case 'VariantOff':
+			var name = _var.a;
+			return '\"' + (name + '\" 0');
+		default:
+			var name = _var.a;
+			var index = _var.b;
+			return '\"' + (name + ('\" ' + $elm$core$String$fromInt(index)));
+	}
+};
+var $mdgriffith$elm_ui$Internal$Model$renderVariants = function (typeface) {
+	if (typeface.$ === 'FontWith') {
+		var font = typeface.a;
+		return $elm$core$Maybe$Just(
+			A2(
+				$elm$core$String$join,
+				', ',
+				A2($elm$core$List$map, $mdgriffith$elm_ui$Internal$Model$renderVariant, font.variants)));
+	} else {
+		return $elm$core$Maybe$Nothing;
+	}
+};
+var $mdgriffith$elm_ui$Internal$Model$transformValue = function (transform) {
+	switch (transform.$) {
+		case 'Untransformed':
+			return $elm$core$Maybe$Nothing;
+		case 'Moved':
+			var _v1 = transform.a;
+			var x = _v1.a;
+			var y = _v1.b;
+			var z = _v1.c;
+			return $elm$core$Maybe$Just(
+				'translate3d(' + ($elm$core$String$fromFloat(x) + ('px, ' + ($elm$core$String$fromFloat(y) + ('px, ' + ($elm$core$String$fromFloat(z) + 'px)'))))));
+		default:
+			var _v2 = transform.a;
+			var tx = _v2.a;
+			var ty = _v2.b;
+			var tz = _v2.c;
+			var _v3 = transform.b;
+			var sx = _v3.a;
+			var sy = _v3.b;
+			var sz = _v3.c;
+			var _v4 = transform.c;
+			var ox = _v4.a;
+			var oy = _v4.b;
+			var oz = _v4.c;
+			var angle = transform.d;
+			var translate = 'translate3d(' + ($elm$core$String$fromFloat(tx) + ('px, ' + ($elm$core$String$fromFloat(ty) + ('px, ' + ($elm$core$String$fromFloat(tz) + 'px)')))));
+			var scale = 'scale3d(' + ($elm$core$String$fromFloat(sx) + (', ' + ($elm$core$String$fromFloat(sy) + (', ' + ($elm$core$String$fromFloat(sz) + ')')))));
+			var rotate = 'rotate3d(' + ($elm$core$String$fromFloat(ox) + (', ' + ($elm$core$String$fromFloat(oy) + (', ' + ($elm$core$String$fromFloat(oz) + (', ' + ($elm$core$String$fromFloat(angle) + 'rad)')))))));
+			return $elm$core$Maybe$Just(translate + (' ' + (scale + (' ' + rotate))));
+	}
+};
+var $mdgriffith$elm_ui$Internal$Model$renderStyleRule = F3(
+	function (options, rule, maybePseudo) {
+		switch (rule.$) {
+			case 'Style':
+				var selector = rule.a;
+				var props = rule.b;
+				return A4($mdgriffith$elm_ui$Internal$Model$renderStyle, options, maybePseudo, selector, props);
+			case 'Shadows':
+				var name = rule.a;
+				var prop = rule.b;
+				return A4(
+					$mdgriffith$elm_ui$Internal$Model$renderStyle,
+					options,
+					maybePseudo,
+					'.' + name,
+					_List_fromArray(
+						[
+							A2($mdgriffith$elm_ui$Internal$Model$Property, 'box-shadow', prop)
+						]));
+			case 'Transparency':
+				var name = rule.a;
+				var transparency = rule.b;
+				var opacity = A2(
+					$elm$core$Basics$max,
+					0,
+					A2($elm$core$Basics$min, 1, 1 - transparency));
+				return A4(
+					$mdgriffith$elm_ui$Internal$Model$renderStyle,
+					options,
+					maybePseudo,
+					'.' + name,
+					_List_fromArray(
+						[
+							A2(
+							$mdgriffith$elm_ui$Internal$Model$Property,
+							'opacity',
+							$elm$core$String$fromFloat(opacity))
+						]));
+			case 'FontSize':
+				var i = rule.a;
+				return A4(
+					$mdgriffith$elm_ui$Internal$Model$renderStyle,
+					options,
+					maybePseudo,
+					'.font-size-' + $elm$core$String$fromInt(i),
+					_List_fromArray(
+						[
+							A2(
+							$mdgriffith$elm_ui$Internal$Model$Property,
+							'font-size',
+							$elm$core$String$fromInt(i) + 'px')
+						]));
+			case 'FontFamily':
+				var name = rule.a;
+				var typefaces = rule.b;
+				var features = A2(
+					$elm$core$String$join,
+					', ',
+					A2($elm$core$List$filterMap, $mdgriffith$elm_ui$Internal$Model$renderVariants, typefaces));
+				var families = _List_fromArray(
+					[
+						A2(
+						$mdgriffith$elm_ui$Internal$Model$Property,
+						'font-family',
+						A2(
+							$elm$core$String$join,
+							', ',
+							A2($elm$core$List$map, $mdgriffith$elm_ui$Internal$Model$fontName, typefaces))),
+						A2($mdgriffith$elm_ui$Internal$Model$Property, 'font-feature-settings', features),
+						A2(
+						$mdgriffith$elm_ui$Internal$Model$Property,
+						'font-variant',
+						A2($elm$core$List$any, $mdgriffith$elm_ui$Internal$Model$hasSmallCaps, typefaces) ? 'small-caps' : 'normal')
+					]);
+				return A4($mdgriffith$elm_ui$Internal$Model$renderStyle, options, maybePseudo, '.' + name, families);
+			case 'Single':
+				var _class = rule.a;
+				var prop = rule.b;
+				var val = rule.c;
+				return A4(
+					$mdgriffith$elm_ui$Internal$Model$renderStyle,
+					options,
+					maybePseudo,
+					'.' + _class,
+					_List_fromArray(
+						[
+							A2($mdgriffith$elm_ui$Internal$Model$Property, prop, val)
+						]));
+			case 'Colored':
+				var _class = rule.a;
+				var prop = rule.b;
+				var color = rule.c;
+				return A4(
+					$mdgriffith$elm_ui$Internal$Model$renderStyle,
+					options,
+					maybePseudo,
+					'.' + _class,
+					_List_fromArray(
+						[
+							A2(
+							$mdgriffith$elm_ui$Internal$Model$Property,
+							prop,
+							$mdgriffith$elm_ui$Internal$Model$formatColor(color))
+						]));
+			case 'SpacingStyle':
+				var cls = rule.a;
+				var x = rule.b;
+				var y = rule.c;
+				var yPx = $elm$core$String$fromInt(y) + 'px';
+				var xPx = $elm$core$String$fromInt(x) + 'px';
+				var single = '.' + $mdgriffith$elm_ui$Internal$Style$classes.single;
+				var row = '.' + $mdgriffith$elm_ui$Internal$Style$classes.row;
+				var wrappedRow = '.' + ($mdgriffith$elm_ui$Internal$Style$classes.wrapped + row);
+				var right = '.' + $mdgriffith$elm_ui$Internal$Style$classes.alignRight;
+				var paragraph = '.' + $mdgriffith$elm_ui$Internal$Style$classes.paragraph;
+				var page = '.' + $mdgriffith$elm_ui$Internal$Style$classes.page;
+				var left = '.' + $mdgriffith$elm_ui$Internal$Style$classes.alignLeft;
+				var halfY = $elm$core$String$fromFloat(y / 2) + 'px';
+				var halfX = $elm$core$String$fromFloat(x / 2) + 'px';
+				var column = '.' + $mdgriffith$elm_ui$Internal$Style$classes.column;
+				var _class = '.' + cls;
+				var any = '.' + $mdgriffith$elm_ui$Internal$Style$classes.any;
+				return $elm$core$List$concat(
+					_List_fromArray(
+						[
+							A4(
+							$mdgriffith$elm_ui$Internal$Model$renderStyle,
+							options,
+							maybePseudo,
+							_class + (row + (' > ' + (any + (' + ' + any)))),
+							_List_fromArray(
+								[
+									A2($mdgriffith$elm_ui$Internal$Model$Property, 'margin-left', xPx)
+								])),
+							A4(
+							$mdgriffith$elm_ui$Internal$Model$renderStyle,
+							options,
+							maybePseudo,
+							_class + (wrappedRow + (' > ' + any)),
+							_List_fromArray(
+								[
+									A2($mdgriffith$elm_ui$Internal$Model$Property, 'margin', halfY + (' ' + halfX))
+								])),
+							A4(
+							$mdgriffith$elm_ui$Internal$Model$renderStyle,
+							options,
+							maybePseudo,
+							_class + (column + (' > ' + (any + (' + ' + any)))),
+							_List_fromArray(
+								[
+									A2($mdgriffith$elm_ui$Internal$Model$Property, 'margin-top', yPx)
+								])),
+							A4(
+							$mdgriffith$elm_ui$Internal$Model$renderStyle,
+							options,
+							maybePseudo,
+							_class + (page + (' > ' + (any + (' + ' + any)))),
+							_List_fromArray(
+								[
+									A2($mdgriffith$elm_ui$Internal$Model$Property, 'margin-top', yPx)
+								])),
+							A4(
+							$mdgriffith$elm_ui$Internal$Model$renderStyle,
+							options,
+							maybePseudo,
+							_class + (page + (' > ' + left)),
+							_List_fromArray(
+								[
+									A2($mdgriffith$elm_ui$Internal$Model$Property, 'margin-right', xPx)
+								])),
+							A4(
+							$mdgriffith$elm_ui$Internal$Model$renderStyle,
+							options,
+							maybePseudo,
+							_class + (page + (' > ' + right)),
+							_List_fromArray(
+								[
+									A2($mdgriffith$elm_ui$Internal$Model$Property, 'margin-left', xPx)
+								])),
+							A4(
+							$mdgriffith$elm_ui$Internal$Model$renderStyle,
+							options,
+							maybePseudo,
+							_Utils_ap(_class, paragraph),
+							_List_fromArray(
+								[
+									A2(
+									$mdgriffith$elm_ui$Internal$Model$Property,
+									'line-height',
+									'calc(1em + ' + ($elm$core$String$fromInt(y) + 'px)'))
+								])),
+							A4(
+							$mdgriffith$elm_ui$Internal$Model$renderStyle,
+							options,
+							maybePseudo,
+							'textarea' + (any + _class),
+							_List_fromArray(
+								[
+									A2(
+									$mdgriffith$elm_ui$Internal$Model$Property,
+									'line-height',
+									'calc(1em + ' + ($elm$core$String$fromInt(y) + 'px)')),
+									A2(
+									$mdgriffith$elm_ui$Internal$Model$Property,
+									'height',
+									'calc(100% + ' + ($elm$core$String$fromInt(y) + 'px)'))
+								])),
+							A4(
+							$mdgriffith$elm_ui$Internal$Model$renderStyle,
+							options,
+							maybePseudo,
+							_class + (paragraph + (' > ' + left)),
+							_List_fromArray(
+								[
+									A2($mdgriffith$elm_ui$Internal$Model$Property, 'margin-right', xPx)
+								])),
+							A4(
+							$mdgriffith$elm_ui$Internal$Model$renderStyle,
+							options,
+							maybePseudo,
+							_class + (paragraph + (' > ' + right)),
+							_List_fromArray(
+								[
+									A2($mdgriffith$elm_ui$Internal$Model$Property, 'margin-left', xPx)
+								])),
+							A4(
+							$mdgriffith$elm_ui$Internal$Model$renderStyle,
+							options,
+							maybePseudo,
+							_class + (paragraph + '::after'),
+							_List_fromArray(
+								[
+									A2($mdgriffith$elm_ui$Internal$Model$Property, 'content', '\'\''),
+									A2($mdgriffith$elm_ui$Internal$Model$Property, 'display', 'block'),
+									A2($mdgriffith$elm_ui$Internal$Model$Property, 'height', '0'),
+									A2($mdgriffith$elm_ui$Internal$Model$Property, 'width', '0'),
+									A2(
+									$mdgriffith$elm_ui$Internal$Model$Property,
+									'margin-top',
+									$elm$core$String$fromInt((-1) * ((y / 2) | 0)) + 'px')
+								])),
+							A4(
+							$mdgriffith$elm_ui$Internal$Model$renderStyle,
+							options,
+							maybePseudo,
+							_class + (paragraph + '::before'),
+							_List_fromArray(
+								[
+									A2($mdgriffith$elm_ui$Internal$Model$Property, 'content', '\'\''),
+									A2($mdgriffith$elm_ui$Internal$Model$Property, 'display', 'block'),
+									A2($mdgriffith$elm_ui$Internal$Model$Property, 'height', '0'),
+									A2($mdgriffith$elm_ui$Internal$Model$Property, 'width', '0'),
+									A2(
+									$mdgriffith$elm_ui$Internal$Model$Property,
+									'margin-bottom',
+									$elm$core$String$fromInt((-1) * ((y / 2) | 0)) + 'px')
+								]))
+						]));
+			case 'PaddingStyle':
+				var cls = rule.a;
+				var top = rule.b;
+				var right = rule.c;
+				var bottom = rule.d;
+				var left = rule.e;
+				var _class = '.' + cls;
+				return A4(
+					$mdgriffith$elm_ui$Internal$Model$renderStyle,
+					options,
+					maybePseudo,
+					_class,
+					_List_fromArray(
+						[
+							A2(
+							$mdgriffith$elm_ui$Internal$Model$Property,
+							'padding',
+							$elm$core$String$fromFloat(top) + ('px ' + ($elm$core$String$fromFloat(right) + ('px ' + ($elm$core$String$fromFloat(bottom) + ('px ' + ($elm$core$String$fromFloat(left) + 'px')))))))
+						]));
+			case 'BorderWidth':
+				var cls = rule.a;
+				var top = rule.b;
+				var right = rule.c;
+				var bottom = rule.d;
+				var left = rule.e;
+				var _class = '.' + cls;
+				return A4(
+					$mdgriffith$elm_ui$Internal$Model$renderStyle,
+					options,
+					maybePseudo,
+					_class,
+					_List_fromArray(
+						[
+							A2(
+							$mdgriffith$elm_ui$Internal$Model$Property,
+							'border-width',
+							$elm$core$String$fromInt(top) + ('px ' + ($elm$core$String$fromInt(right) + ('px ' + ($elm$core$String$fromInt(bottom) + ('px ' + ($elm$core$String$fromInt(left) + 'px')))))))
+						]));
+			case 'GridTemplateStyle':
+				var template = rule.a;
+				var toGridLengthHelper = F3(
+					function (minimum, maximum, x) {
+						toGridLengthHelper:
+						while (true) {
+							switch (x.$) {
+								case 'Px':
+									var px = x.a;
+									return $elm$core$String$fromInt(px) + 'px';
+								case 'Content':
+									var _v2 = _Utils_Tuple2(minimum, maximum);
+									if (_v2.a.$ === 'Nothing') {
+										if (_v2.b.$ === 'Nothing') {
+											var _v3 = _v2.a;
+											var _v4 = _v2.b;
+											return 'max-content';
+										} else {
+											var _v6 = _v2.a;
+											var maxSize = _v2.b.a;
+											return 'minmax(max-content, ' + ($elm$core$String$fromInt(maxSize) + 'px)');
+										}
+									} else {
+										if (_v2.b.$ === 'Nothing') {
+											var minSize = _v2.a.a;
+											var _v5 = _v2.b;
+											return 'minmax(' + ($elm$core$String$fromInt(minSize) + ('px, ' + 'max-content)'));
+										} else {
+											var minSize = _v2.a.a;
+											var maxSize = _v2.b.a;
+											return 'minmax(' + ($elm$core$String$fromInt(minSize) + ('px, ' + ($elm$core$String$fromInt(maxSize) + 'px)')));
+										}
+									}
+								case 'Fill':
+									var i = x.a;
+									var _v7 = _Utils_Tuple2(minimum, maximum);
+									if (_v7.a.$ === 'Nothing') {
+										if (_v7.b.$ === 'Nothing') {
+											var _v8 = _v7.a;
+											var _v9 = _v7.b;
+											return $elm$core$String$fromInt(i) + 'fr';
+										} else {
+											var _v11 = _v7.a;
+											var maxSize = _v7.b.a;
+											return 'minmax(max-content, ' + ($elm$core$String$fromInt(maxSize) + 'px)');
+										}
+									} else {
+										if (_v7.b.$ === 'Nothing') {
+											var minSize = _v7.a.a;
+											var _v10 = _v7.b;
+											return 'minmax(' + ($elm$core$String$fromInt(minSize) + ('px, ' + ($elm$core$String$fromInt(i) + ('fr' + 'fr)'))));
+										} else {
+											var minSize = _v7.a.a;
+											var maxSize = _v7.b.a;
+											return 'minmax(' + ($elm$core$String$fromInt(minSize) + ('px, ' + ($elm$core$String$fromInt(maxSize) + 'px)')));
+										}
+									}
+								case 'Min':
+									var m = x.a;
+									var len = x.b;
+									var $temp$minimum = $elm$core$Maybe$Just(m),
+										$temp$maximum = maximum,
+										$temp$x = len;
+									minimum = $temp$minimum;
+									maximum = $temp$maximum;
+									x = $temp$x;
+									continue toGridLengthHelper;
+								default:
+									var m = x.a;
+									var len = x.b;
+									var $temp$minimum = minimum,
+										$temp$maximum = $elm$core$Maybe$Just(m),
+										$temp$x = len;
+									minimum = $temp$minimum;
+									maximum = $temp$maximum;
+									x = $temp$x;
+									continue toGridLengthHelper;
+							}
+						}
+					});
+				var toGridLength = function (x) {
+					return A3(toGridLengthHelper, $elm$core$Maybe$Nothing, $elm$core$Maybe$Nothing, x);
+				};
+				var xSpacing = toGridLength(template.spacing.a);
+				var ySpacing = toGridLength(template.spacing.b);
+				var rows = function (x) {
+					return 'grid-template-rows: ' + (x + ';');
+				}(
+					A2(
+						$elm$core$String$join,
+						' ',
+						A2($elm$core$List$map, toGridLength, template.rows)));
+				var msRows = function (x) {
+					return '-ms-grid-rows: ' + (x + ';');
+				}(
+					A2(
+						$elm$core$String$join,
+						ySpacing,
+						A2($elm$core$List$map, toGridLength, template.columns)));
+				var msColumns = function (x) {
+					return '-ms-grid-columns: ' + (x + ';');
+				}(
+					A2(
+						$elm$core$String$join,
+						ySpacing,
+						A2($elm$core$List$map, toGridLength, template.columns)));
+				var gapY = 'grid-row-gap:' + (toGridLength(template.spacing.b) + ';');
+				var gapX = 'grid-column-gap:' + (toGridLength(template.spacing.a) + ';');
+				var columns = function (x) {
+					return 'grid-template-columns: ' + (x + ';');
+				}(
+					A2(
+						$elm$core$String$join,
+						' ',
+						A2($elm$core$List$map, toGridLength, template.columns)));
+				var _class = '.grid-rows-' + (A2(
+					$elm$core$String$join,
+					'-',
+					A2($elm$core$List$map, $mdgriffith$elm_ui$Internal$Model$lengthClassName, template.rows)) + ('-cols-' + (A2(
+					$elm$core$String$join,
+					'-',
+					A2($elm$core$List$map, $mdgriffith$elm_ui$Internal$Model$lengthClassName, template.columns)) + ('-space-x-' + ($mdgriffith$elm_ui$Internal$Model$lengthClassName(template.spacing.a) + ('-space-y-' + $mdgriffith$elm_ui$Internal$Model$lengthClassName(template.spacing.b)))))));
+				var modernGrid = _class + ('{' + (columns + (rows + (gapX + (gapY + '}')))));
+				var supports = '@supports (display:grid) {' + (modernGrid + '}');
+				var base = _class + ('{' + (msColumns + (msRows + '}')));
+				return _List_fromArray(
+					[base, supports]);
+			case 'GridPosition':
+				var position = rule.a;
+				var msPosition = A2(
+					$elm$core$String$join,
+					' ',
+					_List_fromArray(
+						[
+							'-ms-grid-row: ' + ($elm$core$String$fromInt(position.row) + ';'),
+							'-ms-grid-row-span: ' + ($elm$core$String$fromInt(position.height) + ';'),
+							'-ms-grid-column: ' + ($elm$core$String$fromInt(position.col) + ';'),
+							'-ms-grid-column-span: ' + ($elm$core$String$fromInt(position.width) + ';')
+						]));
+				var modernPosition = A2(
+					$elm$core$String$join,
+					' ',
+					_List_fromArray(
+						[
+							'grid-row: ' + ($elm$core$String$fromInt(position.row) + (' / ' + ($elm$core$String$fromInt(position.row + position.height) + ';'))),
+							'grid-column: ' + ($elm$core$String$fromInt(position.col) + (' / ' + ($elm$core$String$fromInt(position.col + position.width) + ';')))
+						]));
+				var _class = '.grid-pos-' + ($elm$core$String$fromInt(position.row) + ('-' + ($elm$core$String$fromInt(position.col) + ('-' + ($elm$core$String$fromInt(position.width) + ('-' + $elm$core$String$fromInt(position.height)))))));
+				var modernGrid = _class + ('{' + (modernPosition + '}'));
+				var supports = '@supports (display:grid) {' + (modernGrid + '}');
+				var base = _class + ('{' + (msPosition + '}'));
+				return _List_fromArray(
+					[base, supports]);
+			case 'PseudoSelector':
+				var _class = rule.a;
+				var styles = rule.b;
+				var renderPseudoRule = function (style) {
+					return A3(
+						$mdgriffith$elm_ui$Internal$Model$renderStyleRule,
+						options,
+						style,
+						$elm$core$Maybe$Just(_class));
+				};
+				return A2($elm$core$List$concatMap, renderPseudoRule, styles);
+			default:
+				var transform = rule.a;
+				var val = $mdgriffith$elm_ui$Internal$Model$transformValue(transform);
+				var _class = $mdgriffith$elm_ui$Internal$Model$transformClass(transform);
+				var _v12 = _Utils_Tuple2(_class, val);
+				if ((_v12.a.$ === 'Just') && (_v12.b.$ === 'Just')) {
+					var cls = _v12.a.a;
+					var v = _v12.b.a;
+					return A4(
+						$mdgriffith$elm_ui$Internal$Model$renderStyle,
+						options,
+						maybePseudo,
+						'.' + cls,
+						_List_fromArray(
+							[
+								A2($mdgriffith$elm_ui$Internal$Model$Property, 'transform', v)
+							]));
+				} else {
+					return _List_Nil;
+				}
+		}
+	});
+var $mdgriffith$elm_ui$Internal$Model$encodeStyles = F2(
+	function (options, stylesheet) {
+		return $elm$json$Json$Encode$object(
+			A2(
+				$elm$core$List$map,
+				function (style) {
+					var styled = A3($mdgriffith$elm_ui$Internal$Model$renderStyleRule, options, style, $elm$core$Maybe$Nothing);
+					return _Utils_Tuple2(
+						$mdgriffith$elm_ui$Internal$Model$getStyleName(style),
+						A2($elm$json$Json$Encode$list, $elm$json$Json$Encode$string, styled));
+				},
+				stylesheet));
+	});
+var $mdgriffith$elm_ui$Internal$Model$bracket = F2(
+	function (selector, rules) {
+		var renderPair = function (_v0) {
+			var name = _v0.a;
+			var val = _v0.b;
+			return name + (': ' + (val + ';'));
+		};
+		return selector + (' {' + (A2(
+			$elm$core$String$join,
+			'',
+			A2($elm$core$List$map, renderPair, rules)) + '}'));
+	});
+var $mdgriffith$elm_ui$Internal$Model$fontRule = F3(
+	function (name, modifier, _v0) {
+		var parentAdj = _v0.a;
+		var textAdjustment = _v0.b;
+		return _List_fromArray(
+			[
+				A2($mdgriffith$elm_ui$Internal$Model$bracket, '.' + (name + ('.' + (modifier + (', ' + ('.' + (name + (' .' + modifier))))))), parentAdj),
+				A2($mdgriffith$elm_ui$Internal$Model$bracket, '.' + (name + ('.' + (modifier + ('> .' + ($mdgriffith$elm_ui$Internal$Style$classes.text + (', .' + (name + (' .' + (modifier + (' > .' + $mdgriffith$elm_ui$Internal$Style$classes.text)))))))))), textAdjustment)
+			]);
+	});
+var $mdgriffith$elm_ui$Internal$Model$renderFontAdjustmentRule = F3(
+	function (fontToAdjust, _v0, otherFontName) {
+		var full = _v0.a;
+		var capital = _v0.b;
+		var name = _Utils_eq(fontToAdjust, otherFontName) ? fontToAdjust : (otherFontName + (' .' + fontToAdjust));
+		return A2(
+			$elm$core$String$join,
+			' ',
+			_Utils_ap(
+				A3($mdgriffith$elm_ui$Internal$Model$fontRule, name, $mdgriffith$elm_ui$Internal$Style$classes.sizeByCapital, capital),
+				A3($mdgriffith$elm_ui$Internal$Model$fontRule, name, $mdgriffith$elm_ui$Internal$Style$classes.fullSize, full)));
+	});
+var $mdgriffith$elm_ui$Internal$Model$renderNullAdjustmentRule = F2(
+	function (fontToAdjust, otherFontName) {
+		var name = _Utils_eq(fontToAdjust, otherFontName) ? fontToAdjust : (otherFontName + (' .' + fontToAdjust));
+		return A2(
+			$elm$core$String$join,
+			' ',
+			_List_fromArray(
+				[
+					A2(
+					$mdgriffith$elm_ui$Internal$Model$bracket,
+					'.' + (name + ('.' + ($mdgriffith$elm_ui$Internal$Style$classes.sizeByCapital + (', ' + ('.' + (name + (' .' + $mdgriffith$elm_ui$Internal$Style$classes.sizeByCapital))))))),
+					_List_fromArray(
+						[
+							_Utils_Tuple2('line-height', '1')
+						])),
+					A2(
+					$mdgriffith$elm_ui$Internal$Model$bracket,
+					'.' + (name + ('.' + ($mdgriffith$elm_ui$Internal$Style$classes.sizeByCapital + ('> .' + ($mdgriffith$elm_ui$Internal$Style$classes.text + (', .' + (name + (' .' + ($mdgriffith$elm_ui$Internal$Style$classes.sizeByCapital + (' > .' + $mdgriffith$elm_ui$Internal$Style$classes.text)))))))))),
+					_List_fromArray(
+						[
+							_Utils_Tuple2('vertical-align', '0'),
+							_Utils_Tuple2('line-height', '1')
+						]))
+				]));
+	});
+var $mdgriffith$elm_ui$Internal$Model$adjust = F3(
+	function (size, height, vertical) {
+		return {height: height / size, size: size, vertical: vertical};
+	});
+var $elm$core$List$maximum = function (list) {
+	if (list.b) {
+		var x = list.a;
+		var xs = list.b;
+		return $elm$core$Maybe$Just(
+			A3($elm$core$List$foldl, $elm$core$Basics$max, x, xs));
+	} else {
+		return $elm$core$Maybe$Nothing;
+	}
+};
+var $elm$core$List$minimum = function (list) {
+	if (list.b) {
+		var x = list.a;
+		var xs = list.b;
+		return $elm$core$Maybe$Just(
+			A3($elm$core$List$foldl, $elm$core$Basics$min, x, xs));
+	} else {
+		return $elm$core$Maybe$Nothing;
+	}
+};
+var $mdgriffith$elm_ui$Internal$Model$convertAdjustment = function (adjustment) {
+	var lines = _List_fromArray(
+		[adjustment.capital, adjustment.baseline, adjustment.descender, adjustment.lowercase]);
+	var lineHeight = 1.5;
+	var normalDescender = (lineHeight - 1) / 2;
+	var oldMiddle = lineHeight / 2;
+	var descender = A2(
+		$elm$core$Maybe$withDefault,
+		adjustment.descender,
+		$elm$core$List$minimum(lines));
+	var newBaseline = A2(
+		$elm$core$Maybe$withDefault,
+		adjustment.baseline,
+		$elm$core$List$minimum(
+			A2(
+				$elm$core$List$filter,
+				function (x) {
+					return !_Utils_eq(x, descender);
+				},
+				lines)));
+	var base = lineHeight;
+	var ascender = A2(
+		$elm$core$Maybe$withDefault,
+		adjustment.capital,
+		$elm$core$List$maximum(lines));
+	var capitalSize = 1 / (ascender - newBaseline);
+	var capitalVertical = 1 - ascender;
+	var fullSize = 1 / (ascender - descender);
+	var fullVertical = 1 - ascender;
+	var newCapitalMiddle = ((ascender - newBaseline) / 2) + newBaseline;
+	var newFullMiddle = ((ascender - descender) / 2) + descender;
+	return {
+		capital: A3($mdgriffith$elm_ui$Internal$Model$adjust, capitalSize, ascender - newBaseline, capitalVertical),
+		full: A3($mdgriffith$elm_ui$Internal$Model$adjust, fullSize, ascender - descender, fullVertical)
+	};
+};
+var $mdgriffith$elm_ui$Internal$Model$fontAdjustmentRules = function (converted) {
+	return _Utils_Tuple2(
+		_List_fromArray(
+			[
+				_Utils_Tuple2('display', 'block')
+			]),
+		_List_fromArray(
+			[
+				_Utils_Tuple2('display', 'inline-block'),
+				_Utils_Tuple2(
+				'line-height',
+				$elm$core$String$fromFloat(converted.height)),
+				_Utils_Tuple2(
+				'vertical-align',
+				$elm$core$String$fromFloat(converted.vertical) + 'em'),
+				_Utils_Tuple2(
+				'font-size',
+				$elm$core$String$fromFloat(converted.size) + 'em')
+			]));
+};
+var $mdgriffith$elm_ui$Internal$Model$typefaceAdjustment = function (typefaces) {
+	return A3(
+		$elm$core$List$foldl,
+		F2(
+			function (face, found) {
+				if (found.$ === 'Nothing') {
+					if (face.$ === 'FontWith') {
+						var _with = face.a;
+						var _v2 = _with.adjustment;
+						if (_v2.$ === 'Nothing') {
+							return found;
+						} else {
+							var adjustment = _v2.a;
+							return $elm$core$Maybe$Just(
+								_Utils_Tuple2(
+									$mdgriffith$elm_ui$Internal$Model$fontAdjustmentRules(
+										function ($) {
+											return $.full;
+										}(
+											$mdgriffith$elm_ui$Internal$Model$convertAdjustment(adjustment))),
+									$mdgriffith$elm_ui$Internal$Model$fontAdjustmentRules(
+										function ($) {
+											return $.capital;
+										}(
+											$mdgriffith$elm_ui$Internal$Model$convertAdjustment(adjustment)))));
+						}
+					} else {
+						return found;
+					}
+				} else {
+					return found;
+				}
+			}),
+		$elm$core$Maybe$Nothing,
+		typefaces);
+};
+var $mdgriffith$elm_ui$Internal$Model$renderTopLevelValues = function (rules) {
+	var withImport = function (font) {
+		if (font.$ === 'ImportFont') {
+			var url = font.b;
+			return $elm$core$Maybe$Just('@import url(\'' + (url + '\');'));
+		} else {
+			return $elm$core$Maybe$Nothing;
+		}
+	};
+	var fontImports = function (_v2) {
+		var name = _v2.a;
+		var typefaces = _v2.b;
+		var imports = A2(
+			$elm$core$String$join,
+			'\n',
+			A2($elm$core$List$filterMap, withImport, typefaces));
+		return imports;
+	};
+	var allNames = A2($elm$core$List$map, $elm$core$Tuple$first, rules);
+	var fontAdjustments = function (_v1) {
+		var name = _v1.a;
+		var typefaces = _v1.b;
+		var _v0 = $mdgriffith$elm_ui$Internal$Model$typefaceAdjustment(typefaces);
+		if (_v0.$ === 'Nothing') {
+			return A2(
+				$elm$core$String$join,
+				'',
+				A2(
+					$elm$core$List$map,
+					$mdgriffith$elm_ui$Internal$Model$renderNullAdjustmentRule(name),
+					allNames));
+		} else {
+			var adjustment = _v0.a;
+			return A2(
+				$elm$core$String$join,
+				'',
+				A2(
+					$elm$core$List$map,
+					A2($mdgriffith$elm_ui$Internal$Model$renderFontAdjustmentRule, name, adjustment),
+					allNames));
+		}
+	};
+	return _Utils_ap(
+		A2(
+			$elm$core$String$join,
+			'\n',
+			A2($elm$core$List$map, fontImports, rules)),
+		A2(
+			$elm$core$String$join,
+			'\n',
+			A2($elm$core$List$map, fontAdjustments, rules)));
+};
+var $mdgriffith$elm_ui$Internal$Model$topLevelValue = function (rule) {
+	if (rule.$ === 'FontFamily') {
+		var name = rule.a;
+		var typefaces = rule.b;
+		return $elm$core$Maybe$Just(
+			_Utils_Tuple2(name, typefaces));
+	} else {
+		return $elm$core$Maybe$Nothing;
+	}
+};
+var $mdgriffith$elm_ui$Internal$Model$toStyleSheetString = F2(
+	function (options, stylesheet) {
+		var combine = F2(
+			function (style, rendered) {
+				return {
+					rules: _Utils_ap(
+						rendered.rules,
+						A3($mdgriffith$elm_ui$Internal$Model$renderStyleRule, options, style, $elm$core$Maybe$Nothing)),
+					topLevel: function () {
+						var _v1 = $mdgriffith$elm_ui$Internal$Model$topLevelValue(style);
+						if (_v1.$ === 'Nothing') {
+							return rendered.topLevel;
+						} else {
+							var topLevel = _v1.a;
+							return A2($elm$core$List$cons, topLevel, rendered.topLevel);
+						}
+					}()
+				};
+			});
+		var _v0 = A3(
+			$elm$core$List$foldl,
+			combine,
+			{rules: _List_Nil, topLevel: _List_Nil},
+			stylesheet);
+		var topLevel = _v0.topLevel;
+		var rules = _v0.rules;
+		return _Utils_ap(
+			$mdgriffith$elm_ui$Internal$Model$renderTopLevelValues(topLevel),
+			$elm$core$String$concat(rules));
+	});
+var $mdgriffith$elm_ui$Internal$Model$toStyleSheet = F2(
+	function (options, styleSheet) {
+		var _v0 = options.mode;
+		switch (_v0.$) {
+			case 'Layout':
+				return A3(
+					$elm$virtual_dom$VirtualDom$node,
+					'div',
+					_List_Nil,
+					_List_fromArray(
+						[
+							A3(
+							$elm$virtual_dom$VirtualDom$node,
+							'style',
+							_List_Nil,
+							_List_fromArray(
+								[
+									$elm$virtual_dom$VirtualDom$text(
+									A2($mdgriffith$elm_ui$Internal$Model$toStyleSheetString, options, styleSheet))
+								]))
+						]));
+			case 'NoStaticStyleSheet':
+				return A3(
+					$elm$virtual_dom$VirtualDom$node,
+					'div',
+					_List_Nil,
+					_List_fromArray(
+						[
+							A3(
+							$elm$virtual_dom$VirtualDom$node,
+							'style',
+							_List_Nil,
+							_List_fromArray(
+								[
+									$elm$virtual_dom$VirtualDom$text(
+									A2($mdgriffith$elm_ui$Internal$Model$toStyleSheetString, options, styleSheet))
+								]))
+						]));
+			default:
+				return A3(
+					$elm$virtual_dom$VirtualDom$node,
+					'elm-ui-rules',
+					_List_fromArray(
+						[
+							A2(
+							$elm$virtual_dom$VirtualDom$property,
+							'rules',
+							A2($mdgriffith$elm_ui$Internal$Model$encodeStyles, options, styleSheet))
+						]),
+					_List_Nil);
+		}
+	});
+var $mdgriffith$elm_ui$Internal$Model$embedKeyed = F4(
+	function (_static, opts, styles, children) {
+		var dynamicStyleSheet = A2(
+			$mdgriffith$elm_ui$Internal$Model$toStyleSheet,
+			opts,
+			A3(
+				$elm$core$List$foldl,
+				$mdgriffith$elm_ui$Internal$Model$reduceStyles,
+				_Utils_Tuple2(
+					$elm$core$Set$empty,
+					$mdgriffith$elm_ui$Internal$Model$renderFocusStyle(opts.focus)),
+				styles).b);
+		return _static ? A2(
+			$elm$core$List$cons,
+			_Utils_Tuple2(
+				'static-stylesheet',
+				$mdgriffith$elm_ui$Internal$Model$staticRoot(opts)),
+			A2(
+				$elm$core$List$cons,
+				_Utils_Tuple2('dynamic-stylesheet', dynamicStyleSheet),
+				children)) : A2(
+			$elm$core$List$cons,
+			_Utils_Tuple2('dynamic-stylesheet', dynamicStyleSheet),
+			children);
+	});
+var $mdgriffith$elm_ui$Internal$Model$embedWith = F4(
+	function (_static, opts, styles, children) {
+		var dynamicStyleSheet = A2(
+			$mdgriffith$elm_ui$Internal$Model$toStyleSheet,
+			opts,
+			A3(
+				$elm$core$List$foldl,
+				$mdgriffith$elm_ui$Internal$Model$reduceStyles,
+				_Utils_Tuple2(
+					$elm$core$Set$empty,
+					$mdgriffith$elm_ui$Internal$Model$renderFocusStyle(opts.focus)),
+				styles).b);
+		return _static ? A2(
+			$elm$core$List$cons,
+			$mdgriffith$elm_ui$Internal$Model$staticRoot(opts),
+			A2($elm$core$List$cons, dynamicStyleSheet, children)) : A2($elm$core$List$cons, dynamicStyleSheet, children);
+	});
+var $mdgriffith$elm_ui$Internal$Flag$heightBetween = $mdgriffith$elm_ui$Internal$Flag$flag(45);
+var $mdgriffith$elm_ui$Internal$Flag$heightFill = $mdgriffith$elm_ui$Internal$Flag$flag(37);
+var $elm$virtual_dom$VirtualDom$keyedNode = function (tag) {
+	return _VirtualDom_keyedNode(
+		_VirtualDom_noScript(tag));
+};
+var $elm$core$Basics$not = _Basics_not;
+var $elm$html$Html$p = _VirtualDom_node('p');
+var $elm$core$Bitwise$and = _Bitwise_and;
+var $mdgriffith$elm_ui$Internal$Flag$present = F2(
+	function (myFlag, _v0) {
+		var fieldOne = _v0.a;
+		var fieldTwo = _v0.b;
+		if (myFlag.$ === 'Flag') {
+			var first = myFlag.a;
+			return _Utils_eq(first & fieldOne, first);
+		} else {
+			var second = myFlag.a;
+			return _Utils_eq(second & fieldTwo, second);
+		}
+	});
+var $elm$html$Html$s = _VirtualDom_node('s');
+var $elm$html$Html$u = _VirtualDom_node('u');
+var $mdgriffith$elm_ui$Internal$Flag$widthBetween = $mdgriffith$elm_ui$Internal$Flag$flag(44);
+var $mdgriffith$elm_ui$Internal$Flag$widthFill = $mdgriffith$elm_ui$Internal$Flag$flag(39);
+var $mdgriffith$elm_ui$Internal$Model$finalizeNode = F6(
+	function (has, node, attributes, children, embedMode, parentContext) {
+		var createNode = F2(
+			function (nodeName, attrs) {
+				if (children.$ === 'Keyed') {
+					var keyed = children.a;
+					return A3(
+						$elm$virtual_dom$VirtualDom$keyedNode,
+						nodeName,
+						attrs,
+						function () {
+							switch (embedMode.$) {
+								case 'NoStyleSheet':
+									return keyed;
+								case 'OnlyDynamic':
+									var opts = embedMode.a;
+									var styles = embedMode.b;
+									return A4($mdgriffith$elm_ui$Internal$Model$embedKeyed, false, opts, styles, keyed);
+								default:
+									var opts = embedMode.a;
+									var styles = embedMode.b;
+									return A4($mdgriffith$elm_ui$Internal$Model$embedKeyed, true, opts, styles, keyed);
+							}
+						}());
+				} else {
+					var unkeyed = children.a;
+					return A2(
+						function () {
+							switch (nodeName) {
+								case 'div':
+									return $elm$html$Html$div;
+								case 'p':
+									return $elm$html$Html$p;
+								default:
+									return $elm$virtual_dom$VirtualDom$node(nodeName);
+							}
+						}(),
+						attrs,
+						function () {
+							switch (embedMode.$) {
+								case 'NoStyleSheet':
+									return unkeyed;
+								case 'OnlyDynamic':
+									var opts = embedMode.a;
+									var styles = embedMode.b;
+									return A4($mdgriffith$elm_ui$Internal$Model$embedWith, false, opts, styles, unkeyed);
+								default:
+									var opts = embedMode.a;
+									var styles = embedMode.b;
+									return A4($mdgriffith$elm_ui$Internal$Model$embedWith, true, opts, styles, unkeyed);
+							}
+						}());
+				}
+			});
+		var html = function () {
+			switch (node.$) {
+				case 'Generic':
+					return A2(createNode, 'div', attributes);
+				case 'NodeName':
+					var nodeName = node.a;
+					return A2(createNode, nodeName, attributes);
+				default:
+					var nodeName = node.a;
+					var internal = node.b;
+					return A3(
+						$elm$virtual_dom$VirtualDom$node,
+						nodeName,
+						attributes,
+						_List_fromArray(
+							[
+								A2(
+								createNode,
+								internal,
+								_List_fromArray(
+									[
+										$elm$html$Html$Attributes$class($mdgriffith$elm_ui$Internal$Style$classes.any + (' ' + $mdgriffith$elm_ui$Internal$Style$classes.single))
+									]))
+							]));
+			}
+		}();
+		switch (parentContext.$) {
+			case 'AsRow':
+				return (A2($mdgriffith$elm_ui$Internal$Flag$present, $mdgriffith$elm_ui$Internal$Flag$widthFill, has) && (!A2($mdgriffith$elm_ui$Internal$Flag$present, $mdgriffith$elm_ui$Internal$Flag$widthBetween, has))) ? html : (A2($mdgriffith$elm_ui$Internal$Flag$present, $mdgriffith$elm_ui$Internal$Flag$alignRight, has) ? A2(
+					$elm$html$Html$u,
+					_List_fromArray(
+						[
+							$elm$html$Html$Attributes$class(
+							A2(
+								$elm$core$String$join,
+								' ',
+								_List_fromArray(
+									[$mdgriffith$elm_ui$Internal$Style$classes.any, $mdgriffith$elm_ui$Internal$Style$classes.single, $mdgriffith$elm_ui$Internal$Style$classes.container, $mdgriffith$elm_ui$Internal$Style$classes.contentCenterY, $mdgriffith$elm_ui$Internal$Style$classes.alignContainerRight])))
+						]),
+					_List_fromArray(
+						[html])) : (A2($mdgriffith$elm_ui$Internal$Flag$present, $mdgriffith$elm_ui$Internal$Flag$centerX, has) ? A2(
+					$elm$html$Html$s,
+					_List_fromArray(
+						[
+							$elm$html$Html$Attributes$class(
+							A2(
+								$elm$core$String$join,
+								' ',
+								_List_fromArray(
+									[$mdgriffith$elm_ui$Internal$Style$classes.any, $mdgriffith$elm_ui$Internal$Style$classes.single, $mdgriffith$elm_ui$Internal$Style$classes.container, $mdgriffith$elm_ui$Internal$Style$classes.contentCenterY, $mdgriffith$elm_ui$Internal$Style$classes.alignContainerCenterX])))
+						]),
+					_List_fromArray(
+						[html])) : html));
+			case 'AsColumn':
+				return (A2($mdgriffith$elm_ui$Internal$Flag$present, $mdgriffith$elm_ui$Internal$Flag$heightFill, has) && (!A2($mdgriffith$elm_ui$Internal$Flag$present, $mdgriffith$elm_ui$Internal$Flag$heightBetween, has))) ? html : (A2($mdgriffith$elm_ui$Internal$Flag$present, $mdgriffith$elm_ui$Internal$Flag$centerY, has) ? A2(
+					$elm$html$Html$s,
+					_List_fromArray(
+						[
+							$elm$html$Html$Attributes$class(
+							A2(
+								$elm$core$String$join,
+								' ',
+								_List_fromArray(
+									[$mdgriffith$elm_ui$Internal$Style$classes.any, $mdgriffith$elm_ui$Internal$Style$classes.single, $mdgriffith$elm_ui$Internal$Style$classes.container, $mdgriffith$elm_ui$Internal$Style$classes.alignContainerCenterY])))
+						]),
+					_List_fromArray(
+						[html])) : (A2($mdgriffith$elm_ui$Internal$Flag$present, $mdgriffith$elm_ui$Internal$Flag$alignBottom, has) ? A2(
+					$elm$html$Html$u,
+					_List_fromArray(
+						[
+							$elm$html$Html$Attributes$class(
+							A2(
+								$elm$core$String$join,
+								' ',
+								_List_fromArray(
+									[$mdgriffith$elm_ui$Internal$Style$classes.any, $mdgriffith$elm_ui$Internal$Style$classes.single, $mdgriffith$elm_ui$Internal$Style$classes.container, $mdgriffith$elm_ui$Internal$Style$classes.alignContainerBottom])))
+						]),
+					_List_fromArray(
+						[html])) : html));
+			default:
+				return html;
+		}
+	});
+var $elm$core$List$isEmpty = function (xs) {
+	if (!xs.b) {
+		return true;
+	} else {
+		return false;
+	}
+};
+var $elm$html$Html$text = $elm$virtual_dom$VirtualDom$text;
+var $mdgriffith$elm_ui$Internal$Model$textElementClasses = $mdgriffith$elm_ui$Internal$Style$classes.any + (' ' + ($mdgriffith$elm_ui$Internal$Style$classes.text + (' ' + ($mdgriffith$elm_ui$Internal$Style$classes.widthContent + (' ' + $mdgriffith$elm_ui$Internal$Style$classes.heightContent)))));
+var $mdgriffith$elm_ui$Internal$Model$textElement = function (str) {
+	return A2(
+		$elm$html$Html$div,
+		_List_fromArray(
+			[
+				$elm$html$Html$Attributes$class($mdgriffith$elm_ui$Internal$Model$textElementClasses)
+			]),
+		_List_fromArray(
+			[
+				$elm$html$Html$text(str)
+			]));
+};
+var $mdgriffith$elm_ui$Internal$Model$textElementFillClasses = $mdgriffith$elm_ui$Internal$Style$classes.any + (' ' + ($mdgriffith$elm_ui$Internal$Style$classes.text + (' ' + ($mdgriffith$elm_ui$Internal$Style$classes.widthFill + (' ' + $mdgriffith$elm_ui$Internal$Style$classes.heightFill)))));
+var $mdgriffith$elm_ui$Internal$Model$textElementFill = function (str) {
+	return A2(
+		$elm$html$Html$div,
+		_List_fromArray(
+			[
+				$elm$html$Html$Attributes$class($mdgriffith$elm_ui$Internal$Model$textElementFillClasses)
+			]),
+		_List_fromArray(
+			[
+				$elm$html$Html$text(str)
+			]));
+};
+var $mdgriffith$elm_ui$Internal$Model$createElement = F3(
+	function (context, children, rendered) {
+		var gatherKeyed = F2(
+			function (_v8, _v9) {
+				var key = _v8.a;
+				var child = _v8.b;
+				var htmls = _v9.a;
+				var existingStyles = _v9.b;
+				switch (child.$) {
+					case 'Unstyled':
+						var html = child.a;
+						return _Utils_eq(context, $mdgriffith$elm_ui$Internal$Model$asParagraph) ? _Utils_Tuple2(
+							A2(
+								$elm$core$List$cons,
+								_Utils_Tuple2(
+									key,
+									html(context)),
+								htmls),
+							existingStyles) : _Utils_Tuple2(
+							A2(
+								$elm$core$List$cons,
+								_Utils_Tuple2(
+									key,
+									html(context)),
+								htmls),
+							existingStyles);
+					case 'Styled':
+						var styled = child.a;
+						return _Utils_eq(context, $mdgriffith$elm_ui$Internal$Model$asParagraph) ? _Utils_Tuple2(
+							A2(
+								$elm$core$List$cons,
+								_Utils_Tuple2(
+									key,
+									A2(styled.html, $mdgriffith$elm_ui$Internal$Model$NoStyleSheet, context)),
+								htmls),
+							$elm$core$List$isEmpty(existingStyles) ? styled.styles : _Utils_ap(styled.styles, existingStyles)) : _Utils_Tuple2(
+							A2(
+								$elm$core$List$cons,
+								_Utils_Tuple2(
+									key,
+									A2(styled.html, $mdgriffith$elm_ui$Internal$Model$NoStyleSheet, context)),
+								htmls),
+							$elm$core$List$isEmpty(existingStyles) ? styled.styles : _Utils_ap(styled.styles, existingStyles));
+					case 'Text':
+						var str = child.a;
+						return _Utils_Tuple2(
+							A2(
+								$elm$core$List$cons,
+								_Utils_Tuple2(
+									key,
+									_Utils_eq(context, $mdgriffith$elm_ui$Internal$Model$asEl) ? $mdgriffith$elm_ui$Internal$Model$textElementFill(str) : $mdgriffith$elm_ui$Internal$Model$textElement(str)),
+								htmls),
+							existingStyles);
+					default:
+						return _Utils_Tuple2(htmls, existingStyles);
+				}
+			});
+		var gather = F2(
+			function (child, _v6) {
+				var htmls = _v6.a;
+				var existingStyles = _v6.b;
+				switch (child.$) {
+					case 'Unstyled':
+						var html = child.a;
+						return _Utils_eq(context, $mdgriffith$elm_ui$Internal$Model$asParagraph) ? _Utils_Tuple2(
+							A2(
+								$elm$core$List$cons,
+								html(context),
+								htmls),
+							existingStyles) : _Utils_Tuple2(
+							A2(
+								$elm$core$List$cons,
+								html(context),
+								htmls),
+							existingStyles);
+					case 'Styled':
+						var styled = child.a;
+						return _Utils_eq(context, $mdgriffith$elm_ui$Internal$Model$asParagraph) ? _Utils_Tuple2(
+							A2(
+								$elm$core$List$cons,
+								A2(styled.html, $mdgriffith$elm_ui$Internal$Model$NoStyleSheet, context),
+								htmls),
+							$elm$core$List$isEmpty(existingStyles) ? styled.styles : _Utils_ap(styled.styles, existingStyles)) : _Utils_Tuple2(
+							A2(
+								$elm$core$List$cons,
+								A2(styled.html, $mdgriffith$elm_ui$Internal$Model$NoStyleSheet, context),
+								htmls),
+							$elm$core$List$isEmpty(existingStyles) ? styled.styles : _Utils_ap(styled.styles, existingStyles));
+					case 'Text':
+						var str = child.a;
+						return _Utils_Tuple2(
+							A2(
+								$elm$core$List$cons,
+								_Utils_eq(context, $mdgriffith$elm_ui$Internal$Model$asEl) ? $mdgriffith$elm_ui$Internal$Model$textElementFill(str) : $mdgriffith$elm_ui$Internal$Model$textElement(str),
+								htmls),
+							existingStyles);
+					default:
+						return _Utils_Tuple2(htmls, existingStyles);
+				}
+			});
+		if (children.$ === 'Keyed') {
+			var keyedChildren = children.a;
+			var _v1 = A3(
+				$elm$core$List$foldr,
+				gatherKeyed,
+				_Utils_Tuple2(_List_Nil, _List_Nil),
+				keyedChildren);
+			var keyed = _v1.a;
+			var styles = _v1.b;
+			var newStyles = $elm$core$List$isEmpty(styles) ? rendered.styles : _Utils_ap(rendered.styles, styles);
+			if (!newStyles.b) {
+				return $mdgriffith$elm_ui$Internal$Model$Unstyled(
+					A5(
+						$mdgriffith$elm_ui$Internal$Model$finalizeNode,
+						rendered.has,
+						rendered.node,
+						rendered.attributes,
+						$mdgriffith$elm_ui$Internal$Model$Keyed(
+							A3($mdgriffith$elm_ui$Internal$Model$addKeyedChildren, 'nearby-element-pls', keyed, rendered.children)),
+						$mdgriffith$elm_ui$Internal$Model$NoStyleSheet));
+			} else {
+				var allStyles = newStyles;
+				return $mdgriffith$elm_ui$Internal$Model$Styled(
+					{
+						html: A4(
+							$mdgriffith$elm_ui$Internal$Model$finalizeNode,
+							rendered.has,
+							rendered.node,
+							rendered.attributes,
+							$mdgriffith$elm_ui$Internal$Model$Keyed(
+								A3($mdgriffith$elm_ui$Internal$Model$addKeyedChildren, 'nearby-element-pls', keyed, rendered.children))),
+						styles: allStyles
+					});
+			}
+		} else {
+			var unkeyedChildren = children.a;
+			var _v3 = A3(
+				$elm$core$List$foldr,
+				gather,
+				_Utils_Tuple2(_List_Nil, _List_Nil),
+				unkeyedChildren);
+			var unkeyed = _v3.a;
+			var styles = _v3.b;
+			var newStyles = $elm$core$List$isEmpty(styles) ? rendered.styles : _Utils_ap(rendered.styles, styles);
+			if (!newStyles.b) {
+				return $mdgriffith$elm_ui$Internal$Model$Unstyled(
+					A5(
+						$mdgriffith$elm_ui$Internal$Model$finalizeNode,
+						rendered.has,
+						rendered.node,
+						rendered.attributes,
+						$mdgriffith$elm_ui$Internal$Model$Unkeyed(
+							A2($mdgriffith$elm_ui$Internal$Model$addChildren, unkeyed, rendered.children)),
+						$mdgriffith$elm_ui$Internal$Model$NoStyleSheet));
+			} else {
+				var allStyles = newStyles;
+				return $mdgriffith$elm_ui$Internal$Model$Styled(
+					{
+						html: A4(
+							$mdgriffith$elm_ui$Internal$Model$finalizeNode,
+							rendered.has,
+							rendered.node,
+							rendered.attributes,
+							$mdgriffith$elm_ui$Internal$Model$Unkeyed(
+								A2($mdgriffith$elm_ui$Internal$Model$addChildren, unkeyed, rendered.children))),
+						styles: allStyles
+					});
+			}
+		}
+	});
+var $mdgriffith$elm_ui$Internal$Model$Single = F3(
+	function (a, b, c) {
+		return {$: 'Single', a: a, b: b, c: c};
+	});
+var $mdgriffith$elm_ui$Internal$Model$Transform = function (a) {
+	return {$: 'Transform', a: a};
+};
+var $mdgriffith$elm_ui$Internal$Flag$Field = F2(
+	function (a, b) {
+		return {$: 'Field', a: a, b: b};
+	});
+var $elm$core$Bitwise$or = _Bitwise_or;
+var $mdgriffith$elm_ui$Internal$Flag$add = F2(
+	function (myFlag, _v0) {
+		var one = _v0.a;
+		var two = _v0.b;
+		if (myFlag.$ === 'Flag') {
+			var first = myFlag.a;
+			return A2($mdgriffith$elm_ui$Internal$Flag$Field, first | one, two);
+		} else {
+			var second = myFlag.a;
+			return A2($mdgriffith$elm_ui$Internal$Flag$Field, one, second | two);
+		}
+	});
+var $mdgriffith$elm_ui$Internal$Model$ChildrenBehind = function (a) {
+	return {$: 'ChildrenBehind', a: a};
+};
+var $mdgriffith$elm_ui$Internal$Model$ChildrenBehindAndInFront = F2(
+	function (a, b) {
+		return {$: 'ChildrenBehindAndInFront', a: a, b: b};
+	});
+var $mdgriffith$elm_ui$Internal$Model$ChildrenInFront = function (a) {
+	return {$: 'ChildrenInFront', a: a};
+};
+var $mdgriffith$elm_ui$Internal$Model$nearbyElement = F2(
+	function (location, elem) {
+		return A2(
+			$elm$html$Html$div,
+			_List_fromArray(
+				[
+					$elm$html$Html$Attributes$class(
+					function () {
+						switch (location.$) {
+							case 'Above':
+								return A2(
+									$elm$core$String$join,
+									' ',
+									_List_fromArray(
+										[$mdgriffith$elm_ui$Internal$Style$classes.nearby, $mdgriffith$elm_ui$Internal$Style$classes.single, $mdgriffith$elm_ui$Internal$Style$classes.above]));
+							case 'Below':
+								return A2(
+									$elm$core$String$join,
+									' ',
+									_List_fromArray(
+										[$mdgriffith$elm_ui$Internal$Style$classes.nearby, $mdgriffith$elm_ui$Internal$Style$classes.single, $mdgriffith$elm_ui$Internal$Style$classes.below]));
+							case 'OnRight':
+								return A2(
+									$elm$core$String$join,
+									' ',
+									_List_fromArray(
+										[$mdgriffith$elm_ui$Internal$Style$classes.nearby, $mdgriffith$elm_ui$Internal$Style$classes.single, $mdgriffith$elm_ui$Internal$Style$classes.onRight]));
+							case 'OnLeft':
+								return A2(
+									$elm$core$String$join,
+									' ',
+									_List_fromArray(
+										[$mdgriffith$elm_ui$Internal$Style$classes.nearby, $mdgriffith$elm_ui$Internal$Style$classes.single, $mdgriffith$elm_ui$Internal$Style$classes.onLeft]));
+							case 'InFront':
+								return A2(
+									$elm$core$String$join,
+									' ',
+									_List_fromArray(
+										[$mdgriffith$elm_ui$Internal$Style$classes.nearby, $mdgriffith$elm_ui$Internal$Style$classes.single, $mdgriffith$elm_ui$Internal$Style$classes.inFront]));
+							default:
+								return A2(
+									$elm$core$String$join,
+									' ',
+									_List_fromArray(
+										[$mdgriffith$elm_ui$Internal$Style$classes.nearby, $mdgriffith$elm_ui$Internal$Style$classes.single, $mdgriffith$elm_ui$Internal$Style$classes.behind]));
+						}
+					}())
+				]),
+			_List_fromArray(
+				[
+					function () {
+					switch (elem.$) {
+						case 'Empty':
+							return $elm$virtual_dom$VirtualDom$text('');
+						case 'Text':
+							var str = elem.a;
+							return $mdgriffith$elm_ui$Internal$Model$textElement(str);
+						case 'Unstyled':
+							var html = elem.a;
+							return html($mdgriffith$elm_ui$Internal$Model$asEl);
+						default:
+							var styled = elem.a;
+							return A2(styled.html, $mdgriffith$elm_ui$Internal$Model$NoStyleSheet, $mdgriffith$elm_ui$Internal$Model$asEl);
+					}
+				}()
+				]));
+	});
+var $mdgriffith$elm_ui$Internal$Model$addNearbyElement = F3(
+	function (location, elem, existing) {
+		var nearby = A2($mdgriffith$elm_ui$Internal$Model$nearbyElement, location, elem);
+		switch (existing.$) {
+			case 'NoNearbyChildren':
+				if (location.$ === 'Behind') {
+					return $mdgriffith$elm_ui$Internal$Model$ChildrenBehind(
+						_List_fromArray(
+							[nearby]));
+				} else {
+					return $mdgriffith$elm_ui$Internal$Model$ChildrenInFront(
+						_List_fromArray(
+							[nearby]));
+				}
+			case 'ChildrenBehind':
+				var existingBehind = existing.a;
+				if (location.$ === 'Behind') {
+					return $mdgriffith$elm_ui$Internal$Model$ChildrenBehind(
+						A2($elm$core$List$cons, nearby, existingBehind));
+				} else {
+					return A2(
+						$mdgriffith$elm_ui$Internal$Model$ChildrenBehindAndInFront,
+						existingBehind,
+						_List_fromArray(
+							[nearby]));
+				}
+			case 'ChildrenInFront':
+				var existingInFront = existing.a;
+				if (location.$ === 'Behind') {
+					return A2(
+						$mdgriffith$elm_ui$Internal$Model$ChildrenBehindAndInFront,
+						_List_fromArray(
+							[nearby]),
+						existingInFront);
+				} else {
+					return $mdgriffith$elm_ui$Internal$Model$ChildrenInFront(
+						A2($elm$core$List$cons, nearby, existingInFront));
+				}
+			default:
+				var existingBehind = existing.a;
+				var existingInFront = existing.b;
+				if (location.$ === 'Behind') {
+					return A2(
+						$mdgriffith$elm_ui$Internal$Model$ChildrenBehindAndInFront,
+						A2($elm$core$List$cons, nearby, existingBehind),
+						existingInFront);
+				} else {
+					return A2(
+						$mdgriffith$elm_ui$Internal$Model$ChildrenBehindAndInFront,
+						existingBehind,
+						A2($elm$core$List$cons, nearby, existingInFront));
+				}
+		}
+	});
+var $mdgriffith$elm_ui$Internal$Model$Embedded = F2(
+	function (a, b) {
+		return {$: 'Embedded', a: a, b: b};
+	});
+var $mdgriffith$elm_ui$Internal$Model$NodeName = function (a) {
+	return {$: 'NodeName', a: a};
+};
+var $mdgriffith$elm_ui$Internal$Model$addNodeName = F2(
+	function (newNode, old) {
+		switch (old.$) {
+			case 'Generic':
+				return $mdgriffith$elm_ui$Internal$Model$NodeName(newNode);
+			case 'NodeName':
+				var name = old.a;
+				return A2($mdgriffith$elm_ui$Internal$Model$Embedded, name, newNode);
+			default:
+				var x = old.a;
+				var y = old.b;
+				return A2($mdgriffith$elm_ui$Internal$Model$Embedded, x, y);
+		}
+	});
+var $mdgriffith$elm_ui$Internal$Model$alignXName = function (align) {
+	switch (align.$) {
+		case 'Left':
+			return $mdgriffith$elm_ui$Internal$Style$classes.alignedHorizontally + (' ' + $mdgriffith$elm_ui$Internal$Style$classes.alignLeft);
+		case 'Right':
+			return $mdgriffith$elm_ui$Internal$Style$classes.alignedHorizontally + (' ' + $mdgriffith$elm_ui$Internal$Style$classes.alignRight);
+		default:
+			return $mdgriffith$elm_ui$Internal$Style$classes.alignedHorizontally + (' ' + $mdgriffith$elm_ui$Internal$Style$classes.alignCenterX);
+	}
+};
+var $mdgriffith$elm_ui$Internal$Model$alignYName = function (align) {
+	switch (align.$) {
+		case 'Top':
+			return $mdgriffith$elm_ui$Internal$Style$classes.alignedVertically + (' ' + $mdgriffith$elm_ui$Internal$Style$classes.alignTop);
+		case 'Bottom':
+			return $mdgriffith$elm_ui$Internal$Style$classes.alignedVertically + (' ' + $mdgriffith$elm_ui$Internal$Style$classes.alignBottom);
+		default:
+			return $mdgriffith$elm_ui$Internal$Style$classes.alignedVertically + (' ' + $mdgriffith$elm_ui$Internal$Style$classes.alignCenterY);
+	}
+};
+var $elm$virtual_dom$VirtualDom$attribute = F2(
+	function (key, value) {
+		return A2(
+			_VirtualDom_attribute,
+			_VirtualDom_noOnOrFormAction(key),
+			_VirtualDom_noJavaScriptOrHtmlUri(value));
+	});
+var $mdgriffith$elm_ui$Internal$Model$FullTransform = F4(
+	function (a, b, c, d) {
+		return {$: 'FullTransform', a: a, b: b, c: c, d: d};
+	});
+var $mdgriffith$elm_ui$Internal$Model$Moved = function (a) {
+	return {$: 'Moved', a: a};
+};
+var $mdgriffith$elm_ui$Internal$Model$composeTransformation = F2(
+	function (transform, component) {
+		switch (transform.$) {
+			case 'Untransformed':
+				switch (component.$) {
+					case 'MoveX':
+						var x = component.a;
+						return $mdgriffith$elm_ui$Internal$Model$Moved(
+							_Utils_Tuple3(x, 0, 0));
+					case 'MoveY':
+						var y = component.a;
+						return $mdgriffith$elm_ui$Internal$Model$Moved(
+							_Utils_Tuple3(0, y, 0));
+					case 'MoveZ':
+						var z = component.a;
+						return $mdgriffith$elm_ui$Internal$Model$Moved(
+							_Utils_Tuple3(0, 0, z));
+					case 'MoveXYZ':
+						var xyz = component.a;
+						return $mdgriffith$elm_ui$Internal$Model$Moved(xyz);
+					case 'Rotate':
+						var xyz = component.a;
+						var angle = component.b;
+						return A4(
+							$mdgriffith$elm_ui$Internal$Model$FullTransform,
+							_Utils_Tuple3(0, 0, 0),
+							_Utils_Tuple3(1, 1, 1),
+							xyz,
+							angle);
+					default:
+						var xyz = component.a;
+						return A4(
+							$mdgriffith$elm_ui$Internal$Model$FullTransform,
+							_Utils_Tuple3(0, 0, 0),
+							xyz,
+							_Utils_Tuple3(0, 0, 1),
+							0);
+				}
+			case 'Moved':
+				var moved = transform.a;
+				var x = moved.a;
+				var y = moved.b;
+				var z = moved.c;
+				switch (component.$) {
+					case 'MoveX':
+						var newX = component.a;
+						return $mdgriffith$elm_ui$Internal$Model$Moved(
+							_Utils_Tuple3(newX, y, z));
+					case 'MoveY':
+						var newY = component.a;
+						return $mdgriffith$elm_ui$Internal$Model$Moved(
+							_Utils_Tuple3(x, newY, z));
+					case 'MoveZ':
+						var newZ = component.a;
+						return $mdgriffith$elm_ui$Internal$Model$Moved(
+							_Utils_Tuple3(x, y, newZ));
+					case 'MoveXYZ':
+						var xyz = component.a;
+						return $mdgriffith$elm_ui$Internal$Model$Moved(xyz);
+					case 'Rotate':
+						var xyz = component.a;
+						var angle = component.b;
+						return A4(
+							$mdgriffith$elm_ui$Internal$Model$FullTransform,
+							moved,
+							_Utils_Tuple3(1, 1, 1),
+							xyz,
+							angle);
+					default:
+						var scale = component.a;
+						return A4(
+							$mdgriffith$elm_ui$Internal$Model$FullTransform,
+							moved,
+							scale,
+							_Utils_Tuple3(0, 0, 1),
+							0);
+				}
+			default:
+				var moved = transform.a;
+				var x = moved.a;
+				var y = moved.b;
+				var z = moved.c;
+				var scaled = transform.b;
+				var origin = transform.c;
+				var angle = transform.d;
+				switch (component.$) {
+					case 'MoveX':
+						var newX = component.a;
+						return A4(
+							$mdgriffith$elm_ui$Internal$Model$FullTransform,
+							_Utils_Tuple3(newX, y, z),
+							scaled,
+							origin,
+							angle);
+					case 'MoveY':
+						var newY = component.a;
+						return A4(
+							$mdgriffith$elm_ui$Internal$Model$FullTransform,
+							_Utils_Tuple3(x, newY, z),
+							scaled,
+							origin,
+							angle);
+					case 'MoveZ':
+						var newZ = component.a;
+						return A4(
+							$mdgriffith$elm_ui$Internal$Model$FullTransform,
+							_Utils_Tuple3(x, y, newZ),
+							scaled,
+							origin,
+							angle);
+					case 'MoveXYZ':
+						var newMove = component.a;
+						return A4($mdgriffith$elm_ui$Internal$Model$FullTransform, newMove, scaled, origin, angle);
+					case 'Rotate':
+						var newOrigin = component.a;
+						var newAngle = component.b;
+						return A4($mdgriffith$elm_ui$Internal$Model$FullTransform, moved, scaled, newOrigin, newAngle);
+					default:
+						var newScale = component.a;
+						return A4($mdgriffith$elm_ui$Internal$Model$FullTransform, moved, newScale, origin, angle);
+				}
+		}
+	});
+var $mdgriffith$elm_ui$Internal$Flag$height = $mdgriffith$elm_ui$Internal$Flag$flag(7);
+var $mdgriffith$elm_ui$Internal$Flag$heightContent = $mdgriffith$elm_ui$Internal$Flag$flag(36);
+var $mdgriffith$elm_ui$Internal$Flag$merge = F2(
+	function (_v0, _v1) {
+		var one = _v0.a;
+		var two = _v0.b;
+		var three = _v1.a;
+		var four = _v1.b;
+		return A2($mdgriffith$elm_ui$Internal$Flag$Field, one | three, two | four);
+	});
+var $mdgriffith$elm_ui$Internal$Flag$none = A2($mdgriffith$elm_ui$Internal$Flag$Field, 0, 0);
+var $mdgriffith$elm_ui$Internal$Model$renderHeight = function (h) {
+	switch (h.$) {
+		case 'Px':
+			var px = h.a;
+			var val = $elm$core$String$fromInt(px);
+			var name = 'height-px-' + val;
+			return _Utils_Tuple3(
+				$mdgriffith$elm_ui$Internal$Flag$none,
+				$mdgriffith$elm_ui$Internal$Style$classes.heightExact + (' ' + name),
+				_List_fromArray(
+					[
+						A3($mdgriffith$elm_ui$Internal$Model$Single, name, 'height', val + 'px')
+					]));
+		case 'Content':
+			return _Utils_Tuple3(
+				A2($mdgriffith$elm_ui$Internal$Flag$add, $mdgriffith$elm_ui$Internal$Flag$heightContent, $mdgriffith$elm_ui$Internal$Flag$none),
+				$mdgriffith$elm_ui$Internal$Style$classes.heightContent,
+				_List_Nil);
+		case 'Fill':
+			var portion = h.a;
+			return (portion === 1) ? _Utils_Tuple3(
+				A2($mdgriffith$elm_ui$Internal$Flag$add, $mdgriffith$elm_ui$Internal$Flag$heightFill, $mdgriffith$elm_ui$Internal$Flag$none),
+				$mdgriffith$elm_ui$Internal$Style$classes.heightFill,
+				_List_Nil) : _Utils_Tuple3(
+				A2($mdgriffith$elm_ui$Internal$Flag$add, $mdgriffith$elm_ui$Internal$Flag$heightFill, $mdgriffith$elm_ui$Internal$Flag$none),
+				$mdgriffith$elm_ui$Internal$Style$classes.heightFillPortion + (' height-fill-' + $elm$core$String$fromInt(portion)),
+				_List_fromArray(
+					[
+						A3(
+						$mdgriffith$elm_ui$Internal$Model$Single,
+						$mdgriffith$elm_ui$Internal$Style$classes.any + ('.' + ($mdgriffith$elm_ui$Internal$Style$classes.column + (' > ' + $mdgriffith$elm_ui$Internal$Style$dot(
+							'height-fill-' + $elm$core$String$fromInt(portion))))),
+						'flex-grow',
+						$elm$core$String$fromInt(portion * 100000))
+					]));
+		case 'Min':
+			var minSize = h.a;
+			var len = h.b;
+			var cls = 'min-height-' + $elm$core$String$fromInt(minSize);
+			var style = A3(
+				$mdgriffith$elm_ui$Internal$Model$Single,
+				cls,
+				'min-height',
+				$elm$core$String$fromInt(minSize) + 'px !important');
+			var _v1 = $mdgriffith$elm_ui$Internal$Model$renderHeight(len);
+			var newFlag = _v1.a;
+			var newAttrs = _v1.b;
+			var newStyle = _v1.c;
+			return _Utils_Tuple3(
+				A2($mdgriffith$elm_ui$Internal$Flag$add, $mdgriffith$elm_ui$Internal$Flag$heightBetween, newFlag),
+				cls + (' ' + newAttrs),
+				A2($elm$core$List$cons, style, newStyle));
+		default:
+			var maxSize = h.a;
+			var len = h.b;
+			var cls = 'max-height-' + $elm$core$String$fromInt(maxSize);
+			var style = A3(
+				$mdgriffith$elm_ui$Internal$Model$Single,
+				cls,
+				'max-height',
+				$elm$core$String$fromInt(maxSize) + 'px');
+			var _v2 = $mdgriffith$elm_ui$Internal$Model$renderHeight(len);
+			var newFlag = _v2.a;
+			var newAttrs = _v2.b;
+			var newStyle = _v2.c;
+			return _Utils_Tuple3(
+				A2($mdgriffith$elm_ui$Internal$Flag$add, $mdgriffith$elm_ui$Internal$Flag$heightBetween, newFlag),
+				cls + (' ' + newAttrs),
+				A2($elm$core$List$cons, style, newStyle));
+	}
+};
+var $mdgriffith$elm_ui$Internal$Flag$widthContent = $mdgriffith$elm_ui$Internal$Flag$flag(38);
+var $mdgriffith$elm_ui$Internal$Model$renderWidth = function (w) {
+	switch (w.$) {
+		case 'Px':
+			var px = w.a;
+			return _Utils_Tuple3(
+				$mdgriffith$elm_ui$Internal$Flag$none,
+				$mdgriffith$elm_ui$Internal$Style$classes.widthExact + (' width-px-' + $elm$core$String$fromInt(px)),
+				_List_fromArray(
+					[
+						A3(
+						$mdgriffith$elm_ui$Internal$Model$Single,
+						'width-px-' + $elm$core$String$fromInt(px),
+						'width',
+						$elm$core$String$fromInt(px) + 'px')
+					]));
+		case 'Content':
+			return _Utils_Tuple3(
+				A2($mdgriffith$elm_ui$Internal$Flag$add, $mdgriffith$elm_ui$Internal$Flag$widthContent, $mdgriffith$elm_ui$Internal$Flag$none),
+				$mdgriffith$elm_ui$Internal$Style$classes.widthContent,
+				_List_Nil);
+		case 'Fill':
+			var portion = w.a;
+			return (portion === 1) ? _Utils_Tuple3(
+				A2($mdgriffith$elm_ui$Internal$Flag$add, $mdgriffith$elm_ui$Internal$Flag$widthFill, $mdgriffith$elm_ui$Internal$Flag$none),
+				$mdgriffith$elm_ui$Internal$Style$classes.widthFill,
+				_List_Nil) : _Utils_Tuple3(
+				A2($mdgriffith$elm_ui$Internal$Flag$add, $mdgriffith$elm_ui$Internal$Flag$widthFill, $mdgriffith$elm_ui$Internal$Flag$none),
+				$mdgriffith$elm_ui$Internal$Style$classes.widthFillPortion + (' width-fill-' + $elm$core$String$fromInt(portion)),
+				_List_fromArray(
+					[
+						A3(
+						$mdgriffith$elm_ui$Internal$Model$Single,
+						$mdgriffith$elm_ui$Internal$Style$classes.any + ('.' + ($mdgriffith$elm_ui$Internal$Style$classes.row + (' > ' + $mdgriffith$elm_ui$Internal$Style$dot(
+							'width-fill-' + $elm$core$String$fromInt(portion))))),
+						'flex-grow',
+						$elm$core$String$fromInt(portion * 100000))
+					]));
+		case 'Min':
+			var minSize = w.a;
+			var len = w.b;
+			var cls = 'min-width-' + $elm$core$String$fromInt(minSize);
+			var style = A3(
+				$mdgriffith$elm_ui$Internal$Model$Single,
+				cls,
+				'min-width',
+				$elm$core$String$fromInt(minSize) + 'px');
+			var _v1 = $mdgriffith$elm_ui$Internal$Model$renderWidth(len);
+			var newFlag = _v1.a;
+			var newAttrs = _v1.b;
+			var newStyle = _v1.c;
+			return _Utils_Tuple3(
+				A2($mdgriffith$elm_ui$Internal$Flag$add, $mdgriffith$elm_ui$Internal$Flag$widthBetween, newFlag),
+				cls + (' ' + newAttrs),
+				A2($elm$core$List$cons, style, newStyle));
+		default:
+			var maxSize = w.a;
+			var len = w.b;
+			var cls = 'max-width-' + $elm$core$String$fromInt(maxSize);
+			var style = A3(
+				$mdgriffith$elm_ui$Internal$Model$Single,
+				cls,
+				'max-width',
+				$elm$core$String$fromInt(maxSize) + 'px');
+			var _v2 = $mdgriffith$elm_ui$Internal$Model$renderWidth(len);
+			var newFlag = _v2.a;
+			var newAttrs = _v2.b;
+			var newStyle = _v2.c;
+			return _Utils_Tuple3(
+				A2($mdgriffith$elm_ui$Internal$Flag$add, $mdgriffith$elm_ui$Internal$Flag$widthBetween, newFlag),
+				cls + (' ' + newAttrs),
+				A2($elm$core$List$cons, style, newStyle));
+	}
+};
+var $mdgriffith$elm_ui$Internal$Flag$borderWidth = $mdgriffith$elm_ui$Internal$Flag$flag(27);
+var $elm$core$Basics$ge = _Utils_ge;
+var $mdgriffith$elm_ui$Internal$Model$skippable = F2(
+	function (flag, style) {
+		if (_Utils_eq(flag, $mdgriffith$elm_ui$Internal$Flag$borderWidth)) {
+			if (style.$ === 'Single') {
+				var val = style.c;
+				switch (val) {
+					case '0px':
+						return true;
+					case '1px':
+						return true;
+					case '2px':
+						return true;
+					case '3px':
+						return true;
+					case '4px':
+						return true;
+					case '5px':
+						return true;
+					case '6px':
+						return true;
+					default:
+						return false;
+				}
+			} else {
+				return false;
+			}
+		} else {
+			switch (style.$) {
+				case 'FontSize':
+					var i = style.a;
+					return (i >= 8) && (i <= 32);
+				case 'PaddingStyle':
+					var name = style.a;
+					var t = style.b;
+					var r = style.c;
+					var b = style.d;
+					var l = style.e;
+					return _Utils_eq(t, b) && (_Utils_eq(t, r) && (_Utils_eq(t, l) && ((t >= 0) && (t <= 24))));
+				default:
+					return false;
+			}
+		}
+	});
+var $mdgriffith$elm_ui$Internal$Flag$width = $mdgriffith$elm_ui$Internal$Flag$flag(6);
+var $mdgriffith$elm_ui$Internal$Flag$xAlign = $mdgriffith$elm_ui$Internal$Flag$flag(30);
+var $mdgriffith$elm_ui$Internal$Flag$yAlign = $mdgriffith$elm_ui$Internal$Flag$flag(29);
+var $mdgriffith$elm_ui$Internal$Model$gatherAttrRecursive = F8(
+	function (classes, node, has, transform, styles, attrs, children, elementAttrs) {
+		gatherAttrRecursive:
+		while (true) {
+			if (!elementAttrs.b) {
+				var _v1 = $mdgriffith$elm_ui$Internal$Model$transformClass(transform);
+				if (_v1.$ === 'Nothing') {
+					return {
+						attributes: A2(
+							$elm$core$List$cons,
+							$elm$html$Html$Attributes$class(classes),
+							attrs),
+						children: children,
+						has: has,
+						node: node,
+						styles: styles
+					};
+				} else {
+					var _class = _v1.a;
+					return {
+						attributes: A2(
+							$elm$core$List$cons,
+							$elm$html$Html$Attributes$class(classes + (' ' + _class)),
+							attrs),
+						children: children,
+						has: has,
+						node: node,
+						styles: A2(
+							$elm$core$List$cons,
+							$mdgriffith$elm_ui$Internal$Model$Transform(transform),
+							styles)
+					};
+				}
+			} else {
+				var attribute = elementAttrs.a;
+				var remaining = elementAttrs.b;
+				switch (attribute.$) {
+					case 'NoAttribute':
+						var $temp$classes = classes,
+							$temp$node = node,
+							$temp$has = has,
+							$temp$transform = transform,
+							$temp$styles = styles,
+							$temp$attrs = attrs,
+							$temp$children = children,
+							$temp$elementAttrs = remaining;
+						classes = $temp$classes;
+						node = $temp$node;
+						has = $temp$has;
+						transform = $temp$transform;
+						styles = $temp$styles;
+						attrs = $temp$attrs;
+						children = $temp$children;
+						elementAttrs = $temp$elementAttrs;
+						continue gatherAttrRecursive;
+					case 'Class':
+						var flag = attribute.a;
+						var exactClassName = attribute.b;
+						if (A2($mdgriffith$elm_ui$Internal$Flag$present, flag, has)) {
+							var $temp$classes = classes,
+								$temp$node = node,
+								$temp$has = has,
+								$temp$transform = transform,
+								$temp$styles = styles,
+								$temp$attrs = attrs,
+								$temp$children = children,
+								$temp$elementAttrs = remaining;
+							classes = $temp$classes;
+							node = $temp$node;
+							has = $temp$has;
+							transform = $temp$transform;
+							styles = $temp$styles;
+							attrs = $temp$attrs;
+							children = $temp$children;
+							elementAttrs = $temp$elementAttrs;
+							continue gatherAttrRecursive;
+						} else {
+							var $temp$classes = exactClassName + (' ' + classes),
+								$temp$node = node,
+								$temp$has = A2($mdgriffith$elm_ui$Internal$Flag$add, flag, has),
+								$temp$transform = transform,
+								$temp$styles = styles,
+								$temp$attrs = attrs,
+								$temp$children = children,
+								$temp$elementAttrs = remaining;
+							classes = $temp$classes;
+							node = $temp$node;
+							has = $temp$has;
+							transform = $temp$transform;
+							styles = $temp$styles;
+							attrs = $temp$attrs;
+							children = $temp$children;
+							elementAttrs = $temp$elementAttrs;
+							continue gatherAttrRecursive;
+						}
+					case 'Attr':
+						var actualAttribute = attribute.a;
+						var $temp$classes = classes,
+							$temp$node = node,
+							$temp$has = has,
+							$temp$transform = transform,
+							$temp$styles = styles,
+							$temp$attrs = A2($elm$core$List$cons, actualAttribute, attrs),
+							$temp$children = children,
+							$temp$elementAttrs = remaining;
+						classes = $temp$classes;
+						node = $temp$node;
+						has = $temp$has;
+						transform = $temp$transform;
+						styles = $temp$styles;
+						attrs = $temp$attrs;
+						children = $temp$children;
+						elementAttrs = $temp$elementAttrs;
+						continue gatherAttrRecursive;
+					case 'StyleClass':
+						var flag = attribute.a;
+						var style = attribute.b;
+						if (A2($mdgriffith$elm_ui$Internal$Flag$present, flag, has)) {
+							var $temp$classes = classes,
+								$temp$node = node,
+								$temp$has = has,
+								$temp$transform = transform,
+								$temp$styles = styles,
+								$temp$attrs = attrs,
+								$temp$children = children,
+								$temp$elementAttrs = remaining;
+							classes = $temp$classes;
+							node = $temp$node;
+							has = $temp$has;
+							transform = $temp$transform;
+							styles = $temp$styles;
+							attrs = $temp$attrs;
+							children = $temp$children;
+							elementAttrs = $temp$elementAttrs;
+							continue gatherAttrRecursive;
+						} else {
+							if (A2($mdgriffith$elm_ui$Internal$Model$skippable, flag, style)) {
+								var $temp$classes = $mdgriffith$elm_ui$Internal$Model$getStyleName(style) + (' ' + classes),
+									$temp$node = node,
+									$temp$has = A2($mdgriffith$elm_ui$Internal$Flag$add, flag, has),
+									$temp$transform = transform,
+									$temp$styles = styles,
+									$temp$attrs = attrs,
+									$temp$children = children,
+									$temp$elementAttrs = remaining;
+								classes = $temp$classes;
+								node = $temp$node;
+								has = $temp$has;
+								transform = $temp$transform;
+								styles = $temp$styles;
+								attrs = $temp$attrs;
+								children = $temp$children;
+								elementAttrs = $temp$elementAttrs;
+								continue gatherAttrRecursive;
+							} else {
+								var $temp$classes = $mdgriffith$elm_ui$Internal$Model$getStyleName(style) + (' ' + classes),
+									$temp$node = node,
+									$temp$has = A2($mdgriffith$elm_ui$Internal$Flag$add, flag, has),
+									$temp$transform = transform,
+									$temp$styles = A2($elm$core$List$cons, style, styles),
+									$temp$attrs = attrs,
+									$temp$children = children,
+									$temp$elementAttrs = remaining;
+								classes = $temp$classes;
+								node = $temp$node;
+								has = $temp$has;
+								transform = $temp$transform;
+								styles = $temp$styles;
+								attrs = $temp$attrs;
+								children = $temp$children;
+								elementAttrs = $temp$elementAttrs;
+								continue gatherAttrRecursive;
+							}
+						}
+					case 'TransformComponent':
+						var flag = attribute.a;
+						var component = attribute.b;
+						var $temp$classes = classes,
+							$temp$node = node,
+							$temp$has = A2($mdgriffith$elm_ui$Internal$Flag$add, flag, has),
+							$temp$transform = A2($mdgriffith$elm_ui$Internal$Model$composeTransformation, transform, component),
+							$temp$styles = styles,
+							$temp$attrs = attrs,
+							$temp$children = children,
+							$temp$elementAttrs = remaining;
+						classes = $temp$classes;
+						node = $temp$node;
+						has = $temp$has;
+						transform = $temp$transform;
+						styles = $temp$styles;
+						attrs = $temp$attrs;
+						children = $temp$children;
+						elementAttrs = $temp$elementAttrs;
+						continue gatherAttrRecursive;
+					case 'Width':
+						var width = attribute.a;
+						if (A2($mdgriffith$elm_ui$Internal$Flag$present, $mdgriffith$elm_ui$Internal$Flag$width, has)) {
+							var $temp$classes = classes,
+								$temp$node = node,
+								$temp$has = has,
+								$temp$transform = transform,
+								$temp$styles = styles,
+								$temp$attrs = attrs,
+								$temp$children = children,
+								$temp$elementAttrs = remaining;
+							classes = $temp$classes;
+							node = $temp$node;
+							has = $temp$has;
+							transform = $temp$transform;
+							styles = $temp$styles;
+							attrs = $temp$attrs;
+							children = $temp$children;
+							elementAttrs = $temp$elementAttrs;
+							continue gatherAttrRecursive;
+						} else {
+							switch (width.$) {
+								case 'Px':
+									var px = width.a;
+									var $temp$classes = ($mdgriffith$elm_ui$Internal$Style$classes.widthExact + (' width-px-' + $elm$core$String$fromInt(px))) + (' ' + classes),
+										$temp$node = node,
+										$temp$has = A2($mdgriffith$elm_ui$Internal$Flag$add, $mdgriffith$elm_ui$Internal$Flag$width, has),
+										$temp$transform = transform,
+										$temp$styles = A2(
+										$elm$core$List$cons,
+										A3(
+											$mdgriffith$elm_ui$Internal$Model$Single,
+											'width-px-' + $elm$core$String$fromInt(px),
+											'width',
+											$elm$core$String$fromInt(px) + 'px'),
+										styles),
+										$temp$attrs = attrs,
+										$temp$children = children,
+										$temp$elementAttrs = remaining;
+									classes = $temp$classes;
+									node = $temp$node;
+									has = $temp$has;
+									transform = $temp$transform;
+									styles = $temp$styles;
+									attrs = $temp$attrs;
+									children = $temp$children;
+									elementAttrs = $temp$elementAttrs;
+									continue gatherAttrRecursive;
+								case 'Content':
+									var $temp$classes = classes + (' ' + $mdgriffith$elm_ui$Internal$Style$classes.widthContent),
+										$temp$node = node,
+										$temp$has = A2(
+										$mdgriffith$elm_ui$Internal$Flag$add,
+										$mdgriffith$elm_ui$Internal$Flag$widthContent,
+										A2($mdgriffith$elm_ui$Internal$Flag$add, $mdgriffith$elm_ui$Internal$Flag$width, has)),
+										$temp$transform = transform,
+										$temp$styles = styles,
+										$temp$attrs = attrs,
+										$temp$children = children,
+										$temp$elementAttrs = remaining;
+									classes = $temp$classes;
+									node = $temp$node;
+									has = $temp$has;
+									transform = $temp$transform;
+									styles = $temp$styles;
+									attrs = $temp$attrs;
+									children = $temp$children;
+									elementAttrs = $temp$elementAttrs;
+									continue gatherAttrRecursive;
+								case 'Fill':
+									var portion = width.a;
+									if (portion === 1) {
+										var $temp$classes = classes + (' ' + $mdgriffith$elm_ui$Internal$Style$classes.widthFill),
+											$temp$node = node,
+											$temp$has = A2(
+											$mdgriffith$elm_ui$Internal$Flag$add,
+											$mdgriffith$elm_ui$Internal$Flag$widthFill,
+											A2($mdgriffith$elm_ui$Internal$Flag$add, $mdgriffith$elm_ui$Internal$Flag$width, has)),
+											$temp$transform = transform,
+											$temp$styles = styles,
+											$temp$attrs = attrs,
+											$temp$children = children,
+											$temp$elementAttrs = remaining;
+										classes = $temp$classes;
+										node = $temp$node;
+										has = $temp$has;
+										transform = $temp$transform;
+										styles = $temp$styles;
+										attrs = $temp$attrs;
+										children = $temp$children;
+										elementAttrs = $temp$elementAttrs;
+										continue gatherAttrRecursive;
+									} else {
+										var $temp$classes = classes + (' ' + ($mdgriffith$elm_ui$Internal$Style$classes.widthFillPortion + (' width-fill-' + $elm$core$String$fromInt(portion)))),
+											$temp$node = node,
+											$temp$has = A2(
+											$mdgriffith$elm_ui$Internal$Flag$add,
+											$mdgriffith$elm_ui$Internal$Flag$widthFill,
+											A2($mdgriffith$elm_ui$Internal$Flag$add, $mdgriffith$elm_ui$Internal$Flag$width, has)),
+											$temp$transform = transform,
+											$temp$styles = A2(
+											$elm$core$List$cons,
+											A3(
+												$mdgriffith$elm_ui$Internal$Model$Single,
+												$mdgriffith$elm_ui$Internal$Style$classes.any + ('.' + ($mdgriffith$elm_ui$Internal$Style$classes.row + (' > ' + $mdgriffith$elm_ui$Internal$Style$dot(
+													'width-fill-' + $elm$core$String$fromInt(portion))))),
+												'flex-grow',
+												$elm$core$String$fromInt(portion * 100000)),
+											styles),
+											$temp$attrs = attrs,
+											$temp$children = children,
+											$temp$elementAttrs = remaining;
+										classes = $temp$classes;
+										node = $temp$node;
+										has = $temp$has;
+										transform = $temp$transform;
+										styles = $temp$styles;
+										attrs = $temp$attrs;
+										children = $temp$children;
+										elementAttrs = $temp$elementAttrs;
+										continue gatherAttrRecursive;
+									}
+								default:
+									var _v4 = $mdgriffith$elm_ui$Internal$Model$renderWidth(width);
+									var addToFlags = _v4.a;
+									var newClass = _v4.b;
+									var newStyles = _v4.c;
+									var $temp$classes = classes + (' ' + newClass),
+										$temp$node = node,
+										$temp$has = A2(
+										$mdgriffith$elm_ui$Internal$Flag$merge,
+										addToFlags,
+										A2($mdgriffith$elm_ui$Internal$Flag$add, $mdgriffith$elm_ui$Internal$Flag$width, has)),
+										$temp$transform = transform,
+										$temp$styles = _Utils_ap(newStyles, styles),
+										$temp$attrs = attrs,
+										$temp$children = children,
+										$temp$elementAttrs = remaining;
+									classes = $temp$classes;
+									node = $temp$node;
+									has = $temp$has;
+									transform = $temp$transform;
+									styles = $temp$styles;
+									attrs = $temp$attrs;
+									children = $temp$children;
+									elementAttrs = $temp$elementAttrs;
+									continue gatherAttrRecursive;
+							}
+						}
+					case 'Height':
+						var height = attribute.a;
+						if (A2($mdgriffith$elm_ui$Internal$Flag$present, $mdgriffith$elm_ui$Internal$Flag$height, has)) {
+							var $temp$classes = classes,
+								$temp$node = node,
+								$temp$has = has,
+								$temp$transform = transform,
+								$temp$styles = styles,
+								$temp$attrs = attrs,
+								$temp$children = children,
+								$temp$elementAttrs = remaining;
+							classes = $temp$classes;
+							node = $temp$node;
+							has = $temp$has;
+							transform = $temp$transform;
+							styles = $temp$styles;
+							attrs = $temp$attrs;
+							children = $temp$children;
+							elementAttrs = $temp$elementAttrs;
+							continue gatherAttrRecursive;
+						} else {
+							switch (height.$) {
+								case 'Px':
+									var px = height.a;
+									var val = $elm$core$String$fromInt(px) + 'px';
+									var name = 'height-px-' + val;
+									var $temp$classes = $mdgriffith$elm_ui$Internal$Style$classes.heightExact + (' ' + (name + (' ' + classes))),
+										$temp$node = node,
+										$temp$has = A2($mdgriffith$elm_ui$Internal$Flag$add, $mdgriffith$elm_ui$Internal$Flag$height, has),
+										$temp$transform = transform,
+										$temp$styles = A2(
+										$elm$core$List$cons,
+										A3($mdgriffith$elm_ui$Internal$Model$Single, name, 'height ', val),
+										styles),
+										$temp$attrs = attrs,
+										$temp$children = children,
+										$temp$elementAttrs = remaining;
+									classes = $temp$classes;
+									node = $temp$node;
+									has = $temp$has;
+									transform = $temp$transform;
+									styles = $temp$styles;
+									attrs = $temp$attrs;
+									children = $temp$children;
+									elementAttrs = $temp$elementAttrs;
+									continue gatherAttrRecursive;
+								case 'Content':
+									var $temp$classes = $mdgriffith$elm_ui$Internal$Style$classes.heightContent + (' ' + classes),
+										$temp$node = node,
+										$temp$has = A2(
+										$mdgriffith$elm_ui$Internal$Flag$add,
+										$mdgriffith$elm_ui$Internal$Flag$heightContent,
+										A2($mdgriffith$elm_ui$Internal$Flag$add, $mdgriffith$elm_ui$Internal$Flag$height, has)),
+										$temp$transform = transform,
+										$temp$styles = styles,
+										$temp$attrs = attrs,
+										$temp$children = children,
+										$temp$elementAttrs = remaining;
+									classes = $temp$classes;
+									node = $temp$node;
+									has = $temp$has;
+									transform = $temp$transform;
+									styles = $temp$styles;
+									attrs = $temp$attrs;
+									children = $temp$children;
+									elementAttrs = $temp$elementAttrs;
+									continue gatherAttrRecursive;
+								case 'Fill':
+									var portion = height.a;
+									if (portion === 1) {
+										var $temp$classes = $mdgriffith$elm_ui$Internal$Style$classes.heightFill + (' ' + classes),
+											$temp$node = node,
+											$temp$has = A2(
+											$mdgriffith$elm_ui$Internal$Flag$add,
+											$mdgriffith$elm_ui$Internal$Flag$heightFill,
+											A2($mdgriffith$elm_ui$Internal$Flag$add, $mdgriffith$elm_ui$Internal$Flag$height, has)),
+											$temp$transform = transform,
+											$temp$styles = styles,
+											$temp$attrs = attrs,
+											$temp$children = children,
+											$temp$elementAttrs = remaining;
+										classes = $temp$classes;
+										node = $temp$node;
+										has = $temp$has;
+										transform = $temp$transform;
+										styles = $temp$styles;
+										attrs = $temp$attrs;
+										children = $temp$children;
+										elementAttrs = $temp$elementAttrs;
+										continue gatherAttrRecursive;
+									} else {
+										var $temp$classes = classes + (' ' + ($mdgriffith$elm_ui$Internal$Style$classes.heightFillPortion + (' height-fill-' + $elm$core$String$fromInt(portion)))),
+											$temp$node = node,
+											$temp$has = A2(
+											$mdgriffith$elm_ui$Internal$Flag$add,
+											$mdgriffith$elm_ui$Internal$Flag$heightFill,
+											A2($mdgriffith$elm_ui$Internal$Flag$add, $mdgriffith$elm_ui$Internal$Flag$height, has)),
+											$temp$transform = transform,
+											$temp$styles = A2(
+											$elm$core$List$cons,
+											A3(
+												$mdgriffith$elm_ui$Internal$Model$Single,
+												$mdgriffith$elm_ui$Internal$Style$classes.any + ('.' + ($mdgriffith$elm_ui$Internal$Style$classes.column + (' > ' + $mdgriffith$elm_ui$Internal$Style$dot(
+													'height-fill-' + $elm$core$String$fromInt(portion))))),
+												'flex-grow',
+												$elm$core$String$fromInt(portion * 100000)),
+											styles),
+											$temp$attrs = attrs,
+											$temp$children = children,
+											$temp$elementAttrs = remaining;
+										classes = $temp$classes;
+										node = $temp$node;
+										has = $temp$has;
+										transform = $temp$transform;
+										styles = $temp$styles;
+										attrs = $temp$attrs;
+										children = $temp$children;
+										elementAttrs = $temp$elementAttrs;
+										continue gatherAttrRecursive;
+									}
+								default:
+									var _v6 = $mdgriffith$elm_ui$Internal$Model$renderHeight(height);
+									var addToFlags = _v6.a;
+									var newClass = _v6.b;
+									var newStyles = _v6.c;
+									var $temp$classes = classes + (' ' + newClass),
+										$temp$node = node,
+										$temp$has = A2(
+										$mdgriffith$elm_ui$Internal$Flag$merge,
+										addToFlags,
+										A2($mdgriffith$elm_ui$Internal$Flag$add, $mdgriffith$elm_ui$Internal$Flag$height, has)),
+										$temp$transform = transform,
+										$temp$styles = _Utils_ap(newStyles, styles),
+										$temp$attrs = attrs,
+										$temp$children = children,
+										$temp$elementAttrs = remaining;
+									classes = $temp$classes;
+									node = $temp$node;
+									has = $temp$has;
+									transform = $temp$transform;
+									styles = $temp$styles;
+									attrs = $temp$attrs;
+									children = $temp$children;
+									elementAttrs = $temp$elementAttrs;
+									continue gatherAttrRecursive;
+							}
+						}
+					case 'Describe':
+						var description = attribute.a;
+						switch (description.$) {
+							case 'Main':
+								var $temp$classes = classes,
+									$temp$node = A2($mdgriffith$elm_ui$Internal$Model$addNodeName, 'main', node),
+									$temp$has = has,
+									$temp$transform = transform,
+									$temp$styles = styles,
+									$temp$attrs = attrs,
+									$temp$children = children,
+									$temp$elementAttrs = remaining;
+								classes = $temp$classes;
+								node = $temp$node;
+								has = $temp$has;
+								transform = $temp$transform;
+								styles = $temp$styles;
+								attrs = $temp$attrs;
+								children = $temp$children;
+								elementAttrs = $temp$elementAttrs;
+								continue gatherAttrRecursive;
+							case 'Navigation':
+								var $temp$classes = classes,
+									$temp$node = A2($mdgriffith$elm_ui$Internal$Model$addNodeName, 'nav', node),
+									$temp$has = has,
+									$temp$transform = transform,
+									$temp$styles = styles,
+									$temp$attrs = attrs,
+									$temp$children = children,
+									$temp$elementAttrs = remaining;
+								classes = $temp$classes;
+								node = $temp$node;
+								has = $temp$has;
+								transform = $temp$transform;
+								styles = $temp$styles;
+								attrs = $temp$attrs;
+								children = $temp$children;
+								elementAttrs = $temp$elementAttrs;
+								continue gatherAttrRecursive;
+							case 'ContentInfo':
+								var $temp$classes = classes,
+									$temp$node = A2($mdgriffith$elm_ui$Internal$Model$addNodeName, 'footer', node),
+									$temp$has = has,
+									$temp$transform = transform,
+									$temp$styles = styles,
+									$temp$attrs = attrs,
+									$temp$children = children,
+									$temp$elementAttrs = remaining;
+								classes = $temp$classes;
+								node = $temp$node;
+								has = $temp$has;
+								transform = $temp$transform;
+								styles = $temp$styles;
+								attrs = $temp$attrs;
+								children = $temp$children;
+								elementAttrs = $temp$elementAttrs;
+								continue gatherAttrRecursive;
+							case 'Complementary':
+								var $temp$classes = classes,
+									$temp$node = A2($mdgriffith$elm_ui$Internal$Model$addNodeName, 'aside', node),
+									$temp$has = has,
+									$temp$transform = transform,
+									$temp$styles = styles,
+									$temp$attrs = attrs,
+									$temp$children = children,
+									$temp$elementAttrs = remaining;
+								classes = $temp$classes;
+								node = $temp$node;
+								has = $temp$has;
+								transform = $temp$transform;
+								styles = $temp$styles;
+								attrs = $temp$attrs;
+								children = $temp$children;
+								elementAttrs = $temp$elementAttrs;
+								continue gatherAttrRecursive;
+							case 'Heading':
+								var i = description.a;
+								if (i <= 1) {
+									var $temp$classes = classes,
+										$temp$node = A2($mdgriffith$elm_ui$Internal$Model$addNodeName, 'h1', node),
+										$temp$has = has,
+										$temp$transform = transform,
+										$temp$styles = styles,
+										$temp$attrs = attrs,
+										$temp$children = children,
+										$temp$elementAttrs = remaining;
+									classes = $temp$classes;
+									node = $temp$node;
+									has = $temp$has;
+									transform = $temp$transform;
+									styles = $temp$styles;
+									attrs = $temp$attrs;
+									children = $temp$children;
+									elementAttrs = $temp$elementAttrs;
+									continue gatherAttrRecursive;
+								} else {
+									if (i < 7) {
+										var $temp$classes = classes,
+											$temp$node = A2(
+											$mdgriffith$elm_ui$Internal$Model$addNodeName,
+											'h' + $elm$core$String$fromInt(i),
+											node),
+											$temp$has = has,
+											$temp$transform = transform,
+											$temp$styles = styles,
+											$temp$attrs = attrs,
+											$temp$children = children,
+											$temp$elementAttrs = remaining;
+										classes = $temp$classes;
+										node = $temp$node;
+										has = $temp$has;
+										transform = $temp$transform;
+										styles = $temp$styles;
+										attrs = $temp$attrs;
+										children = $temp$children;
+										elementAttrs = $temp$elementAttrs;
+										continue gatherAttrRecursive;
+									} else {
+										var $temp$classes = classes,
+											$temp$node = A2($mdgriffith$elm_ui$Internal$Model$addNodeName, 'h6', node),
+											$temp$has = has,
+											$temp$transform = transform,
+											$temp$styles = styles,
+											$temp$attrs = attrs,
+											$temp$children = children,
+											$temp$elementAttrs = remaining;
+										classes = $temp$classes;
+										node = $temp$node;
+										has = $temp$has;
+										transform = $temp$transform;
+										styles = $temp$styles;
+										attrs = $temp$attrs;
+										children = $temp$children;
+										elementAttrs = $temp$elementAttrs;
+										continue gatherAttrRecursive;
+									}
+								}
+							case 'Paragraph':
+								var $temp$classes = classes,
+									$temp$node = node,
+									$temp$has = has,
+									$temp$transform = transform,
+									$temp$styles = styles,
+									$temp$attrs = attrs,
+									$temp$children = children,
+									$temp$elementAttrs = remaining;
+								classes = $temp$classes;
+								node = $temp$node;
+								has = $temp$has;
+								transform = $temp$transform;
+								styles = $temp$styles;
+								attrs = $temp$attrs;
+								children = $temp$children;
+								elementAttrs = $temp$elementAttrs;
+								continue gatherAttrRecursive;
+							case 'Button':
+								var $temp$classes = classes,
+									$temp$node = node,
+									$temp$has = has,
+									$temp$transform = transform,
+									$temp$styles = styles,
+									$temp$attrs = A2(
+									$elm$core$List$cons,
+									A2($elm$virtual_dom$VirtualDom$attribute, 'role', 'button'),
+									attrs),
+									$temp$children = children,
+									$temp$elementAttrs = remaining;
+								classes = $temp$classes;
+								node = $temp$node;
+								has = $temp$has;
+								transform = $temp$transform;
+								styles = $temp$styles;
+								attrs = $temp$attrs;
+								children = $temp$children;
+								elementAttrs = $temp$elementAttrs;
+								continue gatherAttrRecursive;
+							case 'Label':
+								var label = description.a;
+								var $temp$classes = classes,
+									$temp$node = node,
+									$temp$has = has,
+									$temp$transform = transform,
+									$temp$styles = styles,
+									$temp$attrs = A2(
+									$elm$core$List$cons,
+									A2($elm$virtual_dom$VirtualDom$attribute, 'aria-label', label),
+									attrs),
+									$temp$children = children,
+									$temp$elementAttrs = remaining;
+								classes = $temp$classes;
+								node = $temp$node;
+								has = $temp$has;
+								transform = $temp$transform;
+								styles = $temp$styles;
+								attrs = $temp$attrs;
+								children = $temp$children;
+								elementAttrs = $temp$elementAttrs;
+								continue gatherAttrRecursive;
+							case 'LivePolite':
+								var $temp$classes = classes,
+									$temp$node = node,
+									$temp$has = has,
+									$temp$transform = transform,
+									$temp$styles = styles,
+									$temp$attrs = A2(
+									$elm$core$List$cons,
+									A2($elm$virtual_dom$VirtualDom$attribute, 'aria-live', 'polite'),
+									attrs),
+									$temp$children = children,
+									$temp$elementAttrs = remaining;
+								classes = $temp$classes;
+								node = $temp$node;
+								has = $temp$has;
+								transform = $temp$transform;
+								styles = $temp$styles;
+								attrs = $temp$attrs;
+								children = $temp$children;
+								elementAttrs = $temp$elementAttrs;
+								continue gatherAttrRecursive;
+							default:
+								var $temp$classes = classes,
+									$temp$node = node,
+									$temp$has = has,
+									$temp$transform = transform,
+									$temp$styles = styles,
+									$temp$attrs = A2(
+									$elm$core$List$cons,
+									A2($elm$virtual_dom$VirtualDom$attribute, 'aria-live', 'assertive'),
+									attrs),
+									$temp$children = children,
+									$temp$elementAttrs = remaining;
+								classes = $temp$classes;
+								node = $temp$node;
+								has = $temp$has;
+								transform = $temp$transform;
+								styles = $temp$styles;
+								attrs = $temp$attrs;
+								children = $temp$children;
+								elementAttrs = $temp$elementAttrs;
+								continue gatherAttrRecursive;
+						}
+					case 'Nearby':
+						var location = attribute.a;
+						var elem = attribute.b;
+						var newStyles = function () {
+							switch (elem.$) {
+								case 'Empty':
+									return styles;
+								case 'Text':
+									var str = elem.a;
+									return styles;
+								case 'Unstyled':
+									var html = elem.a;
+									return styles;
+								default:
+									var styled = elem.a;
+									return _Utils_ap(styles, styled.styles);
+							}
+						}();
+						var $temp$classes = classes,
+							$temp$node = node,
+							$temp$has = has,
+							$temp$transform = transform,
+							$temp$styles = newStyles,
+							$temp$attrs = attrs,
+							$temp$children = A3($mdgriffith$elm_ui$Internal$Model$addNearbyElement, location, elem, children),
+							$temp$elementAttrs = remaining;
+						classes = $temp$classes;
+						node = $temp$node;
+						has = $temp$has;
+						transform = $temp$transform;
+						styles = $temp$styles;
+						attrs = $temp$attrs;
+						children = $temp$children;
+						elementAttrs = $temp$elementAttrs;
+						continue gatherAttrRecursive;
+					case 'AlignX':
+						var x = attribute.a;
+						if (A2($mdgriffith$elm_ui$Internal$Flag$present, $mdgriffith$elm_ui$Internal$Flag$xAlign, has)) {
+							var $temp$classes = classes,
+								$temp$node = node,
+								$temp$has = has,
+								$temp$transform = transform,
+								$temp$styles = styles,
+								$temp$attrs = attrs,
+								$temp$children = children,
+								$temp$elementAttrs = remaining;
+							classes = $temp$classes;
+							node = $temp$node;
+							has = $temp$has;
+							transform = $temp$transform;
+							styles = $temp$styles;
+							attrs = $temp$attrs;
+							children = $temp$children;
+							elementAttrs = $temp$elementAttrs;
+							continue gatherAttrRecursive;
+						} else {
+							var $temp$classes = $mdgriffith$elm_ui$Internal$Model$alignXName(x) + (' ' + classes),
+								$temp$node = node,
+								$temp$has = function (flags) {
+								switch (x.$) {
+									case 'CenterX':
+										return A2($mdgriffith$elm_ui$Internal$Flag$add, $mdgriffith$elm_ui$Internal$Flag$centerX, flags);
+									case 'Right':
+										return A2($mdgriffith$elm_ui$Internal$Flag$add, $mdgriffith$elm_ui$Internal$Flag$alignRight, flags);
+									default:
+										return flags;
+								}
+							}(
+								A2($mdgriffith$elm_ui$Internal$Flag$add, $mdgriffith$elm_ui$Internal$Flag$xAlign, has)),
+								$temp$transform = transform,
+								$temp$styles = styles,
+								$temp$attrs = attrs,
+								$temp$children = children,
+								$temp$elementAttrs = remaining;
+							classes = $temp$classes;
+							node = $temp$node;
+							has = $temp$has;
+							transform = $temp$transform;
+							styles = $temp$styles;
+							attrs = $temp$attrs;
+							children = $temp$children;
+							elementAttrs = $temp$elementAttrs;
+							continue gatherAttrRecursive;
+						}
+					default:
+						var y = attribute.a;
+						if (A2($mdgriffith$elm_ui$Internal$Flag$present, $mdgriffith$elm_ui$Internal$Flag$yAlign, has)) {
+							var $temp$classes = classes,
+								$temp$node = node,
+								$temp$has = has,
+								$temp$transform = transform,
+								$temp$styles = styles,
+								$temp$attrs = attrs,
+								$temp$children = children,
+								$temp$elementAttrs = remaining;
+							classes = $temp$classes;
+							node = $temp$node;
+							has = $temp$has;
+							transform = $temp$transform;
+							styles = $temp$styles;
+							attrs = $temp$attrs;
+							children = $temp$children;
+							elementAttrs = $temp$elementAttrs;
+							continue gatherAttrRecursive;
+						} else {
+							var $temp$classes = $mdgriffith$elm_ui$Internal$Model$alignYName(y) + (' ' + classes),
+								$temp$node = node,
+								$temp$has = function (flags) {
+								switch (y.$) {
+									case 'CenterY':
+										return A2($mdgriffith$elm_ui$Internal$Flag$add, $mdgriffith$elm_ui$Internal$Flag$centerY, flags);
+									case 'Bottom':
+										return A2($mdgriffith$elm_ui$Internal$Flag$add, $mdgriffith$elm_ui$Internal$Flag$alignBottom, flags);
+									default:
+										return flags;
+								}
+							}(
+								A2($mdgriffith$elm_ui$Internal$Flag$add, $mdgriffith$elm_ui$Internal$Flag$yAlign, has)),
+								$temp$transform = transform,
+								$temp$styles = styles,
+								$temp$attrs = attrs,
+								$temp$children = children,
+								$temp$elementAttrs = remaining;
+							classes = $temp$classes;
+							node = $temp$node;
+							has = $temp$has;
+							transform = $temp$transform;
+							styles = $temp$styles;
+							attrs = $temp$attrs;
+							children = $temp$children;
+							elementAttrs = $temp$elementAttrs;
+							continue gatherAttrRecursive;
+						}
+				}
+			}
+		}
+	});
+var $mdgriffith$elm_ui$Internal$Model$Untransformed = {$: 'Untransformed'};
+var $mdgriffith$elm_ui$Internal$Model$untransformed = $mdgriffith$elm_ui$Internal$Model$Untransformed;
+var $mdgriffith$elm_ui$Internal$Model$element = F4(
+	function (context, node, attributes, children) {
+		return A3(
+			$mdgriffith$elm_ui$Internal$Model$createElement,
+			context,
+			children,
+			A8(
+				$mdgriffith$elm_ui$Internal$Model$gatherAttrRecursive,
+				$mdgriffith$elm_ui$Internal$Model$contextClasses(context),
+				node,
+				$mdgriffith$elm_ui$Internal$Flag$none,
+				$mdgriffith$elm_ui$Internal$Model$untransformed,
+				_List_Nil,
+				_List_Nil,
+				$mdgriffith$elm_ui$Internal$Model$NoNearbyChildren,
+				$elm$core$List$reverse(attributes)));
+	});
+var $mdgriffith$elm_ui$Element$Input$enter = 'Enter';
+var $mdgriffith$elm_ui$Internal$Model$NoAttribute = {$: 'NoAttribute'};
+var $mdgriffith$elm_ui$Element$Input$hasFocusStyle = function (attr) {
+	if (((attr.$ === 'StyleClass') && (attr.b.$ === 'PseudoSelector')) && (attr.b.a.$ === 'Focus')) {
+		var _v1 = attr.b;
+		var _v2 = _v1.a;
+		return true;
+	} else {
+		return false;
+	}
+};
+var $mdgriffith$elm_ui$Internal$Model$htmlClass = function (cls) {
+	return $mdgriffith$elm_ui$Internal$Model$Attr(
+		$elm$html$Html$Attributes$class(cls));
+};
+var $mdgriffith$elm_ui$Element$Input$focusDefault = function (attrs) {
+	return A2($elm$core$List$any, $mdgriffith$elm_ui$Element$Input$hasFocusStyle, attrs) ? $mdgriffith$elm_ui$Internal$Model$NoAttribute : $mdgriffith$elm_ui$Internal$Model$htmlClass('focusable');
+};
+var $mdgriffith$elm_ui$Internal$Model$Height = function (a) {
+	return {$: 'Height', a: a};
+};
+var $mdgriffith$elm_ui$Element$height = $mdgriffith$elm_ui$Internal$Model$Height;
+var $elm$core$Basics$composeL = F3(
+	function (g, f, x) {
+		return g(
+			f(x));
+	});
+var $elm$virtual_dom$VirtualDom$Normal = function (a) {
+	return {$: 'Normal', a: a};
+};
+var $elm$virtual_dom$VirtualDom$on = _VirtualDom_on;
+var $elm$html$Html$Events$on = F2(
+	function (event, decoder) {
+		return A2(
+			$elm$virtual_dom$VirtualDom$on,
+			event,
+			$elm$virtual_dom$VirtualDom$Normal(decoder));
+	});
+var $elm$html$Html$Events$onClick = function (msg) {
+	return A2(
+		$elm$html$Html$Events$on,
+		'click',
+		$elm$json$Json$Decode$succeed(msg));
+};
+var $mdgriffith$elm_ui$Element$Events$onClick = A2($elm$core$Basics$composeL, $mdgriffith$elm_ui$Internal$Model$Attr, $elm$html$Html$Events$onClick);
+var $elm$virtual_dom$VirtualDom$MayPreventDefault = function (a) {
+	return {$: 'MayPreventDefault', a: a};
+};
+var $elm$html$Html$Events$preventDefaultOn = F2(
+	function (event, decoder) {
+		return A2(
+			$elm$virtual_dom$VirtualDom$on,
+			event,
+			$elm$virtual_dom$VirtualDom$MayPreventDefault(decoder));
+	});
+var $mdgriffith$elm_ui$Element$Input$onKeyLookup = function (lookup) {
+	var decode = function (code) {
+		var _v0 = lookup(code);
+		if (_v0.$ === 'Nothing') {
+			return $elm$json$Json$Decode$fail('No key matched');
+		} else {
+			var msg = _v0.a;
+			return $elm$json$Json$Decode$succeed(msg);
+		}
+	};
+	var isKey = A2(
+		$elm$json$Json$Decode$andThen,
+		decode,
+		A2($elm$json$Json$Decode$field, 'key', $elm$json$Json$Decode$string));
+	return $mdgriffith$elm_ui$Internal$Model$Attr(
+		A2(
+			$elm$html$Html$Events$preventDefaultOn,
+			'keydown',
+			A2(
+				$elm$json$Json$Decode$map,
+				function (fired) {
+					return _Utils_Tuple2(fired, true);
+				},
+				isKey)));
+};
+var $mdgriffith$elm_ui$Internal$Model$Class = F2(
+	function (a, b) {
+		return {$: 'Class', a: a, b: b};
+	});
+var $mdgriffith$elm_ui$Internal$Flag$cursor = $mdgriffith$elm_ui$Internal$Flag$flag(21);
+var $mdgriffith$elm_ui$Element$pointer = A2($mdgriffith$elm_ui$Internal$Model$Class, $mdgriffith$elm_ui$Internal$Flag$cursor, $mdgriffith$elm_ui$Internal$Style$classes.cursorPointer);
+var $mdgriffith$elm_ui$Internal$Model$Content = {$: 'Content'};
+var $mdgriffith$elm_ui$Element$shrink = $mdgriffith$elm_ui$Internal$Model$Content;
+var $mdgriffith$elm_ui$Element$Input$space = ' ';
+var $elm$html$Html$Attributes$tabindex = function (n) {
+	return A2(
+		_VirtualDom_attribute,
+		'tabIndex',
+		$elm$core$String$fromInt(n));
+};
+var $mdgriffith$elm_ui$Internal$Model$Width = function (a) {
+	return {$: 'Width', a: a};
+};
+var $mdgriffith$elm_ui$Element$width = $mdgriffith$elm_ui$Internal$Model$Width;
+var $mdgriffith$elm_ui$Element$Input$button = F2(
+	function (attrs, _v0) {
+		var onPress = _v0.onPress;
+		var label = _v0.label;
+		return A4(
+			$mdgriffith$elm_ui$Internal$Model$element,
+			$mdgriffith$elm_ui$Internal$Model$asEl,
+			$mdgriffith$elm_ui$Internal$Model$div,
+			A2(
+				$elm$core$List$cons,
+				$mdgriffith$elm_ui$Element$width($mdgriffith$elm_ui$Element$shrink),
+				A2(
+					$elm$core$List$cons,
+					$mdgriffith$elm_ui$Element$height($mdgriffith$elm_ui$Element$shrink),
+					A2(
+						$elm$core$List$cons,
+						$mdgriffith$elm_ui$Internal$Model$htmlClass($mdgriffith$elm_ui$Internal$Style$classes.contentCenterX + (' ' + ($mdgriffith$elm_ui$Internal$Style$classes.contentCenterY + (' ' + ($mdgriffith$elm_ui$Internal$Style$classes.seButton + (' ' + $mdgriffith$elm_ui$Internal$Style$classes.noTextSelection)))))),
+						A2(
+							$elm$core$List$cons,
+							$mdgriffith$elm_ui$Element$pointer,
+							A2(
+								$elm$core$List$cons,
+								$mdgriffith$elm_ui$Element$Input$focusDefault(attrs),
+								A2(
+									$elm$core$List$cons,
+									$mdgriffith$elm_ui$Internal$Model$Describe($mdgriffith$elm_ui$Internal$Model$Button),
+									A2(
+										$elm$core$List$cons,
+										$mdgriffith$elm_ui$Internal$Model$Attr(
+											$elm$html$Html$Attributes$tabindex(0)),
+										function () {
+											if (onPress.$ === 'Nothing') {
+												return A2(
+													$elm$core$List$cons,
+													$mdgriffith$elm_ui$Internal$Model$Attr(
+														$elm$html$Html$Attributes$disabled(true)),
+													attrs);
+											} else {
+												var msg = onPress.a;
+												return A2(
+													$elm$core$List$cons,
+													$mdgriffith$elm_ui$Element$Events$onClick(msg),
+													A2(
+														$elm$core$List$cons,
+														$mdgriffith$elm_ui$Element$Input$onKeyLookup(
+															function (code) {
+																return _Utils_eq(code, $mdgriffith$elm_ui$Element$Input$enter) ? $elm$core$Maybe$Just(msg) : (_Utils_eq(code, $mdgriffith$elm_ui$Element$Input$space) ? $elm$core$Maybe$Just(msg) : $elm$core$Maybe$Nothing);
+															}),
+														attrs));
+											}
+										}()))))))),
+			$mdgriffith$elm_ui$Internal$Model$Unkeyed(
+				_List_fromArray(
+					[label])));
+	});
+var $mdgriffith$elm_ui$Internal$Model$Label = function (a) {
+	return {$: 'Label', a: a};
+};
+var $mdgriffith$elm_ui$Element$Region$description = A2($elm$core$Basics$composeL, $mdgriffith$elm_ui$Internal$Model$Describe, $mdgriffith$elm_ui$Internal$Model$Label);
+var $mdgriffith$elm_ui$Element$el = F2(
+	function (attrs, child) {
+		return A4(
+			$mdgriffith$elm_ui$Internal$Model$element,
+			$mdgriffith$elm_ui$Internal$Model$asEl,
+			$mdgriffith$elm_ui$Internal$Model$div,
+			A2(
+				$elm$core$List$cons,
+				$mdgriffith$elm_ui$Element$width($mdgriffith$elm_ui$Element$shrink),
+				A2(
+					$elm$core$List$cons,
+					$mdgriffith$elm_ui$Element$height($mdgriffith$elm_ui$Element$shrink),
+					attrs)),
+			$mdgriffith$elm_ui$Internal$Model$Unkeyed(
+				_List_fromArray(
+					[child])));
+	});
+var $mdgriffith$elm_ui$Internal$Model$AsRow = {$: 'AsRow'};
+var $mdgriffith$elm_ui$Internal$Model$asRow = $mdgriffith$elm_ui$Internal$Model$AsRow;
+var $mdgriffith$elm_ui$Element$row = F2(
+	function (attrs, children) {
+		return A4(
+			$mdgriffith$elm_ui$Internal$Model$element,
+			$mdgriffith$elm_ui$Internal$Model$asRow,
+			$mdgriffith$elm_ui$Internal$Model$div,
+			A2(
+				$elm$core$List$cons,
+				$mdgriffith$elm_ui$Internal$Model$htmlClass($mdgriffith$elm_ui$Internal$Style$classes.contentLeft + (' ' + $mdgriffith$elm_ui$Internal$Style$classes.contentCenterY)),
+				A2(
+					$elm$core$List$cons,
+					$mdgriffith$elm_ui$Element$width($mdgriffith$elm_ui$Element$shrink),
+					A2(
+						$elm$core$List$cons,
+						$mdgriffith$elm_ui$Element$height($mdgriffith$elm_ui$Element$shrink),
+						attrs))),
+			$mdgriffith$elm_ui$Internal$Model$Unkeyed(children));
+	});
+var $mdgriffith$elm_ui$Internal$Model$Text = function (a) {
+	return {$: 'Text', a: a};
+};
+var $mdgriffith$elm_ui$Element$text = function (content) {
+	return $mdgriffith$elm_ui$Internal$Model$Text(content);
+};
+var $Orasund$elm_ui_widgets$Internal$Button$button = F2(
+	function (style, _v0) {
+		var onPress = _v0.onPress;
+		var text = _v0.text;
+		var icon = _v0.icon;
+		return A2(
+			$mdgriffith$elm_ui$Element$Input$button,
+			_Utils_ap(
+				style.elementButton,
+				_Utils_ap(
+					_Utils_eq(onPress, $elm$core$Maybe$Nothing) ? style.ifDisabled : style.otherwise,
+					_List_fromArray(
+						[
+							$mdgriffith$elm_ui$Element$Region$description(text)
+						]))),
+			{
+				label: A2(
+					$mdgriffith$elm_ui$Element$row,
+					style.content.elementRow,
+					_List_fromArray(
+						[
+							icon(
+							_Utils_eq(onPress, $elm$core$Maybe$Nothing) ? style.content.content.icon.ifDisabled : style.content.content.icon.otherwise),
+							A2(
+							$mdgriffith$elm_ui$Element$el,
+							style.content.content.text.contentText,
+							$mdgriffith$elm_ui$Element$text(text))
+						])),
+				onPress: onPress
+			});
+	});
+var $Orasund$elm_ui_widgets$Widget$button = function () {
+	var fun = $Orasund$elm_ui_widgets$Internal$Button$button;
+	return fun;
+}();
+var $mdgriffith$elm_ui$Internal$Model$AsColumn = {$: 'AsColumn'};
+var $mdgriffith$elm_ui$Internal$Model$asColumn = $mdgriffith$elm_ui$Internal$Model$AsColumn;
+var $mdgriffith$elm_ui$Element$column = F2(
+	function (attrs, children) {
+		return A4(
+			$mdgriffith$elm_ui$Internal$Model$element,
+			$mdgriffith$elm_ui$Internal$Model$asColumn,
+			$mdgriffith$elm_ui$Internal$Model$div,
+			A2(
+				$elm$core$List$cons,
+				$mdgriffith$elm_ui$Internal$Model$htmlClass($mdgriffith$elm_ui$Internal$Style$classes.contentTop + (' ' + $mdgriffith$elm_ui$Internal$Style$classes.contentLeft)),
+				A2(
+					$elm$core$List$cons,
+					$mdgriffith$elm_ui$Element$height($mdgriffith$elm_ui$Element$shrink),
+					A2(
+						$elm$core$List$cons,
+						$mdgriffith$elm_ui$Element$width($mdgriffith$elm_ui$Element$shrink),
+						attrs))),
+			$mdgriffith$elm_ui$Internal$Model$Unkeyed(children));
+	});
+var $author$project$Colors$defaultPalette = function (p) {
+	return {
+		background: p.dark.white,
+		error: p.light.secondary,
+		on: {background: p.light.black, error: p.medium.white, primary: p.light.white, secondary: p.light.white, surface: p.dark.black},
+		primary: p.medium.primary,
+		secondary: p.medium.secondary,
+		surface: p.light.white
+	};
+};
+var $mdgriffith$elm_ui$Internal$Model$Fill = function (a) {
+	return {$: 'Fill', a: a};
+};
+var $mdgriffith$elm_ui$Element$fill = $mdgriffith$elm_ui$Internal$Model$Fill(1);
+var $mdgriffith$elm_ui$Internal$Flag$fontColor = $mdgriffith$elm_ui$Internal$Flag$flag(14);
+var $mdgriffith$elm_ui$Element$Font$color = function (fontColor) {
+	return A2(
+		$mdgriffith$elm_ui$Internal$Model$StyleClass,
+		$mdgriffith$elm_ui$Internal$Flag$fontColor,
+		A3(
+			$mdgriffith$elm_ui$Internal$Model$Colored,
+			'fc-' + $mdgriffith$elm_ui$Internal$Model$formatColorClass(fontColor),
+			'color',
+			fontColor));
+};
+var $author$project$Colors$font = A2(
+	$elm$core$Basics$composeR,
+	$avh4$elm_color$Color$toRgba,
+	A2($elm$core$Basics$composeR, $mdgriffith$elm_ui$Element$fromRgb, $mdgriffith$elm_ui$Element$Font$color));
+var $mdgriffith$elm_ui$Element$Input$HiddenLabel = function (a) {
+	return {$: 'HiddenLabel', a: a};
+};
+var $mdgriffith$elm_ui$Element$Input$labelHidden = $mdgriffith$elm_ui$Element$Input$HiddenLabel;
+var $mdgriffith$elm_ui$Internal$Model$OnlyDynamic = F2(
+	function (a, b) {
+		return {$: 'OnlyDynamic', a: a, b: b};
+	});
+var $mdgriffith$elm_ui$Internal$Model$StaticRootAndDynamic = F2(
+	function (a, b) {
+		return {$: 'StaticRootAndDynamic', a: a, b: b};
+	});
+var $mdgriffith$elm_ui$Internal$Model$AllowHover = {$: 'AllowHover'};
+var $mdgriffith$elm_ui$Internal$Model$Layout = {$: 'Layout'};
+var $mdgriffith$elm_ui$Internal$Model$focusDefaultStyle = {
+	backgroundColor: $elm$core$Maybe$Nothing,
+	borderColor: $elm$core$Maybe$Nothing,
+	shadow: $elm$core$Maybe$Just(
+		{
+			blur: 0,
+			color: A4($mdgriffith$elm_ui$Internal$Model$Rgba, 155 / 255, 203 / 255, 1, 1),
+			offset: _Utils_Tuple2(0, 0),
+			size: 3
+		})
+};
+var $mdgriffith$elm_ui$Internal$Model$optionsToRecord = function (options) {
+	var combine = F2(
+		function (opt, record) {
+			switch (opt.$) {
+				case 'HoverOption':
+					var hoverable = opt.a;
+					var _v4 = record.hover;
+					if (_v4.$ === 'Nothing') {
+						return _Utils_update(
+							record,
+							{
+								hover: $elm$core$Maybe$Just(hoverable)
+							});
+					} else {
+						return record;
+					}
+				case 'FocusStyleOption':
+					var focusStyle = opt.a;
+					var _v5 = record.focus;
+					if (_v5.$ === 'Nothing') {
+						return _Utils_update(
+							record,
+							{
+								focus: $elm$core$Maybe$Just(focusStyle)
+							});
+					} else {
+						return record;
+					}
+				default:
+					var renderMode = opt.a;
+					var _v6 = record.mode;
+					if (_v6.$ === 'Nothing') {
+						return _Utils_update(
+							record,
+							{
+								mode: $elm$core$Maybe$Just(renderMode)
+							});
+					} else {
+						return record;
+					}
+			}
+		});
+	var andFinally = function (record) {
+		return {
+			focus: function () {
+				var _v0 = record.focus;
+				if (_v0.$ === 'Nothing') {
+					return $mdgriffith$elm_ui$Internal$Model$focusDefaultStyle;
+				} else {
+					var focusable = _v0.a;
+					return focusable;
+				}
+			}(),
+			hover: function () {
+				var _v1 = record.hover;
+				if (_v1.$ === 'Nothing') {
+					return $mdgriffith$elm_ui$Internal$Model$AllowHover;
+				} else {
+					var hoverable = _v1.a;
+					return hoverable;
+				}
+			}(),
+			mode: function () {
+				var _v2 = record.mode;
+				if (_v2.$ === 'Nothing') {
+					return $mdgriffith$elm_ui$Internal$Model$Layout;
+				} else {
+					var actualMode = _v2.a;
+					return actualMode;
+				}
+			}()
+		};
+	};
+	return andFinally(
+		A3(
+			$elm$core$List$foldr,
+			combine,
+			{focus: $elm$core$Maybe$Nothing, hover: $elm$core$Maybe$Nothing, mode: $elm$core$Maybe$Nothing},
+			options));
+};
+var $mdgriffith$elm_ui$Internal$Model$toHtml = F2(
+	function (mode, el) {
+		switch (el.$) {
+			case 'Unstyled':
+				var html = el.a;
+				return html($mdgriffith$elm_ui$Internal$Model$asEl);
+			case 'Styled':
+				var styles = el.a.styles;
+				var html = el.a.html;
+				return A2(
+					html,
+					mode(styles),
+					$mdgriffith$elm_ui$Internal$Model$asEl);
+			case 'Text':
+				var text = el.a;
+				return $mdgriffith$elm_ui$Internal$Model$textElement(text);
+			default:
+				return $mdgriffith$elm_ui$Internal$Model$textElement('');
+		}
+	});
+var $mdgriffith$elm_ui$Internal$Model$renderRoot = F3(
+	function (optionList, attributes, child) {
+		var options = $mdgriffith$elm_ui$Internal$Model$optionsToRecord(optionList);
+		var embedStyle = function () {
+			var _v0 = options.mode;
+			if (_v0.$ === 'NoStaticStyleSheet') {
+				return $mdgriffith$elm_ui$Internal$Model$OnlyDynamic(options);
+			} else {
+				return $mdgriffith$elm_ui$Internal$Model$StaticRootAndDynamic(options);
+			}
+		}();
+		return A2(
+			$mdgriffith$elm_ui$Internal$Model$toHtml,
+			embedStyle,
+			A4(
+				$mdgriffith$elm_ui$Internal$Model$element,
+				$mdgriffith$elm_ui$Internal$Model$asEl,
+				$mdgriffith$elm_ui$Internal$Model$div,
+				attributes,
+				$mdgriffith$elm_ui$Internal$Model$Unkeyed(
+					_List_fromArray(
+						[child]))));
+	});
+var $mdgriffith$elm_ui$Internal$Model$FontFamily = F2(
+	function (a, b) {
+		return {$: 'FontFamily', a: a, b: b};
+	});
+var $mdgriffith$elm_ui$Internal$Model$FontSize = function (a) {
+	return {$: 'FontSize', a: a};
+};
+var $mdgriffith$elm_ui$Internal$Model$SansSerif = {$: 'SansSerif'};
+var $mdgriffith$elm_ui$Internal$Model$Typeface = function (a) {
+	return {$: 'Typeface', a: a};
+};
+var $mdgriffith$elm_ui$Internal$Flag$fontFamily = $mdgriffith$elm_ui$Internal$Flag$flag(5);
+var $mdgriffith$elm_ui$Internal$Flag$fontSize = $mdgriffith$elm_ui$Internal$Flag$flag(4);
+var $elm$core$String$toLower = _String_toLower;
+var $elm$core$String$words = _String_words;
+var $mdgriffith$elm_ui$Internal$Model$renderFontClassName = F2(
+	function (font, current) {
+		return _Utils_ap(
+			current,
+			function () {
+				switch (font.$) {
+					case 'Serif':
+						return 'serif';
+					case 'SansSerif':
+						return 'sans-serif';
+					case 'Monospace':
+						return 'monospace';
+					case 'Typeface':
+						var name = font.a;
+						return A2(
+							$elm$core$String$join,
+							'-',
+							$elm$core$String$words(
+								$elm$core$String$toLower(name)));
+					case 'ImportFont':
+						var name = font.a;
+						var url = font.b;
+						return A2(
+							$elm$core$String$join,
+							'-',
+							$elm$core$String$words(
+								$elm$core$String$toLower(name)));
+					default:
+						var name = font.a.name;
+						return A2(
+							$elm$core$String$join,
+							'-',
+							$elm$core$String$words(
+								$elm$core$String$toLower(name)));
+				}
+			}());
+	});
+var $mdgriffith$elm_ui$Internal$Model$rootStyle = function () {
+	var families = _List_fromArray(
+		[
+			$mdgriffith$elm_ui$Internal$Model$Typeface('Open Sans'),
+			$mdgriffith$elm_ui$Internal$Model$Typeface('Helvetica'),
+			$mdgriffith$elm_ui$Internal$Model$Typeface('Verdana'),
+			$mdgriffith$elm_ui$Internal$Model$SansSerif
+		]);
+	return _List_fromArray(
+		[
+			A2(
+			$mdgriffith$elm_ui$Internal$Model$StyleClass,
+			$mdgriffith$elm_ui$Internal$Flag$bgColor,
+			A3(
+				$mdgriffith$elm_ui$Internal$Model$Colored,
+				'bg-' + $mdgriffith$elm_ui$Internal$Model$formatColorClass(
+					A4($mdgriffith$elm_ui$Internal$Model$Rgba, 1, 1, 1, 0)),
+				'background-color',
+				A4($mdgriffith$elm_ui$Internal$Model$Rgba, 1, 1, 1, 0))),
+			A2(
+			$mdgriffith$elm_ui$Internal$Model$StyleClass,
+			$mdgriffith$elm_ui$Internal$Flag$fontColor,
+			A3(
+				$mdgriffith$elm_ui$Internal$Model$Colored,
+				'fc-' + $mdgriffith$elm_ui$Internal$Model$formatColorClass(
+					A4($mdgriffith$elm_ui$Internal$Model$Rgba, 0, 0, 0, 1)),
+				'color',
+				A4($mdgriffith$elm_ui$Internal$Model$Rgba, 0, 0, 0, 1))),
+			A2(
+			$mdgriffith$elm_ui$Internal$Model$StyleClass,
+			$mdgriffith$elm_ui$Internal$Flag$fontSize,
+			$mdgriffith$elm_ui$Internal$Model$FontSize(20)),
+			A2(
+			$mdgriffith$elm_ui$Internal$Model$StyleClass,
+			$mdgriffith$elm_ui$Internal$Flag$fontFamily,
+			A2(
+				$mdgriffith$elm_ui$Internal$Model$FontFamily,
+				A3($elm$core$List$foldl, $mdgriffith$elm_ui$Internal$Model$renderFontClassName, 'font-', families),
+				families))
+		]);
+}();
+var $mdgriffith$elm_ui$Element$layoutWith = F3(
+	function (_v0, attrs, child) {
+		var options = _v0.options;
+		return A3(
+			$mdgriffith$elm_ui$Internal$Model$renderRoot,
+			options,
+			A2(
+				$elm$core$List$cons,
+				$mdgriffith$elm_ui$Internal$Model$htmlClass(
+					A2(
+						$elm$core$String$join,
+						' ',
+						_List_fromArray(
+							[$mdgriffith$elm_ui$Internal$Style$classes.root, $mdgriffith$elm_ui$Internal$Style$classes.any, $mdgriffith$elm_ui$Internal$Style$classes.single]))),
+				_Utils_ap($mdgriffith$elm_ui$Internal$Model$rootStyle, attrs)),
+			child);
+	});
+var $mdgriffith$elm_ui$Element$layout = $mdgriffith$elm_ui$Element$layoutWith(
+	{options: _List_Nil});
+var $elm$html$Html$Attributes$href = function (url) {
+	return A2(
+		$elm$html$Html$Attributes$stringProperty,
+		'href',
+		_VirtualDom_noJavaScriptUri(url));
+};
+var $elm$html$Html$Attributes$rel = _VirtualDom_attribute('rel');
+var $mdgriffith$elm_ui$Element$link = F2(
+	function (attrs, _v0) {
+		var url = _v0.url;
+		var label = _v0.label;
+		return A4(
+			$mdgriffith$elm_ui$Internal$Model$element,
+			$mdgriffith$elm_ui$Internal$Model$asEl,
+			$mdgriffith$elm_ui$Internal$Model$NodeName('a'),
+			A2(
+				$elm$core$List$cons,
+				$mdgriffith$elm_ui$Internal$Model$Attr(
+					$elm$html$Html$Attributes$href(url)),
+				A2(
+					$elm$core$List$cons,
+					$mdgriffith$elm_ui$Internal$Model$Attr(
+						$elm$html$Html$Attributes$rel('noopener noreferrer')),
+					A2(
+						$elm$core$List$cons,
+						$mdgriffith$elm_ui$Element$width($mdgriffith$elm_ui$Element$shrink),
+						A2(
+							$elm$core$List$cons,
+							$mdgriffith$elm_ui$Element$height($mdgriffith$elm_ui$Element$shrink),
+							A2(
+								$elm$core$List$cons,
+								$mdgriffith$elm_ui$Internal$Model$htmlClass($mdgriffith$elm_ui$Internal$Style$classes.contentCenterX + (' ' + ($mdgriffith$elm_ui$Internal$Style$classes.contentCenterY + (' ' + $mdgriffith$elm_ui$Internal$Style$classes.link)))),
+								attrs))))),
+			$mdgriffith$elm_ui$Internal$Model$Unkeyed(
+				_List_fromArray(
+					[label])));
+	});
+var $Orasund$elm_ui_widgets$Internal$Button$iconButton = F2(
+	function (style, _v0) {
+		var onPress = _v0.onPress;
+		var text = _v0.text;
+		var icon = _v0.icon;
+		return A2(
+			$mdgriffith$elm_ui$Element$Input$button,
+			_Utils_ap(
+				style.elementButton,
+				_Utils_ap(
+					_Utils_eq(onPress, $elm$core$Maybe$Nothing) ? style.ifDisabled : style.otherwise,
+					_List_fromArray(
+						[
+							$mdgriffith$elm_ui$Element$Region$description(text)
+						]))),
+			{
+				label: A2(
+					$mdgriffith$elm_ui$Element$el,
+					style.content.elementRow,
+					icon(
+						_Utils_eq(onPress, $elm$core$Maybe$Nothing) ? style.content.content.icon.ifDisabled : style.content.content.icon.otherwise)),
+				onPress: onPress
+			});
+	});
+var $mdgriffith$elm_ui$Element$Tablet = {$: 'Tablet'};
+var $Orasund$elm_ui_widgets$Widget$Customize$mapElementButton = F2(
+	function (fun, a) {
+		return _Utils_update(
+			a,
+			{
+				elementButton: fun(a.elementButton)
+			});
+	});
+var $Orasund$elm_ui_widgets$Widget$Customize$elementButton = F2(
+	function (list, a) {
+		return A2(
+			$Orasund$elm_ui_widgets$Widget$Customize$mapElementButton,
+			function (b) {
+				return _Utils_ap(b, list);
+			},
+			a);
+	});
+var $mdgriffith$elm_ui$Internal$Model$Empty = {$: 'Empty'};
+var $mdgriffith$elm_ui$Element$none = $mdgriffith$elm_ui$Internal$Model$Empty;
+var $mdgriffith$elm_ui$Element$Input$Placeholder = F2(
+	function (a, b) {
+		return {$: 'Placeholder', a: a, b: b};
+	});
+var $mdgriffith$elm_ui$Element$Input$placeholder = $mdgriffith$elm_ui$Element$Input$Placeholder;
+var $Orasund$elm_ui_widgets$Internal$TextInput$internal = F3(
+	function (fun, style, _v0) {
+		var chips = _v0.chips;
+		var placeholder = _v0.placeholder;
+		var label = _v0.label;
+		var text = _v0.text;
+		var onChange = _v0.onChange;
+		return A2(
+			$mdgriffith$elm_ui$Element$row,
+			style.elementRow,
+			_List_fromArray(
+				[
+					$elm$core$List$isEmpty(chips) ? $mdgriffith$elm_ui$Element$none : A2(
+					$mdgriffith$elm_ui$Element$row,
+					style.content.chips.elementRow,
+					A2(
+						$elm$core$List$map,
+						$Orasund$elm_ui_widgets$Internal$Button$button(style.content.chips.content),
+						chips)),
+					A2(
+					fun,
+					style.content.text.elementTextInput,
+					{
+						label: $mdgriffith$elm_ui$Element$Input$labelHidden(label),
+						onChange: onChange,
+						placeholder: placeholder,
+						text: text
+					})
+				]));
+	});
+var $mdgriffith$elm_ui$Element$Input$TextInputNode = function (a) {
+	return {$: 'TextInputNode', a: a};
+};
+var $mdgriffith$elm_ui$Element$Input$TextArea = {$: 'TextArea'};
+var $mdgriffith$elm_ui$Internal$Model$LivePolite = {$: 'LivePolite'};
+var $mdgriffith$elm_ui$Element$Region$announce = $mdgriffith$elm_ui$Internal$Model$Describe($mdgriffith$elm_ui$Internal$Model$LivePolite);
+var $mdgriffith$elm_ui$Element$Input$applyLabel = F3(
+	function (attrs, label, input) {
+		if (label.$ === 'HiddenLabel') {
+			var labelText = label.a;
+			return A4(
+				$mdgriffith$elm_ui$Internal$Model$element,
+				$mdgriffith$elm_ui$Internal$Model$asColumn,
+				$mdgriffith$elm_ui$Internal$Model$NodeName('label'),
+				attrs,
+				$mdgriffith$elm_ui$Internal$Model$Unkeyed(
+					_List_fromArray(
+						[input])));
+		} else {
+			var position = label.a;
+			var labelAttrs = label.b;
+			var labelChild = label.c;
+			var labelElement = A4(
+				$mdgriffith$elm_ui$Internal$Model$element,
+				$mdgriffith$elm_ui$Internal$Model$asEl,
+				$mdgriffith$elm_ui$Internal$Model$div,
+				labelAttrs,
+				$mdgriffith$elm_ui$Internal$Model$Unkeyed(
+					_List_fromArray(
+						[labelChild])));
+			switch (position.$) {
+				case 'Above':
+					return A4(
+						$mdgriffith$elm_ui$Internal$Model$element,
+						$mdgriffith$elm_ui$Internal$Model$asColumn,
+						$mdgriffith$elm_ui$Internal$Model$NodeName('label'),
+						A2(
+							$elm$core$List$cons,
+							$mdgriffith$elm_ui$Internal$Model$htmlClass($mdgriffith$elm_ui$Internal$Style$classes.inputLabel),
+							attrs),
+						$mdgriffith$elm_ui$Internal$Model$Unkeyed(
+							_List_fromArray(
+								[labelElement, input])));
+				case 'Below':
+					return A4(
+						$mdgriffith$elm_ui$Internal$Model$element,
+						$mdgriffith$elm_ui$Internal$Model$asColumn,
+						$mdgriffith$elm_ui$Internal$Model$NodeName('label'),
+						A2(
+							$elm$core$List$cons,
+							$mdgriffith$elm_ui$Internal$Model$htmlClass($mdgriffith$elm_ui$Internal$Style$classes.inputLabel),
+							attrs),
+						$mdgriffith$elm_ui$Internal$Model$Unkeyed(
+							_List_fromArray(
+								[input, labelElement])));
+				case 'OnRight':
+					return A4(
+						$mdgriffith$elm_ui$Internal$Model$element,
+						$mdgriffith$elm_ui$Internal$Model$asRow,
+						$mdgriffith$elm_ui$Internal$Model$NodeName('label'),
+						A2(
+							$elm$core$List$cons,
+							$mdgriffith$elm_ui$Internal$Model$htmlClass($mdgriffith$elm_ui$Internal$Style$classes.inputLabel),
+							attrs),
+						$mdgriffith$elm_ui$Internal$Model$Unkeyed(
+							_List_fromArray(
+								[input, labelElement])));
+				default:
+					return A4(
+						$mdgriffith$elm_ui$Internal$Model$element,
+						$mdgriffith$elm_ui$Internal$Model$asRow,
+						$mdgriffith$elm_ui$Internal$Model$NodeName('label'),
+						A2(
+							$elm$core$List$cons,
+							$mdgriffith$elm_ui$Internal$Model$htmlClass($mdgriffith$elm_ui$Internal$Style$classes.inputLabel),
+							attrs),
+						$mdgriffith$elm_ui$Internal$Model$Unkeyed(
+							_List_fromArray(
+								[labelElement, input])));
+			}
+		}
+	});
+var $elm$html$Html$Attributes$attribute = $elm$virtual_dom$VirtualDom$attribute;
+var $mdgriffith$elm_ui$Element$Input$autofill = A2(
+	$elm$core$Basics$composeL,
+	$mdgriffith$elm_ui$Internal$Model$Attr,
+	$elm$html$Html$Attributes$attribute('autocomplete'));
+var $mdgriffith$elm_ui$Internal$Model$Behind = {$: 'Behind'};
+var $mdgriffith$elm_ui$Internal$Model$Nearby = F2(
+	function (a, b) {
+		return {$: 'Nearby', a: a, b: b};
+	});
+var $mdgriffith$elm_ui$Element$createNearby = F2(
+	function (loc, element) {
+		if (element.$ === 'Empty') {
+			return $mdgriffith$elm_ui$Internal$Model$NoAttribute;
+		} else {
+			return A2($mdgriffith$elm_ui$Internal$Model$Nearby, loc, element);
+		}
+	});
+var $mdgriffith$elm_ui$Element$behindContent = function (element) {
+	return A2($mdgriffith$elm_ui$Element$createNearby, $mdgriffith$elm_ui$Internal$Model$Behind, element);
+};
+var $mdgriffith$elm_ui$Internal$Model$MoveY = function (a) {
+	return {$: 'MoveY', a: a};
+};
+var $mdgriffith$elm_ui$Internal$Model$TransformComponent = F2(
+	function (a, b) {
+		return {$: 'TransformComponent', a: a, b: b};
+	});
+var $mdgriffith$elm_ui$Internal$Flag$moveY = $mdgriffith$elm_ui$Internal$Flag$flag(26);
+var $mdgriffith$elm_ui$Element$moveUp = function (y) {
+	return A2(
+		$mdgriffith$elm_ui$Internal$Model$TransformComponent,
+		$mdgriffith$elm_ui$Internal$Flag$moveY,
+		$mdgriffith$elm_ui$Internal$Model$MoveY(-y));
+};
+var $mdgriffith$elm_ui$Element$Input$calcMoveToCompensateForPadding = function (attrs) {
+	var gatherSpacing = F2(
+		function (attr, found) {
+			if ((attr.$ === 'StyleClass') && (attr.b.$ === 'SpacingStyle')) {
+				var _v2 = attr.b;
+				var x = _v2.b;
+				var y = _v2.c;
+				if (found.$ === 'Nothing') {
+					return $elm$core$Maybe$Just(y);
+				} else {
+					return found;
+				}
+			} else {
+				return found;
+			}
+		});
+	var _v0 = A3($elm$core$List$foldr, gatherSpacing, $elm$core$Maybe$Nothing, attrs);
+	if (_v0.$ === 'Nothing') {
+		return $mdgriffith$elm_ui$Internal$Model$NoAttribute;
+	} else {
+		var vSpace = _v0.a;
+		return $mdgriffith$elm_ui$Element$moveUp(
+			$elm$core$Basics$floor(vSpace / 2));
+	}
+};
+var $mdgriffith$elm_ui$Internal$Flag$overflow = $mdgriffith$elm_ui$Internal$Flag$flag(20);
+var $mdgriffith$elm_ui$Element$clip = A2($mdgriffith$elm_ui$Internal$Model$Class, $mdgriffith$elm_ui$Internal$Flag$overflow, $mdgriffith$elm_ui$Internal$Style$classes.clip);
+var $mdgriffith$elm_ui$Internal$Flag$borderColor = $mdgriffith$elm_ui$Internal$Flag$flag(28);
+var $mdgriffith$elm_ui$Element$Border$color = function (clr) {
+	return A2(
+		$mdgriffith$elm_ui$Internal$Model$StyleClass,
+		$mdgriffith$elm_ui$Internal$Flag$borderColor,
+		A3(
+			$mdgriffith$elm_ui$Internal$Model$Colored,
+			'bc-' + $mdgriffith$elm_ui$Internal$Model$formatColorClass(clr),
+			'border-color',
+			clr));
+};
+var $mdgriffith$elm_ui$Element$rgb = F3(
+	function (r, g, b) {
+		return A4($mdgriffith$elm_ui$Internal$Model$Rgba, r, g, b, 1);
+	});
+var $mdgriffith$elm_ui$Element$Input$darkGrey = A3($mdgriffith$elm_ui$Element$rgb, 186 / 255, 189 / 255, 182 / 255);
+var $mdgriffith$elm_ui$Internal$Model$PaddingStyle = F5(
+	function (a, b, c, d, e) {
+		return {$: 'PaddingStyle', a: a, b: b, c: c, d: d, e: e};
+	});
+var $mdgriffith$elm_ui$Internal$Flag$padding = $mdgriffith$elm_ui$Internal$Flag$flag(2);
+var $mdgriffith$elm_ui$Element$paddingXY = F2(
+	function (x, y) {
+		if (_Utils_eq(x, y)) {
+			var f = x;
+			return A2(
+				$mdgriffith$elm_ui$Internal$Model$StyleClass,
+				$mdgriffith$elm_ui$Internal$Flag$padding,
+				A5(
+					$mdgriffith$elm_ui$Internal$Model$PaddingStyle,
+					'p-' + $elm$core$String$fromInt(x),
+					f,
+					f,
+					f,
+					f));
+		} else {
+			var yFloat = y;
+			var xFloat = x;
+			return A2(
+				$mdgriffith$elm_ui$Internal$Model$StyleClass,
+				$mdgriffith$elm_ui$Internal$Flag$padding,
+				A5(
+					$mdgriffith$elm_ui$Internal$Model$PaddingStyle,
+					'p-' + ($elm$core$String$fromInt(x) + ('-' + $elm$core$String$fromInt(y))),
+					yFloat,
+					xFloat,
+					yFloat,
+					xFloat));
+		}
+	});
+var $mdgriffith$elm_ui$Element$Input$defaultTextPadding = A2($mdgriffith$elm_ui$Element$paddingXY, 12, 12);
+var $mdgriffith$elm_ui$Internal$Flag$borderRound = $mdgriffith$elm_ui$Internal$Flag$flag(17);
+var $mdgriffith$elm_ui$Element$Border$rounded = function (radius) {
+	return A2(
+		$mdgriffith$elm_ui$Internal$Model$StyleClass,
+		$mdgriffith$elm_ui$Internal$Flag$borderRound,
+		A3(
+			$mdgriffith$elm_ui$Internal$Model$Single,
+			'br-' + $elm$core$String$fromInt(radius),
+			'border-radius',
+			$elm$core$String$fromInt(radius) + 'px'));
+};
+var $mdgriffith$elm_ui$Internal$Model$SpacingStyle = F3(
+	function (a, b, c) {
+		return {$: 'SpacingStyle', a: a, b: b, c: c};
+	});
+var $mdgriffith$elm_ui$Internal$Flag$spacing = $mdgriffith$elm_ui$Internal$Flag$flag(3);
+var $mdgriffith$elm_ui$Internal$Model$spacingName = F2(
+	function (x, y) {
+		return 'spacing-' + ($elm$core$String$fromInt(x) + ('-' + $elm$core$String$fromInt(y)));
+	});
+var $mdgriffith$elm_ui$Element$spacing = function (x) {
+	return A2(
+		$mdgriffith$elm_ui$Internal$Model$StyleClass,
+		$mdgriffith$elm_ui$Internal$Flag$spacing,
+		A3(
+			$mdgriffith$elm_ui$Internal$Model$SpacingStyle,
+			A2($mdgriffith$elm_ui$Internal$Model$spacingName, x, x),
+			x,
+			x));
+};
+var $mdgriffith$elm_ui$Element$Input$white = A3($mdgriffith$elm_ui$Element$rgb, 1, 1, 1);
+var $mdgriffith$elm_ui$Internal$Model$BorderWidth = F5(
+	function (a, b, c, d, e) {
+		return {$: 'BorderWidth', a: a, b: b, c: c, d: d, e: e};
+	});
+var $mdgriffith$elm_ui$Element$Border$width = function (v) {
+	return A2(
+		$mdgriffith$elm_ui$Internal$Model$StyleClass,
+		$mdgriffith$elm_ui$Internal$Flag$borderWidth,
+		A5(
+			$mdgriffith$elm_ui$Internal$Model$BorderWidth,
+			'b-' + $elm$core$String$fromInt(v),
+			v,
+			v,
+			v,
+			v));
+};
+var $mdgriffith$elm_ui$Element$Input$defaultTextBoxStyle = _List_fromArray(
+	[
+		$mdgriffith$elm_ui$Element$Input$defaultTextPadding,
+		$mdgriffith$elm_ui$Element$Border$rounded(3),
+		$mdgriffith$elm_ui$Element$Border$color($mdgriffith$elm_ui$Element$Input$darkGrey),
+		$mdgriffith$elm_ui$Element$Background$color($mdgriffith$elm_ui$Element$Input$white),
+		$mdgriffith$elm_ui$Element$Border$width(1),
+		$mdgriffith$elm_ui$Element$spacing(5),
+		$mdgriffith$elm_ui$Element$width($mdgriffith$elm_ui$Element$fill),
+		$mdgriffith$elm_ui$Element$height($mdgriffith$elm_ui$Element$shrink)
+	]);
+var $mdgriffith$elm_ui$Element$Input$getHeight = function (attr) {
+	if (attr.$ === 'Height') {
+		var h = attr.a;
+		return $elm$core$Maybe$Just(h);
+	} else {
+		return $elm$core$Maybe$Nothing;
+	}
+};
+var $elm$core$List$head = function (list) {
+	if (list.b) {
+		var x = list.a;
+		var xs = list.b;
+		return $elm$core$Maybe$Just(x);
+	} else {
+		return $elm$core$Maybe$Nothing;
+	}
+};
+var $mdgriffith$elm_ui$Element$Input$hiddenLabelAttribute = function (label) {
+	if (label.$ === 'HiddenLabel') {
+		var textLabel = label.a;
+		return $mdgriffith$elm_ui$Internal$Model$Describe(
+			$mdgriffith$elm_ui$Internal$Model$Label(textLabel));
+	} else {
+		return $mdgriffith$elm_ui$Internal$Model$NoAttribute;
+	}
+};
+var $mdgriffith$elm_ui$Internal$Model$InFront = {$: 'InFront'};
+var $mdgriffith$elm_ui$Element$inFront = function (element) {
+	return A2($mdgriffith$elm_ui$Element$createNearby, $mdgriffith$elm_ui$Internal$Model$InFront, element);
+};
+var $mdgriffith$elm_ui$Element$Input$isConstrained = function (len) {
+	isConstrained:
+	while (true) {
+		switch (len.$) {
+			case 'Content':
+				return false;
+			case 'Px':
+				return true;
+			case 'Fill':
+				return true;
+			case 'Min':
+				var l = len.b;
+				var $temp$len = l;
+				len = $temp$len;
+				continue isConstrained;
+			default:
+				var l = len.b;
+				return true;
+		}
+	}
+};
+var $mdgriffith$elm_ui$Element$Input$isHiddenLabel = function (label) {
+	if (label.$ === 'HiddenLabel') {
+		return true;
+	} else {
+		return false;
+	}
+};
+var $mdgriffith$elm_ui$Element$Input$isStacked = function (label) {
+	if (label.$ === 'Label') {
+		var loc = label.a;
+		switch (loc.$) {
+			case 'OnRight':
+				return false;
+			case 'OnLeft':
+				return false;
+			case 'Above':
+				return true;
+			default:
+				return true;
+		}
+	} else {
+		return true;
+	}
+};
+var $mdgriffith$elm_ui$Element$Input$negateBox = function (box) {
+	return {bottom: -box.bottom, left: -box.left, right: -box.right, top: -box.top};
+};
+var $elm$html$Html$Events$alwaysStop = function (x) {
+	return _Utils_Tuple2(x, true);
+};
+var $elm$virtual_dom$VirtualDom$MayStopPropagation = function (a) {
+	return {$: 'MayStopPropagation', a: a};
+};
+var $elm$html$Html$Events$stopPropagationOn = F2(
+	function (event, decoder) {
+		return A2(
+			$elm$virtual_dom$VirtualDom$on,
+			event,
+			$elm$virtual_dom$VirtualDom$MayStopPropagation(decoder));
+	});
+var $elm$json$Json$Decode$at = F2(
+	function (fields, decoder) {
+		return A3($elm$core$List$foldr, $elm$json$Json$Decode$field, decoder, fields);
+	});
+var $elm$html$Html$Events$targetValue = A2(
+	$elm$json$Json$Decode$at,
+	_List_fromArray(
+		['target', 'value']),
+	$elm$json$Json$Decode$string);
+var $elm$html$Html$Events$onInput = function (tagger) {
+	return A2(
+		$elm$html$Html$Events$stopPropagationOn,
+		'input',
+		A2(
+			$elm$json$Json$Decode$map,
+			$elm$html$Html$Events$alwaysStop,
+			A2($elm$json$Json$Decode$map, tagger, $elm$html$Html$Events$targetValue)));
+};
+var $mdgriffith$elm_ui$Internal$Model$paddingName = F4(
+	function (top, right, bottom, left) {
+		return 'pad-' + ($elm$core$String$fromInt(top) + ('-' + ($elm$core$String$fromInt(right) + ('-' + ($elm$core$String$fromInt(bottom) + ('-' + $elm$core$String$fromInt(left)))))));
+	});
+var $mdgriffith$elm_ui$Element$paddingEach = function (_v0) {
+	var top = _v0.top;
+	var right = _v0.right;
+	var bottom = _v0.bottom;
+	var left = _v0.left;
+	if (_Utils_eq(top, right) && (_Utils_eq(top, bottom) && _Utils_eq(top, left))) {
+		var topFloat = top;
+		return A2(
+			$mdgriffith$elm_ui$Internal$Model$StyleClass,
+			$mdgriffith$elm_ui$Internal$Flag$padding,
+			A5(
+				$mdgriffith$elm_ui$Internal$Model$PaddingStyle,
+				'p-' + $elm$core$String$fromInt(top),
+				topFloat,
+				topFloat,
+				topFloat,
+				topFloat));
+	} else {
+		return A2(
+			$mdgriffith$elm_ui$Internal$Model$StyleClass,
+			$mdgriffith$elm_ui$Internal$Flag$padding,
+			A5(
+				$mdgriffith$elm_ui$Internal$Model$PaddingStyle,
+				A4($mdgriffith$elm_ui$Internal$Model$paddingName, top, right, bottom, left),
+				top,
+				right,
+				bottom,
+				left));
+	}
+};
+var $mdgriffith$elm_ui$Element$htmlAttribute = $mdgriffith$elm_ui$Internal$Model$Attr;
+var $mdgriffith$elm_ui$Element$Input$isFill = function (len) {
+	isFill:
+	while (true) {
+		switch (len.$) {
+			case 'Fill':
+				return true;
+			case 'Content':
+				return false;
+			case 'Px':
+				return false;
+			case 'Min':
+				var l = len.b;
+				var $temp$len = l;
+				len = $temp$len;
+				continue isFill;
+			default:
+				var l = len.b;
+				var $temp$len = l;
+				len = $temp$len;
+				continue isFill;
+		}
+	}
+};
+var $mdgriffith$elm_ui$Element$Input$isPixel = function (len) {
+	isPixel:
+	while (true) {
+		switch (len.$) {
+			case 'Content':
+				return false;
+			case 'Px':
+				return true;
+			case 'Fill':
+				return false;
+			case 'Min':
+				var l = len.b;
+				var $temp$len = l;
+				len = $temp$len;
+				continue isPixel;
+			default:
+				var l = len.b;
+				var $temp$len = l;
+				len = $temp$len;
+				continue isPixel;
+		}
+	}
+};
+var $mdgriffith$elm_ui$Internal$Model$paddingNameFloat = F4(
+	function (top, right, bottom, left) {
+		return 'pad-' + ($mdgriffith$elm_ui$Internal$Model$floatClass(top) + ('-' + ($mdgriffith$elm_ui$Internal$Model$floatClass(right) + ('-' + ($mdgriffith$elm_ui$Internal$Model$floatClass(bottom) + ('-' + $mdgriffith$elm_ui$Internal$Model$floatClass(left)))))));
+	});
+var $elm$virtual_dom$VirtualDom$style = _VirtualDom_style;
+var $elm$html$Html$Attributes$style = $elm$virtual_dom$VirtualDom$style;
+var $mdgriffith$elm_ui$Element$Input$redistributeOver = F4(
+	function (isMultiline, stacked, attr, els) {
+		switch (attr.$) {
+			case 'Nearby':
+				return _Utils_update(
+					els,
+					{
+						parent: A2($elm$core$List$cons, attr, els.parent)
+					});
+			case 'Width':
+				var width = attr.a;
+				return $mdgriffith$elm_ui$Element$Input$isFill(width) ? _Utils_update(
+					els,
+					{
+						fullParent: A2($elm$core$List$cons, attr, els.fullParent),
+						input: A2($elm$core$List$cons, attr, els.input),
+						parent: A2($elm$core$List$cons, attr, els.parent)
+					}) : (stacked ? _Utils_update(
+					els,
+					{
+						fullParent: A2($elm$core$List$cons, attr, els.fullParent)
+					}) : _Utils_update(
+					els,
+					{
+						parent: A2($elm$core$List$cons, attr, els.parent)
+					}));
+			case 'Height':
+				var height = attr.a;
+				return (!stacked) ? _Utils_update(
+					els,
+					{
+						fullParent: A2($elm$core$List$cons, attr, els.fullParent),
+						parent: A2($elm$core$List$cons, attr, els.parent)
+					}) : ($mdgriffith$elm_ui$Element$Input$isFill(height) ? _Utils_update(
+					els,
+					{
+						fullParent: A2($elm$core$List$cons, attr, els.fullParent),
+						parent: A2($elm$core$List$cons, attr, els.parent)
+					}) : ($mdgriffith$elm_ui$Element$Input$isPixel(height) ? _Utils_update(
+					els,
+					{
+						parent: A2($elm$core$List$cons, attr, els.parent)
+					}) : _Utils_update(
+					els,
+					{
+						parent: A2($elm$core$List$cons, attr, els.parent)
+					})));
+			case 'AlignX':
+				return _Utils_update(
+					els,
+					{
+						fullParent: A2($elm$core$List$cons, attr, els.fullParent)
+					});
+			case 'AlignY':
+				return _Utils_update(
+					els,
+					{
+						fullParent: A2($elm$core$List$cons, attr, els.fullParent)
+					});
+			case 'StyleClass':
+				switch (attr.b.$) {
+					case 'SpacingStyle':
+						var _v1 = attr.b;
+						return _Utils_update(
+							els,
+							{
+								fullParent: A2($elm$core$List$cons, attr, els.fullParent),
+								input: A2($elm$core$List$cons, attr, els.input),
+								parent: A2($elm$core$List$cons, attr, els.parent),
+								wrapper: A2($elm$core$List$cons, attr, els.wrapper)
+							});
+					case 'PaddingStyle':
+						var cls = attr.a;
+						var _v2 = attr.b;
+						var pad = _v2.a;
+						var t = _v2.b;
+						var r = _v2.c;
+						var b = _v2.d;
+						var l = _v2.e;
+						if (isMultiline) {
+							return _Utils_update(
+								els,
+								{
+									cover: A2($elm$core$List$cons, attr, els.cover),
+									parent: A2($elm$core$List$cons, attr, els.parent)
+								});
+						} else {
+							var newTop = t - A2($elm$core$Basics$min, t, b);
+							var newLineHeight = $mdgriffith$elm_ui$Element$htmlAttribute(
+								A2(
+									$elm$html$Html$Attributes$style,
+									'line-height',
+									'calc(1.0em + ' + ($elm$core$String$fromFloat(
+										2 * A2($elm$core$Basics$min, t, b)) + 'px)')));
+							var newHeight = $mdgriffith$elm_ui$Element$htmlAttribute(
+								A2(
+									$elm$html$Html$Attributes$style,
+									'height',
+									'calc(1.0em + ' + ($elm$core$String$fromFloat(
+										2 * A2($elm$core$Basics$min, t, b)) + 'px)')));
+							var newBottom = b - A2($elm$core$Basics$min, t, b);
+							var reducedVerticalPadding = A2(
+								$mdgriffith$elm_ui$Internal$Model$StyleClass,
+								$mdgriffith$elm_ui$Internal$Flag$padding,
+								A5(
+									$mdgriffith$elm_ui$Internal$Model$PaddingStyle,
+									A4($mdgriffith$elm_ui$Internal$Model$paddingNameFloat, newTop, r, newBottom, l),
+									newTop,
+									r,
+									newBottom,
+									l));
+							return _Utils_update(
+								els,
+								{
+									cover: A2($elm$core$List$cons, attr, els.cover),
+									input: A2(
+										$elm$core$List$cons,
+										newHeight,
+										A2($elm$core$List$cons, newLineHeight, els.input)),
+									parent: A2($elm$core$List$cons, reducedVerticalPadding, els.parent)
+								});
+						}
+					case 'BorderWidth':
+						var _v3 = attr.b;
+						return _Utils_update(
+							els,
+							{
+								cover: A2($elm$core$List$cons, attr, els.cover),
+								parent: A2($elm$core$List$cons, attr, els.parent)
+							});
+					case 'Transform':
+						return _Utils_update(
+							els,
+							{
+								cover: A2($elm$core$List$cons, attr, els.cover),
+								parent: A2($elm$core$List$cons, attr, els.parent)
+							});
+					case 'FontSize':
+						return _Utils_update(
+							els,
+							{
+								fullParent: A2($elm$core$List$cons, attr, els.fullParent)
+							});
+					case 'FontFamily':
+						var _v4 = attr.b;
+						return _Utils_update(
+							els,
+							{
+								fullParent: A2($elm$core$List$cons, attr, els.fullParent)
+							});
+					default:
+						var flag = attr.a;
+						var cls = attr.b;
+						return _Utils_update(
+							els,
+							{
+								parent: A2($elm$core$List$cons, attr, els.parent)
+							});
+				}
+			case 'NoAttribute':
+				return els;
+			case 'Attr':
+				var a = attr.a;
+				return _Utils_update(
+					els,
+					{
+						input: A2($elm$core$List$cons, attr, els.input)
+					});
+			case 'Describe':
+				return _Utils_update(
+					els,
+					{
+						input: A2($elm$core$List$cons, attr, els.input)
+					});
+			case 'Class':
+				return _Utils_update(
+					els,
+					{
+						parent: A2($elm$core$List$cons, attr, els.parent)
+					});
+			default:
+				return _Utils_update(
+					els,
+					{
+						input: A2($elm$core$List$cons, attr, els.input)
+					});
+		}
+	});
+var $mdgriffith$elm_ui$Element$Input$redistribute = F3(
+	function (isMultiline, stacked, attrs) {
+		return function (redist) {
+			return {
+				cover: $elm$core$List$reverse(redist.cover),
+				fullParent: $elm$core$List$reverse(redist.fullParent),
+				input: $elm$core$List$reverse(redist.input),
+				parent: $elm$core$List$reverse(redist.parent),
+				wrapper: $elm$core$List$reverse(redist.wrapper)
+			};
+		}(
+			A3(
+				$elm$core$List$foldl,
+				A2($mdgriffith$elm_ui$Element$Input$redistributeOver, isMultiline, stacked),
+				{cover: _List_Nil, fullParent: _List_Nil, input: _List_Nil, parent: _List_Nil, wrapper: _List_Nil},
+				attrs));
+	});
+var $mdgriffith$elm_ui$Element$Input$renderBox = function (_v0) {
+	var top = _v0.top;
+	var right = _v0.right;
+	var bottom = _v0.bottom;
+	var left = _v0.left;
+	return $elm$core$String$fromInt(top) + ('px ' + ($elm$core$String$fromInt(right) + ('px ' + ($elm$core$String$fromInt(bottom) + ('px ' + ($elm$core$String$fromInt(left) + 'px'))))));
+};
+var $mdgriffith$elm_ui$Internal$Model$Transparency = F2(
+	function (a, b) {
+		return {$: 'Transparency', a: a, b: b};
+	});
+var $mdgriffith$elm_ui$Internal$Flag$transparency = $mdgriffith$elm_ui$Internal$Flag$flag(0);
+var $mdgriffith$elm_ui$Element$alpha = function (o) {
+	var transparency = function (x) {
+		return 1 - x;
+	}(
+		A2(
+			$elm$core$Basics$min,
+			1.0,
+			A2($elm$core$Basics$max, 0.0, o)));
+	return A2(
+		$mdgriffith$elm_ui$Internal$Model$StyleClass,
+		$mdgriffith$elm_ui$Internal$Flag$transparency,
+		A2(
+			$mdgriffith$elm_ui$Internal$Model$Transparency,
+			'transparency-' + $mdgriffith$elm_ui$Internal$Model$floatClass(transparency),
+			transparency));
+};
+var $mdgriffith$elm_ui$Element$Input$charcoal = A3($mdgriffith$elm_ui$Element$rgb, 136 / 255, 138 / 255, 133 / 255);
+var $mdgriffith$elm_ui$Element$rgba = $mdgriffith$elm_ui$Internal$Model$Rgba;
+var $mdgriffith$elm_ui$Element$Input$renderPlaceholder = F3(
+	function (_v0, forPlaceholder, on) {
+		var placeholderAttrs = _v0.a;
+		var placeholderEl = _v0.b;
+		return A2(
+			$mdgriffith$elm_ui$Element$el,
+			_Utils_ap(
+				forPlaceholder,
+				_Utils_ap(
+					_List_fromArray(
+						[
+							$mdgriffith$elm_ui$Element$Font$color($mdgriffith$elm_ui$Element$Input$charcoal),
+							$mdgriffith$elm_ui$Internal$Model$htmlClass($mdgriffith$elm_ui$Internal$Style$classes.noTextSelection + (' ' + $mdgriffith$elm_ui$Internal$Style$classes.passPointerEvents)),
+							$mdgriffith$elm_ui$Element$clip,
+							$mdgriffith$elm_ui$Element$Border$color(
+							A4($mdgriffith$elm_ui$Element$rgba, 0, 0, 0, 0)),
+							$mdgriffith$elm_ui$Element$Background$color(
+							A4($mdgriffith$elm_ui$Element$rgba, 0, 0, 0, 0)),
+							$mdgriffith$elm_ui$Element$height($mdgriffith$elm_ui$Element$fill),
+							$mdgriffith$elm_ui$Element$width($mdgriffith$elm_ui$Element$fill),
+							$mdgriffith$elm_ui$Element$alpha(
+							on ? 1 : 0)
+						]),
+					placeholderAttrs)),
+			placeholderEl);
+	});
+var $mdgriffith$elm_ui$Element$scrollbarY = A2($mdgriffith$elm_ui$Internal$Model$Class, $mdgriffith$elm_ui$Internal$Flag$overflow, $mdgriffith$elm_ui$Internal$Style$classes.scrollbarsY);
+var $elm$html$Html$span = _VirtualDom_node('span');
+var $elm$html$Html$Attributes$spellcheck = $elm$html$Html$Attributes$boolProperty('spellcheck');
+var $mdgriffith$elm_ui$Element$Input$spellcheck = A2($elm$core$Basics$composeL, $mdgriffith$elm_ui$Internal$Model$Attr, $elm$html$Html$Attributes$spellcheck);
+var $elm$html$Html$Attributes$type_ = $elm$html$Html$Attributes$stringProperty('type');
+var $mdgriffith$elm_ui$Internal$Model$unstyled = A2($elm$core$Basics$composeL, $mdgriffith$elm_ui$Internal$Model$Unstyled, $elm$core$Basics$always);
+var $elm$html$Html$Attributes$value = $elm$html$Html$Attributes$stringProperty('value');
+var $mdgriffith$elm_ui$Element$Input$value = A2($elm$core$Basics$composeL, $mdgriffith$elm_ui$Internal$Model$Attr, $elm$html$Html$Attributes$value);
+var $mdgriffith$elm_ui$Element$Input$textHelper = F3(
+	function (textInput, attrs, textOptions) {
+		var withDefaults = _Utils_ap($mdgriffith$elm_ui$Element$Input$defaultTextBoxStyle, attrs);
+		var redistributed = A3(
+			$mdgriffith$elm_ui$Element$Input$redistribute,
+			_Utils_eq(textInput.type_, $mdgriffith$elm_ui$Element$Input$TextArea),
+			$mdgriffith$elm_ui$Element$Input$isStacked(textOptions.label),
+			withDefaults);
+		var onlySpacing = function (attr) {
+			if ((attr.$ === 'StyleClass') && (attr.b.$ === 'SpacingStyle')) {
+				var _v9 = attr.b;
+				return true;
+			} else {
+				return false;
+			}
+		};
+		var heightConstrained = function () {
+			var _v7 = textInput.type_;
+			if (_v7.$ === 'TextInputNode') {
+				var inputType = _v7.a;
+				return false;
+			} else {
+				return A2(
+					$elm$core$Maybe$withDefault,
+					false,
+					A2(
+						$elm$core$Maybe$map,
+						$mdgriffith$elm_ui$Element$Input$isConstrained,
+						$elm$core$List$head(
+							$elm$core$List$reverse(
+								A2($elm$core$List$filterMap, $mdgriffith$elm_ui$Element$Input$getHeight, withDefaults)))));
+			}
+		}();
+		var getPadding = function (attr) {
+			if ((attr.$ === 'StyleClass') && (attr.b.$ === 'PaddingStyle')) {
+				var cls = attr.a;
+				var _v6 = attr.b;
+				var pad = _v6.a;
+				var t = _v6.b;
+				var r = _v6.c;
+				var b = _v6.d;
+				var l = _v6.e;
+				return $elm$core$Maybe$Just(
+					{
+						bottom: A2(
+							$elm$core$Basics$max,
+							0,
+							$elm$core$Basics$floor(b - 3)),
+						left: A2(
+							$elm$core$Basics$max,
+							0,
+							$elm$core$Basics$floor(l - 3)),
+						right: A2(
+							$elm$core$Basics$max,
+							0,
+							$elm$core$Basics$floor(r - 3)),
+						top: A2(
+							$elm$core$Basics$max,
+							0,
+							$elm$core$Basics$floor(t - 3))
+					});
+			} else {
+				return $elm$core$Maybe$Nothing;
+			}
+		};
+		var parentPadding = A2(
+			$elm$core$Maybe$withDefault,
+			{bottom: 0, left: 0, right: 0, top: 0},
+			$elm$core$List$head(
+				$elm$core$List$reverse(
+					A2($elm$core$List$filterMap, getPadding, withDefaults))));
+		var inputElement = A4(
+			$mdgriffith$elm_ui$Internal$Model$element,
+			$mdgriffith$elm_ui$Internal$Model$asEl,
+			function () {
+				var _v3 = textInput.type_;
+				if (_v3.$ === 'TextInputNode') {
+					var inputType = _v3.a;
+					return $mdgriffith$elm_ui$Internal$Model$NodeName('input');
+				} else {
+					return $mdgriffith$elm_ui$Internal$Model$NodeName('textarea');
+				}
+			}(),
+			_Utils_ap(
+				function () {
+					var _v4 = textInput.type_;
+					if (_v4.$ === 'TextInputNode') {
+						var inputType = _v4.a;
+						return _List_fromArray(
+							[
+								$mdgriffith$elm_ui$Internal$Model$Attr(
+								$elm$html$Html$Attributes$type_(inputType)),
+								$mdgriffith$elm_ui$Internal$Model$htmlClass($mdgriffith$elm_ui$Internal$Style$classes.inputText)
+							]);
+					} else {
+						return _List_fromArray(
+							[
+								$mdgriffith$elm_ui$Element$clip,
+								$mdgriffith$elm_ui$Element$height($mdgriffith$elm_ui$Element$fill),
+								$mdgriffith$elm_ui$Internal$Model$htmlClass($mdgriffith$elm_ui$Internal$Style$classes.inputMultiline),
+								$mdgriffith$elm_ui$Element$Input$calcMoveToCompensateForPadding(withDefaults),
+								$mdgriffith$elm_ui$Element$paddingEach(parentPadding),
+								$mdgriffith$elm_ui$Internal$Model$Attr(
+								A2(
+									$elm$html$Html$Attributes$style,
+									'margin',
+									$mdgriffith$elm_ui$Element$Input$renderBox(
+										$mdgriffith$elm_ui$Element$Input$negateBox(parentPadding)))),
+								$mdgriffith$elm_ui$Internal$Model$Attr(
+								A2($elm$html$Html$Attributes$style, 'box-sizing', 'content-box'))
+							]);
+					}
+				}(),
+				_Utils_ap(
+					_List_fromArray(
+						[
+							$mdgriffith$elm_ui$Element$Input$value(textOptions.text),
+							$mdgriffith$elm_ui$Internal$Model$Attr(
+							$elm$html$Html$Events$onInput(textOptions.onChange)),
+							$mdgriffith$elm_ui$Element$Input$hiddenLabelAttribute(textOptions.label),
+							$mdgriffith$elm_ui$Element$Input$spellcheck(textInput.spellchecked),
+							A2(
+							$elm$core$Maybe$withDefault,
+							$mdgriffith$elm_ui$Internal$Model$NoAttribute,
+							A2($elm$core$Maybe$map, $mdgriffith$elm_ui$Element$Input$autofill, textInput.autofill))
+						]),
+					redistributed.input)),
+			$mdgriffith$elm_ui$Internal$Model$Unkeyed(_List_Nil));
+		var wrappedInput = function () {
+			var _v0 = textInput.type_;
+			if (_v0.$ === 'TextArea') {
+				return A4(
+					$mdgriffith$elm_ui$Internal$Model$element,
+					$mdgriffith$elm_ui$Internal$Model$asEl,
+					$mdgriffith$elm_ui$Internal$Model$div,
+					_Utils_ap(
+						(heightConstrained ? $elm$core$List$cons($mdgriffith$elm_ui$Element$scrollbarY) : $elm$core$Basics$identity)(
+							_List_fromArray(
+								[
+									$mdgriffith$elm_ui$Element$width($mdgriffith$elm_ui$Element$fill),
+									A2($elm$core$List$any, $mdgriffith$elm_ui$Element$Input$hasFocusStyle, withDefaults) ? $mdgriffith$elm_ui$Internal$Model$NoAttribute : $mdgriffith$elm_ui$Internal$Model$htmlClass($mdgriffith$elm_ui$Internal$Style$classes.focusedWithin),
+									$mdgriffith$elm_ui$Internal$Model$htmlClass($mdgriffith$elm_ui$Internal$Style$classes.inputMultilineWrapper)
+								])),
+						redistributed.parent),
+					$mdgriffith$elm_ui$Internal$Model$Unkeyed(
+						_List_fromArray(
+							[
+								A4(
+								$mdgriffith$elm_ui$Internal$Model$element,
+								$mdgriffith$elm_ui$Internal$Model$asParagraph,
+								$mdgriffith$elm_ui$Internal$Model$div,
+								A2(
+									$elm$core$List$cons,
+									$mdgriffith$elm_ui$Element$width($mdgriffith$elm_ui$Element$fill),
+									A2(
+										$elm$core$List$cons,
+										$mdgriffith$elm_ui$Element$height($mdgriffith$elm_ui$Element$fill),
+										A2(
+											$elm$core$List$cons,
+											$mdgriffith$elm_ui$Element$inFront(inputElement),
+											A2(
+												$elm$core$List$cons,
+												$mdgriffith$elm_ui$Internal$Model$htmlClass($mdgriffith$elm_ui$Internal$Style$classes.inputMultilineParent),
+												redistributed.wrapper)))),
+								$mdgriffith$elm_ui$Internal$Model$Unkeyed(
+									function () {
+										if (textOptions.text === '') {
+											var _v1 = textOptions.placeholder;
+											if (_v1.$ === 'Nothing') {
+												return _List_fromArray(
+													[
+														$mdgriffith$elm_ui$Element$text('\u00A0')
+													]);
+											} else {
+												var place = _v1.a;
+												return _List_fromArray(
+													[
+														A3($mdgriffith$elm_ui$Element$Input$renderPlaceholder, place, _List_Nil, textOptions.text === '')
+													]);
+											}
+										} else {
+											return _List_fromArray(
+												[
+													$mdgriffith$elm_ui$Internal$Model$unstyled(
+													A2(
+														$elm$html$Html$span,
+														_List_fromArray(
+															[
+																$elm$html$Html$Attributes$class($mdgriffith$elm_ui$Internal$Style$classes.inputMultilineFiller)
+															]),
+														_List_fromArray(
+															[
+																$elm$html$Html$text(textOptions.text + '\u00A0')
+															])))
+												]);
+										}
+									}()))
+							])));
+			} else {
+				var inputType = _v0.a;
+				return A4(
+					$mdgriffith$elm_ui$Internal$Model$element,
+					$mdgriffith$elm_ui$Internal$Model$asEl,
+					$mdgriffith$elm_ui$Internal$Model$div,
+					A2(
+						$elm$core$List$cons,
+						$mdgriffith$elm_ui$Element$width($mdgriffith$elm_ui$Element$fill),
+						A2(
+							$elm$core$List$cons,
+							A2($elm$core$List$any, $mdgriffith$elm_ui$Element$Input$hasFocusStyle, withDefaults) ? $mdgriffith$elm_ui$Internal$Model$NoAttribute : $mdgriffith$elm_ui$Internal$Model$htmlClass($mdgriffith$elm_ui$Internal$Style$classes.focusedWithin),
+							$elm$core$List$concat(
+								_List_fromArray(
+									[
+										redistributed.parent,
+										function () {
+										var _v2 = textOptions.placeholder;
+										if (_v2.$ === 'Nothing') {
+											return _List_Nil;
+										} else {
+											var place = _v2.a;
+											return _List_fromArray(
+												[
+													$mdgriffith$elm_ui$Element$behindContent(
+													A3($mdgriffith$elm_ui$Element$Input$renderPlaceholder, place, redistributed.cover, textOptions.text === ''))
+												]);
+										}
+									}()
+									])))),
+					$mdgriffith$elm_ui$Internal$Model$Unkeyed(
+						_List_fromArray(
+							[inputElement])));
+			}
+		}();
+		return A3(
+			$mdgriffith$elm_ui$Element$Input$applyLabel,
+			A2(
+				$elm$core$List$cons,
+				A2($mdgriffith$elm_ui$Internal$Model$Class, $mdgriffith$elm_ui$Internal$Flag$cursor, $mdgriffith$elm_ui$Internal$Style$classes.cursorText),
+				A2(
+					$elm$core$List$cons,
+					$mdgriffith$elm_ui$Element$Input$isHiddenLabel(textOptions.label) ? $mdgriffith$elm_ui$Internal$Model$NoAttribute : $mdgriffith$elm_ui$Element$spacing(5),
+					A2($elm$core$List$cons, $mdgriffith$elm_ui$Element$Region$announce, redistributed.fullParent))),
+			textOptions.label,
+			wrappedInput);
+	});
+var $mdgriffith$elm_ui$Element$Input$text = $mdgriffith$elm_ui$Element$Input$textHelper(
+	{
+		autofill: $elm$core$Maybe$Nothing,
+		spellchecked: false,
+		type_: $mdgriffith$elm_ui$Element$Input$TextInputNode('text')
+	});
+var $Orasund$elm_ui_widgets$Internal$TextInput$textInput = $Orasund$elm_ui_widgets$Internal$TextInput$internal($mdgriffith$elm_ui$Element$Input$text);
+var $Orasund$elm_ui_widgets$Internal$AppBar$internalNav = F3(
+	function (menuElements, style, _v0) {
+		var deviceClass = _v0.deviceClass;
+		var openRightSheet = _v0.openRightSheet;
+		var openTopSheet = _v0.openTopSheet;
+		var primaryActions = _v0.primaryActions;
+		var search = _v0.search;
+		return A2(
+			$mdgriffith$elm_ui$Element$row,
+			_Utils_ap(
+				style.elementRow,
+				_List_fromArray(
+					[
+						$mdgriffith$elm_ui$Element$alignTop,
+						$mdgriffith$elm_ui$Element$width($mdgriffith$elm_ui$Element$fill)
+					])),
+			_List_fromArray(
+				[
+					A2($mdgriffith$elm_ui$Element$row, style.content.menu.elementRow, menuElements),
+					(_Utils_eq(deviceClass, $mdgriffith$elm_ui$Element$Phone) || _Utils_eq(deviceClass, $mdgriffith$elm_ui$Element$Tablet)) ? $mdgriffith$elm_ui$Element$none : A2(
+					$elm$core$Maybe$withDefault,
+					$mdgriffith$elm_ui$Element$none,
+					A2(
+						$elm$core$Maybe$map,
+						function (_v1) {
+							var onChange = _v1.onChange;
+							var text = _v1.text;
+							var label = _v1.label;
+							return A2(
+								$Orasund$elm_ui_widgets$Internal$TextInput$textInput,
+								style.content.search,
+								{
+									chips: _List_Nil,
+									label: label,
+									onChange: onChange,
+									placeholder: $elm$core$Maybe$Just(
+										A2(
+											$mdgriffith$elm_ui$Element$Input$placeholder,
+											_List_Nil,
+											$mdgriffith$elm_ui$Element$text(label))),
+									text: text
+								});
+						},
+						search)),
+					A2(
+					$mdgriffith$elm_ui$Element$row,
+					style.content.actions.elementRow,
+					$elm$core$List$concat(
+						_List_fromArray(
+							[
+								A2(
+								$elm$core$Maybe$withDefault,
+								_List_Nil,
+								A2(
+									$elm$core$Maybe$map,
+									function (_v2) {
+										var label = _v2.label;
+										return _Utils_eq(deviceClass, $mdgriffith$elm_ui$Element$Tablet) ? _List_fromArray(
+											[
+												A2(
+												$Orasund$elm_ui_widgets$Internal$Button$button,
+												A2(
+													$Orasund$elm_ui_widgets$Widget$Customize$elementButton,
+													_List_fromArray(
+														[
+															$mdgriffith$elm_ui$Element$width($mdgriffith$elm_ui$Element$shrink)
+														]),
+													style.content.actions.content.button),
+												{icon: style.content.actions.content.searchIcon, onPress: openTopSheet, text: label})
+											]) : (_Utils_eq(deviceClass, $mdgriffith$elm_ui$Element$Phone) ? _List_fromArray(
+											[
+												A2(
+												$Orasund$elm_ui_widgets$Internal$Button$iconButton,
+												style.content.actions.content.button,
+												{icon: style.content.actions.content.searchIcon, onPress: openTopSheet, text: label})
+											]) : _List_Nil);
+									},
+									search)),
+								A2(
+								$elm$core$List$map,
+								_Utils_eq(deviceClass, $mdgriffith$elm_ui$Element$Phone) ? $Orasund$elm_ui_widgets$Internal$Button$iconButton(style.content.actions.content.button) : $Orasund$elm_ui_widgets$Internal$Button$button(
+									A2(
+										$Orasund$elm_ui_widgets$Widget$Customize$elementButton,
+										_List_fromArray(
+											[
+												$mdgriffith$elm_ui$Element$width($mdgriffith$elm_ui$Element$shrink)
+											]),
+										style.content.actions.content.button)),
+								primaryActions),
+								function () {
+								if (openRightSheet.$ === 'Nothing') {
+									return _List_Nil;
+								} else {
+									return _List_fromArray(
+										[
+											A2(
+											$Orasund$elm_ui_widgets$Internal$Button$iconButton,
+											style.content.actions.content.button,
+											{icon: style.content.actions.content.moreVerticalIcon, onPress: openRightSheet, text: 'More'})
+										]);
+								}
+							}()
+							])))
+				]));
+	});
+var $Orasund$elm_ui_widgets$Internal$AppBar$menuBar = F2(
+	function (style, m) {
+		return A3(
+			$Orasund$elm_ui_widgets$Internal$AppBar$internalNav,
+			_List_fromArray(
+				[
+					A2(
+					$Orasund$elm_ui_widgets$Internal$Button$iconButton,
+					style.content.actions.content.button,
+					{icon: style.content.menu.content.menuIcon, onPress: m.openLeftSheet, text: 'Menu'}),
+					A2($mdgriffith$elm_ui$Element$el, style.content.menu.content.title, m.title)
+				]),
+			{
+				content: {
+					actions: style.content.actions,
+					menu: {elementRow: style.content.menu.elementRow},
+					search: style.content.search
+				},
+				elementRow: style.elementRow
+			},
+			m);
+	});
+var $Orasund$elm_ui_widgets$Widget$menuBar = $Orasund$elm_ui_widgets$Internal$AppBar$menuBar;
+var $mdgriffith$elm_ui$Internal$Flag$letterSpacing = $mdgriffith$elm_ui$Internal$Flag$flag(16);
+var $mdgriffith$elm_ui$Element$Font$letterSpacing = function (offset) {
+	return A2(
+		$mdgriffith$elm_ui$Internal$Model$StyleClass,
+		$mdgriffith$elm_ui$Internal$Flag$letterSpacing,
+		A3(
+			$mdgriffith$elm_ui$Internal$Model$Single,
+			'ls-' + $mdgriffith$elm_ui$Internal$Model$floatClass(offset),
+			'letter-spacing',
+			$elm$core$String$fromFloat(offset) + 'px'));
+};
+var $mdgriffith$elm_ui$Internal$Flag$fontWeight = $mdgriffith$elm_ui$Internal$Flag$flag(13);
+var $mdgriffith$elm_ui$Element$Font$semiBold = A2($mdgriffith$elm_ui$Internal$Model$Class, $mdgriffith$elm_ui$Internal$Flag$fontWeight, $mdgriffith$elm_ui$Internal$Style$classes.textSemiBold);
+var $mdgriffith$elm_ui$Element$Font$size = function (i) {
+	return A2(
+		$mdgriffith$elm_ui$Internal$Model$StyleClass,
+		$mdgriffith$elm_ui$Internal$Flag$fontSize,
+		$mdgriffith$elm_ui$Internal$Model$FontSize(i));
+};
+var $Orasund$elm_ui_widgets$Widget$Material$Typography$h6 = _List_fromArray(
+	[
+		$mdgriffith$elm_ui$Element$Font$size(20),
+		$mdgriffith$elm_ui$Element$Font$semiBold,
+		$mdgriffith$elm_ui$Element$Font$letterSpacing(0.15)
+	]);
+var $elm$core$Basics$pow = _Basics_pow;
+var $noahzgordon$elm_color_extra$Color$Accessibility$luminance = function (cl) {
+	var f = function (intensity) {
+		return (intensity <= 0.03928) ? (intensity / 12.92) : A2($elm$core$Basics$pow, (intensity + 0.055) / 1.055, 2.4);
+	};
+	var _v0 = function (a) {
+		return _Utils_Tuple3(
+			f(a.red),
+			f(a.green),
+			f(a.blue));
+	}(
+		$avh4$elm_color$Color$toRgba(cl));
+	var r = _v0.a;
+	var g = _v0.b;
+	var b = _v0.c;
+	return ((0.2126 * r) + (0.7152 * g)) + (0.0722 * b);
+};
+var $avh4$elm_color$Color$RgbaSpace = F4(
+	function (a, b, c, d) {
+		return {$: 'RgbaSpace', a: a, b: b, c: c, d: d};
+	});
+var $avh4$elm_color$Color$scaleFrom255 = function (c) {
+	return c / 255;
+};
+var $avh4$elm_color$Color$rgb255 = F3(
+	function (r, g, b) {
+		return A4(
+			$avh4$elm_color$Color$RgbaSpace,
+			$avh4$elm_color$Color$scaleFrom255(r),
+			$avh4$elm_color$Color$scaleFrom255(g),
+			$avh4$elm_color$Color$scaleFrom255(b),
+			1.0);
+	});
+var $Orasund$elm_ui_widgets$Widget$Material$Color$accessibleTextColor = function (color) {
+	var l = 1 + ($avh4$elm_color$Color$toRgba(color).alpha * ($noahzgordon$elm_color_extra$Color$Accessibility$luminance(color) - 1));
+	var ratioBlack = 1.05 / (l + 0.05);
+	var ratioWhite = (l + 0.05) / 0.05;
+	return (_Utils_cmp(ratioBlack, ratioWhite) < 0) ? A3($avh4$elm_color$Color$rgb255, 0, 0, 0) : A3($avh4$elm_color$Color$rgb255, 255, 255, 255);
+};
+var $mdgriffith$elm_ui$Internal$Model$AlignX = function (a) {
+	return {$: 'AlignX', a: a};
+};
+var $mdgriffith$elm_ui$Internal$Model$Right = {$: 'Right'};
+var $mdgriffith$elm_ui$Element$alignRight = $mdgriffith$elm_ui$Internal$Model$AlignX($mdgriffith$elm_ui$Internal$Model$Right);
+var $Orasund$elm_ui_widgets$Widget$Material$Typography$button = _List_fromArray(
+	[
+		$mdgriffith$elm_ui$Element$htmlAttribute(
+		A2($elm$html$Html$Attributes$style, 'text-transform', 'uppercase')),
+		$mdgriffith$elm_ui$Element$Font$size(14),
+		$mdgriffith$elm_ui$Element$Font$semiBold,
+		$mdgriffith$elm_ui$Element$Font$letterSpacing(1.25)
+	]);
+var $mdgriffith$elm_ui$Internal$Model$CenterX = {$: 'CenterX'};
+var $mdgriffith$elm_ui$Element$centerX = $mdgriffith$elm_ui$Internal$Model$AlignX($mdgriffith$elm_ui$Internal$Model$CenterX);
+var $mdgriffith$elm_ui$Internal$Model$CenterY = {$: 'CenterY'};
+var $mdgriffith$elm_ui$Element$centerY = $mdgriffith$elm_ui$Internal$Model$AlignY($mdgriffith$elm_ui$Internal$Model$CenterY);
+var $elm$core$Basics$cos = _Basics_cos;
+var $noahzgordon$elm_color_extra$Color$Convert$labToXyz = function (_v0) {
+	var l = _v0.l;
+	var a = _v0.a;
+	var b = _v0.b;
+	var y = (l + 16) / 116;
+	var c = function (ch) {
+		var ch_ = (ch * ch) * ch;
+		return (ch_ > 8.856e-3) ? ch_ : ((ch - (16 / 116)) / 7.787);
+	};
+	return {
+		x: c(y + (a / 500)) * 95.047,
+		y: c(y) * 100,
+		z: c(y - (b / 200)) * 108.883
+	};
+};
+var $elm$core$Basics$clamp = F3(
+	function (low, high, number) {
+		return (_Utils_cmp(number, low) < 0) ? low : ((_Utils_cmp(number, high) > 0) ? high : number);
+	});
+var $avh4$elm_color$Color$rgb = F3(
+	function (r, g, b) {
+		return A4($avh4$elm_color$Color$RgbaSpace, r, g, b, 1.0);
+	});
+var $noahzgordon$elm_color_extra$Color$Convert$xyzToColor = function (_v0) {
+	var x = _v0.x;
+	var y = _v0.y;
+	var z = _v0.z;
+	var z_ = z / 100;
+	var y_ = y / 100;
+	var x_ = x / 100;
+	var r = ((x_ * 3.2404542) + (y_ * (-1.5371385))) + (z_ * (-0.4986));
+	var g = ((x_ * (-0.969266)) + (y_ * 1.8760108)) + (z_ * 4.1556e-2);
+	var c = function (ch) {
+		var ch_ = (ch > 3.1308e-3) ? ((1.055 * A2($elm$core$Basics$pow, ch, 1 / 2.4)) - 5.5e-2) : (12.92 * ch);
+		return A3($elm$core$Basics$clamp, 0, 1, ch_);
+	};
+	var b = ((x_ * 5.56434e-2) + (y_ * (-0.2040259))) + (z_ * 1.0572252);
+	return A3(
+		$avh4$elm_color$Color$rgb,
+		c(r),
+		c(g),
+		c(b));
+};
+var $noahzgordon$elm_color_extra$Color$Convert$labToColor = A2($elm$core$Basics$composeR, $noahzgordon$elm_color_extra$Color$Convert$labToXyz, $noahzgordon$elm_color_extra$Color$Convert$xyzToColor);
+var $elm$core$Basics$sin = _Basics_sin;
+var $Orasund$elm_ui_widgets$Widget$Material$Color$fromCIELCH = A2(
+	$elm$core$Basics$composeR,
+	function (_v0) {
+		var l = _v0.l;
+		var c = _v0.c;
+		var h = _v0.h;
+		return {
+			a: c * $elm$core$Basics$cos(h),
+			b: c * $elm$core$Basics$sin(h),
+			l: l
+		};
+	},
+	$noahzgordon$elm_color_extra$Color$Convert$labToColor);
+var $avh4$elm_color$Color$fromRgba = function (components) {
+	return A4($avh4$elm_color$Color$RgbaSpace, components.red, components.green, components.blue, components.alpha);
+};
+var $elm$core$Basics$atan2 = _Basics_atan2;
+var $noahzgordon$elm_color_extra$Color$Convert$colorToXyz = function (cl) {
+	var c = function (ch) {
+		var ch_ = (ch > 4.045e-2) ? A2($elm$core$Basics$pow, (ch + 5.5e-2) / 1.055, 2.4) : (ch / 12.92);
+		return ch_ * 100;
+	};
+	var _v0 = $avh4$elm_color$Color$toRgba(cl);
+	var red = _v0.red;
+	var green = _v0.green;
+	var blue = _v0.blue;
+	var b = c(blue);
+	var g = c(green);
+	var r = c(red);
+	return {x: ((r * 0.4124) + (g * 0.3576)) + (b * 0.1805), y: ((r * 0.2126) + (g * 0.7152)) + (b * 7.22e-2), z: ((r * 1.93e-2) + (g * 0.1192)) + (b * 0.9505)};
+};
+var $noahzgordon$elm_color_extra$Color$Convert$xyzToLab = function (_v0) {
+	var x = _v0.x;
+	var y = _v0.y;
+	var z = _v0.z;
+	var c = function (ch) {
+		return (ch > 8.856e-3) ? A2($elm$core$Basics$pow, ch, 1 / 3) : ((7.787 * ch) + (16 / 116));
+	};
+	var x_ = c(x / 95.047);
+	var y_ = c(y / 100);
+	var z_ = c(z / 108.883);
+	return {a: 500 * (x_ - y_), b: 200 * (y_ - z_), l: (116 * y_) - 16};
+};
+var $noahzgordon$elm_color_extra$Color$Convert$colorToLab = A2($elm$core$Basics$composeR, $noahzgordon$elm_color_extra$Color$Convert$colorToXyz, $noahzgordon$elm_color_extra$Color$Convert$xyzToLab);
+var $elm$core$Basics$sqrt = _Basics_sqrt;
+var $Orasund$elm_ui_widgets$Widget$Material$Color$toCIELCH = A2(
+	$elm$core$Basics$composeR,
+	$noahzgordon$elm_color_extra$Color$Convert$colorToLab,
+	function (_v0) {
+		var l = _v0.l;
+		var a = _v0.a;
+		var b = _v0.b;
+		return {
+			c: $elm$core$Basics$sqrt((a * a) + (b * b)),
+			h: A2($elm$core$Basics$atan2, b, a),
+			l: l
+		};
+	});
+var $Orasund$elm_ui_widgets$Widget$Material$Color$withShade = F3(
+	function (c2, amount, c1) {
+		var fun = F2(
+			function (a, b) {
+				return {c: ((a.c * (1 - amount)) + (b.c * amount)) / 1, h: ((a.h * (1 - amount)) + (b.h * amount)) / 1, l: ((a.l * (1 - amount)) + (b.l * amount)) / 1};
+			});
+		var alpha = $avh4$elm_color$Color$toRgba(c1).alpha;
+		return $avh4$elm_color$Color$fromRgba(
+			function (color) {
+				return _Utils_update(
+					color,
+					{alpha: alpha});
+			}(
+				$avh4$elm_color$Color$toRgba(
+					$Orasund$elm_ui_widgets$Widget$Material$Color$fromCIELCH(
+						A2(
+							fun,
+							$Orasund$elm_ui_widgets$Widget$Material$Color$toCIELCH(c1),
+							$Orasund$elm_ui_widgets$Widget$Material$Color$toCIELCH(c2))))));
+	});
+var $Orasund$elm_ui_widgets$Internal$Material$Palette$gray = function (palette) {
+	return A3($Orasund$elm_ui_widgets$Widget$Material$Color$withShade, palette.on.surface, 0.5, palette.surface);
+};
+var $mdgriffith$elm_ui$Internal$Model$Min = F2(
+	function (a, b) {
+		return {$: 'Min', a: a, b: b};
+	});
+var $mdgriffith$elm_ui$Element$minimum = F2(
+	function (i, l) {
+		return A2($mdgriffith$elm_ui$Internal$Model$Min, i, l);
+	});
+var $mdgriffith$elm_ui$Internal$Model$Px = function (a) {
+	return {$: 'Px', a: a};
+};
+var $mdgriffith$elm_ui$Element$px = $mdgriffith$elm_ui$Internal$Model$Px;
+var $Orasund$elm_ui_widgets$Internal$Material$Button$baseButton = function (palette) {
+	return {
+		content: {
+			content: {
+				icon: {
+					ifActive: {
+						color: $Orasund$elm_ui_widgets$Internal$Material$Palette$gray(palette),
+						size: 18
+					},
+					ifDisabled: {
+						color: $Orasund$elm_ui_widgets$Internal$Material$Palette$gray(palette),
+						size: 18
+					},
+					otherwise: {
+						color: $Orasund$elm_ui_widgets$Internal$Material$Palette$gray(palette),
+						size: 18
+					}
+				},
+				text: {
+					contentText: _List_fromArray(
+						[$mdgriffith$elm_ui$Element$centerX])
+				}
+			},
+			elementRow: _List_fromArray(
+				[
+					$mdgriffith$elm_ui$Element$spacing(8),
+					$mdgriffith$elm_ui$Element$width(
+					A2($mdgriffith$elm_ui$Element$minimum, 32, $mdgriffith$elm_ui$Element$shrink)),
+					$mdgriffith$elm_ui$Element$centerY
+				])
+		},
+		elementButton: _Utils_ap(
+			$Orasund$elm_ui_widgets$Widget$Material$Typography$button,
+			_List_fromArray(
+				[
+					$mdgriffith$elm_ui$Element$height(
+					$mdgriffith$elm_ui$Element$px(36)),
+					A2($mdgriffith$elm_ui$Element$paddingXY, 8, 8),
+					$mdgriffith$elm_ui$Element$Border$rounded(4)
+				])),
+		ifActive: _List_Nil,
+		ifDisabled: _List_fromArray(
+			[
+				$mdgriffith$elm_ui$Element$htmlAttribute(
+				A2($elm$html$Html$Attributes$style, 'cursor', 'not-allowed'))
+			]),
+		otherwise: _List_Nil
+	};
+};
+var $Orasund$elm_ui_widgets$Widget$Material$Color$buttonFocusOpacity = 0.24;
+var $Orasund$elm_ui_widgets$Widget$Material$Color$buttonHoverOpacity = 0.08;
+var $Orasund$elm_ui_widgets$Widget$Material$Color$buttonPressedOpacity = 0.32;
+var $mdgriffith$elm_ui$Internal$Model$Focus = {$: 'Focus'};
+var $mdgriffith$elm_ui$Internal$Model$PseudoSelector = F2(
+	function (a, b) {
+		return {$: 'PseudoSelector', a: a, b: b};
+	});
+var $mdgriffith$elm_ui$Internal$Flag$focus = $mdgriffith$elm_ui$Internal$Flag$flag(31);
+var $elm$virtual_dom$VirtualDom$map = _VirtualDom_map;
+var $mdgriffith$elm_ui$Internal$Model$map = F2(
+	function (fn, el) {
+		switch (el.$) {
+			case 'Styled':
+				var styled = el.a;
+				return $mdgriffith$elm_ui$Internal$Model$Styled(
+					{
+						html: F2(
+							function (add, context) {
+								return A2(
+									$elm$virtual_dom$VirtualDom$map,
+									fn,
+									A2(styled.html, add, context));
+							}),
+						styles: styled.styles
+					});
+			case 'Unstyled':
+				var html = el.a;
+				return $mdgriffith$elm_ui$Internal$Model$Unstyled(
+					A2(
+						$elm$core$Basics$composeL,
+						$elm$virtual_dom$VirtualDom$map(fn),
+						html));
+			case 'Text':
+				var str = el.a;
+				return $mdgriffith$elm_ui$Internal$Model$Text(str);
+			default:
+				return $mdgriffith$elm_ui$Internal$Model$Empty;
+		}
+	});
+var $elm$virtual_dom$VirtualDom$mapAttribute = _VirtualDom_mapAttribute;
+var $mdgriffith$elm_ui$Internal$Model$mapAttrFromStyle = F2(
+	function (fn, attr) {
+		switch (attr.$) {
+			case 'NoAttribute':
+				return $mdgriffith$elm_ui$Internal$Model$NoAttribute;
+			case 'Describe':
+				var description = attr.a;
+				return $mdgriffith$elm_ui$Internal$Model$Describe(description);
+			case 'AlignX':
+				var x = attr.a;
+				return $mdgriffith$elm_ui$Internal$Model$AlignX(x);
+			case 'AlignY':
+				var y = attr.a;
+				return $mdgriffith$elm_ui$Internal$Model$AlignY(y);
+			case 'Width':
+				var x = attr.a;
+				return $mdgriffith$elm_ui$Internal$Model$Width(x);
+			case 'Height':
+				var x = attr.a;
+				return $mdgriffith$elm_ui$Internal$Model$Height(x);
+			case 'Class':
+				var x = attr.a;
+				var y = attr.b;
+				return A2($mdgriffith$elm_ui$Internal$Model$Class, x, y);
+			case 'StyleClass':
+				var flag = attr.a;
+				var style = attr.b;
+				return A2($mdgriffith$elm_ui$Internal$Model$StyleClass, flag, style);
+			case 'Nearby':
+				var location = attr.a;
+				var elem = attr.b;
+				return A2(
+					$mdgriffith$elm_ui$Internal$Model$Nearby,
+					location,
+					A2($mdgriffith$elm_ui$Internal$Model$map, fn, elem));
+			case 'Attr':
+				var htmlAttr = attr.a;
+				return $mdgriffith$elm_ui$Internal$Model$Attr(
+					A2($elm$virtual_dom$VirtualDom$mapAttribute, fn, htmlAttr));
+			default:
+				var fl = attr.a;
+				var trans = attr.b;
+				return A2($mdgriffith$elm_ui$Internal$Model$TransformComponent, fl, trans);
+		}
+	});
+var $mdgriffith$elm_ui$Internal$Model$removeNever = function (style) {
+	return A2($mdgriffith$elm_ui$Internal$Model$mapAttrFromStyle, $elm$core$Basics$never, style);
+};
+var $mdgriffith$elm_ui$Internal$Model$unwrapDecsHelper = F2(
+	function (attr, _v0) {
+		var styles = _v0.a;
+		var trans = _v0.b;
+		var _v1 = $mdgriffith$elm_ui$Internal$Model$removeNever(attr);
+		switch (_v1.$) {
+			case 'StyleClass':
+				var style = _v1.b;
+				return _Utils_Tuple2(
+					A2($elm$core$List$cons, style, styles),
+					trans);
+			case 'TransformComponent':
+				var flag = _v1.a;
+				var component = _v1.b;
+				return _Utils_Tuple2(
+					styles,
+					A2($mdgriffith$elm_ui$Internal$Model$composeTransformation, trans, component));
+			default:
+				return _Utils_Tuple2(styles, trans);
+		}
+	});
+var $mdgriffith$elm_ui$Internal$Model$unwrapDecorations = function (attrs) {
+	var _v0 = A3(
+		$elm$core$List$foldl,
+		$mdgriffith$elm_ui$Internal$Model$unwrapDecsHelper,
+		_Utils_Tuple2(_List_Nil, $mdgriffith$elm_ui$Internal$Model$Untransformed),
+		attrs);
+	var styles = _v0.a;
+	var transform = _v0.b;
+	return A2(
+		$elm$core$List$cons,
+		$mdgriffith$elm_ui$Internal$Model$Transform(transform),
+		styles);
+};
+var $mdgriffith$elm_ui$Element$focused = function (decs) {
+	return A2(
+		$mdgriffith$elm_ui$Internal$Model$StyleClass,
+		$mdgriffith$elm_ui$Internal$Flag$focus,
+		A2(
+			$mdgriffith$elm_ui$Internal$Model$PseudoSelector,
+			$mdgriffith$elm_ui$Internal$Model$Focus,
+			$mdgriffith$elm_ui$Internal$Model$unwrapDecorations(decs)));
+};
+var $Orasund$elm_ui_widgets$Widget$Material$Color$fromColor = A2($elm$core$Basics$composeR, $avh4$elm_color$Color$toRgba, $mdgriffith$elm_ui$Element$fromRgb);
+var $mdgriffith$elm_ui$Internal$Model$Active = {$: 'Active'};
+var $mdgriffith$elm_ui$Internal$Flag$active = $mdgriffith$elm_ui$Internal$Flag$flag(32);
+var $mdgriffith$elm_ui$Element$mouseDown = function (decs) {
+	return A2(
+		$mdgriffith$elm_ui$Internal$Model$StyleClass,
+		$mdgriffith$elm_ui$Internal$Flag$active,
+		A2(
+			$mdgriffith$elm_ui$Internal$Model$PseudoSelector,
+			$mdgriffith$elm_ui$Internal$Model$Active,
+			$mdgriffith$elm_ui$Internal$Model$unwrapDecorations(decs)));
+};
+var $mdgriffith$elm_ui$Internal$Model$Hover = {$: 'Hover'};
+var $mdgriffith$elm_ui$Internal$Flag$hover = $mdgriffith$elm_ui$Internal$Flag$flag(33);
+var $mdgriffith$elm_ui$Element$mouseOver = function (decs) {
+	return A2(
+		$mdgriffith$elm_ui$Internal$Model$StyleClass,
+		$mdgriffith$elm_ui$Internal$Flag$hover,
+		A2(
+			$mdgriffith$elm_ui$Internal$Model$PseudoSelector,
+			$mdgriffith$elm_ui$Internal$Model$Hover,
+			$mdgriffith$elm_ui$Internal$Model$unwrapDecorations(decs)));
+};
+var $Orasund$elm_ui_widgets$Widget$Material$Color$scaleOpacity = function (opacity) {
+	return A2(
+		$elm$core$Basics$composeR,
+		$avh4$elm_color$Color$toRgba,
+		A2(
+			$elm$core$Basics$composeR,
+			function (color) {
+				return _Utils_update(
+					color,
+					{alpha: color.alpha * opacity});
+			},
+			$avh4$elm_color$Color$fromRgba));
+};
+var $Orasund$elm_ui_widgets$Internal$Material$Button$iconButton = function (palette) {
+	return {
+		content: {
+			content: {
+				icon: {
+					ifActive: {color: palette.primary, size: 18},
+					ifDisabled: {
+						color: $Orasund$elm_ui_widgets$Internal$Material$Palette$gray(palette),
+						size: 18
+					},
+					otherwise: {color: palette.primary, size: 18}
+				},
+				text: {
+					contentText: _List_fromArray(
+						[$mdgriffith$elm_ui$Element$centerX])
+				}
+			},
+			elementRow: _List_fromArray(
+				[
+					$mdgriffith$elm_ui$Element$spacing(8),
+					$mdgriffith$elm_ui$Element$width($mdgriffith$elm_ui$Element$shrink),
+					$mdgriffith$elm_ui$Element$centerY,
+					$mdgriffith$elm_ui$Element$centerX
+				])
+		},
+		elementButton: _Utils_ap(
+			$Orasund$elm_ui_widgets$Internal$Material$Button$baseButton(palette).elementButton,
+			_List_fromArray(
+				[
+					$mdgriffith$elm_ui$Element$height(
+					$mdgriffith$elm_ui$Element$px(48)),
+					$mdgriffith$elm_ui$Element$width(
+					A2($mdgriffith$elm_ui$Element$minimum, 48, $mdgriffith$elm_ui$Element$shrink)),
+					$mdgriffith$elm_ui$Element$Border$rounded(24),
+					$mdgriffith$elm_ui$Element$mouseDown(
+					_List_fromArray(
+						[
+							$mdgriffith$elm_ui$Element$Background$color(
+							$Orasund$elm_ui_widgets$Widget$Material$Color$fromColor(
+								A2($Orasund$elm_ui_widgets$Widget$Material$Color$scaleOpacity, $Orasund$elm_ui_widgets$Widget$Material$Color$buttonPressedOpacity, palette.surface)))
+						])),
+					$mdgriffith$elm_ui$Element$focused(
+					_List_fromArray(
+						[
+							$mdgriffith$elm_ui$Element$Background$color(
+							$Orasund$elm_ui_widgets$Widget$Material$Color$fromColor(
+								A2($Orasund$elm_ui_widgets$Widget$Material$Color$scaleOpacity, $Orasund$elm_ui_widgets$Widget$Material$Color$buttonFocusOpacity, palette.surface)))
+						])),
+					$mdgriffith$elm_ui$Element$mouseOver(
+					_List_fromArray(
+						[
+							$mdgriffith$elm_ui$Element$Background$color(
+							$Orasund$elm_ui_widgets$Widget$Material$Color$fromColor(
+								A2($Orasund$elm_ui_widgets$Widget$Material$Color$scaleOpacity, $Orasund$elm_ui_widgets$Widget$Material$Color$buttonHoverOpacity, palette.surface)))
+						]))
+				])),
+		ifActive: _List_fromArray(
+			[
+				$mdgriffith$elm_ui$Element$Background$color(
+				$Orasund$elm_ui_widgets$Widget$Material$Color$fromColor(
+					A2($Orasund$elm_ui_widgets$Widget$Material$Color$scaleOpacity, $Orasund$elm_ui_widgets$Widget$Material$Color$buttonHoverOpacity, palette.surface)))
+			]),
+		ifDisabled: _Utils_ap(
+			$Orasund$elm_ui_widgets$Internal$Material$Button$baseButton(palette).ifDisabled,
+			_List_fromArray(
+				[
+					$mdgriffith$elm_ui$Element$Font$color(
+					$Orasund$elm_ui_widgets$Widget$Material$Color$fromColor(
+						$Orasund$elm_ui_widgets$Internal$Material$Palette$gray(palette))),
+					$mdgriffith$elm_ui$Element$mouseDown(_List_Nil),
+					$mdgriffith$elm_ui$Element$mouseOver(_List_Nil),
+					$mdgriffith$elm_ui$Element$focused(_List_Nil)
+				])),
+		otherwise: _List_Nil
+	};
+};
+var $Orasund$elm_ui_widgets$Widget$Customize$mapContent = F2(
+	function (fun, a) {
+		return _Utils_update(
+			a,
+			{
+				content: fun(a.content)
+			});
+	});
+var $elm$svg$Svg$Attributes$d = _VirtualDom_attribute('d');
+var $elm$svg$Svg$Attributes$fill = _VirtualDom_attribute('fill');
+var $elm$svg$Svg$Attributes$height = _VirtualDom_attribute('height');
+var $mdgriffith$elm_ui$Element$html = $mdgriffith$elm_ui$Internal$Model$unstyled;
+var $elm$svg$Svg$Attributes$stroke = _VirtualDom_attribute('stroke');
+var $elm$svg$Svg$trustedNode = _VirtualDom_nodeNS('http://www.w3.org/2000/svg');
+var $elm$svg$Svg$svg = $elm$svg$Svg$trustedNode('svg');
+var $avh4$elm_color$Color$toCssString = function (_v0) {
+	var r = _v0.a;
+	var g = _v0.b;
+	var b = _v0.c;
+	var a = _v0.d;
+	var roundTo = function (x) {
+		return $elm$core$Basics$round(x * 1000) / 1000;
+	};
+	var pct = function (x) {
+		return $elm$core$Basics$round(x * 10000) / 100;
+	};
+	return $elm$core$String$concat(
+		_List_fromArray(
+			[
+				'rgba(',
+				$elm$core$String$fromFloat(
+				pct(r)),
+				'%,',
+				$elm$core$String$fromFloat(
+				pct(g)),
+				'%,',
+				$elm$core$String$fromFloat(
+				pct(b)),
+				'%,',
+				$elm$core$String$fromFloat(
+				roundTo(a)),
+				')'
+			]));
+};
+var $elm$svg$Svg$Attributes$viewBox = _VirtualDom_attribute('viewBox');
+var $elm$svg$Svg$Attributes$width = _VirtualDom_attribute('width');
+var $Orasund$elm_ui_widgets$Internal$Material$Icon$icon = function (_v0) {
+	var viewBox = _v0.viewBox;
+	var size = _v0.size;
+	var color = _v0.color;
+	return A2(
+		$elm$core$Basics$composeR,
+		$elm$svg$Svg$svg(
+			_List_fromArray(
+				[
+					$elm$svg$Svg$Attributes$height(
+					$elm$core$String$fromInt(size)),
+					$elm$svg$Svg$Attributes$stroke(
+					$avh4$elm_color$Color$toCssString(color)),
+					$elm$svg$Svg$Attributes$fill(
+					$avh4$elm_color$Color$toCssString(color)),
+					$elm$svg$Svg$Attributes$viewBox(viewBox),
+					$elm$svg$Svg$Attributes$width(
+					$elm$core$String$fromInt(size))
+				])),
+		A2(
+			$elm$core$Basics$composeR,
+			$mdgriffith$elm_ui$Element$html,
+			$mdgriffith$elm_ui$Element$el(_List_Nil)));
+};
+var $elm$svg$Svg$path = $elm$svg$Svg$trustedNode('path');
+var $Orasund$elm_ui_widgets$Internal$Material$Icon$more_vert = function (_v0) {
+	var size = _v0.size;
+	var color = _v0.color;
+	return A2(
+		$Orasund$elm_ui_widgets$Internal$Material$Icon$icon,
+		{color: color, size: size, viewBox: '0 0 48 48'},
+		_List_fromArray(
+			[
+				A2(
+				$elm$svg$Svg$path,
+				_List_fromArray(
+					[
+						$elm$svg$Svg$Attributes$d('M24 16c2.21 0 4-1.79 4-4s-1.79-4-4-4-4 1.79-4 4 1.79 4 4 4zm0 4c-2.21 0-4 1.79-4 4s1.79 4 4 4 4-1.79 4-4-1.79-4-4-4zm0 12c-2.21 0-4 1.79-4 4s1.79 4 4 4 4-1.79 4-4-1.79-4-4-4z')
+					]),
+				_List_Nil)
+			]));
+};
+var $mdgriffith$elm_ui$Element$padding = function (x) {
+	var f = x;
+	return A2(
+		$mdgriffith$elm_ui$Internal$Model$StyleClass,
+		$mdgriffith$elm_ui$Internal$Flag$padding,
+		A5(
+			$mdgriffith$elm_ui$Internal$Model$PaddingStyle,
+			'p-' + $elm$core$String$fromInt(x),
+			f,
+			f,
+			f,
+			f));
+};
+var $Orasund$elm_ui_widgets$Internal$Material$Icon$search = function (_v0) {
+	var size = _v0.size;
+	var color = _v0.color;
+	return A2(
+		$Orasund$elm_ui_widgets$Internal$Material$Icon$icon,
+		{color: color, size: size, viewBox: '0 0 48 48'},
+		_List_fromArray(
+			[
+				A2(
+				$elm$svg$Svg$path,
+				_List_fromArray(
+					[
+						$elm$svg$Svg$Attributes$d('M31 28h-1.59l-.55-.55C30.82 25.18 32 22.23 32 19c0-7.18-5.82-13-13-13S6 11.82 6 19s5.82 13 13 13c3.23 0 6.18-1.18 8.45-3.13l.55.55V31l10 9.98L40.98 38 31 28zm-12 0c-4.97 0-9-4.03-9-9s4.03-9 9-9 9 4.03 9 9-4.03 9-9 9z')
+					]),
+				_List_Nil)
+			]));
+};
+var $Orasund$elm_ui_widgets$Widget$Customize$mapElementTextInput = F2(
+	function (fun, a) {
+		return _Utils_update(
+			a,
+			{
+				elementTextInput: fun(a.elementTextInput)
+			});
+	});
+var $Orasund$elm_ui_widgets$Widget$Customize$elementTextInput = F2(
+	function (list, a) {
+		return A2(
+			$Orasund$elm_ui_widgets$Widget$Customize$mapElementTextInput,
+			function (b) {
+				return _Utils_ap(b, list);
+			},
+			a);
+	});
+var $Orasund$elm_ui_widgets$Widget$Customize$mapElementRow = F2(
+	function (fun, a) {
+		return _Utils_update(
+			a,
+			{
+				elementRow: fun(a.elementRow)
+			});
+	});
+var $mdgriffith$elm_ui$Internal$Model$Max = F2(
+	function (a, b) {
+		return {$: 'Max', a: a, b: b};
+	});
+var $mdgriffith$elm_ui$Element$maximum = F2(
+	function (i, l) {
+		return A2($mdgriffith$elm_ui$Internal$Model$Max, i, l);
+	});
+var $Orasund$elm_ui_widgets$Widget$Material$Color$buttonDisabledOpacity = 0.38;
+var $Orasund$elm_ui_widgets$Widget$Material$Color$buttonSelectedOpacity = 0.16;
+var $Orasund$elm_ui_widgets$Internal$Material$Palette$lightGray = function (palette) {
+	return A3($Orasund$elm_ui_widgets$Widget$Material$Color$withShade, palette.on.surface, 0.14, palette.surface);
+};
+var $mdgriffith$elm_ui$Internal$Model$boxShadowClass = function (shadow) {
+	return $elm$core$String$concat(
+		_List_fromArray(
+			[
+				shadow.inset ? 'box-inset' : 'box-',
+				$mdgriffith$elm_ui$Internal$Model$floatClass(shadow.offset.a) + 'px',
+				$mdgriffith$elm_ui$Internal$Model$floatClass(shadow.offset.b) + 'px',
+				$mdgriffith$elm_ui$Internal$Model$floatClass(shadow.blur) + 'px',
+				$mdgriffith$elm_ui$Internal$Model$floatClass(shadow.size) + 'px',
+				$mdgriffith$elm_ui$Internal$Model$formatColorClass(shadow.color)
+			]));
+};
+var $mdgriffith$elm_ui$Internal$Flag$shadows = $mdgriffith$elm_ui$Internal$Flag$flag(19);
+var $mdgriffith$elm_ui$Element$Border$shadow = function (almostShade) {
+	var shade = {blur: almostShade.blur, color: almostShade.color, inset: false, offset: almostShade.offset, size: almostShade.size};
+	return A2(
+		$mdgriffith$elm_ui$Internal$Model$StyleClass,
+		$mdgriffith$elm_ui$Internal$Flag$shadows,
+		A3(
+			$mdgriffith$elm_ui$Internal$Model$Single,
+			$mdgriffith$elm_ui$Internal$Model$boxShadowClass(shade),
+			'box-shadow',
+			$mdgriffith$elm_ui$Internal$Model$formatBoxShadow(shade)));
+};
+var $mdgriffith$elm_ui$Element$rgba255 = F4(
+	function (red, green, blue, a) {
+		return A4($mdgriffith$elm_ui$Internal$Model$Rgba, red / 255, green / 255, blue / 255, a);
+	});
+var $Orasund$elm_ui_widgets$Widget$Material$Color$shadow = function (_float) {
+	return {
+		blur: _float,
+		color: A4($mdgriffith$elm_ui$Element$rgba255, 0, 0, 0, 0.2),
+		offset: _Utils_Tuple2(0, _float),
+		size: 0
+	};
+};
+var $Orasund$elm_ui_widgets$Widget$Material$Color$textAndBackground = function (color) {
+	return _List_fromArray(
+		[
+			$mdgriffith$elm_ui$Element$Background$color(
+			$Orasund$elm_ui_widgets$Widget$Material$Color$fromColor(color)),
+			$mdgriffith$elm_ui$Element$Font$color(
+			$Orasund$elm_ui_widgets$Widget$Material$Color$fromColor(
+				$Orasund$elm_ui_widgets$Widget$Material$Color$accessibleTextColor(color)))
+		]);
+};
+var $Orasund$elm_ui_widgets$Internal$Material$Chip$chip = function (palette) {
+	return {
+		content: {
+			content: {
+				icon: {
+					ifActive: {
+						color: $Orasund$elm_ui_widgets$Widget$Material$Color$accessibleTextColor(
+							$Orasund$elm_ui_widgets$Internal$Material$Palette$lightGray(palette)),
+						size: 18
+					},
+					ifDisabled: {
+						color: $Orasund$elm_ui_widgets$Widget$Material$Color$accessibleTextColor(
+							$Orasund$elm_ui_widgets$Internal$Material$Palette$lightGray(palette)),
+						size: 18
+					},
+					otherwise: {
+						color: $Orasund$elm_ui_widgets$Widget$Material$Color$accessibleTextColor(
+							$Orasund$elm_ui_widgets$Internal$Material$Palette$lightGray(palette)),
+						size: 18
+					}
+				},
+				text: {contentText: _List_Nil}
+			},
+			elementRow: _List_fromArray(
+				[
+					$mdgriffith$elm_ui$Element$spacing(8),
+					$mdgriffith$elm_ui$Element$paddingEach(
+					{bottom: 0, left: 8, right: 0, top: 0}),
+					$mdgriffith$elm_ui$Element$centerY
+				])
+		},
+		elementButton: _List_fromArray(
+			[
+				$mdgriffith$elm_ui$Element$height(
+				$mdgriffith$elm_ui$Element$px(32)),
+				$mdgriffith$elm_ui$Element$paddingEach(
+				{bottom: 0, left: 4, right: 12, top: 0}),
+				$mdgriffith$elm_ui$Element$Border$rounded(16),
+				$mdgriffith$elm_ui$Element$mouseDown(
+				_List_fromArray(
+					[
+						$mdgriffith$elm_ui$Element$Background$color(
+						$Orasund$elm_ui_widgets$Widget$Material$Color$fromColor(
+							A3(
+								$Orasund$elm_ui_widgets$Widget$Material$Color$withShade,
+								palette.on.surface,
+								$Orasund$elm_ui_widgets$Widget$Material$Color$buttonPressedOpacity,
+								$Orasund$elm_ui_widgets$Internal$Material$Palette$lightGray(palette))))
+					])),
+				$mdgriffith$elm_ui$Element$focused(
+				_List_fromArray(
+					[
+						$mdgriffith$elm_ui$Element$Background$color(
+						$Orasund$elm_ui_widgets$Widget$Material$Color$fromColor(
+							A3(
+								$Orasund$elm_ui_widgets$Widget$Material$Color$withShade,
+								palette.on.surface,
+								$Orasund$elm_ui_widgets$Widget$Material$Color$buttonFocusOpacity,
+								$Orasund$elm_ui_widgets$Internal$Material$Palette$lightGray(palette))))
+					])),
+				$mdgriffith$elm_ui$Element$mouseOver(
+				_List_fromArray(
+					[
+						$mdgriffith$elm_ui$Element$Background$color(
+						$Orasund$elm_ui_widgets$Widget$Material$Color$fromColor(
+							A3(
+								$Orasund$elm_ui_widgets$Widget$Material$Color$withShade,
+								palette.on.surface,
+								$Orasund$elm_ui_widgets$Widget$Material$Color$buttonHoverOpacity,
+								$Orasund$elm_ui_widgets$Internal$Material$Palette$lightGray(palette))))
+					]))
+			]),
+		ifActive: _List_fromArray(
+			[
+				$mdgriffith$elm_ui$Element$Background$color(
+				$Orasund$elm_ui_widgets$Widget$Material$Color$fromColor(
+					A3(
+						$Orasund$elm_ui_widgets$Widget$Material$Color$withShade,
+						palette.on.surface,
+						$Orasund$elm_ui_widgets$Widget$Material$Color$buttonSelectedOpacity,
+						$Orasund$elm_ui_widgets$Internal$Material$Palette$lightGray(palette)))),
+				$mdgriffith$elm_ui$Element$Font$color(
+				$Orasund$elm_ui_widgets$Widget$Material$Color$fromColor(
+					$Orasund$elm_ui_widgets$Widget$Material$Color$accessibleTextColor(
+						$Orasund$elm_ui_widgets$Internal$Material$Palette$lightGray(palette)))),
+				$mdgriffith$elm_ui$Element$Border$shadow(
+				$Orasund$elm_ui_widgets$Widget$Material$Color$shadow(4))
+			]),
+		ifDisabled: _Utils_ap(
+			$Orasund$elm_ui_widgets$Internal$Material$Button$baseButton(palette).ifDisabled,
+			_Utils_ap(
+				$Orasund$elm_ui_widgets$Widget$Material$Color$textAndBackground(
+					A3(
+						$Orasund$elm_ui_widgets$Widget$Material$Color$withShade,
+						palette.on.surface,
+						$Orasund$elm_ui_widgets$Widget$Material$Color$buttonDisabledOpacity,
+						$Orasund$elm_ui_widgets$Internal$Material$Palette$lightGray(palette))),
+				_List_fromArray(
+					[
+						$mdgriffith$elm_ui$Element$mouseDown(_List_Nil),
+						$mdgriffith$elm_ui$Element$mouseOver(_List_Nil),
+						$mdgriffith$elm_ui$Element$focused(_List_Nil)
+					]))),
+		otherwise: _List_fromArray(
+			[
+				$mdgriffith$elm_ui$Element$Background$color(
+				$Orasund$elm_ui_widgets$Widget$Material$Color$fromColor(
+					$Orasund$elm_ui_widgets$Internal$Material$Palette$lightGray(palette))),
+				$mdgriffith$elm_ui$Element$Font$color(
+				$Orasund$elm_ui_widgets$Widget$Material$Color$fromColor(
+					$Orasund$elm_ui_widgets$Widget$Material$Color$accessibleTextColor(
+						$Orasund$elm_ui_widgets$Internal$Material$Palette$lightGray(palette))))
+			])
+	};
+};
+var $Orasund$elm_ui_widgets$Internal$Material$TextInput$textInputBase = function (palette) {
+	return {
+		content: {
+			chips: {
+				content: $Orasund$elm_ui_widgets$Internal$Material$Chip$chip(palette),
+				elementRow: _List_fromArray(
+					[
+						$mdgriffith$elm_ui$Element$spacing(8)
+					])
+			},
+			text: {
+				elementTextInput: _Utils_ap(
+					$Orasund$elm_ui_widgets$Widget$Material$Color$textAndBackground(palette.surface),
+					_List_fromArray(
+						[
+							$mdgriffith$elm_ui$Element$Border$width(0),
+							$mdgriffith$elm_ui$Element$mouseOver(_List_Nil),
+							$mdgriffith$elm_ui$Element$focused(_List_Nil)
+						]))
+			}
+		},
+		elementRow: $Orasund$elm_ui_widgets$Widget$Material$Color$textAndBackground(palette.surface)
+	};
+};
+var $Orasund$elm_ui_widgets$Internal$Material$TextInput$searchInput = function (palette) {
+	return A2(
+		$Orasund$elm_ui_widgets$Widget$Customize$mapContent,
+		function (record) {
+			return _Utils_update(
+				record,
+				{
+					text: A2(
+						$Orasund$elm_ui_widgets$Widget$Customize$elementTextInput,
+						_List_fromArray(
+							[
+								$mdgriffith$elm_ui$Element$Border$width(0),
+								A2($mdgriffith$elm_ui$Element$paddingXY, 8, 8),
+								$mdgriffith$elm_ui$Element$height(
+								$mdgriffith$elm_ui$Element$px(32)),
+								$mdgriffith$elm_ui$Element$width(
+								A2($mdgriffith$elm_ui$Element$maximum, 360, $mdgriffith$elm_ui$Element$fill))
+							]),
+						record.text)
+				});
+		},
+		A2(
+			$Orasund$elm_ui_widgets$Widget$Customize$mapElementRow,
+			$elm$core$Basics$always(
+				_List_fromArray(
+					[
+						$mdgriffith$elm_ui$Element$alignRight,
+						A2($mdgriffith$elm_ui$Element$paddingXY, 8, 8),
+						$mdgriffith$elm_ui$Element$Border$rounded(4)
+					])),
+			$Orasund$elm_ui_widgets$Internal$Material$TextInput$textInputBase(palette)));
+};
+var $Orasund$elm_ui_widgets$Internal$Material$AppBar$internalBar = F2(
+	function (content, palette) {
+		return {
+			content: {
+				actions: {
+					content: {
+						button: A2(
+							$Orasund$elm_ui_widgets$Widget$Customize$mapContent,
+							$Orasund$elm_ui_widgets$Widget$Customize$mapContent(
+								function (record) {
+									return _Utils_update(
+										record,
+										{
+											icon: {
+												ifActive: {
+													color: $Orasund$elm_ui_widgets$Widget$Material$Color$accessibleTextColor(palette.primary),
+													size: record.icon.ifActive.size
+												},
+												ifDisabled: record.icon.ifDisabled,
+												otherwise: {
+													color: $Orasund$elm_ui_widgets$Widget$Material$Color$accessibleTextColor(palette.primary),
+													size: record.icon.otherwise.size
+												}
+											}
+										});
+								}),
+							$Orasund$elm_ui_widgets$Internal$Material$Button$iconButton(palette)),
+						moreVerticalIcon: $Orasund$elm_ui_widgets$Internal$Material$Icon$more_vert,
+						searchIcon: $Orasund$elm_ui_widgets$Internal$Material$Icon$search
+					},
+					elementRow: _List_fromArray(
+						[
+							$mdgriffith$elm_ui$Element$alignRight,
+							$mdgriffith$elm_ui$Element$width($mdgriffith$elm_ui$Element$shrink)
+						])
+				},
+				menu: {
+					content: content,
+					elementRow: _List_fromArray(
+						[
+							$mdgriffith$elm_ui$Element$width($mdgriffith$elm_ui$Element$shrink),
+							$mdgriffith$elm_ui$Element$spacing(8)
+						])
+				},
+				search: $Orasund$elm_ui_widgets$Internal$Material$TextInput$searchInput(palette)
+			},
+			elementRow: _Utils_ap(
+				$Orasund$elm_ui_widgets$Widget$Material$Color$textAndBackground(palette.primary),
+				_List_fromArray(
+					[
+						$mdgriffith$elm_ui$Element$padding(0),
+						$mdgriffith$elm_ui$Element$spacing(8),
+						$mdgriffith$elm_ui$Element$height(
+						$mdgriffith$elm_ui$Element$px(56)),
+						$mdgriffith$elm_ui$Element$width(
+						A2($mdgriffith$elm_ui$Element$minimum, 360, $mdgriffith$elm_ui$Element$fill))
+					]))
+		};
+	});
+var $Orasund$elm_ui_widgets$Internal$Material$Icon$menu = function (_v0) {
+	var size = _v0.size;
+	var color = _v0.color;
+	return A2(
+		$Orasund$elm_ui_widgets$Internal$Material$Icon$icon,
+		{color: color, size: size, viewBox: '0 0 48 48'},
+		_List_fromArray(
+			[
+				A2(
+				$elm$svg$Svg$path,
+				_List_fromArray(
+					[
+						$elm$svg$Svg$Attributes$d('M6 36h36v-4H6v4zm0-10h36v-4H6v4zm0-14v4h36v-4H6z')
+					]),
+				_List_Nil)
+			]));
+};
+var $Orasund$elm_ui_widgets$Internal$Material$AppBar$menuBar = $Orasund$elm_ui_widgets$Internal$Material$AppBar$internalBar(
+	{
+		menuIcon: $Orasund$elm_ui_widgets$Internal$Material$Icon$menu,
+		title: _Utils_ap(
+			$Orasund$elm_ui_widgets$Widget$Material$Typography$h6,
+			_List_fromArray(
+				[
+					A2($mdgriffith$elm_ui$Element$paddingXY, 8, 0)
+				]))
+	});
+var $Orasund$elm_ui_widgets$Widget$Material$menuBar = $Orasund$elm_ui_widgets$Internal$Material$AppBar$menuBar;
+var $mdgriffith$elm_ui$Element$Input$multiline = F2(
+	function (attrs, multi) {
+		return A3(
+			$mdgriffith$elm_ui$Element$Input$textHelper,
+			{autofill: $elm$core$Maybe$Nothing, spellchecked: multi.spellcheck, type_: $mdgriffith$elm_ui$Element$Input$TextArea},
+			attrs,
+			{label: multi.label, onChange: multi.onChange, placeholder: multi.placeholder, text: multi.text});
+	});
+var $Orasund$elm_ui_widgets$Internal$Material$Button$outlinedButton = function (palette) {
+	return {
+		content: {
+			content: {
+				icon: {
+					ifActive: {color: palette.primary, size: 18},
+					ifDisabled: {
+						color: $Orasund$elm_ui_widgets$Internal$Material$Palette$gray(palette),
+						size: 18
+					},
+					otherwise: {color: palette.primary, size: 18}
+				},
+				text: {
+					contentText: $Orasund$elm_ui_widgets$Internal$Material$Button$baseButton(palette).content.content.text.contentText
+				}
+			},
+			elementRow: _Utils_ap(
+				$Orasund$elm_ui_widgets$Internal$Material$Button$baseButton(palette).content.elementRow,
+				_List_fromArray(
+					[
+						A2($mdgriffith$elm_ui$Element$paddingXY, 8, 0)
+					]))
+		},
+		elementButton: _Utils_ap(
+			$Orasund$elm_ui_widgets$Internal$Material$Button$baseButton(palette).elementButton,
+			_List_fromArray(
+				[
+					$mdgriffith$elm_ui$Element$Border$width(1),
+					$mdgriffith$elm_ui$Element$Font$color(
+					$Orasund$elm_ui_widgets$Widget$Material$Color$fromColor(palette.primary)),
+					$mdgriffith$elm_ui$Element$Border$color(
+					$Orasund$elm_ui_widgets$Widget$Material$Color$fromColor(
+						A3(
+							$Orasund$elm_ui_widgets$Widget$Material$Color$withShade,
+							palette.primary,
+							$Orasund$elm_ui_widgets$Widget$Material$Color$buttonHoverOpacity,
+							A2($Orasund$elm_ui_widgets$Widget$Material$Color$scaleOpacity, 0.14, palette.on.surface)))),
+					$mdgriffith$elm_ui$Element$mouseDown(
+					_List_fromArray(
+						[
+							$mdgriffith$elm_ui$Element$Background$color(
+							$Orasund$elm_ui_widgets$Widget$Material$Color$fromColor(
+								A2($Orasund$elm_ui_widgets$Widget$Material$Color$scaleOpacity, $Orasund$elm_ui_widgets$Widget$Material$Color$buttonPressedOpacity, palette.primary)))
+						])),
+					$mdgriffith$elm_ui$Element$focused(
+					_List_fromArray(
+						[
+							$mdgriffith$elm_ui$Element$Background$color(
+							$Orasund$elm_ui_widgets$Widget$Material$Color$fromColor(
+								A2($Orasund$elm_ui_widgets$Widget$Material$Color$scaleOpacity, $Orasund$elm_ui_widgets$Widget$Material$Color$buttonFocusOpacity, palette.primary)))
+						])),
+					$mdgriffith$elm_ui$Element$mouseOver(
+					_List_fromArray(
+						[
+							$mdgriffith$elm_ui$Element$Background$color(
+							$Orasund$elm_ui_widgets$Widget$Material$Color$fromColor(
+								A2($Orasund$elm_ui_widgets$Widget$Material$Color$scaleOpacity, $Orasund$elm_ui_widgets$Widget$Material$Color$buttonHoverOpacity, palette.primary)))
+						]))
+				])),
+		ifActive: _List_fromArray(
+			[
+				$mdgriffith$elm_ui$Element$Background$color(
+				$Orasund$elm_ui_widgets$Widget$Material$Color$fromColor(
+					A2($Orasund$elm_ui_widgets$Widget$Material$Color$scaleOpacity, $Orasund$elm_ui_widgets$Widget$Material$Color$buttonHoverOpacity, palette.primary)))
+			]),
+		ifDisabled: _Utils_ap(
+			$Orasund$elm_ui_widgets$Internal$Material$Button$baseButton(palette).ifDisabled,
+			_List_fromArray(
+				[
+					$mdgriffith$elm_ui$Element$Font$color(
+					$Orasund$elm_ui_widgets$Widget$Material$Color$fromColor(
+						$Orasund$elm_ui_widgets$Internal$Material$Palette$gray(palette))),
+					$mdgriffith$elm_ui$Element$mouseDown(_List_Nil),
+					$mdgriffith$elm_ui$Element$mouseOver(_List_Nil),
+					$mdgriffith$elm_ui$Element$focused(_List_Nil)
+				])),
+		otherwise: _List_Nil
+	};
+};
+var $Orasund$elm_ui_widgets$Widget$Material$outlinedButton = $Orasund$elm_ui_widgets$Internal$Material$Button$outlinedButton;
+var $mdgriffith$elm_ui$Internal$Model$Paragraph = {$: 'Paragraph'};
+var $mdgriffith$elm_ui$Element$paragraph = F2(
+	function (attrs, children) {
+		return A4(
+			$mdgriffith$elm_ui$Internal$Model$element,
+			$mdgriffith$elm_ui$Internal$Model$asParagraph,
+			$mdgriffith$elm_ui$Internal$Model$div,
+			A2(
+				$elm$core$List$cons,
+				$mdgriffith$elm_ui$Internal$Model$Describe($mdgriffith$elm_ui$Internal$Model$Paragraph),
+				A2(
+					$elm$core$List$cons,
+					$mdgriffith$elm_ui$Element$width($mdgriffith$elm_ui$Element$fill),
+					A2(
+						$elm$core$List$cons,
+						$mdgriffith$elm_ui$Element$spacing(5),
+						attrs))),
+			$mdgriffith$elm_ui$Internal$Model$Unkeyed(children));
+	});
+var $author$project$Main$OnObjectClick = function (a) {
+	return {$: 'OnObjectClick', a: a};
+};
+var $mdgriffith$elm_ui$Element$map = $mdgriffith$elm_ui$Internal$Model$map;
+var $author$project$DocsDisplay$bfs = F2(
+	function (queue, acc) {
+		bfs:
+		while (true) {
+			if (!queue.b) {
+				return acc;
+			} else {
+				var head = queue.a;
+				var tail = queue.b;
+				switch (head.$) {
+					case 'DocsBool':
+						var $temp$queue = tail,
+							$temp$acc = acc;
+						queue = $temp$queue;
+						acc = $temp$acc;
+						continue bfs;
+					case 'DocsDict':
+						var d = head.a;
+						var $temp$queue = A2($elm$core$List$cons, d, tail),
+							$temp$acc = acc;
+						queue = $temp$queue;
+						acc = $temp$acc;
+						continue bfs;
+					case 'DocsFloat':
+						var $temp$queue = tail,
+							$temp$acc = acc;
+						queue = $temp$queue;
+						acc = $temp$acc;
+						continue bfs;
+					case 'DocsInt':
+						var $temp$queue = tail,
+							$temp$acc = acc;
+						queue = $temp$queue;
+						acc = $temp$acc;
+						continue bfs;
+					case 'DocsLazy':
+						var f = head.a;
+						var $temp$queue = A2(
+							$elm$core$List$cons,
+							f(_Utils_Tuple0),
+							tail),
+							$temp$acc = acc;
+						queue = $temp$queue;
+						acc = $temp$acc;
+						continue bfs;
+					case 'DocsList':
+						var d = head.a;
+						var $temp$queue = A2($elm$core$List$cons, d, tail),
+							$temp$acc = acc;
+						queue = $temp$queue;
+						acc = $temp$acc;
+						continue bfs;
+					case 'DocsMap':
+						var content = head.a.content;
+						var $temp$queue = A2($elm$core$List$cons, content, tail),
+							$temp$acc = acc;
+						queue = $temp$queue;
+						acc = $temp$acc;
+						continue bfs;
+					case 'DocsObject':
+						var dobject = head.a;
+						if (A2(
+							$elm$core$List$any,
+							function (item) {
+								return _Utils_eq(item.name, dobject.name);
+							},
+							acc)) {
+							var $temp$queue = tail,
+								$temp$acc = acc;
+							queue = $temp$queue;
+							acc = $temp$acc;
+							continue bfs;
+						} else {
+							var $temp$queue = A2(
+								$elm$core$List$append,
+								tail,
+								A2(
+									$elm$core$List$map,
+									function ($) {
+										return $.content;
+									},
+									dobject.keys)),
+								$temp$acc = A2(
+								$elm$core$List$append,
+								acc,
+								_List_fromArray(
+									[dobject]));
+							queue = $temp$queue;
+							acc = $temp$acc;
+							continue bfs;
+						}
+					case 'DocsOptional':
+						var d = head.a;
+						var $temp$queue = A2($elm$core$List$cons, d, tail),
+							$temp$acc = acc;
+						queue = $temp$queue;
+						acc = $temp$acc;
+						continue bfs;
+					case 'DocsRiskyMap':
+						var content = head.a.content;
+						var $temp$queue = A2($elm$core$List$cons, content, tail),
+							$temp$acc = acc;
+						queue = $temp$queue;
+						acc = $temp$acc;
+						continue bfs;
+					case 'DocsString':
+						var $temp$queue = tail,
+							$temp$acc = acc;
+						queue = $temp$queue;
+						acc = $temp$acc;
+						continue bfs;
+					default:
+						var $temp$queue = tail,
+							$temp$acc = acc;
+						queue = $temp$queue;
+						acc = $temp$acc;
+						continue bfs;
+				}
+			}
+		}
+	});
+var $author$project$DocsDisplay$findObjects = function (docs) {
+	return A2(
+		$author$project$DocsDisplay$bfs,
+		_List_fromArray(
+			[docs]),
+		_List_Nil);
+};
+var $author$project$DocsDisplay$getFunctionBFS = F2(
+	function (docs, acc) {
+		getFunctionBFS:
+		while (true) {
+			switch (docs.$) {
+				case 'DocsBool':
+					return acc;
+				case 'DocsDict':
+					var d = docs.a;
+					var $temp$docs = d,
+						$temp$acc = acc;
+					docs = $temp$docs;
+					acc = $temp$acc;
+					continue getFunctionBFS;
+				case 'DocsFloat':
+					return acc;
+				case 'DocsInt':
+					return acc;
+				case 'DocsLazy':
+					var f = docs.a;
+					var $temp$docs = f(_Utils_Tuple0),
+						$temp$acc = acc;
+					docs = $temp$docs;
+					acc = $temp$acc;
+					continue getFunctionBFS;
+				case 'DocsList':
+					var d = docs.a;
+					var $temp$docs = d,
+						$temp$acc = acc;
+					docs = $temp$docs;
+					acc = $temp$acc;
+					continue getFunctionBFS;
+				case 'DocsMap':
+					var name = docs.a.name;
+					var description = docs.a.description;
+					var content = docs.a.content;
+					var $temp$docs = content,
+						$temp$acc = A2(
+						$elm$core$List$append,
+						acc,
+						_List_fromArray(
+							[
+								{description: description, name: name}
+							]));
+					docs = $temp$docs;
+					acc = $temp$acc;
+					continue getFunctionBFS;
+				case 'DocsObject':
+					return acc;
+				case 'DocsOptional':
+					var d = docs.a;
+					var $temp$docs = d,
+						$temp$acc = acc;
+					docs = $temp$docs;
+					acc = $temp$acc;
+					continue getFunctionBFS;
+				case 'DocsRiskyMap':
+					var name = docs.a.name;
+					var description = docs.a.description;
+					var content = docs.a.content;
+					var $temp$docs = content,
+						$temp$acc = A2(
+						$elm$core$List$append,
+						acc,
+						_List_fromArray(
+							[
+								{description: description, name: name}
+							]));
+					docs = $temp$docs;
+					acc = $temp$acc;
+					continue getFunctionBFS;
+				case 'DocsString':
+					return acc;
+				default:
+					return acc;
+			}
+		}
+	});
+var $author$project$DocsDisplay$getFunctions = function (docs) {
+	return A2($author$project$DocsDisplay$getFunctionBFS, docs, _List_Nil);
+};
+var $Orasund$elm_ui_widgets$Widget$Material$Typography$h3 = _List_fromArray(
+	[
+		$mdgriffith$elm_ui$Element$Font$size(48)
+	]);
+var $mdgriffith$elm_ui$Internal$Model$Heading = function (a) {
+	return {$: 'Heading', a: a};
+};
+var $mdgriffith$elm_ui$Element$Region$heading = A2($elm$core$Basics$composeL, $mdgriffith$elm_ui$Internal$Model$Describe, $mdgriffith$elm_ui$Internal$Model$Heading);
+var $elm$html$Html$Attributes$id = $elm$html$Html$Attributes$stringProperty('id');
+var $mdgriffith$elm_ui$Element$Font$bold = A2($mdgriffith$elm_ui$Internal$Model$Class, $mdgriffith$elm_ui$Internal$Flag$fontWeight, $mdgriffith$elm_ui$Internal$Style$classes.bold);
+var $author$project$Colors$border = A2(
+	$elm$core$Basics$composeR,
+	$avh4$elm_color$Color$toRgba,
+	A2($elm$core$Basics$composeR, $mdgriffith$elm_ui$Element$fromRgb, $mdgriffith$elm_ui$Element$Border$color));
+var $elm$core$Basics$modBy = _Basics_modBy;
+var $elm$core$List$singleton = function (value) {
+	return _List_fromArray(
+		[value]);
+};
+var $author$project$Colors$BlueConeMonochromacy = {$: 'BlueConeMonochromacy'};
+var $author$project$Colors$Deuteranomaly = {$: 'Deuteranomaly'};
+var $author$project$Colors$Deuteranopia = {$: 'Deuteranopia'};
+var $author$project$Colors$Monochromacy = {$: 'Monochromacy'};
+var $author$project$Colors$Protanomaly = {$: 'Protanomaly'};
+var $author$project$Colors$Protanopia = {$: 'Protanopia'};
+var $author$project$Colors$Trichromatic = {$: 'Trichromatic'};
+var $author$project$Colors$Tritanomaly = {$: 'Tritanomaly'};
+var $author$project$Colors$Tritanopia = {$: 'Tritanopia'};
+var $author$project$Colors$allBlindnesses = function (builder) {
+	return {
+		blueConeMonochromacy: builder($author$project$Colors$BlueConeMonochromacy),
+		deuteranomaly: builder($author$project$Colors$Deuteranomaly),
+		deuteranopia: builder($author$project$Colors$Deuteranopia),
+		monochromacy: builder($author$project$Colors$Monochromacy),
+		protanomaly: builder($author$project$Colors$Protanomaly),
+		protanopia: builder($author$project$Colors$Protanopia),
+		trichromatic: builder($author$project$Colors$Trichromatic),
+		tritanomaly: builder($author$project$Colors$Tritanomaly),
+		tritanopia: builder($author$project$Colors$Tritanopia)
+	};
+};
+var $author$project$Colors$DarkMode = {$: 'DarkMode'};
+var $author$project$Colors$LightMode = {$: 'LightMode'};
+var $author$project$Colors$allModes = function (builder) {
+	return {
+		darkMode: builder($author$project$Colors$DarkMode),
+		lightMode: builder($author$project$Colors$LightMode)
+	};
+};
+var $author$project$Colors$Black = {$: 'Black'};
+var $author$project$Colors$Extra = {$: 'Extra'};
+var $author$project$Colors$Primary = {$: 'Primary'};
+var $author$project$Colors$Quaternary = {$: 'Quaternary'};
+var $author$project$Colors$Secondary = {$: 'Secondary'};
+var $author$project$Colors$Tertiary = {$: 'Tertiary'};
+var $author$project$Colors$White = {$: 'White'};
+var $author$project$Colors$allNames = function (builder) {
+	return {
+		black: builder($author$project$Colors$Black),
+		extra: builder($author$project$Colors$Extra),
+		primary: builder($author$project$Colors$Primary),
+		quaternary: builder($author$project$Colors$Quaternary),
+		secondary: builder($author$project$Colors$Secondary),
+		tertiary: builder($author$project$Colors$Tertiary),
+		white: builder($author$project$Colors$White)
+	};
+};
+var $author$project$Colors$Dark = {$: 'Dark'};
+var $author$project$Colors$Light = {$: 'Light'};
+var $author$project$Colors$Medium = {$: 'Medium'};
+var $author$project$Colors$allShades = function (builder) {
+	return {
+		dark: builder($author$project$Colors$Dark),
+		light: builder($author$project$Colors$Light),
+		medium: builder($author$project$Colors$Medium)
+	};
+};
+var $author$project$Colors$flipName = F2(
+	function (mode, name) {
+		if (mode.$ === 'LightMode') {
+			return name;
+		} else {
+			switch (name.$) {
+				case 'Black':
+					return $author$project$Colors$White;
+				case 'White':
+					return $author$project$Colors$Black;
+				default:
+					return name;
+			}
+		}
+	});
+var $author$project$Colors$flipShade = F2(
+	function (mode, shade) {
+		var _v0 = _Utils_Tuple2(mode, shade);
+		if (_v0.a.$ === 'LightMode') {
+			var _v1 = _v0.a;
+			return shade;
+		} else {
+			switch (_v0.b.$) {
+				case 'Dark':
+					var _v2 = _v0.a;
+					var _v3 = _v0.b;
+					return $author$project$Colors$Light;
+				case 'Medium':
+					var _v4 = _v0.a;
+					var _v5 = _v0.b;
+					return $author$project$Colors$Medium;
+				default:
+					var _v6 = _v0.a;
+					var _v7 = _v0.b;
+					return $author$project$Colors$Dark;
+			}
+		}
+	});
+var $author$project$Colors$fromShade = function (shade) {
+	switch (shade.$) {
+		case 'Light':
+			return function ($) {
+				return $.light;
+			};
+		case 'Medium':
+			return function ($) {
+				return $.medium;
+			};
+		default:
+			return function ($) {
+				return $.dark;
+			};
+	}
+};
+var $author$project$Colors$blueConeMonochromacy = {
+	black: {
+		dark: _Utils_Tuple3(0, 0, 0),
+		light: _Utils_Tuple3(46, 46, 56),
+		medium: _Utils_Tuple3(30, 30, 37)
+	},
+	blue: {
+		dark: _Utils_Tuple3(45, 76, 114),
+		light: _Utils_Tuple3(105, 131, 174),
+		medium: _Utils_Tuple3(102, 124, 165)
+	},
+	green: {
+		dark: _Utils_Tuple3(82, 99, 95),
+		light: _Utils_Tuple3(177, 213, 204),
+		medium: _Utils_Tuple3(124, 149, 143)
+	},
+	orange: {
+		dark: _Utils_Tuple3(141, 125, 116),
+		light: _Utils_Tuple3(222, 197, 183),
+		medium: _Utils_Tuple3(177, 157, 146)
+	},
+	red: {
+		dark: _Utils_Tuple3(78, 27, 27),
+		light: _Utils_Tuple3(122, 42, 42),
+		medium: _Utils_Tuple3(98, 34, 34)
+	},
+	white: {
+		dark: _Utils_Tuple3(240, 239, 237),
+		light: _Utils_Tuple3(255, 255, 255),
+		medium: _Utils_Tuple3(252, 251, 249)
+	},
+	yellow: {
+		dark: _Utils_Tuple3(164, 163, 111),
+		light: _Utils_Tuple3(235, 234, 159),
+		medium: _Utils_Tuple3(197, 196, 133)
+	}
+};
+var $author$project$Colors$deuteranomaly = {
+	black: {
+		dark: _Utils_Tuple3(0, 0, 0),
+		light: _Utils_Tuple3(38, 46, 72),
+		medium: _Utils_Tuple3(25, 30, 48)
+	},
+	blue: {
+		dark: _Utils_Tuple3(0, 89, 169),
+		light: _Utils_Tuple3(24, 138, 250),
+		medium: _Utils_Tuple3(24, 130, 236)
+	},
+	green: {
+		dark: _Utils_Tuple3(92, 101, 100),
+		light: _Utils_Tuple3(198, 217, 213),
+		medium: _Utils_Tuple3(139, 152, 149)
+	},
+	orange: {
+		dark: _Utils_Tuple3(157, 122, 93),
+		light: _Utils_Tuple3(245, 191, 146),
+		medium: _Utils_Tuple3(196, 153, 116)
+	},
+	red: {
+		dark: _Utils_Tuple3(108, 43, 0),
+		light: _Utils_Tuple3(169, 67, 0),
+		medium: _Utils_Tuple3(135, 54, 0)
+	},
+	white: {
+		dark: _Utils_Tuple3(250, 236, 236),
+		light: _Utils_Tuple3(255, 255, 255),
+		medium: _Utils_Tuple3(254, 250, 245)
+	},
+	yellow: {
+		dark: _Utils_Tuple3(198, 164, 35),
+		light: _Utils_Tuple3(254, 243, 156),
+		medium: _Utils_Tuple3(238, 197, 43)
+	}
+};
+var $author$project$Colors$deuteranopia = {
+	black: {
+		dark: _Utils_Tuple3(0, 0, 0),
+		light: _Utils_Tuple3(35, 47, 71),
+		medium: _Utils_Tuple3(22, 31, 48)
+	},
+	blue: {
+		dark: _Utils_Tuple3(0, 91, 157),
+		light: _Utils_Tuple3(0, 140, 248),
+		medium: _Utils_Tuple3(0, 132, 234)
+	},
+	green: {
+		dark: _Utils_Tuple3(109, 97, 101),
+		light: _Utils_Tuple3(235, 208, 215),
+		medium: _Utils_Tuple3(165, 146, 151)
+	},
+	orange: {
+		dark: _Utils_Tuple3(153, 123, 93),
+		light: _Utils_Tuple3(240, 194, 146),
+		medium: _Utils_Tuple3(191, 155, 116)
+	},
+	red: {
+		dark: _Utils_Tuple3(89, 67, 0),
+		light: _Utils_Tuple3(140, 105, 0),
+		medium: _Utils_Tuple3(112, 84, 0)
+	},
+	white: {
+		dark: _Utils_Tuple3(255, 234, 237),
+		light: _Utils_Tuple3(255, 255, 255),
+		medium: _Utils_Tuple3(255, 249, 250)
+	},
+	yellow: {
+		dark: _Utils_Tuple3(211, 159, 38),
+		light: _Utils_Tuple3(255, 239, 220),
+		medium: _Utils_Tuple3(254, 191, 46)
+	}
+};
+var $author$project$Colors$monochromacy = {
+	black: {
+		dark: _Utils_Tuple3(0, 0, 0),
+		light: _Utils_Tuple3(47, 47, 47),
+		medium: _Utils_Tuple3(31, 31, 31)
+	},
+	blue: {
+		dark: _Utils_Tuple3(71, 71, 71),
+		light: _Utils_Tuple3(128, 128, 128),
+		medium: _Utils_Tuple3(122, 122, 122)
+	},
+	green: {
+		dark: _Utils_Tuple3(94, 94, 94),
+		light: _Utils_Tuple3(201, 201, 201),
+		medium: _Utils_Tuple3(141, 141, 141)
+	},
+	orange: {
+		dark: _Utils_Tuple3(129, 129, 129),
+		light: _Utils_Tuple3(203, 203, 203),
+		medium: _Utils_Tuple3(162, 162, 162)
+	},
+	red: {
+		dark: _Utils_Tuple3(42, 42, 42),
+		light: _Utils_Tuple3(66, 66, 66),
+		medium: _Utils_Tuple3(53, 53, 53)
+	},
+	white: {
+		dark: _Utils_Tuple3(239, 239, 239),
+		light: _Utils_Tuple3(255, 255, 255),
+		medium: _Utils_Tuple3(251, 251, 251)
+	},
+	yellow: {
+		dark: _Utils_Tuple3(157, 157, 157),
+		light: _Utils_Tuple3(226, 226, 226),
+		medium: _Utils_Tuple3(189, 189, 189)
+	}
+};
+var $author$project$Colors$protanomaly = {
+	black: {
+		dark: _Utils_Tuple3(0, 0, 0),
+		light: _Utils_Tuple3(39, 45, 73),
+		medium: _Utils_Tuple3(26, 30, 49)
+	},
+	blue: {
+		dark: _Utils_Tuple3(0, 85, 185),
+		light: _Utils_Tuple3(73, 134, 254),
+		medium: _Utils_Tuple3(70, 126, 239)
+	},
+	green: {
+		dark: _Utils_Tuple3(88, 103, 95),
+		light: _Utils_Tuple3(190, 221, 202),
+		medium: _Utils_Tuple3(133, 155, 142)
+	},
+	orange: {
+		dark: _Utils_Tuple3(147, 125, 97),
+		light: _Utils_Tuple3(230, 196, 151),
+		medium: _Utils_Tuple3(184, 157, 120)
+	},
+	red: {
+		dark: _Utils_Tuple3(101, 45, 12),
+		light: _Utils_Tuple3(159, 71, 18),
+		medium: _Utils_Tuple3(127, 57, 15)
+	},
+	white: {
+		dark: _Utils_Tuple3(244, 238, 234),
+		light: _Utils_Tuple3(255, 255, 255),
+		medium: _Utils_Tuple3(255, 250, 246)
+	},
+	yellow: {
+		dark: _Utils_Tuple3(184, 170, 29),
+		light: _Utils_Tuple3(254, 244, 136),
+		medium: _Utils_Tuple3(221, 204, 35)
+	}
+};
+var $author$project$Colors$protanopia = {
+	black: {
+		dark: _Utils_Tuple3(0, 0, 0),
+		light: _Utils_Tuple3(36, 46, 74),
+		medium: _Utils_Tuple3(24, 30, 49)
+	},
+	blue: {
+		dark: _Utils_Tuple3(0, 86, 182),
+		light: _Utils_Tuple3(77, 134, 254),
+		medium: _Utils_Tuple3(72, 126, 239)
+	},
+	green: {
+		dark: _Utils_Tuple3(103, 100, 93),
+		light: _Utils_Tuple3(222, 214, 198),
+		medium: _Utils_Tuple3(156, 150, 139)
+	},
+	orange: {
+		dark: _Utils_Tuple3(138, 129, 98),
+		light: _Utils_Tuple3(216, 202, 154),
+		medium: _Utils_Tuple3(173, 161, 122)
+	},
+	red: {
+		dark: _Utils_Tuple3(79, 71, 18),
+		light: _Utils_Tuple3(125, 111, 28),
+		medium: _Utils_Tuple3(100, 89, 23)
+	},
+	white: {
+		dark: _Utils_Tuple3(245, 238, 234),
+		light: _Utils_Tuple3(255, 255, 255),
+		medium: _Utils_Tuple3(255, 250, 246)
+	},
+	yellow: {
+		dark: _Utils_Tuple3(189, 168, 29),
+		light: _Utils_Tuple3(255, 242, 190),
+		medium: _Utils_Tuple3(227, 202, 34)
+	}
+};
+var $author$project$Colors$trichromatic = {
+	black: {
+		dark: _Utils_Tuple3(0, 0, 0),
+		light: _Utils_Tuple3(44, 44, 72),
+		medium: _Utils_Tuple3(29, 29, 48)
+	},
+	blue: {
+		dark: _Utils_Tuple3(0, 84, 189),
+		light: _Utils_Tuple3(66, 135, 255),
+		medium: _Utils_Tuple3(66, 127, 240)
+	},
+	green: {
+		dark: _Utils_Tuple3(62, 109, 98),
+		light: _Utils_Tuple3(134, 234, 209),
+		medium: _Utils_Tuple3(94, 164, 147)
+	},
+	orange: {
+		dark: _Utils_Tuple3(163, 119, 94),
+		light: _Utils_Tuple3(255, 187, 147),
+		medium: _Utils_Tuple3(204, 149, 117)
+	},
+	red: {
+		dark: _Utils_Tuple3(140, 0, 0),
+		light: _Utils_Tuple3(220, 0, 0),
+		medium: _Utils_Tuple3(176, 0, 0)
+	},
+	white: {
+		dark: _Utils_Tuple3(242, 239, 234),
+		light: _Utils_Tuple3(255, 255, 255),
+		medium: _Utils_Tuple3(254, 250, 245)
+	},
+	yellow: {
+		dark: _Utils_Tuple3(175, 173, 30),
+		light: _Utils_Tuple3(252, 249, 43),
+		medium: _Utils_Tuple3(210, 208, 36)
+	}
+};
+var $author$project$Colors$tritanomaly = {
+	black: {
+		dark: _Utils_Tuple3(0, 0, 0),
+		light: _Utils_Tuple3(41, 47, 59),
+		medium: _Utils_Tuple3(27, 31, 39)
+	},
+	blue: {
+		dark: _Utils_Tuple3(0, 94, 136),
+		light: _Utils_Tuple3(24, 147, 197),
+		medium: _Utils_Tuple3(24, 138, 186)
+	},
+	green: {
+		dark: _Utils_Tuple3(65, 107, 109),
+		light: _Utils_Tuple3(140, 231, 233),
+		medium: _Utils_Tuple3(98, 162, 164)
+	},
+	orange: {
+		dark: _Utils_Tuple3(165, 116, 113),
+		light: _Utils_Tuple3(255, 184, 178),
+		medium: _Utils_Tuple3(206, 146, 141)
+	},
+	red: {
+		dark: _Utils_Tuple3(139, 8, 0),
+		light: _Utils_Tuple3(219, 13, 0),
+		medium: _Utils_Tuple3(175, 10, 0)
+	},
+	white: {
+		dark: _Utils_Tuple3(244, 237, 247),
+		light: _Utils_Tuple3(255, 255, 255),
+		medium: _Utils_Tuple3(253, 250, 251)
+	},
+	yellow: {
+		dark: _Utils_Tuple3(182, 165, 121),
+		light: _Utils_Tuple3(254, 241, 172),
+		medium: _Utils_Tuple3(218, 199, 146)
+	}
+};
+var $author$project$Colors$tritanopia = {
+	black: {
+		dark: _Utils_Tuple3(0, 0, 0),
+		light: _Utils_Tuple3(39, 48, 52),
+		medium: _Utils_Tuple3(26, 32, 34)
+	},
+	blue: {
+		dark: _Utils_Tuple3(0, 99, 105),
+		light: _Utils_Tuple3(0, 153, 164),
+		medium: _Utils_Tuple3(0, 144, 155)
+	},
+	green: {
+		dark: _Utils_Tuple3(67, 107, 115),
+		light: _Utils_Tuple3(144, 229, 247),
+		medium: _Utils_Tuple3(101, 160, 173)
+	},
+	orange: {
+		dark: _Utils_Tuple3(166, 115, 124),
+		light: _Utils_Tuple3(255, 183, 195),
+		medium: _Utils_Tuple3(207, 144, 155)
+	},
+	red: {
+		dark: _Utils_Tuple3(139, 13, 0),
+		light: _Utils_Tuple3(218, 20, 0),
+		medium: _Utils_Tuple3(175, 16, 0)
+	},
+	white: {
+		dark: _Utils_Tuple3(245, 236, 254),
+		light: _Utils_Tuple3(255, 255, 255),
+		medium: _Utils_Tuple3(252, 250, 255)
+	},
+	yellow: {
+		dark: _Utils_Tuple3(186, 161, 174),
+		light: _Utils_Tuple3(255, 237, 246),
+		medium: _Utils_Tuple3(223, 194, 209)
+	}
+};
+var $author$project$Colors$toBlindnessPalette = function (blindness) {
+	switch (blindness.$) {
+		case 'Trichromatic':
+			return $author$project$Colors$trichromatic;
+		case 'Protanomaly':
+			return $author$project$Colors$protanomaly;
+		case 'Deuteranomaly':
+			return $author$project$Colors$deuteranomaly;
+		case 'Tritanomaly':
+			return $author$project$Colors$tritanomaly;
+		case 'Protanopia':
+			return $author$project$Colors$protanopia;
+		case 'Deuteranopia':
+			return $author$project$Colors$deuteranopia;
+		case 'Tritanopia':
+			return $author$project$Colors$tritanopia;
+		case 'Monochromacy':
+			return $author$project$Colors$monochromacy;
+		default:
+			return $author$project$Colors$blueConeMonochromacy;
+	}
+};
+var $author$project$Colors$toColor = F2(
+	function (blindness, name) {
+		switch (name.$) {
+			case 'Primary':
+				return function ($) {
+					return $.blue;
+				};
+			case 'Secondary':
+				return function ($) {
+					return $.red;
+				};
+			case 'Tertiary':
+				if (blindness.$ === 'Tritanopia') {
+					return function ($) {
+						return $.orange;
+					};
+				} else {
+					return function ($) {
+						return $.yellow;
+					};
+				}
+			case 'Quaternary':
+				if (blindness.$ === 'Monochromacy') {
+					return function ($) {
+						return $.orange;
+					};
+				} else {
+					return function ($) {
+						return $.green;
+					};
+				}
+			case 'Extra':
+				switch (blindness.$) {
+					case 'Tritanopia':
+						return function ($) {
+							return $.yellow;
+						};
+					case 'Monochromacy':
+						return function ($) {
+							return $.green;
+						};
+					default:
+						return function ($) {
+							return $.orange;
+						};
+				}
+			case 'Black':
+				return function ($) {
+					return $.black;
+				};
+			default:
+				return function ($) {
+					return $.white;
+				};
+		}
+	});
+var $author$project$Colors$get = F4(
+	function (blindness, mode, shade, name) {
+		var trueShade = A2($author$project$Colors$flipShade, mode, shade);
+		var trueName = A2($author$project$Colors$flipName, mode, name);
+		return function (_v0) {
+			var r = _v0.a;
+			var g = _v0.b;
+			var b = _v0.c;
+			return A3($avh4$elm_color$Color$rgb255, r, g, b);
+		}(
+			A2(
+				$author$project$Colors$fromShade,
+				trueShade,
+				A3(
+					$author$project$Colors$toColor,
+					blindness,
+					trueName,
+					$author$project$Colors$toBlindnessPalette(blindness))));
+	});
+var $author$project$Colors$allColors = $author$project$Colors$allBlindnesses(
+	function (blindness) {
+		return $author$project$Colors$allModes(
+			function (mode) {
+				return $author$project$Colors$allShades(
+					function (shade) {
+						return $author$project$Colors$allNames(
+							function (name) {
+								return A4($author$project$Colors$get, blindness, mode, shade, name);
+							});
+					});
+			});
+	});
+var $author$project$Colors$stdPicker = $author$project$Colors$allColors.trichromatic.lightMode;
+var $author$project$DocsDisplay$showFunctions = function (functions) {
+	return A2(
+		$mdgriffith$elm_ui$Element$column,
+		_List_fromArray(
+			[
+				$mdgriffith$elm_ui$Element$padding(5),
+				$mdgriffith$elm_ui$Element$spacing(5),
+				$mdgriffith$elm_ui$Element$width($mdgriffith$elm_ui$Element$fill)
+			]),
+		A2(
+			$elm$core$List$indexedMap,
+			F2(
+				function (i, f) {
+					var name = function () {
+						var _v0 = A2($elm$core$Basics$modBy, 5, i);
+						switch (_v0) {
+							case 0:
+								return function ($) {
+									return $.primary;
+								};
+							case 1:
+								return function ($) {
+									return $.secondary;
+								};
+							case 2:
+								return function ($) {
+									return $.tertiary;
+								};
+							case 3:
+								return function ($) {
+									return $.quaternary;
+								};
+							default:
+								return function ($) {
+									return $.extra;
+								};
+						}
+					}();
+					return A2(
+						$mdgriffith$elm_ui$Element$column,
+						_List_fromArray(
+							[
+								$mdgriffith$elm_ui$Element$Border$rounded(15),
+								$author$project$Colors$background(
+								name($author$project$Colors$stdPicker.light)),
+								$author$project$Colors$border(
+								name($author$project$Colors$stdPicker.dark)),
+								$mdgriffith$elm_ui$Element$Border$width(2),
+								$mdgriffith$elm_ui$Element$padding(5)
+							]),
+						A2(
+							$elm$core$List$cons,
+							A2(
+								$mdgriffith$elm_ui$Element$el,
+								_List_fromArray(
+									[$mdgriffith$elm_ui$Element$Font$bold]),
+								$mdgriffith$elm_ui$Element$text('Function ' + f.name)),
+							A2(
+								$elm$core$List$map,
+								A2(
+									$elm$core$Basics$composeR,
+									$mdgriffith$elm_ui$Element$text,
+									A2(
+										$elm$core$Basics$composeR,
+										$elm$core$List$singleton,
+										$mdgriffith$elm_ui$Element$paragraph(_List_Nil))),
+								f.description)));
+				}),
+			functions));
+};
+var $mdgriffith$elm_ui$Element$Font$family = function (families) {
+	return A2(
+		$mdgriffith$elm_ui$Internal$Model$StyleClass,
+		$mdgriffith$elm_ui$Internal$Flag$fontFamily,
+		A2(
+			$mdgriffith$elm_ui$Internal$Model$FontFamily,
+			A3($elm$core$List$foldl, $mdgriffith$elm_ui$Internal$Model$renderFontClassName, 'ff-', families),
+			families));
+};
+var $mdgriffith$elm_ui$Internal$Model$Monospace = {$: 'Monospace'};
+var $mdgriffith$elm_ui$Element$Font$monospace = $mdgriffith$elm_ui$Internal$Model$Monospace;
+var $author$project$DocsDisplay$toString = function () {
+	var go = function (docs) {
+		go:
+		while (true) {
+			switch (docs.$) {
+				case 'DocsBool':
+					return _List_fromArray(
+						[
+							$mdgriffith$elm_ui$Element$text('bool')
+						]);
+				case 'DocsDict':
+					var d = docs.a;
+					return $elm$core$List$concat(
+						_List_fromArray(
+							[
+								_List_fromArray(
+								[
+									$mdgriffith$elm_ui$Element$text('{string:')
+								]),
+								go(d),
+								_List_fromArray(
+								[
+									$mdgriffith$elm_ui$Element$text('}')
+								])
+							]));
+				case 'DocsFloat':
+					return _List_fromArray(
+						[
+							$mdgriffith$elm_ui$Element$text('float')
+						]);
+				case 'DocsInt':
+					return _List_fromArray(
+						[
+							$mdgriffith$elm_ui$Element$text('int')
+						]);
+				case 'DocsLazy':
+					var f = docs.a;
+					var $temp$docs = f(_Utils_Tuple0);
+					docs = $temp$docs;
+					continue go;
+				case 'DocsList':
+					var d = docs.a;
+					return $elm$core$List$concat(
+						_List_fromArray(
+							[
+								_List_fromArray(
+								[
+									$mdgriffith$elm_ui$Element$text('[')
+								]),
+								go(d),
+								_List_fromArray(
+								[
+									$mdgriffith$elm_ui$Element$text(']')
+								])
+							]));
+				case 'DocsMap':
+					var name = docs.a.name;
+					var content = docs.a.content;
+					return $elm$core$List$concat(
+						_List_fromArray(
+							[
+								_List_fromArray(
+								[
+									$mdgriffith$elm_ui$Element$text(name),
+									$mdgriffith$elm_ui$Element$text('(')
+								]),
+								go(content),
+								_List_fromArray(
+								[
+									$mdgriffith$elm_ui$Element$text(')')
+								])
+							]));
+				case 'DocsObject':
+					var name = docs.a.name;
+					return $elm$core$List$singleton(
+						A2(
+							$mdgriffith$elm_ui$Element$el,
+							_List_fromArray(
+								[
+									$mdgriffith$elm_ui$Element$Events$onClick(name)
+								]),
+							$mdgriffith$elm_ui$Element$text(name)));
+				case 'DocsOptional':
+					var d = docs.a;
+					var $temp$docs = d;
+					docs = $temp$docs;
+					continue go;
+				case 'DocsRiskyMap':
+					var name = docs.a.name;
+					var content = docs.a.content;
+					return $elm$core$List$concat(
+						_List_fromArray(
+							[
+								_List_fromArray(
+								[
+									$mdgriffith$elm_ui$Element$text(name),
+									$mdgriffith$elm_ui$Element$text('(')
+								]),
+								go(content),
+								_List_fromArray(
+								[
+									$mdgriffith$elm_ui$Element$text(')')
+								])
+							]));
+				case 'DocsString':
+					return _List_fromArray(
+						[
+							$mdgriffith$elm_ui$Element$text('string')
+						]);
+				default:
+					return _List_fromArray(
+						[
+							$mdgriffith$elm_ui$Element$text('JSON')
+						]);
+			}
+		}
+	};
+	return A2(
+		$elm$core$Basics$composeR,
+		go,
+		$mdgriffith$elm_ui$Element$paragraph(
+			_List_fromArray(
+				[
+					$mdgriffith$elm_ui$Element$Font$family(
+					_List_fromArray(
+						[$mdgriffith$elm_ui$Element$Font$monospace])),
+					$author$project$Colors$background($author$project$Colors$stdPicker.dark.white)
+				])));
+}();
+var $mdgriffith$elm_ui$Element$fillPortion = $mdgriffith$elm_ui$Internal$Model$Fill;
+var $mdgriffith$elm_ui$Element$InternalIndexedColumn = function (a) {
+	return {$: 'InternalIndexedColumn', a: a};
+};
+var $mdgriffith$elm_ui$Internal$Model$GridPosition = function (a) {
+	return {$: 'GridPosition', a: a};
+};
+var $mdgriffith$elm_ui$Internal$Model$GridTemplateStyle = function (a) {
+	return {$: 'GridTemplateStyle', a: a};
+};
+var $elm$core$List$all = F2(
+	function (isOkay, list) {
+		return !A2(
+			$elm$core$List$any,
+			A2($elm$core$Basics$composeL, $elm$core$Basics$not, isOkay),
+			list);
+	});
+var $mdgriffith$elm_ui$Internal$Model$AsGrid = {$: 'AsGrid'};
+var $mdgriffith$elm_ui$Internal$Model$asGrid = $mdgriffith$elm_ui$Internal$Model$AsGrid;
+var $mdgriffith$elm_ui$Internal$Model$getSpacing = F2(
+	function (attrs, _default) {
+		return A2(
+			$elm$core$Maybe$withDefault,
+			_default,
+			A3(
+				$elm$core$List$foldr,
+				F2(
+					function (attr, acc) {
+						if (acc.$ === 'Just') {
+							var x = acc.a;
+							return $elm$core$Maybe$Just(x);
+						} else {
+							if ((attr.$ === 'StyleClass') && (attr.b.$ === 'SpacingStyle')) {
+								var _v2 = attr.b;
+								var x = _v2.b;
+								var y = _v2.c;
+								return $elm$core$Maybe$Just(
+									_Utils_Tuple2(x, y));
+							} else {
+								return $elm$core$Maybe$Nothing;
+							}
+						}
+					}),
+				$elm$core$Maybe$Nothing,
+				attrs));
+	});
+var $mdgriffith$elm_ui$Internal$Flag$gridPosition = $mdgriffith$elm_ui$Internal$Flag$flag(35);
+var $mdgriffith$elm_ui$Internal$Flag$gridTemplate = $mdgriffith$elm_ui$Internal$Flag$flag(34);
+var $elm$core$List$repeatHelp = F3(
+	function (result, n, value) {
+		repeatHelp:
+		while (true) {
+			if (n <= 0) {
+				return result;
+			} else {
+				var $temp$result = A2($elm$core$List$cons, value, result),
+					$temp$n = n - 1,
+					$temp$value = value;
+				result = $temp$result;
+				n = $temp$n;
+				value = $temp$value;
+				continue repeatHelp;
+			}
+		}
+	});
+var $elm$core$List$repeat = F2(
+	function (n, value) {
+		return A3($elm$core$List$repeatHelp, _List_Nil, n, value);
+	});
+var $mdgriffith$elm_ui$Element$tableHelper = F2(
+	function (attrs, config) {
+		var onGrid = F3(
+			function (rowLevel, columnLevel, elem) {
+				return A4(
+					$mdgriffith$elm_ui$Internal$Model$element,
+					$mdgriffith$elm_ui$Internal$Model$asEl,
+					$mdgriffith$elm_ui$Internal$Model$div,
+					_List_fromArray(
+						[
+							A2(
+							$mdgriffith$elm_ui$Internal$Model$StyleClass,
+							$mdgriffith$elm_ui$Internal$Flag$gridPosition,
+							$mdgriffith$elm_ui$Internal$Model$GridPosition(
+								{col: columnLevel, height: 1, row: rowLevel, width: 1}))
+						]),
+					$mdgriffith$elm_ui$Internal$Model$Unkeyed(
+						_List_fromArray(
+							[elem])));
+			});
+		var columnWidth = function (col) {
+			if (col.$ === 'InternalIndexedColumn') {
+				var colConfig = col.a;
+				return colConfig.width;
+			} else {
+				var colConfig = col.a;
+				return colConfig.width;
+			}
+		};
+		var columnHeader = function (col) {
+			if (col.$ === 'InternalIndexedColumn') {
+				var colConfig = col.a;
+				return colConfig.header;
+			} else {
+				var colConfig = col.a;
+				return colConfig.header;
+			}
+		};
+		var maybeHeaders = function (headers) {
+			return A2(
+				$elm$core$List$all,
+				$elm$core$Basics$eq($mdgriffith$elm_ui$Internal$Model$Empty),
+				headers) ? $elm$core$Maybe$Nothing : $elm$core$Maybe$Just(
+				A2(
+					$elm$core$List$indexedMap,
+					F2(
+						function (col, header) {
+							return A3(onGrid, 1, col + 1, header);
+						}),
+					headers));
+		}(
+			A2($elm$core$List$map, columnHeader, config.columns));
+		var add = F3(
+			function (cell, columnConfig, cursor) {
+				if (columnConfig.$ === 'InternalIndexedColumn') {
+					var col = columnConfig.a;
+					return _Utils_update(
+						cursor,
+						{
+							column: cursor.column + 1,
+							elements: A2(
+								$elm$core$List$cons,
+								A3(
+									onGrid,
+									cursor.row,
+									cursor.column,
+									A2(
+										col.view,
+										_Utils_eq(maybeHeaders, $elm$core$Maybe$Nothing) ? (cursor.row - 1) : (cursor.row - 2),
+										cell)),
+								cursor.elements)
+						});
+				} else {
+					var col = columnConfig.a;
+					return {
+						column: cursor.column + 1,
+						elements: A2(
+							$elm$core$List$cons,
+							A3(
+								onGrid,
+								cursor.row,
+								cursor.column,
+								col.view(cell)),
+							cursor.elements),
+						row: cursor.row
+					};
+				}
+			});
+		var build = F3(
+			function (columns, rowData, cursor) {
+				var newCursor = A3(
+					$elm$core$List$foldl,
+					add(rowData),
+					cursor,
+					columns);
+				return {column: 1, elements: newCursor.elements, row: cursor.row + 1};
+			});
+		var children = A3(
+			$elm$core$List$foldl,
+			build(config.columns),
+			{
+				column: 1,
+				elements: _List_Nil,
+				row: _Utils_eq(maybeHeaders, $elm$core$Maybe$Nothing) ? 1 : 2
+			},
+			config.data);
+		var _v0 = A2(
+			$mdgriffith$elm_ui$Internal$Model$getSpacing,
+			attrs,
+			_Utils_Tuple2(0, 0));
+		var sX = _v0.a;
+		var sY = _v0.b;
+		var template = A2(
+			$mdgriffith$elm_ui$Internal$Model$StyleClass,
+			$mdgriffith$elm_ui$Internal$Flag$gridTemplate,
+			$mdgriffith$elm_ui$Internal$Model$GridTemplateStyle(
+				{
+					columns: A2($elm$core$List$map, columnWidth, config.columns),
+					rows: A2(
+						$elm$core$List$repeat,
+						$elm$core$List$length(config.data),
+						$mdgriffith$elm_ui$Internal$Model$Content),
+					spacing: _Utils_Tuple2(
+						$mdgriffith$elm_ui$Element$px(sX),
+						$mdgriffith$elm_ui$Element$px(sY))
+				}));
+		return A4(
+			$mdgriffith$elm_ui$Internal$Model$element,
+			$mdgriffith$elm_ui$Internal$Model$asGrid,
+			$mdgriffith$elm_ui$Internal$Model$div,
+			A2(
+				$elm$core$List$cons,
+				$mdgriffith$elm_ui$Element$width($mdgriffith$elm_ui$Element$fill),
+				A2($elm$core$List$cons, template, attrs)),
+			$mdgriffith$elm_ui$Internal$Model$Unkeyed(
+				function () {
+					if (maybeHeaders.$ === 'Nothing') {
+						return children.elements;
+					} else {
+						var renderedHeaders = maybeHeaders.a;
+						return _Utils_ap(
+							renderedHeaders,
+							$elm$core$List$reverse(children.elements));
+					}
+				}()));
+	});
+var $mdgriffith$elm_ui$Element$indexedTable = F2(
+	function (attrs, config) {
+		return A2(
+			$mdgriffith$elm_ui$Element$tableHelper,
+			attrs,
+			{
+				columns: A2($elm$core$List$map, $mdgriffith$elm_ui$Element$InternalIndexedColumn, config.columns),
+				data: config.data
+			});
+	});
+var $author$project$DocsDisplay$showDescription = F2(
+	function (i, _v0) {
+		var content = _v0.content;
+		var description = _v0.description;
+		var required = _v0.required;
+		return A2(
+			$mdgriffith$elm_ui$Element$column,
+			_List_fromArray(
+				[
+					(!A2($elm$core$Basics$modBy, 2, i)) ? $author$project$Colors$background($author$project$Colors$stdPicker.light.white) : $author$project$Colors$background($author$project$Colors$stdPicker.medium.white),
+					$mdgriffith$elm_ui$Element$padding(3)
+				]),
+			_List_fromArray(
+				[
+					function () {
+					if (!description.b) {
+						return A2(
+							$mdgriffith$elm_ui$Element$paragraph,
+							_List_Nil,
+							_List_fromArray(
+								[
+									A2(
+									$mdgriffith$elm_ui$Element$el,
+									_List_fromArray(
+										[$mdgriffith$elm_ui$Element$Font$bold]),
+									$mdgriffith$elm_ui$Element$text('WARNING: ')),
+									$mdgriffith$elm_ui$Element$text('This field has no documentation yet!')
+								]));
+					} else {
+						var head = description.a;
+						var tail = description.b;
+						return A2(
+							$mdgriffith$elm_ui$Element$column,
+							_List_fromArray(
+								[
+									$mdgriffith$elm_ui$Element$width($mdgriffith$elm_ui$Element$fill)
+								]),
+							A2(
+								$elm$core$List$append,
+								_List_fromArray(
+									[
+										A2(
+										$mdgriffith$elm_ui$Element$paragraph,
+										_List_Nil,
+										_List_fromArray(
+											[
+												A2(
+												$mdgriffith$elm_ui$Element$el,
+												_List_fromArray(
+													[$mdgriffith$elm_ui$Element$Font$bold]),
+												$mdgriffith$elm_ui$Element$text(
+													function () {
+														if (required.$ === 'RequiredField') {
+															return 'Required: ';
+														} else {
+															return '';
+														}
+													}())),
+												$mdgriffith$elm_ui$Element$text(head)
+											]))
+									]),
+								A2(
+									$elm$core$List$map,
+									A2(
+										$elm$core$Basics$composeR,
+										$mdgriffith$elm_ui$Element$text,
+										A2(
+											$elm$core$Basics$composeR,
+											$elm$core$List$singleton,
+											$mdgriffith$elm_ui$Element$paragraph(_List_Nil))),
+									tail)));
+					}
+				}(),
+					$author$project$DocsDisplay$showFunctions(
+					$author$project$DocsDisplay$getFunctions(content))
+				]));
+	});
+var $author$project$DocsDisplay$toTable = function (dobject) {
+	var toCell = F2(
+		function (content, i) {
+			return A2(
+				$mdgriffith$elm_ui$Element$el,
+				_List_fromArray(
+					[
+						(!A2($elm$core$Basics$modBy, 2, i)) ? $author$project$Colors$background($author$project$Colors$stdPicker.light.white) : $author$project$Colors$background($author$project$Colors$stdPicker.medium.white),
+						$mdgriffith$elm_ui$Element$padding(3)
+					]),
+				content);
+		});
+	var header = function (t) {
+		return A2(
+			$mdgriffith$elm_ui$Element$el,
+			_List_fromArray(
+				[
+					$mdgriffith$elm_ui$Element$height($mdgriffith$elm_ui$Element$fill),
+					$mdgriffith$elm_ui$Element$width($mdgriffith$elm_ui$Element$fill),
+					$mdgriffith$elm_ui$Element$Font$bold
+				]),
+			$mdgriffith$elm_ui$Element$text(t));
+	};
+	return A2(
+		$mdgriffith$elm_ui$Element$indexedTable,
+		_List_fromArray(
+			[
+				$author$project$Colors$background($author$project$Colors$stdPicker.light.white)
+			]),
+		{
+			columns: _List_fromArray(
+				[
+					{
+					header: header('Field'),
+					view: F2(
+						function (i, item) {
+							return A2(
+								toCell,
+								$mdgriffith$elm_ui$Element$text(item.field),
+								i);
+						}),
+					width: $mdgriffith$elm_ui$Element$fillPortion(1)
+				},
+					{
+					header: header('Type'),
+					view: F2(
+						function (i, item) {
+							return A2(
+								toCell,
+								$author$project$DocsDisplay$toString(item.content),
+								i);
+						}),
+					width: $mdgriffith$elm_ui$Element$fillPortion(1)
+				},
+					{
+					header: header('Description'),
+					view: F2(
+						function (i, item) {
+							return A2($author$project$DocsDisplay$showDescription, i, item);
+						}),
+					width: $mdgriffith$elm_ui$Element$fillPortion(3)
+				}
+				]),
+			data: dobject.keys
+		});
+};
+var $author$project$DocsDisplay$render = function (docs) {
+	return A2(
+		$mdgriffith$elm_ui$Element$column,
+		_List_fromArray(
+			[
+				$mdgriffith$elm_ui$Element$spacing(20),
+				$mdgriffith$elm_ui$Element$width($mdgriffith$elm_ui$Element$fill)
+			]),
+		A2(
+			$elm$core$List$append,
+			_List_fromArray(
+				[
+					A2(
+					$mdgriffith$elm_ui$Element$paragraph,
+					_List_Nil,
+					_List_fromArray(
+						[
+							$mdgriffith$elm_ui$Element$text('This coder decodes to '),
+							$author$project$DocsDisplay$toString(docs)
+						])),
+					$author$project$DocsDisplay$showFunctions(
+					$author$project$DocsDisplay$getFunctions(docs))
+				]),
+			A2(
+				$elm$core$List$map,
+				function (dobject) {
+					return A2(
+						$mdgriffith$elm_ui$Element$column,
+						_List_fromArray(
+							[
+								$mdgriffith$elm_ui$Element$width($mdgriffith$elm_ui$Element$fill),
+								$mdgriffith$elm_ui$Element$spacing(12)
+							]),
+						_List_fromArray(
+							[
+								A2(
+								$mdgriffith$elm_ui$Element$el,
+								A2(
+									$elm$core$List$append,
+									_List_fromArray(
+										[
+											$mdgriffith$elm_ui$Element$Region$heading(3),
+											$mdgriffith$elm_ui$Element$htmlAttribute(
+											$elm$html$Html$Attributes$id(dobject.name))
+										]),
+									$Orasund$elm_ui_widgets$Widget$Material$Typography$h3),
+								$mdgriffith$elm_ui$Element$text(dobject.name)),
+								A2(
+								$mdgriffith$elm_ui$Element$column,
+								_List_Nil,
+								A2(
+									$elm$core$List$map,
+									A2(
+										$elm$core$Basics$composeR,
+										$mdgriffith$elm_ui$Element$text,
+										A2(
+											$elm$core$Basics$composeR,
+											$elm$core$List$singleton,
+											$mdgriffith$elm_ui$Element$paragraph(_List_Nil))),
+									dobject.description)),
+								$author$project$DocsDisplay$toTable(dobject)
+							]));
+				},
+				$author$project$DocsDisplay$findObjects(docs))));
+};
+var $author$project$Main$showDocs = A2(
+	$elm$core$Basics$composeR,
+	$author$project$DocsDisplay$render,
+	$mdgriffith$elm_ui$Element$map($author$project$Main$OnObjectClick));
+var $author$project$Route$toString = function (route) {
+	switch (route.$) {
+		case 'Home':
+			return 'Home';
+		case 'NotFound':
+			return '404';
+		default:
+			var o = route.a;
+			return o;
+	}
+};
+var $mdgriffith$elm_ui$Element$Font$underline = $mdgriffith$elm_ui$Internal$Model$htmlClass($mdgriffith$elm_ui$Internal$Style$classes.underline);
+var $author$project$Main$view = function (model) {
+	return {
+		body: $elm$core$List$singleton(
+			A2(
+				$mdgriffith$elm_ui$Element$layout,
+				_List_fromArray(
+					[
+						$author$project$Colors$background($author$project$Colors$stdPicker.dark.white),
+						$author$project$Colors$font($author$project$Colors$stdPicker.dark.black)
+					]),
+				A2(
+					$mdgriffith$elm_ui$Element$column,
+					_List_fromArray(
+						[
+							$mdgriffith$elm_ui$Element$width($mdgriffith$elm_ui$Element$fill),
+							$mdgriffith$elm_ui$Element$height($mdgriffith$elm_ui$Element$fill),
+							$mdgriffith$elm_ui$Element$alignTop
+						]),
+					_List_fromArray(
+						[
+							A2(
+							$Orasund$elm_ui_widgets$Widget$menuBar,
+							$Orasund$elm_ui_widgets$Widget$Material$menuBar(
+								$author$project$Colors$defaultPalette($author$project$Colors$stdPicker)),
+							{
+								deviceClass: $mdgriffith$elm_ui$Element$Phone,
+								openLeftSheet: $elm$core$Maybe$Nothing,
+								openRightSheet: $elm$core$Maybe$Nothing,
+								openTopSheet: $elm$core$Maybe$Nothing,
+								primaryActions: _List_Nil,
+								search: $elm$core$Maybe$Nothing,
+								title: A2(
+									$mdgriffith$elm_ui$Element$link,
+									_List_Nil,
+									{
+										label: A2(
+											$mdgriffith$elm_ui$Element$el,
+											_List_fromArray(
+												[
+													$author$project$Colors$font($author$project$Colors$stdPicker.light.white)
+												]),
+											$mdgriffith$elm_ui$Element$text('Elm Matrix SDK Docs')),
+										url: '/'
+									})
+							}),
+							A2(
+							$mdgriffith$elm_ui$Element$el,
+							_List_fromArray(
+								[
+									A2($mdgriffith$elm_ui$Element$paddingXY, 120, 120),
+									$mdgriffith$elm_ui$Element$height($mdgriffith$elm_ui$Element$fill)
+								]),
+							function () {
+								var _v0 = model.page;
+								switch (_v0.$) {
+									case 'ViewObject':
+										var o = _v0.a;
+										return A2(
+											$mdgriffith$elm_ui$Element$column,
+											_List_fromArray(
+												[
+													$mdgriffith$elm_ui$Element$spacing(10)
+												]),
+											_List_fromArray(
+												[
+													A2(
+													$elm$core$Maybe$withDefault,
+													$mdgriffith$elm_ui$Element$text('This object doesn\'t exist!'),
+													A2(
+														$elm$core$Maybe$map,
+														A2($elm$core$Basics$composeR, $elm$core$Tuple$first, $author$project$Main$showDocs),
+														A2($elm$core$Dict$get, o, $author$project$Main$coders))),
+													A2(
+													$mdgriffith$elm_ui$Element$column,
+													_List_fromArray(
+														[
+															$mdgriffith$elm_ui$Element$width($mdgriffith$elm_ui$Element$fill),
+															$mdgriffith$elm_ui$Element$height(
+															A2($mdgriffith$elm_ui$Element$minimum, 100, $mdgriffith$elm_ui$Element$fill))
+														]),
+													_List_fromArray(
+														[
+															A2(
+															$mdgriffith$elm_ui$Element$Input$multiline,
+															_List_fromArray(
+																[
+																	function () {
+																	var _v1 = model.valid;
+																	if (_v1.$ === 'Just') {
+																		if (_v1.a.$ === 'Err') {
+																			return $author$project$Colors$background($author$project$Colors$stdPicker.light.secondary);
+																		} else {
+																			return $author$project$Colors$background($author$project$Colors$stdPicker.light.quaternary);
+																		}
+																	} else {
+																		return $mdgriffith$elm_ui$Element$width($mdgriffith$elm_ui$Element$fill);
+																	}
+																}(),
+																	$mdgriffith$elm_ui$Element$width($mdgriffith$elm_ui$Element$fill)
+																]),
+															{
+																label: $mdgriffith$elm_ui$Element$Input$labelHidden('Test input JSON'),
+																onChange: $author$project$Main$OnWriteJSON,
+																placeholder: $elm$core$Maybe$Just(
+																	A2(
+																		$mdgriffith$elm_ui$Element$Input$placeholder,
+																		_List_Nil,
+																		$mdgriffith$elm_ui$Element$text('Insert a test JSON object...'))),
+																spellcheck: false,
+																text: model.input
+															}),
+															A2(
+															$Orasund$elm_ui_widgets$Widget$button,
+															$Orasund$elm_ui_widgets$Widget$Material$outlinedButton(
+																$author$project$Colors$defaultPalette($author$project$Colors$stdPicker)),
+															{
+																icon: $elm$core$Basics$always($mdgriffith$elm_ui$Element$none),
+																onPress: $elm$core$Maybe$Just($author$project$Main$OnDecodeString),
+																text: 'Check JSON'
+															}),
+															function () {
+															var _v2 = model.valid;
+															if (_v2.$ === 'Nothing') {
+																return $mdgriffith$elm_ui$Element$none;
+															} else {
+																if (_v2.a.$ === 'Ok') {
+																	var msg = _v2.a.a;
+																	return A2(
+																		$mdgriffith$elm_ui$Element$paragraph,
+																		_List_fromArray(
+																			[
+																				$author$project$Colors$font($author$project$Colors$stdPicker.dark.quaternary)
+																			]),
+																		$elm$core$List$singleton(
+																			$mdgriffith$elm_ui$Element$text(msg)));
+																} else {
+																	var msg = _v2.a.a;
+																	return A2(
+																		$mdgriffith$elm_ui$Element$paragraph,
+																		_List_fromArray(
+																			[
+																				$author$project$Colors$font($author$project$Colors$stdPicker.dark.secondary)
+																			]),
+																		$elm$core$List$singleton(
+																			$mdgriffith$elm_ui$Element$text(msg)));
+																}
+															}
+														}()
+														]))
+												]));
+									case 'Home':
+										return A2(
+											$mdgriffith$elm_ui$Element$column,
+											_List_fromArray(
+												[
+													$mdgriffith$elm_ui$Element$spacing(10)
+												]),
+											A2(
+												$elm$core$List$append,
+												_List_fromArray(
+													[
+														A2(
+														$mdgriffith$elm_ui$Element$paragraph,
+														_List_Nil,
+														_List_fromArray(
+															[
+																$mdgriffith$elm_ui$Element$text('This is the Home of the Elm Matrix SDK JSON documentation tool.')
+															])),
+														A2(
+														$mdgriffith$elm_ui$Element$paragraph,
+														_List_Nil,
+														_List_fromArray(
+															[
+																$mdgriffith$elm_ui$Element$text('This tool helps you debug and explore JSON data types that are used by the Elm Matrix SDK.')
+															]))
+													]),
+												A2(
+													$elm$core$List$map,
+													function (name) {
+														return A2(
+															$mdgriffith$elm_ui$Element$link,
+															_List_fromArray(
+																[
+																	$author$project$Colors$font($author$project$Colors$stdPicker.medium.primary),
+																	$mdgriffith$elm_ui$Element$Font$underline
+																]),
+															{
+																label: $mdgriffith$elm_ui$Element$text(name),
+																url: '/object/' + name
+															});
+													},
+													$elm$core$Dict$keys($author$project$Main$coders))));
+									default:
+										return $author$project$Main$showDocs(
+											$author$project$Internal$Tools$Json$toDocs($author$project$Internal$Values$StateManager$coder));
+								}
+							}())
+						])))),
+		title: $author$project$Route$toString(model.page) + ' | Elm Matrix SDK Docs'
+	};
+};
+var $author$project$Main$main = $elm$browser$Browser$application(
+	{init: $author$project$Main$init, onUrlChange: $author$project$Main$OnUrlChange, onUrlRequest: $author$project$Main$OnUrlRequest, subscriptions: $author$project$Main$subscriptions, update: $author$project$Main$update, view: $author$project$Main$view});
+_Platform_export({'Main':{'init':$author$project$Main$main(
+	$elm$json$Json$Decode$succeed(_Utils_Tuple0))(0)}});}(this));
+
+  var app = Elm.Main.init({ node: document.getElementById("elm") });
+}
+catch (e)
+{
+  // display initialization errors (e.g. bad flags, infinite recursion)
+  var header = document.createElement("h1");
+  header.style.fontFamily = "monospace";
+  header.innerText = "Initialization Error";
+  var pre = document.getElementById("elm");
+  document.body.insertBefore(header, pre);
+  pre.innerText = e;
+  throw e;
+}
+</script>
+
+</body>
+</html>
\ No newline at end of file
